commit 5ec4ad9d32cc05e40019334fef9545b814593e12
Author: admin <admin@www1334uf.sakura.ne.jp>
Date:   Mon Feb 22 17:53:59 2016 +0900

    2/17版のpictcodeを移植

diff --git a/app/Controller/AppController.php b/app/Controller/AppController.php
index 15b9d76..0f51375 100644
--- a/app/Controller/AppController.php
+++ b/app/Controller/AppController.php
@@ -41,8 +41,26 @@ class AppController extends Controller {
 	public $components = array(
 		'DebugKit.Toolbar',
 		'Session',
-		/*
+		'Flash',
 		'Auth' => array(
+            'loginRedirect' => array(
+                'controller' => 'users',
+                'action' => 'index'
+            ),
+            'logoutRedirect' => array(
+                'controller' => 'users',
+                'action' => 'login',
+                'home'
+            ),
+            'authenticate' => array(
+				'Form' => array(
+					'fields' => array(
+					    'username' => 'login_id', //Default is 'username' in the userModel
+						'password' => 'password'  //Default is 'password' in the userModel
+					),
+					'passwordHasher' => 'Blowfish'
+                )
+            ),
 			'flash' => array(
 				'element' => 'alert',
 				'key' => 'auth',
@@ -52,6 +70,5 @@ class AppController extends Controller {
 				)
 			)
 		)
-		 */
 	);
 }
diff --git a/app/Controller/PictcodeController.php b/app/Controller/PictcodeController.php
index 5fa03ea..338517e 100644
--- a/app/Controller/PictcodeController.php
+++ b/app/Controller/PictcodeController.php
@@ -39,6 +39,10 @@ class PictcodeController extends AppController {
 	public $uses = array('');
 	public $layout = 'top';
 
+	function beforeFilter(){
+		$this->Auth->allow();
+	}
+
 /**
  * index
  */
diff --git a/app/Controller/TopController.php b/app/Controller/TopController.php
index 98db7e1..8583dca 100644
--- a/app/Controller/TopController.php
+++ b/app/Controller/TopController.php
@@ -40,6 +40,9 @@ class TopController extends AppController {
 	public $uses = array('ContactValidate');
 	public $layout = 'top';
 
+	function beforeFilter(){
+		$this->Auth->allow();
+	}
 /**
  * index
  */
diff --git a/app/Controller/UsersController.php b/app/Controller/UsersController.php
new file mode 100644
index 0000000..d41f772
--- /dev/null
+++ b/app/Controller/UsersController.php
@@ -0,0 +1,142 @@
+<?php
+App::uses('AppController', 'Controller');
+/**
+ * Users Controller
+ *
+ * @property User $User
+ * @property PaginatorComponent $Paginator
+ */
+class UsersController extends AppController {
+
+	public $layout = 'top';
+	var $name = 'users';
+
+    public function beforeFilter() {
+        parent::beforeFilter();
+    }
+
+/**
+ * Components
+ *
+ * @var array
+ */
+	public $components = array('Paginator');
+
+/**
+ * index method
+ *
+ * @return void
+ */
+	public function index() {
+		$this->User->recursive = 0;
+		$this->set('users', $this->Paginator->paginate());
+	}
+
+/**
+ * view method
+ *
+ * @throws NotFoundException
+ * @param string $id
+ * @return void
+ */
+	public function view($id = null) {
+		if (!$this->User->exists($id)) {
+			throw new NotFoundException(__('Invalid user'));
+		}
+		$options = array('conditions' => array('User.' . $this->User->primaryKey => $id));
+		$this->set('user', $this->User->find('first', $options));
+	}
+
+/**
+ * add method
+ *
+ * @return void
+ */
+	public function add() {
+		if ($this->request->is('post')) {
+			$this->User->create();
+			if ($this->User->save($this->request->data)) {
+				$this->Flash->success(__('The user has been saved.'));
+				return $this->redirect(array('action' => 'index'));
+			} else {
+				$this->Flash->error(__('The user could not be saved. Please, try again.'));
+			}
+		}
+	}
+
+/**
+ * edit method
+ *
+ * @throws NotFoundException
+ * @param string $id
+ * @return void
+ */
+	public function edit($id = null) {
+		if (!$this->User->exists($id)) {
+			throw new NotFoundException(__('Invalid user'));
+		}
+		if ($this->request->is(array('post', 'put'))) {
+			if ($this->User->save($this->request->data)) {
+				$this->Flash->success(__('The user has been saved.'));
+				return $this->redirect(array('action' => 'index'));
+			} else {
+				$this->Flash->error(__('The user could not be saved. Please, try again.'));
+			}
+		} else {
+			$options = array('conditions' => array('User.' . $this->User->primaryKey => $id));
+			$this->request->data = $this->User->find('first', $options);
+		}
+	}
+
+/**
+ * delete method
+ *
+ * @throws NotFoundException
+ * @param string $id
+ * @return void
+ */
+	public function delete($id = null) {
+		$this->User->id = $id;
+		if (!$this->User->exists()) {
+			throw new NotFoundException(__('Invalid user'));
+		}
+		$this->request->allowMethod('post', 'delete');
+		if ($this->User->delete()) {
+			$this->Flash->success(__('The user has been deleted.'));
+		} else {
+			$this->Flash->error(__('The user could not be deleted. Please, try again.'));
+		}
+		return $this->redirect(array('action' => 'index'));
+	}
+
+/**
+ * login method
+ *
+ * @throws NotFoundException
+ * @param string $id
+ * @return void
+ */
+	public function login() {
+		//var_dump(Security::hash( "123", 'blowfish'));
+		if($this->Auth->user()){
+			$this->redirect($this->Auth->redirectUrl());                          
+		}
+		if ($this->request->is('post')) {
+			if ($this->Auth->login()) {
+				$this->redirect($this->Auth->redirectUrl());                          
+			} else {
+				$this->Flash->error(__('login error'));
+			}
+		}
+	}	
+/**
+ * logout method
+ *
+ * @throws NotFoundException
+ * @param string $id
+ * @return void
+ */
+	public function logout() {
+	    $this->redirect($this->Auth->logout());
+	}
+}
diff --git a/app/View/pictcode/index.ctp b/app/View/pictcode/index.ctp
index 57b5d78..5f76549 100644
--- a/app/View/pictcode/index.ctp
+++ b/app/View/pictcode/index.ctp
@@ -3,7 +3,8 @@
 <html>
 <head>
 	<title>-PictCode-</title>
-	<meta name="apple-mobile-web-app-capable" content="yes">
+	<!-- <meta name="apple-mobile-web-app-capable" content="yes"> -->
+	<meta name="apple-mobile-web-app-status-bar-style" content="black-translucent">
 	<meta name="viewport" content="width=device-width, initial-scale=1.0,  maximum-scale=1.0, minimum-scale=1.0">
 	<meta charset = "UTF-8">
 	<meta http-equiv="pragma" content="public">
@@ -17,7 +18,7 @@
 	<link href = "/css/pictcode/main.css" rel="stylesheet" type="text/css">
 </head>
 
-<body>
+<body oncontextmenu='return false' ontouchmove="event.preventDefault()">
 
 	<!-- プリロード -->
 	<div id="preload">
@@ -81,8 +82,14 @@
 		<div id="modal_coding_function">
 			<div id="modal_coding_function_container"></div>
 		</div>
-		<div id="modal_coding_sound" style="text-align: center;">
-			<div id="modal_coding_sound_container" style="text-align: left;"></div>
+		<div id="modal_coding_sound">
+			<div id="modal_coding_sound_container">
+				<div id="modal_coding_sound_container_scroll">
+				</div>
+			</div>
+		</div>
+		<div id="modal_coding_tag">
+			<div id="modal_coding_tag_container"></div>
 		</div>
 	</div>
 
@@ -147,3 +154,4 @@
 	<script data-main="/js/pictcode/app.js" src="/js/pictcode/require.js"></script>
 </body>
 </html>
+
diff --git a/app/View/users/login.ctp b/app/View/users/login.ctp
new file mode 100644
index 0000000..c0d6b9f
--- /dev/null
+++ b/app/View/users/login.ctp
@@ -0,0 +1,33 @@
+<header>
+<div class="container">
+<div class="row">
+<div class="col-lg-12">
+<div class="intro-text">
+<span class="name">ログイン</span>
+</div>
+</div>
+</div>
+</div>
+</header>
+<div class="users form">
+<?php echo $this->Flash->render('auth'); ?>
+<?php echo $this->Form->create('User',array(
+										'inputDefaults' => array(
+											'div' => 'form-group',
+											'wrapInput' => false,
+											'class' => 'form-control'
+										),
+											'class' => 'well')); ?>
+    <fieldset>
+        <legend>
+            <?php echo __('ユーザーネームとパスワードを入力してください'); ?>
+        </legend>
+        <?php echo $this->Form->input('login_id',array( 'type' => 'text'));
+        echo $this->Form->input('password');
+    ?>
+    </fieldset>
+<?php echo $this->Session->Flash(); ?>
+<?php echo $this->Form->submit('ログイン',array('class'=>'btn btn-info')); ?>
+<?php echo $this->Form->end(); ?>
+</div>
+<?php echo $this->element('footer');?>
diff --git a/app/webroot/fonts/glyphicons-halflings-regular.eot b/app/webroot/fonts/glyphicons-halflings-regular.eot
new file mode 100644
index 0000000..b93a495
Binary files /dev/null and b/app/webroot/fonts/glyphicons-halflings-regular.eot differ
diff --git a/app/webroot/fonts/glyphicons-halflings-regular.svg b/app/webroot/fonts/glyphicons-halflings-regular.svg
new file mode 100644
index 0000000..94fb549
--- /dev/null
+++ b/app/webroot/fonts/glyphicons-halflings-regular.svg
@@ -0,0 +1,288 @@
+<?xml version="1.0" standalone="no"?>
+<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd" >
+<svg xmlns="http://www.w3.org/2000/svg">
+<metadata></metadata>
+<defs>
+<font id="glyphicons_halflingsregular" horiz-adv-x="1200" >
+<font-face units-per-em="1200" ascent="960" descent="-240" />
+<missing-glyph horiz-adv-x="500" />
+<glyph horiz-adv-x="0" />
+<glyph horiz-adv-x="400" />
+<glyph unicode=" " />
+<glyph unicode="*" d="M600 1100q15 0 34 -1.5t30 -3.5l11 -1q10 -2 17.5 -10.5t7.5 -18.5v-224l158 158q7 7 18 8t19 -6l106 -106q7 -8 6 -19t-8 -18l-158 -158h224q10 0 18.5 -7.5t10.5 -17.5q6 -41 6 -75q0 -15 -1.5 -34t-3.5 -30l-1 -11q-2 -10 -10.5 -17.5t-18.5 -7.5h-224l158 -158 q7 -7 8 -18t-6 -19l-106 -106q-8 -7 -19 -6t-18 8l-158 158v-224q0 -10 -7.5 -18.5t-17.5 -10.5q-41 -6 -75 -6q-15 0 -34 1.5t-30 3.5l-11 1q-10 2 -17.5 10.5t-7.5 18.5v224l-158 -158q-7 -7 -18 -8t-19 6l-106 106q-7 8 -6 19t8 18l158 158h-224q-10 0 -18.5 7.5 t-10.5 17.5q-6 41 -6 75q0 15 1.5 34t3.5 30l1 11q2 10 10.5 17.5t18.5 7.5h224l-158 158q-7 7 -8 18t6 19l106 106q8 7 19 6t18 -8l158 -158v224q0 10 7.5 18.5t17.5 10.5q41 6 75 6z" />
+<glyph unicode="+" d="M450 1100h200q21 0 35.5 -14.5t14.5 -35.5v-350h350q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-350v-350q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v350h-350q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5 h350v350q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xa0;" />
+<glyph unicode="&#xa5;" d="M825 1100h250q10 0 12.5 -5t-5.5 -13l-364 -364q-6 -6 -11 -18h268q10 0 13 -6t-3 -14l-120 -160q-6 -8 -18 -14t-22 -6h-125v-100h275q10 0 13 -6t-3 -14l-120 -160q-6 -8 -18 -14t-22 -6h-125v-174q0 -11 -7.5 -18.5t-18.5 -7.5h-148q-11 0 -18.5 7.5t-7.5 18.5v174 h-275q-10 0 -13 6t3 14l120 160q6 8 18 14t22 6h125v100h-275q-10 0 -13 6t3 14l120 160q6 8 18 14t22 6h118q-5 12 -11 18l-364 364q-8 8 -5.5 13t12.5 5h250q25 0 43 -18l164 -164q8 -8 18 -8t18 8l164 164q18 18 43 18z" />
+<glyph unicode="&#x2000;" horiz-adv-x="650" />
+<glyph unicode="&#x2001;" horiz-adv-x="1300" />
+<glyph unicode="&#x2002;" horiz-adv-x="650" />
+<glyph unicode="&#x2003;" horiz-adv-x="1300" />
+<glyph unicode="&#x2004;" horiz-adv-x="433" />
+<glyph unicode="&#x2005;" horiz-adv-x="325" />
+<glyph unicode="&#x2006;" horiz-adv-x="216" />
+<glyph unicode="&#x2007;" horiz-adv-x="216" />
+<glyph unicode="&#x2008;" horiz-adv-x="162" />
+<glyph unicode="&#x2009;" horiz-adv-x="260" />
+<glyph unicode="&#x200a;" horiz-adv-x="72" />
+<glyph unicode="&#x202f;" horiz-adv-x="260" />
+<glyph unicode="&#x205f;" horiz-adv-x="325" />
+<glyph unicode="&#x20ac;" d="M744 1198q242 0 354 -189q60 -104 66 -209h-181q0 45 -17.5 82.5t-43.5 61.5t-58 40.5t-60.5 24t-51.5 7.5q-19 0 -40.5 -5.5t-49.5 -20.5t-53 -38t-49 -62.5t-39 -89.5h379l-100 -100h-300q-6 -50 -6 -100h406l-100 -100h-300q9 -74 33 -132t52.5 -91t61.5 -54.5t59 -29 t47 -7.5q22 0 50.5 7.5t60.5 24.5t58 41t43.5 61t17.5 80h174q-30 -171 -128 -278q-107 -117 -274 -117q-206 0 -324 158q-36 48 -69 133t-45 204h-217l100 100h112q1 47 6 100h-218l100 100h134q20 87 51 153.5t62 103.5q117 141 297 141z" />
+<glyph unicode="&#x20bd;" d="M428 1200h350q67 0 120 -13t86 -31t57 -49.5t35 -56.5t17 -64.5t6.5 -60.5t0.5 -57v-16.5v-16.5q0 -36 -0.5 -57t-6.5 -61t-17 -65t-35 -57t-57 -50.5t-86 -31.5t-120 -13h-178l-2 -100h288q10 0 13 -6t-3 -14l-120 -160q-6 -8 -18 -14t-22 -6h-138v-175q0 -11 -5.5 -18 t-15.5 -7h-149q-10 0 -17.5 7.5t-7.5 17.5v175h-267q-10 0 -13 6t3 14l120 160q6 8 18 14t22 6h117v100h-267q-10 0 -13 6t3 14l120 160q6 8 18 14t22 6h117v475q0 10 7.5 17.5t17.5 7.5zM600 1000v-300h203q64 0 86.5 33t22.5 119q0 84 -22.5 116t-86.5 32h-203z" />
+<glyph unicode="&#x2212;" d="M250 700h800q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-800q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#x231b;" d="M1000 1200v-150q0 -21 -14.5 -35.5t-35.5 -14.5h-50v-100q0 -91 -49.5 -165.5t-130.5 -109.5q81 -35 130.5 -109.5t49.5 -165.5v-150h50q21 0 35.5 -14.5t14.5 -35.5v-150h-800v150q0 21 14.5 35.5t35.5 14.5h50v150q0 91 49.5 165.5t130.5 109.5q-81 35 -130.5 109.5 t-49.5 165.5v100h-50q-21 0 -35.5 14.5t-14.5 35.5v150h800zM400 1000v-100q0 -60 32.5 -109.5t87.5 -73.5q28 -12 44 -37t16 -55t-16 -55t-44 -37q-55 -24 -87.5 -73.5t-32.5 -109.5v-150h400v150q0 60 -32.5 109.5t-87.5 73.5q-28 12 -44 37t-16 55t16 55t44 37 q55 24 87.5 73.5t32.5 109.5v100h-400z" />
+<glyph unicode="&#x25fc;" horiz-adv-x="500" d="M0 0z" />
+<glyph unicode="&#x2601;" d="M503 1089q110 0 200.5 -59.5t134.5 -156.5q44 14 90 14q120 0 205 -86.5t85 -206.5q0 -121 -85 -207.5t-205 -86.5h-750q-79 0 -135.5 57t-56.5 137q0 69 42.5 122.5t108.5 67.5q-2 12 -2 37q0 153 108 260.5t260 107.5z" />
+<glyph unicode="&#x26fa;" d="M774 1193.5q16 -9.5 20.5 -27t-5.5 -33.5l-136 -187l467 -746h30q20 0 35 -18.5t15 -39.5v-42h-1200v42q0 21 15 39.5t35 18.5h30l468 746l-135 183q-10 16 -5.5 34t20.5 28t34 5.5t28 -20.5l111 -148l112 150q9 16 27 20.5t34 -5zM600 200h377l-182 112l-195 534v-646z " />
+<glyph unicode="&#x2709;" d="M25 1100h1150q10 0 12.5 -5t-5.5 -13l-564 -567q-8 -8 -18 -8t-18 8l-564 567q-8 8 -5.5 13t12.5 5zM18 882l264 -264q8 -8 8 -18t-8 -18l-264 -264q-8 -8 -13 -5.5t-5 12.5v550q0 10 5 12.5t13 -5.5zM918 618l264 264q8 8 13 5.5t5 -12.5v-550q0 -10 -5 -12.5t-13 5.5 l-264 264q-8 8 -8 18t8 18zM818 482l364 -364q8 -8 5.5 -13t-12.5 -5h-1150q-10 0 -12.5 5t5.5 13l364 364q8 8 18 8t18 -8l164 -164q8 -8 18 -8t18 8l164 164q8 8 18 8t18 -8z" />
+<glyph unicode="&#x270f;" d="M1011 1210q19 0 33 -13l153 -153q13 -14 13 -33t-13 -33l-99 -92l-214 214l95 96q13 14 32 14zM1013 800l-615 -614l-214 214l614 614zM317 96l-333 -112l110 335z" />
+<glyph unicode="&#xe001;" d="M700 650v-550h250q21 0 35.5 -14.5t14.5 -35.5v-50h-800v50q0 21 14.5 35.5t35.5 14.5h250v550l-500 550h1200z" />
+<glyph unicode="&#xe002;" d="M368 1017l645 163q39 15 63 0t24 -49v-831q0 -55 -41.5 -95.5t-111.5 -63.5q-79 -25 -147 -4.5t-86 75t25.5 111.5t122.5 82q72 24 138 8v521l-600 -155v-606q0 -42 -44 -90t-109 -69q-79 -26 -147 -5.5t-86 75.5t25.5 111.5t122.5 82.5q72 24 138 7v639q0 38 14.5 59 t53.5 34z" />
+<glyph unicode="&#xe003;" d="M500 1191q100 0 191 -39t156.5 -104.5t104.5 -156.5t39 -191l-1 -2l1 -5q0 -141 -78 -262l275 -274q23 -26 22.5 -44.5t-22.5 -42.5l-59 -58q-26 -20 -46.5 -20t-39.5 20l-275 274q-119 -77 -261 -77l-5 1l-2 -1q-100 0 -191 39t-156.5 104.5t-104.5 156.5t-39 191 t39 191t104.5 156.5t156.5 104.5t191 39zM500 1022q-88 0 -162 -43t-117 -117t-43 -162t43 -162t117 -117t162 -43t162 43t117 117t43 162t-43 162t-117 117t-162 43z" />
+<glyph unicode="&#xe005;" d="M649 949q48 68 109.5 104t121.5 38.5t118.5 -20t102.5 -64t71 -100.5t27 -123q0 -57 -33.5 -117.5t-94 -124.5t-126.5 -127.5t-150 -152.5t-146 -174q-62 85 -145.5 174t-150 152.5t-126.5 127.5t-93.5 124.5t-33.5 117.5q0 64 28 123t73 100.5t104 64t119 20 t120.5 -38.5t104.5 -104z" />
+<glyph unicode="&#xe006;" d="M407 800l131 353q7 19 17.5 19t17.5 -19l129 -353h421q21 0 24 -8.5t-14 -20.5l-342 -249l130 -401q7 -20 -0.5 -25.5t-24.5 6.5l-343 246l-342 -247q-17 -12 -24.5 -6.5t-0.5 25.5l130 400l-347 251q-17 12 -14 20.5t23 8.5h429z" />
+<glyph unicode="&#xe007;" d="M407 800l131 353q7 19 17.5 19t17.5 -19l129 -353h421q21 0 24 -8.5t-14 -20.5l-342 -249l130 -401q7 -20 -0.5 -25.5t-24.5 6.5l-343 246l-342 -247q-17 -12 -24.5 -6.5t-0.5 25.5l130 400l-347 251q-17 12 -14 20.5t23 8.5h429zM477 700h-240l197 -142l-74 -226 l193 139l195 -140l-74 229l192 140h-234l-78 211z" />
+<glyph unicode="&#xe008;" d="M600 1200q124 0 212 -88t88 -212v-250q0 -46 -31 -98t-69 -52v-75q0 -10 6 -21.5t15 -17.5l358 -230q9 -5 15 -16.5t6 -21.5v-93q0 -10 -7.5 -17.5t-17.5 -7.5h-1150q-10 0 -17.5 7.5t-7.5 17.5v93q0 10 6 21.5t15 16.5l358 230q9 6 15 17.5t6 21.5v75q-38 0 -69 52 t-31 98v250q0 124 88 212t212 88z" />
+<glyph unicode="&#xe009;" d="M25 1100h1150q10 0 17.5 -7.5t7.5 -17.5v-1050q0 -10 -7.5 -17.5t-17.5 -7.5h-1150q-10 0 -17.5 7.5t-7.5 17.5v1050q0 10 7.5 17.5t17.5 7.5zM100 1000v-100h100v100h-100zM875 1000h-550q-10 0 -17.5 -7.5t-7.5 -17.5v-350q0 -10 7.5 -17.5t17.5 -7.5h550 q10 0 17.5 7.5t7.5 17.5v350q0 10 -7.5 17.5t-17.5 7.5zM1000 1000v-100h100v100h-100zM100 800v-100h100v100h-100zM1000 800v-100h100v100h-100zM100 600v-100h100v100h-100zM1000 600v-100h100v100h-100zM875 500h-550q-10 0 -17.5 -7.5t-7.5 -17.5v-350q0 -10 7.5 -17.5 t17.5 -7.5h550q10 0 17.5 7.5t7.5 17.5v350q0 10 -7.5 17.5t-17.5 7.5zM100 400v-100h100v100h-100zM1000 400v-100h100v100h-100zM100 200v-100h100v100h-100zM1000 200v-100h100v100h-100z" />
+<glyph unicode="&#xe010;" d="M50 1100h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5zM650 1100h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5v400 q0 21 14.5 35.5t35.5 14.5zM50 500h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5zM650 500h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400 q-21 0 -35.5 14.5t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe011;" d="M50 1100h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5zM450 1100h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v200 q0 21 14.5 35.5t35.5 14.5zM850 1100h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5zM50 700h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200 q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5zM450 700h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5zM850 700h200q21 0 35.5 -14.5t14.5 -35.5v-200 q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5zM50 300h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5zM450 300h200 q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5zM850 300h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5 t35.5 14.5z" />
+<glyph unicode="&#xe012;" d="M50 1100h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5zM450 1100h700q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-700q-21 0 -35.5 14.5t-14.5 35.5v200 q0 21 14.5 35.5t35.5 14.5zM50 700h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5zM450 700h700q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-700 q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5zM50 300h200q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5zM450 300h700q21 0 35.5 -14.5t14.5 -35.5v-200 q0 -21 -14.5 -35.5t-35.5 -14.5h-700q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe013;" d="M465 477l571 571q8 8 18 8t17 -8l177 -177q8 -7 8 -17t-8 -18l-783 -784q-7 -8 -17.5 -8t-17.5 8l-384 384q-8 8 -8 18t8 17l177 177q7 8 17 8t18 -8l171 -171q7 -7 18 -7t18 7z" />
+<glyph unicode="&#xe014;" d="M904 1083l178 -179q8 -8 8 -18.5t-8 -17.5l-267 -268l267 -268q8 -7 8 -17.5t-8 -18.5l-178 -178q-8 -8 -18.5 -8t-17.5 8l-268 267l-268 -267q-7 -8 -17.5 -8t-18.5 8l-178 178q-8 8 -8 18.5t8 17.5l267 268l-267 268q-8 7 -8 17.5t8 18.5l178 178q8 8 18.5 8t17.5 -8 l268 -267l268 268q7 7 17.5 7t18.5 -7z" />
+<glyph unicode="&#xe015;" d="M507 1177q98 0 187.5 -38.5t154.5 -103.5t103.5 -154.5t38.5 -187.5q0 -141 -78 -262l300 -299q8 -8 8 -18.5t-8 -18.5l-109 -108q-7 -8 -17.5 -8t-18.5 8l-300 299q-119 -77 -261 -77q-98 0 -188 38.5t-154.5 103t-103 154.5t-38.5 188t38.5 187.5t103 154.5 t154.5 103.5t188 38.5zM506.5 1023q-89.5 0 -165.5 -44t-120 -120.5t-44 -166t44 -165.5t120 -120t165.5 -44t166 44t120.5 120t44 165.5t-44 166t-120.5 120.5t-166 44zM425 900h150q10 0 17.5 -7.5t7.5 -17.5v-75h75q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5 t-17.5 -7.5h-75v-75q0 -10 -7.5 -17.5t-17.5 -7.5h-150q-10 0 -17.5 7.5t-7.5 17.5v75h-75q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5h75v75q0 10 7.5 17.5t17.5 7.5z" />
+<glyph unicode="&#xe016;" d="M507 1177q98 0 187.5 -38.5t154.5 -103.5t103.5 -154.5t38.5 -187.5q0 -141 -78 -262l300 -299q8 -8 8 -18.5t-8 -18.5l-109 -108q-7 -8 -17.5 -8t-18.5 8l-300 299q-119 -77 -261 -77q-98 0 -188 38.5t-154.5 103t-103 154.5t-38.5 188t38.5 187.5t103 154.5 t154.5 103.5t188 38.5zM506.5 1023q-89.5 0 -165.5 -44t-120 -120.5t-44 -166t44 -165.5t120 -120t165.5 -44t166 44t120.5 120t44 165.5t-44 166t-120.5 120.5t-166 44zM325 800h350q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-350q-10 0 -17.5 7.5 t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5z" />
+<glyph unicode="&#xe017;" d="M550 1200h100q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5zM800 975v166q167 -62 272 -209.5t105 -331.5q0 -117 -45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5 t-184.5 123t-123 184.5t-45.5 224q0 184 105 331.5t272 209.5v-166q-103 -55 -165 -155t-62 -220q0 -116 57 -214.5t155.5 -155.5t214.5 -57t214.5 57t155.5 155.5t57 214.5q0 120 -62 220t-165 155z" />
+<glyph unicode="&#xe018;" d="M1025 1200h150q10 0 17.5 -7.5t7.5 -17.5v-1150q0 -10 -7.5 -17.5t-17.5 -7.5h-150q-10 0 -17.5 7.5t-7.5 17.5v1150q0 10 7.5 17.5t17.5 7.5zM725 800h150q10 0 17.5 -7.5t7.5 -17.5v-750q0 -10 -7.5 -17.5t-17.5 -7.5h-150q-10 0 -17.5 7.5t-7.5 17.5v750 q0 10 7.5 17.5t17.5 7.5zM425 500h150q10 0 17.5 -7.5t7.5 -17.5v-450q0 -10 -7.5 -17.5t-17.5 -7.5h-150q-10 0 -17.5 7.5t-7.5 17.5v450q0 10 7.5 17.5t17.5 7.5zM125 300h150q10 0 17.5 -7.5t7.5 -17.5v-250q0 -10 -7.5 -17.5t-17.5 -7.5h-150q-10 0 -17.5 7.5t-7.5 17.5 v250q0 10 7.5 17.5t17.5 7.5z" />
+<glyph unicode="&#xe019;" d="M600 1174q33 0 74 -5l38 -152l5 -1q49 -14 94 -39l5 -2l134 80q61 -48 104 -105l-80 -134l3 -5q25 -44 39 -93l1 -6l152 -38q5 -43 5 -73q0 -34 -5 -74l-152 -38l-1 -6q-15 -49 -39 -93l-3 -5l80 -134q-48 -61 -104 -105l-134 81l-5 -3q-44 -25 -94 -39l-5 -2l-38 -151 q-43 -5 -74 -5q-33 0 -74 5l-38 151l-5 2q-49 14 -94 39l-5 3l-134 -81q-60 48 -104 105l80 134l-3 5q-25 45 -38 93l-2 6l-151 38q-6 42 -6 74q0 33 6 73l151 38l2 6q13 48 38 93l3 5l-80 134q47 61 105 105l133 -80l5 2q45 25 94 39l5 1l38 152q43 5 74 5zM600 815 q-89 0 -152 -63t-63 -151.5t63 -151.5t152 -63t152 63t63 151.5t-63 151.5t-152 63z" />
+<glyph unicode="&#xe020;" d="M500 1300h300q41 0 70.5 -29.5t29.5 -70.5v-100h275q10 0 17.5 -7.5t7.5 -17.5v-75h-1100v75q0 10 7.5 17.5t17.5 7.5h275v100q0 41 29.5 70.5t70.5 29.5zM500 1200v-100h300v100h-300zM1100 900v-800q0 -41 -29.5 -70.5t-70.5 -29.5h-700q-41 0 -70.5 29.5t-29.5 70.5 v800h900zM300 800v-700h100v700h-100zM500 800v-700h100v700h-100zM700 800v-700h100v700h-100zM900 800v-700h100v700h-100z" />
+<glyph unicode="&#xe021;" d="M18 618l620 608q8 7 18.5 7t17.5 -7l608 -608q8 -8 5.5 -13t-12.5 -5h-175v-575q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5t-7.5 17.5v375h-300v-375q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5t-7.5 17.5v575h-175q-10 0 -12.5 5t5.5 13z" />
+<glyph unicode="&#xe022;" d="M600 1200v-400q0 -41 29.5 -70.5t70.5 -29.5h300v-650q0 -21 -14.5 -35.5t-35.5 -14.5h-800q-21 0 -35.5 14.5t-14.5 35.5v1100q0 21 14.5 35.5t35.5 14.5h450zM1000 800h-250q-21 0 -35.5 14.5t-14.5 35.5v250z" />
+<glyph unicode="&#xe023;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM600 1027q-116 0 -214.5 -57t-155.5 -155.5t-57 -214.5t57 -214.5 t155.5 -155.5t214.5 -57t214.5 57t155.5 155.5t57 214.5t-57 214.5t-155.5 155.5t-214.5 57zM525 900h50q10 0 17.5 -7.5t7.5 -17.5v-275h175q10 0 17.5 -7.5t7.5 -17.5v-50q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5t-7.5 17.5v350q0 10 7.5 17.5t17.5 7.5z" />
+<glyph unicode="&#xe024;" d="M1300 0h-538l-41 400h-242l-41 -400h-538l431 1200h209l-21 -300h162l-20 300h208zM515 800l-27 -300h224l-27 300h-170z" />
+<glyph unicode="&#xe025;" d="M550 1200h200q21 0 35.5 -14.5t14.5 -35.5v-450h191q20 0 25.5 -11.5t-7.5 -27.5l-327 -400q-13 -16 -32 -16t-32 16l-327 400q-13 16 -7.5 27.5t25.5 11.5h191v450q0 21 14.5 35.5t35.5 14.5zM1125 400h50q10 0 17.5 -7.5t7.5 -17.5v-350q0 -10 -7.5 -17.5t-17.5 -7.5 h-1050q-10 0 -17.5 7.5t-7.5 17.5v350q0 10 7.5 17.5t17.5 7.5h50q10 0 17.5 -7.5t7.5 -17.5v-175h900v175q0 10 7.5 17.5t17.5 7.5z" />
+<glyph unicode="&#xe026;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM600 1027q-116 0 -214.5 -57t-155.5 -155.5t-57 -214.5t57 -214.5 t155.5 -155.5t214.5 -57t214.5 57t155.5 155.5t57 214.5t-57 214.5t-155.5 155.5t-214.5 57zM525 900h150q10 0 17.5 -7.5t7.5 -17.5v-275h137q21 0 26 -11.5t-8 -27.5l-223 -275q-13 -16 -32 -16t-32 16l-223 275q-13 16 -8 27.5t26 11.5h137v275q0 10 7.5 17.5t17.5 7.5z " />
+<glyph unicode="&#xe027;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM600 1027q-116 0 -214.5 -57t-155.5 -155.5t-57 -214.5t57 -214.5 t155.5 -155.5t214.5 -57t214.5 57t155.5 155.5t57 214.5t-57 214.5t-155.5 155.5t-214.5 57zM632 914l223 -275q13 -16 8 -27.5t-26 -11.5h-137v-275q0 -10 -7.5 -17.5t-17.5 -7.5h-150q-10 0 -17.5 7.5t-7.5 17.5v275h-137q-21 0 -26 11.5t8 27.5l223 275q13 16 32 16 t32 -16z" />
+<glyph unicode="&#xe028;" d="M225 1200h750q10 0 19.5 -7t12.5 -17l186 -652q7 -24 7 -49v-425q0 -12 -4 -27t-9 -17q-12 -6 -37 -6h-1100q-12 0 -27 4t-17 8q-6 13 -6 38l1 425q0 25 7 49l185 652q3 10 12.5 17t19.5 7zM878 1000h-556q-10 0 -19 -7t-11 -18l-87 -450q-2 -11 4 -18t16 -7h150 q10 0 19.5 -7t11.5 -17l38 -152q2 -10 11.5 -17t19.5 -7h250q10 0 19.5 7t11.5 17l38 152q2 10 11.5 17t19.5 7h150q10 0 16 7t4 18l-87 450q-2 11 -11 18t-19 7z" />
+<glyph unicode="&#xe029;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM600 1027q-116 0 -214.5 -57t-155.5 -155.5t-57 -214.5t57 -214.5 t155.5 -155.5t214.5 -57t214.5 57t155.5 155.5t57 214.5t-57 214.5t-155.5 155.5t-214.5 57zM540 820l253 -190q17 -12 17 -30t-17 -30l-253 -190q-16 -12 -28 -6.5t-12 26.5v400q0 21 12 26.5t28 -6.5z" />
+<glyph unicode="&#xe030;" d="M947 1060l135 135q7 7 12.5 5t5.5 -13v-362q0 -10 -7.5 -17.5t-17.5 -7.5h-362q-11 0 -13 5.5t5 12.5l133 133q-109 76 -238 76q-116 0 -214.5 -57t-155.5 -155.5t-57 -214.5t57 -214.5t155.5 -155.5t214.5 -57t214.5 57t155.5 155.5t57 214.5h150q0 -117 -45.5 -224 t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5q192 0 347 -117z" />
+<glyph unicode="&#xe031;" d="M947 1060l135 135q7 7 12.5 5t5.5 -13v-361q0 -11 -7.5 -18.5t-18.5 -7.5h-361q-11 0 -13 5.5t5 12.5l134 134q-110 75 -239 75q-116 0 -214.5 -57t-155.5 -155.5t-57 -214.5h-150q0 117 45.5 224t123 184.5t184.5 123t224 45.5q192 0 347 -117zM1027 600h150 q0 -117 -45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5q-192 0 -348 118l-134 -134q-7 -8 -12.5 -5.5t-5.5 12.5v360q0 11 7.5 18.5t18.5 7.5h360q10 0 12.5 -5.5t-5.5 -12.5l-133 -133q110 -76 240 -76q116 0 214.5 57t155.5 155.5t57 214.5z" />
+<glyph unicode="&#xe032;" d="M125 1200h1050q10 0 17.5 -7.5t7.5 -17.5v-1150q0 -10 -7.5 -17.5t-17.5 -7.5h-1050q-10 0 -17.5 7.5t-7.5 17.5v1150q0 10 7.5 17.5t17.5 7.5zM1075 1000h-850q-10 0 -17.5 -7.5t-7.5 -17.5v-850q0 -10 7.5 -17.5t17.5 -7.5h850q10 0 17.5 7.5t7.5 17.5v850 q0 10 -7.5 17.5t-17.5 7.5zM325 900h50q10 0 17.5 -7.5t7.5 -17.5v-50q0 -10 -7.5 -17.5t-17.5 -7.5h-50q-10 0 -17.5 7.5t-7.5 17.5v50q0 10 7.5 17.5t17.5 7.5zM525 900h450q10 0 17.5 -7.5t7.5 -17.5v-50q0 -10 -7.5 -17.5t-17.5 -7.5h-450q-10 0 -17.5 7.5t-7.5 17.5v50 q0 10 7.5 17.5t17.5 7.5zM325 700h50q10 0 17.5 -7.5t7.5 -17.5v-50q0 -10 -7.5 -17.5t-17.5 -7.5h-50q-10 0 -17.5 7.5t-7.5 17.5v50q0 10 7.5 17.5t17.5 7.5zM525 700h450q10 0 17.5 -7.5t7.5 -17.5v-50q0 -10 -7.5 -17.5t-17.5 -7.5h-450q-10 0 -17.5 7.5t-7.5 17.5v50 q0 10 7.5 17.5t17.5 7.5zM325 500h50q10 0 17.5 -7.5t7.5 -17.5v-50q0 -10 -7.5 -17.5t-17.5 -7.5h-50q-10 0 -17.5 7.5t-7.5 17.5v50q0 10 7.5 17.5t17.5 7.5zM525 500h450q10 0 17.5 -7.5t7.5 -17.5v-50q0 -10 -7.5 -17.5t-17.5 -7.5h-450q-10 0 -17.5 7.5t-7.5 17.5v50 q0 10 7.5 17.5t17.5 7.5zM325 300h50q10 0 17.5 -7.5t7.5 -17.5v-50q0 -10 -7.5 -17.5t-17.5 -7.5h-50q-10 0 -17.5 7.5t-7.5 17.5v50q0 10 7.5 17.5t17.5 7.5zM525 300h450q10 0 17.5 -7.5t7.5 -17.5v-50q0 -10 -7.5 -17.5t-17.5 -7.5h-450q-10 0 -17.5 7.5t-7.5 17.5v50 q0 10 7.5 17.5t17.5 7.5z" />
+<glyph unicode="&#xe033;" d="M900 800v200q0 83 -58.5 141.5t-141.5 58.5h-300q-82 0 -141 -59t-59 -141v-200h-100q-41 0 -70.5 -29.5t-29.5 -70.5v-600q0 -41 29.5 -70.5t70.5 -29.5h900q41 0 70.5 29.5t29.5 70.5v600q0 41 -29.5 70.5t-70.5 29.5h-100zM400 800v150q0 21 15 35.5t35 14.5h200 q20 0 35 -14.5t15 -35.5v-150h-300z" />
+<glyph unicode="&#xe034;" d="M125 1100h50q10 0 17.5 -7.5t7.5 -17.5v-1075h-100v1075q0 10 7.5 17.5t17.5 7.5zM1075 1052q4 0 9 -2q16 -6 16 -23v-421q0 -6 -3 -12q-33 -59 -66.5 -99t-65.5 -58t-56.5 -24.5t-52.5 -6.5q-26 0 -57.5 6.5t-52.5 13.5t-60 21q-41 15 -63 22.5t-57.5 15t-65.5 7.5 q-85 0 -160 -57q-7 -5 -15 -5q-6 0 -11 3q-14 7 -14 22v438q22 55 82 98.5t119 46.5q23 2 43 0.5t43 -7t32.5 -8.5t38 -13t32.5 -11q41 -14 63.5 -21t57 -14t63.5 -7q103 0 183 87q7 8 18 8z" />
+<glyph unicode="&#xe035;" d="M600 1175q116 0 227 -49.5t192.5 -131t131 -192.5t49.5 -227v-300q0 -10 -7.5 -17.5t-17.5 -7.5h-50q-10 0 -17.5 7.5t-7.5 17.5v300q0 127 -70.5 231.5t-184.5 161.5t-245 57t-245 -57t-184.5 -161.5t-70.5 -231.5v-300q0 -10 -7.5 -17.5t-17.5 -7.5h-50 q-10 0 -17.5 7.5t-7.5 17.5v300q0 116 49.5 227t131 192.5t192.5 131t227 49.5zM220 500h160q8 0 14 -6t6 -14v-460q0 -8 -6 -14t-14 -6h-160q-8 0 -14 6t-6 14v460q0 8 6 14t14 6zM820 500h160q8 0 14 -6t6 -14v-460q0 -8 -6 -14t-14 -6h-160q-8 0 -14 6t-6 14v460 q0 8 6 14t14 6z" />
+<glyph unicode="&#xe036;" d="M321 814l258 172q9 6 15 2.5t6 -13.5v-750q0 -10 -6 -13.5t-15 2.5l-258 172q-21 14 -46 14h-250q-10 0 -17.5 7.5t-7.5 17.5v350q0 10 7.5 17.5t17.5 7.5h250q25 0 46 14zM900 668l120 120q7 7 17 7t17 -7l34 -34q7 -7 7 -17t-7 -17l-120 -120l120 -120q7 -7 7 -17 t-7 -17l-34 -34q-7 -7 -17 -7t-17 7l-120 119l-120 -119q-7 -7 -17 -7t-17 7l-34 34q-7 7 -7 17t7 17l119 120l-119 120q-7 7 -7 17t7 17l34 34q7 8 17 8t17 -8z" />
+<glyph unicode="&#xe037;" d="M321 814l258 172q9 6 15 2.5t6 -13.5v-750q0 -10 -6 -13.5t-15 2.5l-258 172q-21 14 -46 14h-250q-10 0 -17.5 7.5t-7.5 17.5v350q0 10 7.5 17.5t17.5 7.5h250q25 0 46 14zM766 900h4q10 -1 16 -10q96 -129 96 -290q0 -154 -90 -281q-6 -9 -17 -10l-3 -1q-9 0 -16 6 l-29 23q-7 7 -8.5 16.5t4.5 17.5q72 103 72 229q0 132 -78 238q-6 8 -4.5 18t9.5 17l29 22q7 5 15 5z" />
+<glyph unicode="&#xe038;" d="M967 1004h3q11 -1 17 -10q135 -179 135 -396q0 -105 -34 -206.5t-98 -185.5q-7 -9 -17 -10h-3q-9 0 -16 6l-42 34q-8 6 -9 16t5 18q111 150 111 328q0 90 -29.5 176t-84.5 157q-6 9 -5 19t10 16l42 33q7 5 15 5zM321 814l258 172q9 6 15 2.5t6 -13.5v-750q0 -10 -6 -13.5 t-15 2.5l-258 172q-21 14 -46 14h-250q-10 0 -17.5 7.5t-7.5 17.5v350q0 10 7.5 17.5t17.5 7.5h250q25 0 46 14zM766 900h4q10 -1 16 -10q96 -129 96 -290q0 -154 -90 -281q-6 -9 -17 -10l-3 -1q-9 0 -16 6l-29 23q-7 7 -8.5 16.5t4.5 17.5q72 103 72 229q0 132 -78 238 q-6 8 -4.5 18.5t9.5 16.5l29 22q7 5 15 5z" />
+<glyph unicode="&#xe039;" d="M500 900h100v-100h-100v-100h-400v-100h-100v600h500v-300zM1200 700h-200v-100h200v-200h-300v300h-200v300h-100v200h600v-500zM100 1100v-300h300v300h-300zM800 1100v-300h300v300h-300zM300 900h-100v100h100v-100zM1000 900h-100v100h100v-100zM300 500h200v-500 h-500v500h200v100h100v-100zM800 300h200v-100h-100v-100h-200v100h-100v100h100v200h-200v100h300v-300zM100 400v-300h300v300h-300zM300 200h-100v100h100v-100zM1200 200h-100v100h100v-100zM700 0h-100v100h100v-100zM1200 0h-300v100h300v-100z" />
+<glyph unicode="&#xe040;" d="M100 200h-100v1000h100v-1000zM300 200h-100v1000h100v-1000zM700 200h-200v1000h200v-1000zM900 200h-100v1000h100v-1000zM1200 200h-200v1000h200v-1000zM400 0h-300v100h300v-100zM600 0h-100v91h100v-91zM800 0h-100v91h100v-91zM1100 0h-200v91h200v-91z" />
+<glyph unicode="&#xe041;" d="M500 1200l682 -682q8 -8 8 -18t-8 -18l-464 -464q-8 -8 -18 -8t-18 8l-682 682l1 475q0 10 7.5 17.5t17.5 7.5h474zM319.5 1024.5q-29.5 29.5 -71 29.5t-71 -29.5t-29.5 -71.5t29.5 -71.5t71 -29.5t71 29.5t29.5 71.5t-29.5 71.5z" />
+<glyph unicode="&#xe042;" d="M500 1200l682 -682q8 -8 8 -18t-8 -18l-464 -464q-8 -8 -18 -8t-18 8l-682 682l1 475q0 10 7.5 17.5t17.5 7.5h474zM800 1200l682 -682q8 -8 8 -18t-8 -18l-464 -464q-8 -8 -18 -8t-18 8l-56 56l424 426l-700 700h150zM319.5 1024.5q-29.5 29.5 -71 29.5t-71 -29.5 t-29.5 -71.5t29.5 -71.5t71 -29.5t71 29.5t29.5 71.5t-29.5 71.5z" />
+<glyph unicode="&#xe043;" d="M300 1200h825q75 0 75 -75v-900q0 -25 -18 -43l-64 -64q-8 -8 -13 -5.5t-5 12.5v950q0 10 -7.5 17.5t-17.5 7.5h-700q-25 0 -43 -18l-64 -64q-8 -8 -5.5 -13t12.5 -5h700q10 0 17.5 -7.5t7.5 -17.5v-950q0 -10 -7.5 -17.5t-17.5 -7.5h-850q-10 0 -17.5 7.5t-7.5 17.5v975 q0 25 18 43l139 139q18 18 43 18z" />
+<glyph unicode="&#xe044;" d="M250 1200h800q21 0 35.5 -14.5t14.5 -35.5v-1150l-450 444l-450 -445v1151q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe045;" d="M822 1200h-444q-11 0 -19 -7.5t-9 -17.5l-78 -301q-7 -24 7 -45l57 -108q6 -9 17.5 -15t21.5 -6h450q10 0 21.5 6t17.5 15l62 108q14 21 7 45l-83 301q-1 10 -9 17.5t-19 7.5zM1175 800h-150q-10 0 -21 -6.5t-15 -15.5l-78 -156q-4 -9 -15 -15.5t-21 -6.5h-550 q-10 0 -21 6.5t-15 15.5l-78 156q-4 9 -15 15.5t-21 6.5h-150q-10 0 -17.5 -7.5t-7.5 -17.5v-650q0 -10 7.5 -17.5t17.5 -7.5h150q10 0 17.5 7.5t7.5 17.5v150q0 10 7.5 17.5t17.5 7.5h750q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 7.5 -17.5t17.5 -7.5h150q10 0 17.5 7.5 t7.5 17.5v650q0 10 -7.5 17.5t-17.5 7.5zM850 200h-500q-10 0 -19.5 -7t-11.5 -17l-38 -152q-2 -10 3.5 -17t15.5 -7h600q10 0 15.5 7t3.5 17l-38 152q-2 10 -11.5 17t-19.5 7z" />
+<glyph unicode="&#xe046;" d="M500 1100h200q56 0 102.5 -20.5t72.5 -50t44 -59t25 -50.5l6 -20h150q41 0 70.5 -29.5t29.5 -70.5v-600q0 -41 -29.5 -70.5t-70.5 -29.5h-1000q-41 0 -70.5 29.5t-29.5 70.5v600q0 41 29.5 70.5t70.5 29.5h150q2 8 6.5 21.5t24 48t45 61t72 48t102.5 21.5zM900 800v-100 h100v100h-100zM600 730q-95 0 -162.5 -67.5t-67.5 -162.5t67.5 -162.5t162.5 -67.5t162.5 67.5t67.5 162.5t-67.5 162.5t-162.5 67.5zM600 603q43 0 73 -30t30 -73t-30 -73t-73 -30t-73 30t-30 73t30 73t73 30z" />
+<glyph unicode="&#xe047;" d="M681 1199l385 -998q20 -50 60 -92q18 -19 36.5 -29.5t27.5 -11.5l10 -2v-66h-417v66q53 0 75 43.5t5 88.5l-82 222h-391q-58 -145 -92 -234q-11 -34 -6.5 -57t25.5 -37t46 -20t55 -6v-66h-365v66q56 24 84 52q12 12 25 30.5t20 31.5l7 13l399 1006h93zM416 521h340 l-162 457z" />
+<glyph unicode="&#xe048;" d="M753 641q5 -1 14.5 -4.5t36 -15.5t50.5 -26.5t53.5 -40t50.5 -54.5t35.5 -70t14.5 -87q0 -67 -27.5 -125.5t-71.5 -97.5t-98.5 -66.5t-108.5 -40.5t-102 -13h-500v89q41 7 70.5 32.5t29.5 65.5v827q0 24 -0.5 34t-3.5 24t-8.5 19.5t-17 13.5t-28 12.5t-42.5 11.5v71 l471 -1q57 0 115.5 -20.5t108 -57t80.5 -94t31 -124.5q0 -51 -15.5 -96.5t-38 -74.5t-45 -50.5t-38.5 -30.5zM400 700h139q78 0 130.5 48.5t52.5 122.5q0 41 -8.5 70.5t-29.5 55.5t-62.5 39.5t-103.5 13.5h-118v-350zM400 200h216q80 0 121 50.5t41 130.5q0 90 -62.5 154.5 t-156.5 64.5h-159v-400z" />
+<glyph unicode="&#xe049;" d="M877 1200l2 -57q-83 -19 -116 -45.5t-40 -66.5l-132 -839q-9 -49 13 -69t96 -26v-97h-500v97q186 16 200 98l173 832q3 17 3 30t-1.5 22.5t-9 17.5t-13.5 12.5t-21.5 10t-26 8.5t-33.5 10q-13 3 -19 5v57h425z" />
+<glyph unicode="&#xe050;" d="M1300 900h-50q0 21 -4 37t-9.5 26.5t-18 17.5t-22 11t-28.5 5.5t-31 2t-37 0.5h-200v-850q0 -22 25 -34.5t50 -13.5l25 -2v-100h-400v100q4 0 11 0.5t24 3t30 7t24 15t11 24.5v850h-200q-25 0 -37 -0.5t-31 -2t-28.5 -5.5t-22 -11t-18 -17.5t-9.5 -26.5t-4 -37h-50v300 h1000v-300zM175 1000h-75v-800h75l-125 -167l-125 167h75v800h-75l125 167z" />
+<glyph unicode="&#xe051;" d="M1100 900h-50q0 21 -4 37t-9.5 26.5t-18 17.5t-22 11t-28.5 5.5t-31 2t-37 0.5h-200v-650q0 -22 25 -34.5t50 -13.5l25 -2v-100h-400v100q4 0 11 0.5t24 3t30 7t24 15t11 24.5v650h-200q-25 0 -37 -0.5t-31 -2t-28.5 -5.5t-22 -11t-18 -17.5t-9.5 -26.5t-4 -37h-50v300 h1000v-300zM1167 50l-167 -125v75h-800v-75l-167 125l167 125v-75h800v75z" />
+<glyph unicode="&#xe052;" d="M50 1100h600q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-600q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM50 800h1000q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1000q-21 0 -35.5 14.5t-14.5 35.5v100 q0 21 14.5 35.5t35.5 14.5zM50 500h800q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-800q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM50 200h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1100 q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe053;" d="M250 1100h700q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-700q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM50 800h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1100q-21 0 -35.5 14.5t-14.5 35.5v100 q0 21 14.5 35.5t35.5 14.5zM250 500h700q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-700q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM50 200h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1100 q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe054;" d="M500 950v100q0 21 14.5 35.5t35.5 14.5h600q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-600q-21 0 -35.5 14.5t-14.5 35.5zM100 650v100q0 21 14.5 35.5t35.5 14.5h1000q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1000 q-21 0 -35.5 14.5t-14.5 35.5zM300 350v100q0 21 14.5 35.5t35.5 14.5h800q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-800q-21 0 -35.5 14.5t-14.5 35.5zM0 50v100q0 21 14.5 35.5t35.5 14.5h1100q21 0 35.5 -14.5t14.5 -35.5v-100 q0 -21 -14.5 -35.5t-35.5 -14.5h-1100q-21 0 -35.5 14.5t-14.5 35.5z" />
+<glyph unicode="&#xe055;" d="M50 1100h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1100q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM50 800h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1100q-21 0 -35.5 14.5t-14.5 35.5v100 q0 21 14.5 35.5t35.5 14.5zM50 500h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1100q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM50 200h1100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1100 q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe056;" d="M50 1100h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM350 1100h800q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-800q-21 0 -35.5 14.5t-14.5 35.5v100 q0 21 14.5 35.5t35.5 14.5zM50 800h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM350 800h800q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-800 q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM50 500h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM350 500h800q21 0 35.5 -14.5t14.5 -35.5v-100 q0 -21 -14.5 -35.5t-35.5 -14.5h-800q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM50 200h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM350 200h800 q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-800q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe057;" d="M400 0h-100v1100h100v-1100zM550 1100h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM550 800h500q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-500 q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM267 550l-167 -125v75h-200v100h200v75zM550 500h300q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-300q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM550 200h600 q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-600q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe058;" d="M50 1100h100q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM900 0h-100v1100h100v-1100zM50 800h500q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-500 q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM1100 600h200v-100h-200v-75l-167 125l167 125v-75zM50 500h300q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-300q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5zM50 200h600 q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-600q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe059;" d="M75 1000h750q31 0 53 -22t22 -53v-650q0 -31 -22 -53t-53 -22h-750q-31 0 -53 22t-22 53v650q0 31 22 53t53 22zM1200 300l-300 300l300 300v-600z" />
+<glyph unicode="&#xe060;" d="M44 1100h1112q18 0 31 -13t13 -31v-1012q0 -18 -13 -31t-31 -13h-1112q-18 0 -31 13t-13 31v1012q0 18 13 31t31 13zM100 1000v-737l247 182l298 -131l-74 156l293 318l236 -288v500h-1000zM342 884q56 0 95 -39t39 -94.5t-39 -95t-95 -39.5t-95 39.5t-39 95t39 94.5 t95 39z" />
+<glyph unicode="&#xe062;" d="M648 1169q117 0 216 -60t156.5 -161t57.5 -218q0 -115 -70 -258q-69 -109 -158 -225.5t-143 -179.5l-54 -62q-9 8 -25.5 24.5t-63.5 67.5t-91 103t-98.5 128t-95.5 148q-60 132 -60 249q0 88 34 169.5t91.5 142t137 96.5t166.5 36zM652.5 974q-91.5 0 -156.5 -65 t-65 -157t65 -156.5t156.5 -64.5t156.5 64.5t65 156.5t-65 157t-156.5 65z" />
+<glyph unicode="&#xe063;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM600 173v854q-116 0 -214.5 -57t-155.5 -155.5t-57 -214.5t57 -214.5 t155.5 -155.5t214.5 -57z" />
+<glyph unicode="&#xe064;" d="M554 1295q21 -72 57.5 -143.5t76 -130t83 -118t82.5 -117t70 -116t49.5 -126t18.5 -136.5q0 -71 -25.5 -135t-68.5 -111t-99 -82t-118.5 -54t-125.5 -23q-84 5 -161.5 34t-139.5 78.5t-99 125t-37 164.5q0 69 18 136.5t49.5 126.5t69.5 116.5t81.5 117.5t83.5 119 t76.5 131t58.5 143zM344 710q-23 -33 -43.5 -70.5t-40.5 -102.5t-17 -123q1 -37 14.5 -69.5t30 -52t41 -37t38.5 -24.5t33 -15q21 -7 32 -1t13 22l6 34q2 10 -2.5 22t-13.5 19q-5 4 -14 12t-29.5 40.5t-32.5 73.5q-26 89 6 271q2 11 -6 11q-8 1 -15 -10z" />
+<glyph unicode="&#xe065;" d="M1000 1013l108 115q2 1 5 2t13 2t20.5 -1t25 -9.5t28.5 -21.5q22 -22 27 -43t0 -32l-6 -10l-108 -115zM350 1100h400q50 0 105 -13l-187 -187h-368q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v182l200 200v-332 q0 -165 -93.5 -257.5t-256.5 -92.5h-400q-165 0 -257.5 92.5t-92.5 257.5v400q0 165 92.5 257.5t257.5 92.5zM1009 803l-362 -362l-161 -50l55 170l355 355z" />
+<glyph unicode="&#xe066;" d="M350 1100h361q-164 -146 -216 -200h-195q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5l200 153v-103q0 -165 -92.5 -257.5t-257.5 -92.5h-400q-165 0 -257.5 92.5t-92.5 257.5v400q0 165 92.5 257.5t257.5 92.5z M824 1073l339 -301q8 -7 8 -17.5t-8 -17.5l-340 -306q-7 -6 -12.5 -4t-6.5 11v203q-26 1 -54.5 0t-78.5 -7.5t-92 -17.5t-86 -35t-70 -57q10 59 33 108t51.5 81.5t65 58.5t68.5 40.5t67 24.5t56 13.5t40 4.5v210q1 10 6.5 12.5t13.5 -4.5z" />
+<glyph unicode="&#xe067;" d="M350 1100h350q60 0 127 -23l-178 -177h-349q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v69l200 200v-219q0 -165 -92.5 -257.5t-257.5 -92.5h-400q-165 0 -257.5 92.5t-92.5 257.5v400q0 165 92.5 257.5t257.5 92.5z M643 639l395 395q7 7 17.5 7t17.5 -7l101 -101q7 -7 7 -17.5t-7 -17.5l-531 -532q-7 -7 -17.5 -7t-17.5 7l-248 248q-7 7 -7 17.5t7 17.5l101 101q7 7 17.5 7t17.5 -7l111 -111q8 -7 18 -7t18 7z" />
+<glyph unicode="&#xe068;" d="M318 918l264 264q8 8 18 8t18 -8l260 -264q7 -8 4.5 -13t-12.5 -5h-170v-200h200v173q0 10 5 12t13 -5l264 -260q8 -7 8 -17.5t-8 -17.5l-264 -265q-8 -7 -13 -5t-5 12v173h-200v-200h170q10 0 12.5 -5t-4.5 -13l-260 -264q-8 -8 -18 -8t-18 8l-264 264q-8 8 -5.5 13 t12.5 5h175v200h-200v-173q0 -10 -5 -12t-13 5l-264 265q-8 7 -8 17.5t8 17.5l264 260q8 7 13 5t5 -12v-173h200v200h-175q-10 0 -12.5 5t5.5 13z" />
+<glyph unicode="&#xe069;" d="M250 1100h100q21 0 35.5 -14.5t14.5 -35.5v-438l464 453q15 14 25.5 10t10.5 -25v-1000q0 -21 -10.5 -25t-25.5 10l-464 453v-438q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v1000q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe070;" d="M50 1100h100q21 0 35.5 -14.5t14.5 -35.5v-438l464 453q15 14 25.5 10t10.5 -25v-438l464 453q15 14 25.5 10t10.5 -25v-1000q0 -21 -10.5 -25t-25.5 10l-464 453v-438q0 -21 -10.5 -25t-25.5 10l-464 453v-438q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5 t-14.5 35.5v1000q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe071;" d="M1200 1050v-1000q0 -21 -10.5 -25t-25.5 10l-464 453v-438q0 -21 -10.5 -25t-25.5 10l-492 480q-15 14 -15 35t15 35l492 480q15 14 25.5 10t10.5 -25v-438l464 453q15 14 25.5 10t10.5 -25z" />
+<glyph unicode="&#xe072;" d="M243 1074l814 -498q18 -11 18 -26t-18 -26l-814 -498q-18 -11 -30.5 -4t-12.5 28v1000q0 21 12.5 28t30.5 -4z" />
+<glyph unicode="&#xe073;" d="M250 1000h200q21 0 35.5 -14.5t14.5 -35.5v-800q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v800q0 21 14.5 35.5t35.5 14.5zM650 1000h200q21 0 35.5 -14.5t14.5 -35.5v-800q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v800 q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe074;" d="M1100 950v-800q0 -21 -14.5 -35.5t-35.5 -14.5h-800q-21 0 -35.5 14.5t-14.5 35.5v800q0 21 14.5 35.5t35.5 14.5h800q21 0 35.5 -14.5t14.5 -35.5z" />
+<glyph unicode="&#xe075;" d="M500 612v438q0 21 10.5 25t25.5 -10l492 -480q15 -14 15 -35t-15 -35l-492 -480q-15 -14 -25.5 -10t-10.5 25v438l-464 -453q-15 -14 -25.5 -10t-10.5 25v1000q0 21 10.5 25t25.5 -10z" />
+<glyph unicode="&#xe076;" d="M1048 1102l100 1q20 0 35 -14.5t15 -35.5l5 -1000q0 -21 -14.5 -35.5t-35.5 -14.5l-100 -1q-21 0 -35.5 14.5t-14.5 35.5l-2 437l-463 -454q-14 -15 -24.5 -10.5t-10.5 25.5l-2 437l-462 -455q-15 -14 -25.5 -9.5t-10.5 24.5l-5 1000q0 21 10.5 25.5t25.5 -10.5l466 -450 l-2 438q0 20 10.5 24.5t25.5 -9.5l466 -451l-2 438q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe077;" d="M850 1100h100q21 0 35.5 -14.5t14.5 -35.5v-1000q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v438l-464 -453q-15 -14 -25.5 -10t-10.5 25v1000q0 21 10.5 25t25.5 -10l464 -453v438q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe078;" d="M686 1081l501 -540q15 -15 10.5 -26t-26.5 -11h-1042q-22 0 -26.5 11t10.5 26l501 540q15 15 36 15t36 -15zM150 400h1000q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1000q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe079;" d="M885 900l-352 -353l352 -353l-197 -198l-552 552l552 550z" />
+<glyph unicode="&#xe080;" d="M1064 547l-551 -551l-198 198l353 353l-353 353l198 198z" />
+<glyph unicode="&#xe081;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM650 900h-100q-21 0 -35.5 -14.5t-14.5 -35.5v-150h-150 q-21 0 -35.5 -14.5t-14.5 -35.5v-100q0 -21 14.5 -35.5t35.5 -14.5h150v-150q0 -21 14.5 -35.5t35.5 -14.5h100q21 0 35.5 14.5t14.5 35.5v150h150q21 0 35.5 14.5t14.5 35.5v100q0 21 -14.5 35.5t-35.5 14.5h-150v150q0 21 -14.5 35.5t-35.5 14.5z" />
+<glyph unicode="&#xe082;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM850 700h-500q-21 0 -35.5 -14.5t-14.5 -35.5v-100q0 -21 14.5 -35.5 t35.5 -14.5h500q21 0 35.5 14.5t14.5 35.5v100q0 21 -14.5 35.5t-35.5 14.5z" />
+<glyph unicode="&#xe083;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM741.5 913q-12.5 0 -21.5 -9l-120 -120l-120 120q-9 9 -21.5 9 t-21.5 -9l-141 -141q-9 -9 -9 -21.5t9 -21.5l120 -120l-120 -120q-9 -9 -9 -21.5t9 -21.5l141 -141q9 -9 21.5 -9t21.5 9l120 120l120 -120q9 -9 21.5 -9t21.5 9l141 141q9 9 9 21.5t-9 21.5l-120 120l120 120q9 9 9 21.5t-9 21.5l-141 141q-9 9 -21.5 9z" />
+<glyph unicode="&#xe084;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM546 623l-84 85q-7 7 -17.5 7t-18.5 -7l-139 -139q-7 -8 -7 -18t7 -18 l242 -241q7 -8 17.5 -8t17.5 8l375 375q7 7 7 17.5t-7 18.5l-139 139q-7 7 -17.5 7t-17.5 -7z" />
+<glyph unicode="&#xe085;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM588 941q-29 0 -59 -5.5t-63 -20.5t-58 -38.5t-41.5 -63t-16.5 -89.5 q0 -25 20 -25h131q30 -5 35 11q6 20 20.5 28t45.5 8q20 0 31.5 -10.5t11.5 -28.5q0 -23 -7 -34t-26 -18q-1 0 -13.5 -4t-19.5 -7.5t-20 -10.5t-22 -17t-18.5 -24t-15.5 -35t-8 -46q-1 -8 5.5 -16.5t20.5 -8.5h173q7 0 22 8t35 28t37.5 48t29.5 74t12 100q0 47 -17 83 t-42.5 57t-59.5 34.5t-64 18t-59 4.5zM675 400h-150q-10 0 -17.5 -7.5t-7.5 -17.5v-150q0 -10 7.5 -17.5t17.5 -7.5h150q10 0 17.5 7.5t7.5 17.5v150q0 10 -7.5 17.5t-17.5 7.5z" />
+<glyph unicode="&#xe086;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM675 1000h-150q-10 0 -17.5 -7.5t-7.5 -17.5v-150q0 -10 7.5 -17.5 t17.5 -7.5h150q10 0 17.5 7.5t7.5 17.5v150q0 10 -7.5 17.5t-17.5 7.5zM675 700h-250q-10 0 -17.5 -7.5t-7.5 -17.5v-50q0 -10 7.5 -17.5t17.5 -7.5h75v-200h-75q-10 0 -17.5 -7.5t-7.5 -17.5v-50q0 -10 7.5 -17.5t17.5 -7.5h350q10 0 17.5 7.5t7.5 17.5v50q0 10 -7.5 17.5 t-17.5 7.5h-75v275q0 10 -7.5 17.5t-17.5 7.5z" />
+<glyph unicode="&#xe087;" d="M525 1200h150q10 0 17.5 -7.5t7.5 -17.5v-194q103 -27 178.5 -102.5t102.5 -178.5h194q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-194q-27 -103 -102.5 -178.5t-178.5 -102.5v-194q0 -10 -7.5 -17.5t-17.5 -7.5h-150q-10 0 -17.5 7.5t-7.5 17.5v194 q-103 27 -178.5 102.5t-102.5 178.5h-194q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5h194q27 103 102.5 178.5t178.5 102.5v194q0 10 7.5 17.5t17.5 7.5zM700 893v-168q0 -10 -7.5 -17.5t-17.5 -7.5h-150q-10 0 -17.5 7.5t-7.5 17.5v168q-68 -23 -119 -74 t-74 -119h168q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-168q23 -68 74 -119t119 -74v168q0 10 7.5 17.5t17.5 7.5h150q10 0 17.5 -7.5t7.5 -17.5v-168q68 23 119 74t74 119h-168q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5h168 q-23 68 -74 119t-119 74z" />
+<glyph unicode="&#xe088;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM600 1027q-116 0 -214.5 -57t-155.5 -155.5t-57 -214.5t57 -214.5 t155.5 -155.5t214.5 -57t214.5 57t155.5 155.5t57 214.5t-57 214.5t-155.5 155.5t-214.5 57zM759 823l64 -64q7 -7 7 -17.5t-7 -17.5l-124 -124l124 -124q7 -7 7 -17.5t-7 -17.5l-64 -64q-7 -7 -17.5 -7t-17.5 7l-124 124l-124 -124q-7 -7 -17.5 -7t-17.5 7l-64 64 q-7 7 -7 17.5t7 17.5l124 124l-124 124q-7 7 -7 17.5t7 17.5l64 64q7 7 17.5 7t17.5 -7l124 -124l124 124q7 7 17.5 7t17.5 -7z" />
+<glyph unicode="&#xe089;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM600 1027q-116 0 -214.5 -57t-155.5 -155.5t-57 -214.5t57 -214.5 t155.5 -155.5t214.5 -57t214.5 57t155.5 155.5t57 214.5t-57 214.5t-155.5 155.5t-214.5 57zM782 788l106 -106q7 -7 7 -17.5t-7 -17.5l-320 -321q-8 -7 -18 -7t-18 7l-202 203q-8 7 -8 17.5t8 17.5l106 106q7 8 17.5 8t17.5 -8l79 -79l197 197q7 7 17.5 7t17.5 -7z" />
+<glyph unicode="&#xe090;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM600 1027q-116 0 -214.5 -57t-155.5 -155.5t-57 -214.5q0 -120 65 -225 l587 587q-105 65 -225 65zM965 819l-584 -584q104 -62 219 -62q116 0 214.5 57t155.5 155.5t57 214.5q0 115 -62 219z" />
+<glyph unicode="&#xe091;" d="M39 582l522 427q16 13 27.5 8t11.5 -26v-291h550q21 0 35.5 -14.5t14.5 -35.5v-200q0 -21 -14.5 -35.5t-35.5 -14.5h-550v-291q0 -21 -11.5 -26t-27.5 8l-522 427q-16 13 -16 32t16 32z" />
+<glyph unicode="&#xe092;" d="M639 1009l522 -427q16 -13 16 -32t-16 -32l-522 -427q-16 -13 -27.5 -8t-11.5 26v291h-550q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5h550v291q0 21 11.5 26t27.5 -8z" />
+<glyph unicode="&#xe093;" d="M682 1161l427 -522q13 -16 8 -27.5t-26 -11.5h-291v-550q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v550h-291q-21 0 -26 11.5t8 27.5l427 522q13 16 32 16t32 -16z" />
+<glyph unicode="&#xe094;" d="M550 1200h200q21 0 35.5 -14.5t14.5 -35.5v-550h291q21 0 26 -11.5t-8 -27.5l-427 -522q-13 -16 -32 -16t-32 16l-427 522q-13 16 -8 27.5t26 11.5h291v550q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe095;" d="M639 1109l522 -427q16 -13 16 -32t-16 -32l-522 -427q-16 -13 -27.5 -8t-11.5 26v291q-94 -2 -182 -20t-170.5 -52t-147 -92.5t-100.5 -135.5q5 105 27 193.5t67.5 167t113 135t167 91.5t225.5 42v262q0 21 11.5 26t27.5 -8z" />
+<glyph unicode="&#xe096;" d="M850 1200h300q21 0 35.5 -14.5t14.5 -35.5v-300q0 -21 -10.5 -25t-24.5 10l-94 94l-249 -249q-8 -7 -18 -7t-18 7l-106 106q-7 8 -7 18t7 18l249 249l-94 94q-14 14 -10 24.5t25 10.5zM350 0h-300q-21 0 -35.5 14.5t-14.5 35.5v300q0 21 10.5 25t24.5 -10l94 -94l249 249 q8 7 18 7t18 -7l106 -106q7 -8 7 -18t-7 -18l-249 -249l94 -94q14 -14 10 -24.5t-25 -10.5z" />
+<glyph unicode="&#xe097;" d="M1014 1120l106 -106q7 -8 7 -18t-7 -18l-249 -249l94 -94q14 -14 10 -24.5t-25 -10.5h-300q-21 0 -35.5 14.5t-14.5 35.5v300q0 21 10.5 25t24.5 -10l94 -94l249 249q8 7 18 7t18 -7zM250 600h300q21 0 35.5 -14.5t14.5 -35.5v-300q0 -21 -10.5 -25t-24.5 10l-94 94 l-249 -249q-8 -7 -18 -7t-18 7l-106 106q-7 8 -7 18t7 18l249 249l-94 94q-14 14 -10 24.5t25 10.5z" />
+<glyph unicode="&#xe101;" d="M600 1177q117 0 224 -45.5t184.5 -123t123 -184.5t45.5 -224t-45.5 -224t-123 -184.5t-184.5 -123t-224 -45.5t-224 45.5t-184.5 123t-123 184.5t-45.5 224t45.5 224t123 184.5t184.5 123t224 45.5zM704 900h-208q-20 0 -32 -14.5t-8 -34.5l58 -302q4 -20 21.5 -34.5 t37.5 -14.5h54q20 0 37.5 14.5t21.5 34.5l58 302q4 20 -8 34.5t-32 14.5zM675 400h-150q-10 0 -17.5 -7.5t-7.5 -17.5v-150q0 -10 7.5 -17.5t17.5 -7.5h150q10 0 17.5 7.5t7.5 17.5v150q0 10 -7.5 17.5t-17.5 7.5z" />
+<glyph unicode="&#xe102;" d="M260 1200q9 0 19 -2t15 -4l5 -2q22 -10 44 -23l196 -118q21 -13 36 -24q29 -21 37 -12q11 13 49 35l196 118q22 13 45 23q17 7 38 7q23 0 47 -16.5t37 -33.5l13 -16q14 -21 18 -45l25 -123l8 -44q1 -9 8.5 -14.5t17.5 -5.5h61q10 0 17.5 -7.5t7.5 -17.5v-50 q0 -10 -7.5 -17.5t-17.5 -7.5h-50q-10 0 -17.5 -7.5t-7.5 -17.5v-175h-400v300h-200v-300h-400v175q0 10 -7.5 17.5t-17.5 7.5h-50q-10 0 -17.5 7.5t-7.5 17.5v50q0 10 7.5 17.5t17.5 7.5h61q11 0 18 3t7 8q0 4 9 52l25 128q5 25 19 45q2 3 5 7t13.5 15t21.5 19.5t26.5 15.5 t29.5 7zM915 1079l-166 -162q-7 -7 -5 -12t12 -5h219q10 0 15 7t2 17l-51 149q-3 10 -11 12t-15 -6zM463 917l-177 157q-8 7 -16 5t-11 -12l-51 -143q-3 -10 2 -17t15 -7h231q11 0 12.5 5t-5.5 12zM500 0h-375q-10 0 -17.5 7.5t-7.5 17.5v375h400v-400zM1100 400v-375 q0 -10 -7.5 -17.5t-17.5 -7.5h-375v400h400z" />
+<glyph unicode="&#xe103;" d="M1165 1190q8 3 21 -6.5t13 -17.5q-2 -178 -24.5 -323.5t-55.5 -245.5t-87 -174.5t-102.5 -118.5t-118 -68.5t-118.5 -33t-120 -4.5t-105 9.5t-90 16.5q-61 12 -78 11q-4 1 -12.5 0t-34 -14.5t-52.5 -40.5l-153 -153q-26 -24 -37 -14.5t-11 43.5q0 64 42 102q8 8 50.5 45 t66.5 58q19 17 35 47t13 61q-9 55 -10 102.5t7 111t37 130t78 129.5q39 51 80 88t89.5 63.5t94.5 45t113.5 36t129 31t157.5 37t182 47.5zM1116 1098q-8 9 -22.5 -3t-45.5 -50q-38 -47 -119 -103.5t-142 -89.5l-62 -33q-56 -30 -102 -57t-104 -68t-102.5 -80.5t-85.5 -91 t-64 -104.5q-24 -56 -31 -86t2 -32t31.5 17.5t55.5 59.5q25 30 94 75.5t125.5 77.5t147.5 81q70 37 118.5 69t102 79.5t99 111t86.5 148.5q22 50 24 60t-6 19z" />
+<glyph unicode="&#xe104;" d="M653 1231q-39 -67 -54.5 -131t-10.5 -114.5t24.5 -96.5t47.5 -80t63.5 -62.5t68.5 -46.5t65 -30q-4 7 -17.5 35t-18.5 39.5t-17 39.5t-17 43t-13 42t-9.5 44.5t-2 42t4 43t13.5 39t23 38.5q96 -42 165 -107.5t105 -138t52 -156t13 -159t-19 -149.5q-13 -55 -44 -106.5 t-68 -87t-78.5 -64.5t-72.5 -45t-53 -22q-72 -22 -127 -11q-31 6 -13 19q6 3 17 7q13 5 32.5 21t41 44t38.5 63.5t21.5 81.5t-6.5 94.5t-50 107t-104 115.5q10 -104 -0.5 -189t-37 -140.5t-65 -93t-84 -52t-93.5 -11t-95 24.5q-80 36 -131.5 114t-53.5 171q-2 23 0 49.5 t4.5 52.5t13.5 56t27.5 60t46 64.5t69.5 68.5q-8 -53 -5 -102.5t17.5 -90t34 -68.5t44.5 -39t49 -2q31 13 38.5 36t-4.5 55t-29 64.5t-36 75t-26 75.5q-15 85 2 161.5t53.5 128.5t85.5 92.5t93.5 61t81.5 25.5z" />
+<glyph unicode="&#xe105;" d="M600 1094q82 0 160.5 -22.5t140 -59t116.5 -82.5t94.5 -95t68 -95t42.5 -82.5t14 -57.5t-14 -57.5t-43 -82.5t-68.5 -95t-94.5 -95t-116.5 -82.5t-140 -59t-159.5 -22.5t-159.5 22.5t-140 59t-116.5 82.5t-94.5 95t-68.5 95t-43 82.5t-14 57.5t14 57.5t42.5 82.5t68 95 t94.5 95t116.5 82.5t140 59t160.5 22.5zM888 829q-15 15 -18 12t5 -22q25 -57 25 -119q0 -124 -88 -212t-212 -88t-212 88t-88 212q0 59 23 114q8 19 4.5 22t-17.5 -12q-70 -69 -160 -184q-13 -16 -15 -40.5t9 -42.5q22 -36 47 -71t70 -82t92.5 -81t113 -58.5t133.5 -24.5 t133.5 24t113 58.5t92.5 81.5t70 81.5t47 70.5q11 18 9 42.5t-14 41.5q-90 117 -163 189zM448 727l-35 -36q-15 -15 -19.5 -38.5t4.5 -41.5q37 -68 93 -116q16 -13 38.5 -11t36.5 17l35 34q14 15 12.5 33.5t-16.5 33.5q-44 44 -89 117q-11 18 -28 20t-32 -12z" />
+<glyph unicode="&#xe106;" d="M592 0h-148l31 120q-91 20 -175.5 68.5t-143.5 106.5t-103.5 119t-66.5 110t-22 76q0 21 14 57.5t42.5 82.5t68 95t94.5 95t116.5 82.5t140 59t160.5 22.5q61 0 126 -15l32 121h148zM944 770l47 181q108 -85 176.5 -192t68.5 -159q0 -26 -19.5 -71t-59.5 -102t-93 -112 t-129 -104.5t-158 -75.5l46 173q77 49 136 117t97 131q11 18 9 42.5t-14 41.5q-54 70 -107 130zM310 824q-70 -69 -160 -184q-13 -16 -15 -40.5t9 -42.5q18 -30 39 -60t57 -70.5t74 -73t90 -61t105 -41.5l41 154q-107 18 -178.5 101.5t-71.5 193.5q0 59 23 114q8 19 4.5 22 t-17.5 -12zM448 727l-35 -36q-15 -15 -19.5 -38.5t4.5 -41.5q37 -68 93 -116q16 -13 38.5 -11t36.5 17l12 11l22 86l-3 4q-44 44 -89 117q-11 18 -28 20t-32 -12z" />
+<glyph unicode="&#xe107;" d="M-90 100l642 1066q20 31 48 28.5t48 -35.5l642 -1056q21 -32 7.5 -67.5t-50.5 -35.5h-1294q-37 0 -50.5 34t7.5 66zM155 200h345v75q0 10 7.5 17.5t17.5 7.5h150q10 0 17.5 -7.5t7.5 -17.5v-75h345l-445 723zM496 700h208q20 0 32 -14.5t8 -34.5l-58 -252 q-4 -20 -21.5 -34.5t-37.5 -14.5h-54q-20 0 -37.5 14.5t-21.5 34.5l-58 252q-4 20 8 34.5t32 14.5z" />
+<glyph unicode="&#xe108;" d="M650 1200q62 0 106 -44t44 -106v-339l363 -325q15 -14 26 -38.5t11 -44.5v-41q0 -20 -12 -26.5t-29 5.5l-359 249v-263q100 -93 100 -113v-64q0 -21 -13 -29t-32 1l-205 128l-205 -128q-19 -9 -32 -1t-13 29v64q0 20 100 113v263l-359 -249q-17 -12 -29 -5.5t-12 26.5v41 q0 20 11 44.5t26 38.5l363 325v339q0 62 44 106t106 44z" />
+<glyph unicode="&#xe109;" d="M850 1200h100q21 0 35.5 -14.5t14.5 -35.5v-50h50q21 0 35.5 -14.5t14.5 -35.5v-150h-1100v150q0 21 14.5 35.5t35.5 14.5h50v50q0 21 14.5 35.5t35.5 14.5h100q21 0 35.5 -14.5t14.5 -35.5v-50h500v50q0 21 14.5 35.5t35.5 14.5zM1100 800v-750q0 -21 -14.5 -35.5 t-35.5 -14.5h-1000q-21 0 -35.5 14.5t-14.5 35.5v750h1100zM100 600v-100h100v100h-100zM300 600v-100h100v100h-100zM500 600v-100h100v100h-100zM700 600v-100h100v100h-100zM900 600v-100h100v100h-100zM100 400v-100h100v100h-100zM300 400v-100h100v100h-100zM500 400 v-100h100v100h-100zM700 400v-100h100v100h-100zM900 400v-100h100v100h-100zM100 200v-100h100v100h-100zM300 200v-100h100v100h-100zM500 200v-100h100v100h-100zM700 200v-100h100v100h-100zM900 200v-100h100v100h-100z" />
+<glyph unicode="&#xe110;" d="M1135 1165l249 -230q15 -14 15 -35t-15 -35l-249 -230q-14 -14 -24.5 -10t-10.5 25v150h-159l-600 -600h-291q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5h209l600 600h241v150q0 21 10.5 25t24.5 -10zM522 819l-141 -141l-122 122h-209q-21 0 -35.5 14.5 t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5h291zM1135 565l249 -230q15 -14 15 -35t-15 -35l-249 -230q-14 -14 -24.5 -10t-10.5 25v150h-241l-181 181l141 141l122 -122h159v150q0 21 10.5 25t24.5 -10z" />
+<glyph unicode="&#xe111;" d="M100 1100h1000q41 0 70.5 -29.5t29.5 -70.5v-600q0 -41 -29.5 -70.5t-70.5 -29.5h-596l-304 -300v300h-100q-41 0 -70.5 29.5t-29.5 70.5v600q0 41 29.5 70.5t70.5 29.5z" />
+<glyph unicode="&#xe112;" d="M150 1200h200q21 0 35.5 -14.5t14.5 -35.5v-250h-300v250q0 21 14.5 35.5t35.5 14.5zM850 1200h200q21 0 35.5 -14.5t14.5 -35.5v-250h-300v250q0 21 14.5 35.5t35.5 14.5zM1100 800v-300q0 -41 -3 -77.5t-15 -89.5t-32 -96t-58 -89t-89 -77t-129 -51t-174 -20t-174 20 t-129 51t-89 77t-58 89t-32 96t-15 89.5t-3 77.5v300h300v-250v-27v-42.5t1.5 -41t5 -38t10 -35t16.5 -30t25.5 -24.5t35 -19t46.5 -12t60 -4t60 4.5t46.5 12.5t35 19.5t25 25.5t17 30.5t10 35t5 38t2 40.5t-0.5 42v25v250h300z" />
+<glyph unicode="&#xe113;" d="M1100 411l-198 -199l-353 353l-353 -353l-197 199l551 551z" />
+<glyph unicode="&#xe114;" d="M1101 789l-550 -551l-551 551l198 199l353 -353l353 353z" />
+<glyph unicode="&#xe115;" d="M404 1000h746q21 0 35.5 -14.5t14.5 -35.5v-551h150q21 0 25 -10.5t-10 -24.5l-230 -249q-14 -15 -35 -15t-35 15l-230 249q-14 14 -10 24.5t25 10.5h150v401h-381zM135 984l230 -249q14 -14 10 -24.5t-25 -10.5h-150v-400h385l215 -200h-750q-21 0 -35.5 14.5 t-14.5 35.5v550h-150q-21 0 -25 10.5t10 24.5l230 249q14 15 35 15t35 -15z" />
+<glyph unicode="&#xe116;" d="M56 1200h94q17 0 31 -11t18 -27l38 -162h896q24 0 39 -18.5t10 -42.5l-100 -475q-5 -21 -27 -42.5t-55 -21.5h-633l48 -200h535q21 0 35.5 -14.5t14.5 -35.5t-14.5 -35.5t-35.5 -14.5h-50v-50q0 -21 -14.5 -35.5t-35.5 -14.5t-35.5 14.5t-14.5 35.5v50h-300v-50 q0 -21 -14.5 -35.5t-35.5 -14.5t-35.5 14.5t-14.5 35.5v50h-31q-18 0 -32.5 10t-20.5 19l-5 10l-201 961h-54q-20 0 -35 14.5t-15 35.5t15 35.5t35 14.5z" />
+<glyph unicode="&#xe117;" d="M1200 1000v-100h-1200v100h200q0 41 29.5 70.5t70.5 29.5h300q41 0 70.5 -29.5t29.5 -70.5h500zM0 800h1200v-800h-1200v800z" />
+<glyph unicode="&#xe118;" d="M200 800l-200 -400v600h200q0 41 29.5 70.5t70.5 29.5h300q42 0 71 -29.5t29 -70.5h500v-200h-1000zM1500 700l-300 -700h-1200l300 700h1200z" />
+<glyph unicode="&#xe119;" d="M635 1184l230 -249q14 -14 10 -24.5t-25 -10.5h-150v-601h150q21 0 25 -10.5t-10 -24.5l-230 -249q-14 -15 -35 -15t-35 15l-230 249q-14 14 -10 24.5t25 10.5h150v601h-150q-21 0 -25 10.5t10 24.5l230 249q14 15 35 15t35 -15z" />
+<glyph unicode="&#xe120;" d="M936 864l249 -229q14 -15 14 -35.5t-14 -35.5l-249 -229q-15 -15 -25.5 -10.5t-10.5 24.5v151h-600v-151q0 -20 -10.5 -24.5t-25.5 10.5l-249 229q-14 15 -14 35.5t14 35.5l249 229q15 15 25.5 10.5t10.5 -25.5v-149h600v149q0 21 10.5 25.5t25.5 -10.5z" />
+<glyph unicode="&#xe121;" d="M1169 400l-172 732q-5 23 -23 45.5t-38 22.5h-672q-20 0 -38 -20t-23 -41l-172 -739h1138zM1100 300h-1000q-41 0 -70.5 -29.5t-29.5 -70.5v-100q0 -41 29.5 -70.5t70.5 -29.5h1000q41 0 70.5 29.5t29.5 70.5v100q0 41 -29.5 70.5t-70.5 29.5zM800 100v100h100v-100h-100 zM1000 100v100h100v-100h-100z" />
+<glyph unicode="&#xe122;" d="M1150 1100q21 0 35.5 -14.5t14.5 -35.5v-850q0 -21 -14.5 -35.5t-35.5 -14.5t-35.5 14.5t-14.5 35.5v850q0 21 14.5 35.5t35.5 14.5zM1000 200l-675 200h-38l47 -276q3 -16 -5.5 -20t-29.5 -4h-7h-84q-20 0 -34.5 14t-18.5 35q-55 337 -55 351v250v6q0 16 1 23.5t6.5 14 t17.5 6.5h200l675 250v-850zM0 750v-250q-4 0 -11 0.5t-24 6t-30 15t-24 30t-11 48.5v50q0 26 10.5 46t25 30t29 16t25.5 7z" />
+<glyph unicode="&#xe123;" d="M553 1200h94q20 0 29 -10.5t3 -29.5l-18 -37q83 -19 144 -82.5t76 -140.5l63 -327l118 -173h17q19 0 33 -14.5t14 -35t-13 -40.5t-31 -27q-8 -4 -23 -9.5t-65 -19.5t-103 -25t-132.5 -20t-158.5 -9q-57 0 -115 5t-104 12t-88.5 15.5t-73.5 17.5t-54.5 16t-35.5 12l-11 4 q-18 8 -31 28t-13 40.5t14 35t33 14.5h17l118 173l63 327q15 77 76 140t144 83l-18 32q-6 19 3.5 32t28.5 13zM498 110q50 -6 102 -6q53 0 102 6q-12 -49 -39.5 -79.5t-62.5 -30.5t-63 30.5t-39 79.5z" />
+<glyph unicode="&#xe124;" d="M800 946l224 78l-78 -224l234 -45l-180 -155l180 -155l-234 -45l78 -224l-224 78l-45 -234l-155 180l-155 -180l-45 234l-224 -78l78 224l-234 45l180 155l-180 155l234 45l-78 224l224 -78l45 234l155 -180l155 180z" />
+<glyph unicode="&#xe125;" d="M650 1200h50q40 0 70 -40.5t30 -84.5v-150l-28 -125h328q40 0 70 -40.5t30 -84.5v-100q0 -45 -29 -74l-238 -344q-16 -24 -38 -40.5t-45 -16.5h-250q-7 0 -42 25t-66 50l-31 25h-61q-45 0 -72.5 18t-27.5 57v400q0 36 20 63l145 196l96 198q13 28 37.5 48t51.5 20z M650 1100l-100 -212l-150 -213v-375h100l136 -100h214l250 375v125h-450l50 225v175h-50zM50 800h100q21 0 35.5 -14.5t14.5 -35.5v-500q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v500q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe126;" d="M600 1100h250q23 0 45 -16.5t38 -40.5l238 -344q29 -29 29 -74v-100q0 -44 -30 -84.5t-70 -40.5h-328q28 -118 28 -125v-150q0 -44 -30 -84.5t-70 -40.5h-50q-27 0 -51.5 20t-37.5 48l-96 198l-145 196q-20 27 -20 63v400q0 39 27.5 57t72.5 18h61q124 100 139 100z M50 1000h100q21 0 35.5 -14.5t14.5 -35.5v-500q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v500q0 21 14.5 35.5t35.5 14.5zM636 1000l-136 -100h-100v-375l150 -213l100 -212h50v175l-50 225h450v125l-250 375h-214z" />
+<glyph unicode="&#xe127;" d="M356 873l363 230q31 16 53 -6l110 -112q13 -13 13.5 -32t-11.5 -34l-84 -121h302q84 0 138 -38t54 -110t-55 -111t-139 -39h-106l-131 -339q-6 -21 -19.5 -41t-28.5 -20h-342q-7 0 -90 81t-83 94v525q0 17 14 35.5t28 28.5zM400 792v-503l100 -89h293l131 339 q6 21 19.5 41t28.5 20h203q21 0 30.5 25t0.5 50t-31 25h-456h-7h-6h-5.5t-6 0.5t-5 1.5t-5 2t-4 2.5t-4 4t-2.5 4.5q-12 25 5 47l146 183l-86 83zM50 800h100q21 0 35.5 -14.5t14.5 -35.5v-500q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v500 q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe128;" d="M475 1103l366 -230q2 -1 6 -3.5t14 -10.5t18 -16.5t14.5 -20t6.5 -22.5v-525q0 -13 -86 -94t-93 -81h-342q-15 0 -28.5 20t-19.5 41l-131 339h-106q-85 0 -139.5 39t-54.5 111t54 110t138 38h302l-85 121q-11 15 -10.5 34t13.5 32l110 112q22 22 53 6zM370 945l146 -183 q17 -22 5 -47q-2 -2 -3.5 -4.5t-4 -4t-4 -2.5t-5 -2t-5 -1.5t-6 -0.5h-6h-6.5h-6h-475v-100h221q15 0 29 -20t20 -41l130 -339h294l106 89v503l-342 236zM1050 800h100q21 0 35.5 -14.5t14.5 -35.5v-500q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5 v500q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe129;" d="M550 1294q72 0 111 -55t39 -139v-106l339 -131q21 -6 41 -19.5t20 -28.5v-342q0 -7 -81 -90t-94 -83h-525q-17 0 -35.5 14t-28.5 28l-9 14l-230 363q-16 31 6 53l112 110q13 13 32 13.5t34 -11.5l121 -84v302q0 84 38 138t110 54zM600 972v203q0 21 -25 30.5t-50 0.5 t-25 -31v-456v-7v-6v-5.5t-0.5 -6t-1.5 -5t-2 -5t-2.5 -4t-4 -4t-4.5 -2.5q-25 -12 -47 5l-183 146l-83 -86l236 -339h503l89 100v293l-339 131q-21 6 -41 19.5t-20 28.5zM450 200h500q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-500 q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe130;" d="M350 1100h500q21 0 35.5 14.5t14.5 35.5v100q0 21 -14.5 35.5t-35.5 14.5h-500q-21 0 -35.5 -14.5t-14.5 -35.5v-100q0 -21 14.5 -35.5t35.5 -14.5zM600 306v-106q0 -84 -39 -139t-111 -55t-110 54t-38 138v302l-121 -84q-15 -12 -34 -11.5t-32 13.5l-112 110 q-22 22 -6 53l230 363q1 2 3.5 6t10.5 13.5t16.5 17t20 13.5t22.5 6h525q13 0 94 -83t81 -90v-342q0 -15 -20 -28.5t-41 -19.5zM308 900l-236 -339l83 -86l183 146q22 17 47 5q2 -1 4.5 -2.5t4 -4t2.5 -4t2 -5t1.5 -5t0.5 -6v-5.5v-6v-7v-456q0 -22 25 -31t50 0.5t25 30.5 v203q0 15 20 28.5t41 19.5l339 131v293l-89 100h-503z" />
+<glyph unicode="&#xe131;" d="M600 1178q118 0 225 -45.5t184.5 -123t123 -184.5t45.5 -225t-45.5 -225t-123 -184.5t-184.5 -123t-225 -45.5t-225 45.5t-184.5 123t-123 184.5t-45.5 225t45.5 225t123 184.5t184.5 123t225 45.5zM914 632l-275 223q-16 13 -27.5 8t-11.5 -26v-137h-275 q-10 0 -17.5 -7.5t-7.5 -17.5v-150q0 -10 7.5 -17.5t17.5 -7.5h275v-137q0 -21 11.5 -26t27.5 8l275 223q16 13 16 32t-16 32z" />
+<glyph unicode="&#xe132;" d="M600 1178q118 0 225 -45.5t184.5 -123t123 -184.5t45.5 -225t-45.5 -225t-123 -184.5t-184.5 -123t-225 -45.5t-225 45.5t-184.5 123t-123 184.5t-45.5 225t45.5 225t123 184.5t184.5 123t225 45.5zM561 855l-275 -223q-16 -13 -16 -32t16 -32l275 -223q16 -13 27.5 -8 t11.5 26v137h275q10 0 17.5 7.5t7.5 17.5v150q0 10 -7.5 17.5t-17.5 7.5h-275v137q0 21 -11.5 26t-27.5 -8z" />
+<glyph unicode="&#xe133;" d="M600 1178q118 0 225 -45.5t184.5 -123t123 -184.5t45.5 -225t-45.5 -225t-123 -184.5t-184.5 -123t-225 -45.5t-225 45.5t-184.5 123t-123 184.5t-45.5 225t45.5 225t123 184.5t184.5 123t225 45.5zM855 639l-223 275q-13 16 -32 16t-32 -16l-223 -275q-13 -16 -8 -27.5 t26 -11.5h137v-275q0 -10 7.5 -17.5t17.5 -7.5h150q10 0 17.5 7.5t7.5 17.5v275h137q21 0 26 11.5t-8 27.5z" />
+<glyph unicode="&#xe134;" d="M600 1178q118 0 225 -45.5t184.5 -123t123 -184.5t45.5 -225t-45.5 -225t-123 -184.5t-184.5 -123t-225 -45.5t-225 45.5t-184.5 123t-123 184.5t-45.5 225t45.5 225t123 184.5t184.5 123t225 45.5zM675 900h-150q-10 0 -17.5 -7.5t-7.5 -17.5v-275h-137q-21 0 -26 -11.5 t8 -27.5l223 -275q13 -16 32 -16t32 16l223 275q13 16 8 27.5t-26 11.5h-137v275q0 10 -7.5 17.5t-17.5 7.5z" />
+<glyph unicode="&#xe135;" d="M600 1176q116 0 222.5 -46t184 -123.5t123.5 -184t46 -222.5t-46 -222.5t-123.5 -184t-184 -123.5t-222.5 -46t-222.5 46t-184 123.5t-123.5 184t-46 222.5t46 222.5t123.5 184t184 123.5t222.5 46zM627 1101q-15 -12 -36.5 -20.5t-35.5 -12t-43 -8t-39 -6.5 q-15 -3 -45.5 0t-45.5 -2q-20 -7 -51.5 -26.5t-34.5 -34.5q-3 -11 6.5 -22.5t8.5 -18.5q-3 -34 -27.5 -91t-29.5 -79q-9 -34 5 -93t8 -87q0 -9 17 -44.5t16 -59.5q12 0 23 -5t23.5 -15t19.5 -14q16 -8 33 -15t40.5 -15t34.5 -12q21 -9 52.5 -32t60 -38t57.5 -11 q7 -15 -3 -34t-22.5 -40t-9.5 -38q13 -21 23 -34.5t27.5 -27.5t36.5 -18q0 -7 -3.5 -16t-3.5 -14t5 -17q104 -2 221 112q30 29 46.5 47t34.5 49t21 63q-13 8 -37 8.5t-36 7.5q-15 7 -49.5 15t-51.5 19q-18 0 -41 -0.5t-43 -1.5t-42 -6.5t-38 -16.5q-51 -35 -66 -12 q-4 1 -3.5 25.5t0.5 25.5q-6 13 -26.5 17.5t-24.5 6.5q1 15 -0.5 30.5t-7 28t-18.5 11.5t-31 -21q-23 -25 -42 4q-19 28 -8 58q6 16 22 22q6 -1 26 -1.5t33.5 -4t19.5 -13.5q7 -12 18 -24t21.5 -20.5t20 -15t15.5 -10.5l5 -3q2 12 7.5 30.5t8 34.5t-0.5 32q-3 18 3.5 29 t18 22.5t15.5 24.5q6 14 10.5 35t8 31t15.5 22.5t34 22.5q-6 18 10 36q8 0 24 -1.5t24.5 -1.5t20 4.5t20.5 15.5q-10 23 -31 42.5t-37.5 29.5t-49 27t-43.5 23q0 1 2 8t3 11.5t1.5 10.5t-1 9.5t-4.5 4.5q31 -13 58.5 -14.5t38.5 2.5l12 5q5 28 -9.5 46t-36.5 24t-50 15 t-41 20q-18 -4 -37 0zM613 994q0 -17 8 -42t17 -45t9 -23q-8 1 -39.5 5.5t-52.5 10t-37 16.5q3 11 16 29.5t16 25.5q10 -10 19 -10t14 6t13.5 14.5t16.5 12.5z" />
+<glyph unicode="&#xe136;" d="M756 1157q164 92 306 -9l-259 -138l145 -232l251 126q6 -89 -34 -156.5t-117 -110.5q-60 -34 -127 -39.5t-126 16.5l-596 -596q-15 -16 -36.5 -16t-36.5 16l-111 110q-15 15 -15 36.5t15 37.5l600 599q-34 101 5.5 201.5t135.5 154.5z" />
+<glyph unicode="&#xe137;" horiz-adv-x="1220" d="M100 1196h1000q41 0 70.5 -29.5t29.5 -70.5v-100q0 -41 -29.5 -70.5t-70.5 -29.5h-1000q-41 0 -70.5 29.5t-29.5 70.5v100q0 41 29.5 70.5t70.5 29.5zM1100 1096h-200v-100h200v100zM100 796h1000q41 0 70.5 -29.5t29.5 -70.5v-100q0 -41 -29.5 -70.5t-70.5 -29.5h-1000 q-41 0 -70.5 29.5t-29.5 70.5v100q0 41 29.5 70.5t70.5 29.5zM1100 696h-500v-100h500v100zM100 396h1000q41 0 70.5 -29.5t29.5 -70.5v-100q0 -41 -29.5 -70.5t-70.5 -29.5h-1000q-41 0 -70.5 29.5t-29.5 70.5v100q0 41 29.5 70.5t70.5 29.5zM1100 296h-300v-100h300v100z " />
+<glyph unicode="&#xe138;" d="M150 1200h900q21 0 35.5 -14.5t14.5 -35.5t-14.5 -35.5t-35.5 -14.5h-900q-21 0 -35.5 14.5t-14.5 35.5t14.5 35.5t35.5 14.5zM700 500v-300l-200 -200v500l-350 500h900z" />
+<glyph unicode="&#xe139;" d="M500 1200h200q41 0 70.5 -29.5t29.5 -70.5v-100h300q41 0 70.5 -29.5t29.5 -70.5v-400h-500v100h-200v-100h-500v400q0 41 29.5 70.5t70.5 29.5h300v100q0 41 29.5 70.5t70.5 29.5zM500 1100v-100h200v100h-200zM1200 400v-200q0 -41 -29.5 -70.5t-70.5 -29.5h-1000 q-41 0 -70.5 29.5t-29.5 70.5v200h1200z" />
+<glyph unicode="&#xe140;" d="M50 1200h300q21 0 25 -10.5t-10 -24.5l-94 -94l199 -199q7 -8 7 -18t-7 -18l-106 -106q-8 -7 -18 -7t-18 7l-199 199l-94 -94q-14 -14 -24.5 -10t-10.5 25v300q0 21 14.5 35.5t35.5 14.5zM850 1200h300q21 0 35.5 -14.5t14.5 -35.5v-300q0 -21 -10.5 -25t-24.5 10l-94 94 l-199 -199q-8 -7 -18 -7t-18 7l-106 106q-7 8 -7 18t7 18l199 199l-94 94q-14 14 -10 24.5t25 10.5zM364 470l106 -106q7 -8 7 -18t-7 -18l-199 -199l94 -94q14 -14 10 -24.5t-25 -10.5h-300q-21 0 -35.5 14.5t-14.5 35.5v300q0 21 10.5 25t24.5 -10l94 -94l199 199 q8 7 18 7t18 -7zM1071 271l94 94q14 14 24.5 10t10.5 -25v-300q0 -21 -14.5 -35.5t-35.5 -14.5h-300q-21 0 -25 10.5t10 24.5l94 94l-199 199q-7 8 -7 18t7 18l106 106q8 7 18 7t18 -7z" />
+<glyph unicode="&#xe141;" d="M596 1192q121 0 231.5 -47.5t190 -127t127 -190t47.5 -231.5t-47.5 -231.5t-127 -190.5t-190 -127t-231.5 -47t-231.5 47t-190.5 127t-127 190.5t-47 231.5t47 231.5t127 190t190.5 127t231.5 47.5zM596 1010q-112 0 -207.5 -55.5t-151 -151t-55.5 -207.5t55.5 -207.5 t151 -151t207.5 -55.5t207.5 55.5t151 151t55.5 207.5t-55.5 207.5t-151 151t-207.5 55.5zM454.5 905q22.5 0 38.5 -16t16 -38.5t-16 -39t-38.5 -16.5t-38.5 16.5t-16 39t16 38.5t38.5 16zM754.5 905q22.5 0 38.5 -16t16 -38.5t-16 -39t-38 -16.5q-14 0 -29 10l-55 -145 q17 -23 17 -51q0 -36 -25.5 -61.5t-61.5 -25.5t-61.5 25.5t-25.5 61.5q0 32 20.5 56.5t51.5 29.5l122 126l1 1q-9 14 -9 28q0 23 16 39t38.5 16zM345.5 709q22.5 0 38.5 -16t16 -38.5t-16 -38.5t-38.5 -16t-38.5 16t-16 38.5t16 38.5t38.5 16zM854.5 709q22.5 0 38.5 -16 t16 -38.5t-16 -38.5t-38.5 -16t-38.5 16t-16 38.5t16 38.5t38.5 16z" />
+<glyph unicode="&#xe142;" d="M546 173l469 470q91 91 99 192q7 98 -52 175.5t-154 94.5q-22 4 -47 4q-34 0 -66.5 -10t-56.5 -23t-55.5 -38t-48 -41.5t-48.5 -47.5q-376 -375 -391 -390q-30 -27 -45 -41.5t-37.5 -41t-32 -46.5t-16 -47.5t-1.5 -56.5q9 -62 53.5 -95t99.5 -33q74 0 125 51l548 548 q36 36 20 75q-7 16 -21.5 26t-32.5 10q-26 0 -50 -23q-13 -12 -39 -38l-341 -338q-15 -15 -35.5 -15.5t-34.5 13.5t-14 34.5t14 34.5q327 333 361 367q35 35 67.5 51.5t78.5 16.5q14 0 29 -1q44 -8 74.5 -35.5t43.5 -68.5q14 -47 2 -96.5t-47 -84.5q-12 -11 -32 -32 t-79.5 -81t-114.5 -115t-124.5 -123.5t-123 -119.5t-96.5 -89t-57 -45q-56 -27 -120 -27q-70 0 -129 32t-93 89q-48 78 -35 173t81 163l511 511q71 72 111 96q91 55 198 55q80 0 152 -33q78 -36 129.5 -103t66.5 -154q17 -93 -11 -183.5t-94 -156.5l-482 -476 q-15 -15 -36 -16t-37 14t-17.5 34t14.5 35z" />
+<glyph unicode="&#xe143;" d="M649 949q48 68 109.5 104t121.5 38.5t118.5 -20t102.5 -64t71 -100.5t27 -123q0 -57 -33.5 -117.5t-94 -124.5t-126.5 -127.5t-150 -152.5t-146 -174q-62 85 -145.5 174t-150 152.5t-126.5 127.5t-93.5 124.5t-33.5 117.5q0 64 28 123t73 100.5t104 64t119 20 t120.5 -38.5t104.5 -104zM896 972q-33 0 -64.5 -19t-56.5 -46t-47.5 -53.5t-43.5 -45.5t-37.5 -19t-36 19t-40 45.5t-43 53.5t-54 46t-65.5 19q-67 0 -122.5 -55.5t-55.5 -132.5q0 -23 13.5 -51t46 -65t57.5 -63t76 -75l22 -22q15 -14 44 -44t50.5 -51t46 -44t41 -35t23 -12 t23.5 12t42.5 36t46 44t52.5 52t44 43q4 4 12 13q43 41 63.5 62t52 55t46 55t26 46t11.5 44q0 79 -53 133.5t-120 54.5z" />
+<glyph unicode="&#xe144;" d="M776.5 1214q93.5 0 159.5 -66l141 -141q66 -66 66 -160q0 -42 -28 -95.5t-62 -87.5l-29 -29q-31 53 -77 99l-18 18l95 95l-247 248l-389 -389l212 -212l-105 -106l-19 18l-141 141q-66 66 -66 159t66 159l283 283q65 66 158.5 66zM600 706l105 105q10 -8 19 -17l141 -141 q66 -66 66 -159t-66 -159l-283 -283q-66 -66 -159 -66t-159 66l-141 141q-66 66 -66 159.5t66 159.5l55 55q29 -55 75 -102l18 -17l-95 -95l247 -248l389 389z" />
+<glyph unicode="&#xe145;" d="M603 1200q85 0 162 -15t127 -38t79 -48t29 -46v-953q0 -41 -29.5 -70.5t-70.5 -29.5h-600q-41 0 -70.5 29.5t-29.5 70.5v953q0 21 30 46.5t81 48t129 37.5t163 15zM300 1000v-700h600v700h-600zM600 254q-43 0 -73.5 -30.5t-30.5 -73.5t30.5 -73.5t73.5 -30.5t73.5 30.5 t30.5 73.5t-30.5 73.5t-73.5 30.5z" />
+<glyph unicode="&#xe146;" d="M902 1185l283 -282q15 -15 15 -36t-14.5 -35.5t-35.5 -14.5t-35 15l-36 35l-279 -267v-300l-212 210l-308 -307l-280 -203l203 280l307 308l-210 212h300l267 279l-35 36q-15 14 -15 35t14.5 35.5t35.5 14.5t35 -15z" />
+<glyph unicode="&#xe148;" d="M700 1248v-78q38 -5 72.5 -14.5t75.5 -31.5t71 -53.5t52 -84t24 -118.5h-159q-4 36 -10.5 59t-21 45t-40 35.5t-64.5 20.5v-307l64 -13q34 -7 64 -16.5t70 -32t67.5 -52.5t47.5 -80t20 -112q0 -139 -89 -224t-244 -97v-77h-100v79q-150 16 -237 103q-40 40 -52.5 93.5 t-15.5 139.5h139q5 -77 48.5 -126t117.5 -65v335l-27 8q-46 14 -79 26.5t-72 36t-63 52t-40 72.5t-16 98q0 70 25 126t67.5 92t94.5 57t110 27v77h100zM600 754v274q-29 -4 -50 -11t-42 -21.5t-31.5 -41.5t-10.5 -65q0 -29 7 -50.5t16.5 -34t28.5 -22.5t31.5 -14t37.5 -10 q9 -3 13 -4zM700 547v-310q22 2 42.5 6.5t45 15.5t41.5 27t29 42t12 59.5t-12.5 59.5t-38 44.5t-53 31t-66.5 24.5z" />
+<glyph unicode="&#xe149;" d="M561 1197q84 0 160.5 -40t123.5 -109.5t47 -147.5h-153q0 40 -19.5 71.5t-49.5 48.5t-59.5 26t-55.5 9q-37 0 -79 -14.5t-62 -35.5q-41 -44 -41 -101q0 -26 13.5 -63t26.5 -61t37 -66q6 -9 9 -14h241v-100h-197q8 -50 -2.5 -115t-31.5 -95q-45 -62 -99 -112 q34 10 83 17.5t71 7.5q32 1 102 -16t104 -17q83 0 136 30l50 -147q-31 -19 -58 -30.5t-55 -15.5t-42 -4.5t-46 -0.5q-23 0 -76 17t-111 32.5t-96 11.5q-39 -3 -82 -16t-67 -25l-23 -11l-55 145q4 3 16 11t15.5 10.5t13 9t15.5 12t14.5 14t17.5 18.5q48 55 54 126.5 t-30 142.5h-221v100h166q-23 47 -44 104q-7 20 -12 41.5t-6 55.5t6 66.5t29.5 70.5t58.5 71q97 88 263 88z" />
+<glyph unicode="&#xe150;" d="M400 300h150q21 0 25 -11t-10 -25l-230 -250q-14 -15 -35 -15t-35 15l-230 250q-14 14 -10 25t25 11h150v900h200v-900zM935 1184l230 -249q14 -14 10 -24.5t-25 -10.5h-150v-900h-200v900h-150q-21 0 -25 10.5t10 24.5l230 249q14 15 35 15t35 -15z" />
+<glyph unicode="&#xe151;" d="M1000 700h-100v100h-100v-100h-100v500h300v-500zM400 300h150q21 0 25 -11t-10 -25l-230 -250q-14 -15 -35 -15t-35 15l-230 250q-14 14 -10 25t25 11h150v900h200v-900zM801 1100v-200h100v200h-100zM1000 350l-200 -250h200v-100h-300v150l200 250h-200v100h300v-150z " />
+<glyph unicode="&#xe152;" d="M400 300h150q21 0 25 -11t-10 -25l-230 -250q-14 -15 -35 -15t-35 15l-230 250q-14 14 -10 25t25 11h150v900h200v-900zM1000 1050l-200 -250h200v-100h-300v150l200 250h-200v100h300v-150zM1000 0h-100v100h-100v-100h-100v500h300v-500zM801 400v-200h100v200h-100z " />
+<glyph unicode="&#xe153;" d="M400 300h150q21 0 25 -11t-10 -25l-230 -250q-14 -15 -35 -15t-35 15l-230 250q-14 14 -10 25t25 11h150v900h200v-900zM1000 700h-100v400h-100v100h200v-500zM1100 0h-100v100h-200v400h300v-500zM901 400v-200h100v200h-100z" />
+<glyph unicode="&#xe154;" d="M400 300h150q21 0 25 -11t-10 -25l-230 -250q-14 -15 -35 -15t-35 15l-230 250q-14 14 -10 25t25 11h150v900h200v-900zM1100 700h-100v100h-200v400h300v-500zM901 1100v-200h100v200h-100zM1000 0h-100v400h-100v100h200v-500z" />
+<glyph unicode="&#xe155;" d="M400 300h150q21 0 25 -11t-10 -25l-230 -250q-14 -15 -35 -15t-35 15l-230 250q-14 14 -10 25t25 11h150v900h200v-900zM900 1000h-200v200h200v-200zM1000 700h-300v200h300v-200zM1100 400h-400v200h400v-200zM1200 100h-500v200h500v-200z" />
+<glyph unicode="&#xe156;" d="M400 300h150q21 0 25 -11t-10 -25l-230 -250q-14 -15 -35 -15t-35 15l-230 250q-14 14 -10 25t25 11h150v900h200v-900zM1200 1000h-500v200h500v-200zM1100 700h-400v200h400v-200zM1000 400h-300v200h300v-200zM900 100h-200v200h200v-200z" />
+<glyph unicode="&#xe157;" d="M350 1100h400q162 0 256 -93.5t94 -256.5v-400q0 -165 -93.5 -257.5t-256.5 -92.5h-400q-165 0 -257.5 92.5t-92.5 257.5v400q0 165 92.5 257.5t257.5 92.5zM800 900h-500q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5 v500q0 41 -29.5 70.5t-70.5 29.5z" />
+<glyph unicode="&#xe158;" d="M350 1100h400q165 0 257.5 -92.5t92.5 -257.5v-400q0 -165 -92.5 -257.5t-257.5 -92.5h-400q-163 0 -256.5 92.5t-93.5 257.5v400q0 163 94 256.5t256 93.5zM800 900h-500q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5 v500q0 41 -29.5 70.5t-70.5 29.5zM440 770l253 -190q17 -12 17 -30t-17 -30l-253 -190q-16 -12 -28 -6.5t-12 26.5v400q0 21 12 26.5t28 -6.5z" />
+<glyph unicode="&#xe159;" d="M350 1100h400q163 0 256.5 -94t93.5 -256v-400q0 -165 -92.5 -257.5t-257.5 -92.5h-400q-165 0 -257.5 92.5t-92.5 257.5v400q0 163 92.5 256.5t257.5 93.5zM800 900h-500q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5 v500q0 41 -29.5 70.5t-70.5 29.5zM350 700h400q21 0 26.5 -12t-6.5 -28l-190 -253q-12 -17 -30 -17t-30 17l-190 253q-12 16 -6.5 28t26.5 12z" />
+<glyph unicode="&#xe160;" d="M350 1100h400q165 0 257.5 -92.5t92.5 -257.5v-400q0 -163 -92.5 -256.5t-257.5 -93.5h-400q-163 0 -256.5 94t-93.5 256v400q0 165 92.5 257.5t257.5 92.5zM800 900h-500q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5 v500q0 41 -29.5 70.5t-70.5 29.5zM580 693l190 -253q12 -16 6.5 -28t-26.5 -12h-400q-21 0 -26.5 12t6.5 28l190 253q12 17 30 17t30 -17z" />
+<glyph unicode="&#xe161;" d="M550 1100h400q165 0 257.5 -92.5t92.5 -257.5v-400q0 -165 -92.5 -257.5t-257.5 -92.5h-400q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5h450q41 0 70.5 29.5t29.5 70.5v500q0 41 -29.5 70.5t-70.5 29.5h-450q-21 0 -35.5 14.5t-14.5 35.5v100 q0 21 14.5 35.5t35.5 14.5zM338 867l324 -284q16 -14 16 -33t-16 -33l-324 -284q-16 -14 -27 -9t-11 26v150h-250q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5h250v150q0 21 11 26t27 -9z" />
+<glyph unicode="&#xe162;" d="M793 1182l9 -9q8 -10 5 -27q-3 -11 -79 -225.5t-78 -221.5l300 1q24 0 32.5 -17.5t-5.5 -35.5q-1 0 -133.5 -155t-267 -312.5t-138.5 -162.5q-12 -15 -26 -15h-9l-9 8q-9 11 -4 32q2 9 42 123.5t79 224.5l39 110h-302q-23 0 -31 19q-10 21 6 41q75 86 209.5 237.5 t228 257t98.5 111.5q9 16 25 16h9z" />
+<glyph unicode="&#xe163;" d="M350 1100h400q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-450q-41 0 -70.5 -29.5t-29.5 -70.5v-500q0 -41 29.5 -70.5t70.5 -29.5h450q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-165 0 -257.5 92.5t-92.5 257.5v400 q0 165 92.5 257.5t257.5 92.5zM938 867l324 -284q16 -14 16 -33t-16 -33l-324 -284q-16 -14 -27 -9t-11 26v150h-250q-21 0 -35.5 14.5t-14.5 35.5v200q0 21 14.5 35.5t35.5 14.5h250v150q0 21 11 26t27 -9z" />
+<glyph unicode="&#xe164;" d="M750 1200h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -10.5 -25t-24.5 10l-109 109l-312 -312q-15 -15 -35.5 -15t-35.5 15l-141 141q-15 15 -15 35.5t15 35.5l312 312l-109 109q-14 14 -10 24.5t25 10.5zM456 900h-156q-41 0 -70.5 -29.5t-29.5 -70.5v-500 q0 -41 29.5 -70.5t70.5 -29.5h500q41 0 70.5 29.5t29.5 70.5v148l200 200v-298q0 -165 -93.5 -257.5t-256.5 -92.5h-400q-165 0 -257.5 92.5t-92.5 257.5v400q0 165 92.5 257.5t257.5 92.5h300z" />
+<glyph unicode="&#xe165;" d="M600 1186q119 0 227.5 -46.5t187 -125t125 -187t46.5 -227.5t-46.5 -227.5t-125 -187t-187 -125t-227.5 -46.5t-227.5 46.5t-187 125t-125 187t-46.5 227.5t46.5 227.5t125 187t187 125t227.5 46.5zM600 1022q-115 0 -212 -56.5t-153.5 -153.5t-56.5 -212t56.5 -212 t153.5 -153.5t212 -56.5t212 56.5t153.5 153.5t56.5 212t-56.5 212t-153.5 153.5t-212 56.5zM600 794q80 0 137 -57t57 -137t-57 -137t-137 -57t-137 57t-57 137t57 137t137 57z" />
+<glyph unicode="&#xe166;" d="M450 1200h200q21 0 35.5 -14.5t14.5 -35.5v-350h245q20 0 25 -11t-9 -26l-383 -426q-14 -15 -33.5 -15t-32.5 15l-379 426q-13 15 -8.5 26t25.5 11h250v350q0 21 14.5 35.5t35.5 14.5zM50 300h1000q21 0 35.5 -14.5t14.5 -35.5v-250h-1100v250q0 21 14.5 35.5t35.5 14.5z M900 200v-50h100v50h-100z" />
+<glyph unicode="&#xe167;" d="M583 1182l378 -435q14 -15 9 -31t-26 -16h-244v-250q0 -20 -17 -35t-39 -15h-200q-20 0 -32 14.5t-12 35.5v250h-250q-20 0 -25.5 16.5t8.5 31.5l383 431q14 16 33.5 17t33.5 -14zM50 300h1000q21 0 35.5 -14.5t14.5 -35.5v-250h-1100v250q0 21 14.5 35.5t35.5 14.5z M900 200v-50h100v50h-100z" />
+<glyph unicode="&#xe168;" d="M396 723l369 369q7 7 17.5 7t17.5 -7l139 -139q7 -8 7 -18.5t-7 -17.5l-525 -525q-7 -8 -17.5 -8t-17.5 8l-292 291q-7 8 -7 18t7 18l139 139q8 7 18.5 7t17.5 -7zM50 300h1000q21 0 35.5 -14.5t14.5 -35.5v-250h-1100v250q0 21 14.5 35.5t35.5 14.5zM900 200v-50h100v50 h-100z" />
+<glyph unicode="&#xe169;" d="M135 1023l142 142q14 14 35 14t35 -14l77 -77l-212 -212l-77 76q-14 15 -14 36t14 35zM655 855l210 210q14 14 24.5 10t10.5 -25l-2 -599q-1 -20 -15.5 -35t-35.5 -15l-597 -1q-21 0 -25 10.5t10 24.5l208 208l-154 155l212 212zM50 300h1000q21 0 35.5 -14.5t14.5 -35.5 v-250h-1100v250q0 21 14.5 35.5t35.5 14.5zM900 200v-50h100v50h-100z" />
+<glyph unicode="&#xe170;" d="M350 1200l599 -2q20 -1 35 -15.5t15 -35.5l1 -597q0 -21 -10.5 -25t-24.5 10l-208 208l-155 -154l-212 212l155 154l-210 210q-14 14 -10 24.5t25 10.5zM524 512l-76 -77q-15 -14 -36 -14t-35 14l-142 142q-14 14 -14 35t14 35l77 77zM50 300h1000q21 0 35.5 -14.5 t14.5 -35.5v-250h-1100v250q0 21 14.5 35.5t35.5 14.5zM900 200v-50h100v50h-100z" />
+<glyph unicode="&#xe171;" d="M1200 103l-483 276l-314 -399v423h-399l1196 796v-1096zM483 424v-230l683 953z" />
+<glyph unicode="&#xe172;" d="M1100 1000v-850q0 -21 -14.5 -35.5t-35.5 -14.5h-150v400h-700v-400h-150q-21 0 -35.5 14.5t-14.5 35.5v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100zM700 1000h-100v200h100v-200z" />
+<glyph unicode="&#xe173;" d="M1100 1000l-2 -149l-299 -299l-95 95q-9 9 -21.5 9t-21.5 -9l-149 -147h-312v-400h-150q-21 0 -35.5 14.5t-14.5 35.5v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100zM700 1000h-100v200h100v-200zM1132 638l106 -106q7 -7 7 -17.5t-7 -17.5l-420 -421q-8 -7 -18 -7 t-18 7l-202 203q-8 7 -8 17.5t8 17.5l106 106q7 8 17.5 8t17.5 -8l79 -79l297 297q7 7 17.5 7t17.5 -7z" />
+<glyph unicode="&#xe174;" d="M1100 1000v-269l-103 -103l-134 134q-15 15 -33.5 16.5t-34.5 -12.5l-266 -266h-329v-400h-150q-21 0 -35.5 14.5t-14.5 35.5v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100zM700 1000h-100v200h100v-200zM1202 572l70 -70q15 -15 15 -35.5t-15 -35.5l-131 -131 l131 -131q15 -15 15 -35.5t-15 -35.5l-70 -70q-15 -15 -35.5 -15t-35.5 15l-131 131l-131 -131q-15 -15 -35.5 -15t-35.5 15l-70 70q-15 15 -15 35.5t15 35.5l131 131l-131 131q-15 15 -15 35.5t15 35.5l70 70q15 15 35.5 15t35.5 -15l131 -131l131 131q15 15 35.5 15 t35.5 -15z" />
+<glyph unicode="&#xe175;" d="M1100 1000v-300h-350q-21 0 -35.5 -14.5t-14.5 -35.5v-150h-500v-400h-150q-21 0 -35.5 14.5t-14.5 35.5v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100zM700 1000h-100v200h100v-200zM850 600h100q21 0 35.5 -14.5t14.5 -35.5v-250h150q21 0 25 -10.5t-10 -24.5 l-230 -230q-14 -14 -35 -14t-35 14l-230 230q-14 14 -10 24.5t25 10.5h150v250q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe176;" d="M1100 1000v-400l-165 165q-14 15 -35 15t-35 -15l-263 -265h-402v-400h-150q-21 0 -35.5 14.5t-14.5 35.5v1000q0 20 14.5 35t35.5 15h250v-300h500v300h100zM700 1000h-100v200h100v-200zM935 565l230 -229q14 -15 10 -25.5t-25 -10.5h-150v-250q0 -20 -14.5 -35 t-35.5 -15h-100q-21 0 -35.5 15t-14.5 35v250h-150q-21 0 -25 10.5t10 25.5l230 229q14 15 35 15t35 -15z" />
+<glyph unicode="&#xe177;" d="M50 1100h1100q21 0 35.5 -14.5t14.5 -35.5v-150h-1200v150q0 21 14.5 35.5t35.5 14.5zM1200 800v-550q0 -21 -14.5 -35.5t-35.5 -14.5h-1100q-21 0 -35.5 14.5t-14.5 35.5v550h1200zM100 500v-200h400v200h-400z" />
+<glyph unicode="&#xe178;" d="M935 1165l248 -230q14 -14 14 -35t-14 -35l-248 -230q-14 -14 -24.5 -10t-10.5 25v150h-400v200h400v150q0 21 10.5 25t24.5 -10zM200 800h-50q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5h50v-200zM400 800h-100v200h100v-200zM18 435l247 230 q14 14 24.5 10t10.5 -25v-150h400v-200h-400v-150q0 -21 -10.5 -25t-24.5 10l-247 230q-15 14 -15 35t15 35zM900 300h-100v200h100v-200zM1000 500h51q20 0 34.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-34.5 -14.5h-51v200z" />
+<glyph unicode="&#xe179;" d="M862 1073l276 116q25 18 43.5 8t18.5 -41v-1106q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v397q-4 1 -11 5t-24 17.5t-30 29t-24 42t-11 56.5v359q0 31 18.5 65t43.5 52zM550 1200q22 0 34.5 -12.5t14.5 -24.5l1 -13v-450q0 -28 -10.5 -59.5 t-25 -56t-29 -45t-25.5 -31.5l-10 -11v-447q0 -21 -14.5 -35.5t-35.5 -14.5h-200q-21 0 -35.5 14.5t-14.5 35.5v447q-4 4 -11 11.5t-24 30.5t-30 46t-24 55t-11 60v450q0 2 0.5 5.5t4 12t8.5 15t14.5 12t22.5 5.5q20 0 32.5 -12.5t14.5 -24.5l3 -13v-350h100v350v5.5t2.5 12 t7 15t15 12t25.5 5.5q23 0 35.5 -12.5t13.5 -24.5l1 -13v-350h100v350q0 2 0.5 5.5t3 12t7 15t15 12t24.5 5.5z" />
+<glyph unicode="&#xe180;" d="M1200 1100v-56q-4 0 -11 -0.5t-24 -3t-30 -7.5t-24 -15t-11 -24v-888q0 -22 25 -34.5t50 -13.5l25 -2v-56h-400v56q75 0 87.5 6.5t12.5 43.5v394h-500v-394q0 -37 12.5 -43.5t87.5 -6.5v-56h-400v56q4 0 11 0.5t24 3t30 7.5t24 15t11 24v888q0 22 -25 34.5t-50 13.5 l-25 2v56h400v-56q-75 0 -87.5 -6.5t-12.5 -43.5v-394h500v394q0 37 -12.5 43.5t-87.5 6.5v56h400z" />
+<glyph unicode="&#xe181;" d="M675 1000h375q21 0 35.5 -14.5t14.5 -35.5v-150h-105l-295 -98v98l-200 200h-400l100 100h375zM100 900h300q41 0 70.5 -29.5t29.5 -70.5v-500q0 -41 -29.5 -70.5t-70.5 -29.5h-300q-41 0 -70.5 29.5t-29.5 70.5v500q0 41 29.5 70.5t70.5 29.5zM100 800v-200h300v200 h-300zM1100 535l-400 -133v163l400 133v-163zM100 500v-200h300v200h-300zM1100 398v-248q0 -21 -14.5 -35.5t-35.5 -14.5h-375l-100 -100h-375l-100 100h400l200 200h105z" />
+<glyph unicode="&#xe182;" d="M17 1007l162 162q17 17 40 14t37 -22l139 -194q14 -20 11 -44.5t-20 -41.5l-119 -118q102 -142 228 -268t267 -227l119 118q17 17 42.5 19t44.5 -12l192 -136q19 -14 22.5 -37.5t-13.5 -40.5l-163 -162q-3 -1 -9.5 -1t-29.5 2t-47.5 6t-62.5 14.5t-77.5 26.5t-90 42.5 t-101.5 60t-111 83t-119 108.5q-74 74 -133.5 150.5t-94.5 138.5t-60 119.5t-34.5 100t-15 74.5t-4.5 48z" />
+<glyph unicode="&#xe183;" d="M600 1100q92 0 175 -10.5t141.5 -27t108.5 -36.5t81.5 -40t53.5 -37t31 -27l9 -10v-200q0 -21 -14.5 -33t-34.5 -9l-202 34q-20 3 -34.5 20t-14.5 38v146q-141 24 -300 24t-300 -24v-146q0 -21 -14.5 -38t-34.5 -20l-202 -34q-20 -3 -34.5 9t-14.5 33v200q3 4 9.5 10.5 t31 26t54 37.5t80.5 39.5t109 37.5t141 26.5t175 10.5zM600 795q56 0 97 -9.5t60 -23.5t30 -28t12 -24l1 -10v-50l365 -303q14 -15 24.5 -40t10.5 -45v-212q0 -21 -14.5 -35.5t-35.5 -14.5h-1100q-21 0 -35.5 14.5t-14.5 35.5v212q0 20 10.5 45t24.5 40l365 303v50 q0 4 1 10.5t12 23t30 29t60 22.5t97 10z" />
+<glyph unicode="&#xe184;" d="M1100 700l-200 -200h-600l-200 200v500h200v-200h200v200h200v-200h200v200h200v-500zM250 400h700q21 0 35.5 -14.5t14.5 -35.5t-14.5 -35.5t-35.5 -14.5h-12l137 -100h-950l137 100h-12q-21 0 -35.5 14.5t-14.5 35.5t14.5 35.5t35.5 14.5zM50 100h1100q21 0 35.5 -14.5 t14.5 -35.5v-50h-1200v50q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe185;" d="M700 1100h-100q-41 0 -70.5 -29.5t-29.5 -70.5v-1000h300v1000q0 41 -29.5 70.5t-70.5 29.5zM1100 800h-100q-41 0 -70.5 -29.5t-29.5 -70.5v-700h300v700q0 41 -29.5 70.5t-70.5 29.5zM400 0h-300v400q0 41 29.5 70.5t70.5 29.5h100q41 0 70.5 -29.5t29.5 -70.5v-400z " />
+<glyph unicode="&#xe186;" d="M200 1100h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212v500q0 124 88 212t212 88zM100 900v-700h900v700h-900zM500 700h-200v-100h200v-300h-300v100h200v100h-200v300h300v-100zM900 700v-300l-100 -100h-200v500h200z M700 700v-300h100v300h-100z" />
+<glyph unicode="&#xe187;" d="M200 1100h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212v500q0 124 88 212t212 88zM100 900v-700h900v700h-900zM500 300h-100v200h-100v-200h-100v500h100v-200h100v200h100v-500zM900 700v-300l-100 -100h-200v500h200z M700 700v-300h100v300h-100z" />
+<glyph unicode="&#xe188;" d="M200 1100h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212v500q0 124 88 212t212 88zM100 900v-700h900v700h-900zM500 700h-200v-300h200v-100h-300v500h300v-100zM900 700h-200v-300h200v-100h-300v500h300v-100z" />
+<glyph unicode="&#xe189;" d="M200 1100h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212v500q0 124 88 212t212 88zM100 900v-700h900v700h-900zM500 400l-300 150l300 150v-300zM900 550l-300 -150v300z" />
+<glyph unicode="&#xe190;" d="M200 1100h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212v500q0 124 88 212t212 88zM100 900v-700h900v700h-900zM900 300h-700v500h700v-500zM800 700h-130q-38 0 -66.5 -43t-28.5 -108t27 -107t68 -42h130v300zM300 700v-300 h130q41 0 68 42t27 107t-28.5 108t-66.5 43h-130z" />
+<glyph unicode="&#xe191;" d="M200 1100h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212v500q0 124 88 212t212 88zM100 900v-700h900v700h-900zM500 700h-200v-100h200v-300h-300v100h200v100h-200v300h300v-100zM900 300h-100v400h-100v100h200v-500z M700 300h-100v100h100v-100z" />
+<glyph unicode="&#xe192;" d="M200 1100h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212v500q0 124 88 212t212 88zM100 900v-700h900v700h-900zM300 700h200v-400h-300v500h100v-100zM900 300h-100v400h-100v100h200v-500zM300 600v-200h100v200h-100z M700 300h-100v100h100v-100z" />
+<glyph unicode="&#xe193;" d="M200 1100h700q124 0 212 -88t88 -212v-500q0 -124 -88 -212t-212 -88h-700q-124 0 -212 88t-88 212v500q0 124 88 212t212 88zM100 900v-700h900v700h-900zM500 500l-199 -200h-100v50l199 200v150h-200v100h300v-300zM900 300h-100v400h-100v100h200v-500zM701 300h-100 v100h100v-100z" />
+<glyph unicode="&#xe194;" d="M600 1191q120 0 229.5 -47t188.5 -126t126 -188.5t47 -229.5t-47 -229.5t-126 -188.5t-188.5 -126t-229.5 -47t-229.5 47t-188.5 126t-126 188.5t-47 229.5t47 229.5t126 188.5t188.5 126t229.5 47zM600 1021q-114 0 -211 -56.5t-153.5 -153.5t-56.5 -211t56.5 -211 t153.5 -153.5t211 -56.5t211 56.5t153.5 153.5t56.5 211t-56.5 211t-153.5 153.5t-211 56.5zM800 700h-300v-200h300v-100h-300l-100 100v200l100 100h300v-100z" />
+<glyph unicode="&#xe195;" d="M600 1191q120 0 229.5 -47t188.5 -126t126 -188.5t47 -229.5t-47 -229.5t-126 -188.5t-188.5 -126t-229.5 -47t-229.5 47t-188.5 126t-126 188.5t-47 229.5t47 229.5t126 188.5t188.5 126t229.5 47zM600 1021q-114 0 -211 -56.5t-153.5 -153.5t-56.5 -211t56.5 -211 t153.5 -153.5t211 -56.5t211 56.5t153.5 153.5t56.5 211t-56.5 211t-153.5 153.5t-211 56.5zM800 700v-100l-50 -50l100 -100v-50h-100l-100 100h-150v-100h-100v400h300zM500 700v-100h200v100h-200z" />
+<glyph unicode="&#xe197;" d="M503 1089q110 0 200.5 -59.5t134.5 -156.5q44 14 90 14q120 0 205 -86.5t85 -207t-85 -207t-205 -86.5h-128v250q0 21 -14.5 35.5t-35.5 14.5h-300q-21 0 -35.5 -14.5t-14.5 -35.5v-250h-222q-80 0 -136 57.5t-56 136.5q0 69 43 122.5t108 67.5q-2 19 -2 37q0 100 49 185 t134 134t185 49zM525 500h150q10 0 17.5 -7.5t7.5 -17.5v-275h137q21 0 26 -11.5t-8 -27.5l-223 -244q-13 -16 -32 -16t-32 16l-223 244q-13 16 -8 27.5t26 11.5h137v275q0 10 7.5 17.5t17.5 7.5z" />
+<glyph unicode="&#xe198;" d="M502 1089q110 0 201 -59.5t135 -156.5q43 15 89 15q121 0 206 -86.5t86 -206.5q0 -99 -60 -181t-150 -110l-378 360q-13 16 -31.5 16t-31.5 -16l-381 -365h-9q-79 0 -135.5 57.5t-56.5 136.5q0 69 43 122.5t108 67.5q-2 19 -2 38q0 100 49 184.5t133.5 134t184.5 49.5z M632 467l223 -228q13 -16 8 -27.5t-26 -11.5h-137v-275q0 -10 -7.5 -17.5t-17.5 -7.5h-150q-10 0 -17.5 7.5t-7.5 17.5v275h-137q-21 0 -26 11.5t8 27.5q199 204 223 228q19 19 31.5 19t32.5 -19z" />
+<glyph unicode="&#xe199;" d="M700 100v100h400l-270 300h170l-270 300h170l-300 333l-300 -333h170l-270 -300h170l-270 -300h400v-100h-50q-21 0 -35.5 -14.5t-14.5 -35.5v-50h400v50q0 21 -14.5 35.5t-35.5 14.5h-50z" />
+<glyph unicode="&#xe200;" d="M600 1179q94 0 167.5 -56.5t99.5 -145.5q89 -6 150.5 -71.5t61.5 -155.5q0 -61 -29.5 -112.5t-79.5 -82.5q9 -29 9 -55q0 -74 -52.5 -126.5t-126.5 -52.5q-55 0 -100 30v-251q21 0 35.5 -14.5t14.5 -35.5v-50h-300v50q0 21 14.5 35.5t35.5 14.5v251q-45 -30 -100 -30 q-74 0 -126.5 52.5t-52.5 126.5q0 18 4 38q-47 21 -75.5 65t-28.5 97q0 74 52.5 126.5t126.5 52.5q5 0 23 -2q0 2 -1 10t-1 13q0 116 81.5 197.5t197.5 81.5z" />
+<glyph unicode="&#xe201;" d="M1010 1010q111 -111 150.5 -260.5t0 -299t-150.5 -260.5q-83 -83 -191.5 -126.5t-218.5 -43.5t-218.5 43.5t-191.5 126.5q-111 111 -150.5 260.5t0 299t150.5 260.5q83 83 191.5 126.5t218.5 43.5t218.5 -43.5t191.5 -126.5zM476 1065q-4 0 -8 -1q-121 -34 -209.5 -122.5 t-122.5 -209.5q-4 -12 2.5 -23t18.5 -14l36 -9q3 -1 7 -1q23 0 29 22q27 96 98 166q70 71 166 98q11 3 17.5 13.5t3.5 22.5l-9 35q-3 13 -14 19q-7 4 -15 4zM512 920q-4 0 -9 -2q-80 -24 -138.5 -82.5t-82.5 -138.5q-4 -13 2 -24t19 -14l34 -9q4 -1 8 -1q22 0 28 21 q18 58 58.5 98.5t97.5 58.5q12 3 18 13.5t3 21.5l-9 35q-3 12 -14 19q-7 4 -15 4zM719.5 719.5q-49.5 49.5 -119.5 49.5t-119.5 -49.5t-49.5 -119.5t49.5 -119.5t119.5 -49.5t119.5 49.5t49.5 119.5t-49.5 119.5zM855 551q-22 0 -28 -21q-18 -58 -58.5 -98.5t-98.5 -57.5 q-11 -4 -17 -14.5t-3 -21.5l9 -35q3 -12 14 -19q7 -4 15 -4q4 0 9 2q80 24 138.5 82.5t82.5 138.5q4 13 -2.5 24t-18.5 14l-34 9q-4 1 -8 1zM1000 515q-23 0 -29 -22q-27 -96 -98 -166q-70 -71 -166 -98q-11 -3 -17.5 -13.5t-3.5 -22.5l9 -35q3 -13 14 -19q7 -4 15 -4 q4 0 8 1q121 34 209.5 122.5t122.5 209.5q4 12 -2.5 23t-18.5 14l-36 9q-3 1 -7 1z" />
+<glyph unicode="&#xe202;" d="M700 800h300v-380h-180v200h-340v-200h-380v755q0 10 7.5 17.5t17.5 7.5h575v-400zM1000 900h-200v200zM700 300h162l-212 -212l-212 212h162v200h100v-200zM520 0h-395q-10 0 -17.5 7.5t-7.5 17.5v395zM1000 220v-195q0 -10 -7.5 -17.5t-17.5 -7.5h-195z" />
+<glyph unicode="&#xe203;" d="M700 800h300v-520l-350 350l-550 -550v1095q0 10 7.5 17.5t17.5 7.5h575v-400zM1000 900h-200v200zM862 200h-162v-200h-100v200h-162l212 212zM480 0h-355q-10 0 -17.5 7.5t-7.5 17.5v55h380v-80zM1000 80v-55q0 -10 -7.5 -17.5t-17.5 -7.5h-155v80h180z" />
+<glyph unicode="&#xe204;" d="M1162 800h-162v-200h100l100 -100h-300v300h-162l212 212zM200 800h200q27 0 40 -2t29.5 -10.5t23.5 -30t7 -57.5h300v-100h-600l-200 -350v450h100q0 36 7 57.5t23.5 30t29.5 10.5t40 2zM800 400h240l-240 -400h-800l300 500h500v-100z" />
+<glyph unicode="&#xe205;" d="M650 1100h100q21 0 35.5 -14.5t14.5 -35.5v-50h50q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-300q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5h50v50q0 21 14.5 35.5t35.5 14.5zM1000 850v150q41 0 70.5 -29.5t29.5 -70.5v-800 q0 -41 -29.5 -70.5t-70.5 -29.5h-600q-1 0 -20 4l246 246l-326 326v324q0 41 29.5 70.5t70.5 29.5v-150q0 -62 44 -106t106 -44h300q62 0 106 44t44 106zM412 250l-212 -212v162h-200v100h200v162z" />
+<glyph unicode="&#xe206;" d="M450 1100h100q21 0 35.5 -14.5t14.5 -35.5v-50h50q21 0 35.5 -14.5t14.5 -35.5v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-300q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5h50v50q0 21 14.5 35.5t35.5 14.5zM800 850v150q41 0 70.5 -29.5t29.5 -70.5v-500 h-200v-300h200q0 -36 -7 -57.5t-23.5 -30t-29.5 -10.5t-40 -2h-600q-41 0 -70.5 29.5t-29.5 70.5v800q0 41 29.5 70.5t70.5 29.5v-150q0 -62 44 -106t106 -44h300q62 0 106 44t44 106zM1212 250l-212 -212v162h-200v100h200v162z" />
+<glyph unicode="&#xe209;" d="M658 1197l637 -1104q23 -38 7 -65.5t-60 -27.5h-1276q-44 0 -60 27.5t7 65.5l637 1104q22 39 54 39t54 -39zM704 800h-208q-20 0 -32 -14.5t-8 -34.5l58 -302q4 -20 21.5 -34.5t37.5 -14.5h54q20 0 37.5 14.5t21.5 34.5l58 302q4 20 -8 34.5t-32 14.5zM500 300v-100h200 v100h-200z" />
+<glyph unicode="&#xe210;" d="M425 1100h250q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5zM425 800h250q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5 t17.5 7.5zM825 800h250q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5zM25 500h250q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5t-7.5 17.5v150 q0 10 7.5 17.5t17.5 7.5zM425 500h250q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5zM825 500h250q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5t-7.5 17.5 v150q0 10 7.5 17.5t17.5 7.5zM25 200h250q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5zM425 200h250q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5 t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5zM825 200h250q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-250q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5z" />
+<glyph unicode="&#xe211;" d="M700 1200h100v-200h-100v-100h350q62 0 86.5 -39.5t-3.5 -94.5l-66 -132q-41 -83 -81 -134h-772q-40 51 -81 134l-66 132q-28 55 -3.5 94.5t86.5 39.5h350v100h-100v200h100v100h200v-100zM250 400h700q21 0 35.5 -14.5t14.5 -35.5t-14.5 -35.5t-35.5 -14.5h-12l137 -100 h-950l138 100h-13q-21 0 -35.5 14.5t-14.5 35.5t14.5 35.5t35.5 14.5zM50 100h1100q21 0 35.5 -14.5t14.5 -35.5v-50h-1200v50q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe212;" d="M600 1300q40 0 68.5 -29.5t28.5 -70.5h-194q0 41 28.5 70.5t68.5 29.5zM443 1100h314q18 -37 18 -75q0 -8 -3 -25h328q41 0 44.5 -16.5t-30.5 -38.5l-175 -145h-678l-178 145q-34 22 -29 38.5t46 16.5h328q-3 17 -3 25q0 38 18 75zM250 700h700q21 0 35.5 -14.5 t14.5 -35.5t-14.5 -35.5t-35.5 -14.5h-150v-200l275 -200h-950l275 200v200h-150q-21 0 -35.5 14.5t-14.5 35.5t14.5 35.5t35.5 14.5zM50 100h1100q21 0 35.5 -14.5t14.5 -35.5v-50h-1200v50q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe213;" d="M600 1181q75 0 128 -53t53 -128t-53 -128t-128 -53t-128 53t-53 128t53 128t128 53zM602 798h46q34 0 55.5 -28.5t21.5 -86.5q0 -76 39 -183h-324q39 107 39 183q0 58 21.5 86.5t56.5 28.5h45zM250 400h700q21 0 35.5 -14.5t14.5 -35.5t-14.5 -35.5t-35.5 -14.5h-13 l138 -100h-950l137 100h-12q-21 0 -35.5 14.5t-14.5 35.5t14.5 35.5t35.5 14.5zM50 100h1100q21 0 35.5 -14.5t14.5 -35.5v-50h-1200v50q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe214;" d="M600 1300q47 0 92.5 -53.5t71 -123t25.5 -123.5q0 -78 -55.5 -133.5t-133.5 -55.5t-133.5 55.5t-55.5 133.5q0 62 34 143l144 -143l111 111l-163 163q34 26 63 26zM602 798h46q34 0 55.5 -28.5t21.5 -86.5q0 -76 39 -183h-324q39 107 39 183q0 58 21.5 86.5t56.5 28.5h45 zM250 400h700q21 0 35.5 -14.5t14.5 -35.5t-14.5 -35.5t-35.5 -14.5h-13l138 -100h-950l137 100h-12q-21 0 -35.5 14.5t-14.5 35.5t14.5 35.5t35.5 14.5zM50 100h1100q21 0 35.5 -14.5t14.5 -35.5v-50h-1200v50q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe215;" d="M600 1200l300 -161v-139h-300q0 -57 18.5 -108t50 -91.5t63 -72t70 -67.5t57.5 -61h-530q-60 83 -90.5 177.5t-30.5 178.5t33 164.5t87.5 139.5t126 96.5t145.5 41.5v-98zM250 400h700q21 0 35.5 -14.5t14.5 -35.5t-14.5 -35.5t-35.5 -14.5h-13l138 -100h-950l137 100 h-12q-21 0 -35.5 14.5t-14.5 35.5t14.5 35.5t35.5 14.5zM50 100h1100q21 0 35.5 -14.5t14.5 -35.5v-50h-1200v50q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe216;" d="M600 1300q41 0 70.5 -29.5t29.5 -70.5v-78q46 -26 73 -72t27 -100v-50h-400v50q0 54 27 100t73 72v78q0 41 29.5 70.5t70.5 29.5zM400 800h400q54 0 100 -27t72 -73h-172v-100h200v-100h-200v-100h200v-100h-200v-100h200q0 -83 -58.5 -141.5t-141.5 -58.5h-400 q-83 0 -141.5 58.5t-58.5 141.5v400q0 83 58.5 141.5t141.5 58.5z" />
+<glyph unicode="&#xe218;" d="M150 1100h900q21 0 35.5 -14.5t14.5 -35.5v-500q0 -21 -14.5 -35.5t-35.5 -14.5h-900q-21 0 -35.5 14.5t-14.5 35.5v500q0 21 14.5 35.5t35.5 14.5zM125 400h950q10 0 17.5 -7.5t7.5 -17.5v-50q0 -10 -7.5 -17.5t-17.5 -7.5h-283l224 -224q13 -13 13 -31.5t-13 -32 t-31.5 -13.5t-31.5 13l-88 88h-524l-87 -88q-13 -13 -32 -13t-32 13.5t-13 32t13 31.5l224 224h-289q-10 0 -17.5 7.5t-7.5 17.5v50q0 10 7.5 17.5t17.5 7.5zM541 300l-100 -100h324l-100 100h-124z" />
+<glyph unicode="&#xe219;" d="M200 1100h800q83 0 141.5 -58.5t58.5 -141.5v-200h-100q0 41 -29.5 70.5t-70.5 29.5h-250q-41 0 -70.5 -29.5t-29.5 -70.5h-100q0 41 -29.5 70.5t-70.5 29.5h-250q-41 0 -70.5 -29.5t-29.5 -70.5h-100v200q0 83 58.5 141.5t141.5 58.5zM100 600h1000q41 0 70.5 -29.5 t29.5 -70.5v-300h-1200v300q0 41 29.5 70.5t70.5 29.5zM300 100v-50q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v50h200zM1100 100v-50q0 -21 -14.5 -35.5t-35.5 -14.5h-100q-21 0 -35.5 14.5t-14.5 35.5v50h200z" />
+<glyph unicode="&#xe221;" d="M480 1165l682 -683q31 -31 31 -75.5t-31 -75.5l-131 -131h-481l-517 518q-32 31 -32 75.5t32 75.5l295 296q31 31 75.5 31t76.5 -31zM108 794l342 -342l303 304l-341 341zM250 100h800q21 0 35.5 -14.5t14.5 -35.5v-50h-900v50q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe223;" d="M1057 647l-189 506q-8 19 -27.5 33t-40.5 14h-400q-21 0 -40.5 -14t-27.5 -33l-189 -506q-8 -19 1.5 -33t30.5 -14h625v-150q0 -21 14.5 -35.5t35.5 -14.5t35.5 14.5t14.5 35.5v150h125q21 0 30.5 14t1.5 33zM897 0h-595v50q0 21 14.5 35.5t35.5 14.5h50v50 q0 21 14.5 35.5t35.5 14.5h48v300h200v-300h47q21 0 35.5 -14.5t14.5 -35.5v-50h50q21 0 35.5 -14.5t14.5 -35.5v-50z" />
+<glyph unicode="&#xe224;" d="M900 800h300v-575q0 -10 -7.5 -17.5t-17.5 -7.5h-375v591l-300 300v84q0 10 7.5 17.5t17.5 7.5h375v-400zM1200 900h-200v200zM400 600h300v-575q0 -10 -7.5 -17.5t-17.5 -7.5h-650q-10 0 -17.5 7.5t-7.5 17.5v950q0 10 7.5 17.5t17.5 7.5h375v-400zM700 700h-200v200z " />
+<glyph unicode="&#xe225;" d="M484 1095h195q75 0 146 -32.5t124 -86t89.5 -122.5t48.5 -142q18 -14 35 -20q31 -10 64.5 6.5t43.5 48.5q10 34 -15 71q-19 27 -9 43q5 8 12.5 11t19 -1t23.5 -16q41 -44 39 -105q-3 -63 -46 -106.5t-104 -43.5h-62q-7 -55 -35 -117t-56 -100l-39 -234q-3 -20 -20 -34.5 t-38 -14.5h-100q-21 0 -33 14.5t-9 34.5l12 70q-49 -14 -91 -14h-195q-24 0 -65 8l-11 -64q-3 -20 -20 -34.5t-38 -14.5h-100q-21 0 -33 14.5t-9 34.5l26 157q-84 74 -128 175l-159 53q-19 7 -33 26t-14 40v50q0 21 14.5 35.5t35.5 14.5h124q11 87 56 166l-111 95 q-16 14 -12.5 23.5t24.5 9.5h203q116 101 250 101zM675 1000h-250q-10 0 -17.5 -7.5t-7.5 -17.5v-50q0 -10 7.5 -17.5t17.5 -7.5h250q10 0 17.5 7.5t7.5 17.5v50q0 10 -7.5 17.5t-17.5 7.5z" />
+<glyph unicode="&#xe226;" d="M641 900l423 247q19 8 42 2.5t37 -21.5l32 -38q14 -15 12.5 -36t-17.5 -34l-139 -120h-390zM50 1100h106q67 0 103 -17t66 -71l102 -212h823q21 0 35.5 -14.5t14.5 -35.5v-50q0 -21 -14 -40t-33 -26l-737 -132q-23 -4 -40 6t-26 25q-42 67 -100 67h-300q-62 0 -106 44 t-44 106v200q0 62 44 106t106 44zM173 928h-80q-19 0 -28 -14t-9 -35v-56q0 -51 42 -51h134q16 0 21.5 8t5.5 24q0 11 -16 45t-27 51q-18 28 -43 28zM550 727q-32 0 -54.5 -22.5t-22.5 -54.5t22.5 -54.5t54.5 -22.5t54.5 22.5t22.5 54.5t-22.5 54.5t-54.5 22.5zM130 389 l152 130q18 19 34 24t31 -3.5t24.5 -17.5t25.5 -28q28 -35 50.5 -51t48.5 -13l63 5l48 -179q13 -61 -3.5 -97.5t-67.5 -79.5l-80 -69q-47 -40 -109 -35.5t-103 51.5l-130 151q-40 47 -35.5 109.5t51.5 102.5zM380 377l-102 -88q-31 -27 2 -65l37 -43q13 -15 27.5 -19.5 t31.5 6.5l61 53q19 16 14 49q-2 20 -12 56t-17 45q-11 12 -19 14t-23 -8z" />
+<glyph unicode="&#xe227;" d="M625 1200h150q10 0 17.5 -7.5t7.5 -17.5v-109q79 -33 131 -87.5t53 -128.5q1 -46 -15 -84.5t-39 -61t-46 -38t-39 -21.5l-17 -6q6 0 15 -1.5t35 -9t50 -17.5t53 -30t50 -45t35.5 -64t14.5 -84q0 -59 -11.5 -105.5t-28.5 -76.5t-44 -51t-49.5 -31.5t-54.5 -16t-49.5 -6.5 t-43.5 -1v-75q0 -10 -7.5 -17.5t-17.5 -7.5h-150q-10 0 -17.5 7.5t-7.5 17.5v75h-100v-75q0 -10 -7.5 -17.5t-17.5 -7.5h-150q-10 0 -17.5 7.5t-7.5 17.5v75h-175q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5h75v600h-75q-10 0 -17.5 7.5t-7.5 17.5v150 q0 10 7.5 17.5t17.5 7.5h175v75q0 10 7.5 17.5t17.5 7.5h150q10 0 17.5 -7.5t7.5 -17.5v-75h100v75q0 10 7.5 17.5t17.5 7.5zM400 900v-200h263q28 0 48.5 10.5t30 25t15 29t5.5 25.5l1 10q0 4 -0.5 11t-6 24t-15 30t-30 24t-48.5 11h-263zM400 500v-200h363q28 0 48.5 10.5 t30 25t15 29t5.5 25.5l1 10q0 4 -0.5 11t-6 24t-15 30t-30 24t-48.5 11h-363z" />
+<glyph unicode="&#xe230;" d="M212 1198h780q86 0 147 -61t61 -147v-416q0 -51 -18 -142.5t-36 -157.5l-18 -66q-29 -87 -93.5 -146.5t-146.5 -59.5h-572q-82 0 -147 59t-93 147q-8 28 -20 73t-32 143.5t-20 149.5v416q0 86 61 147t147 61zM600 1045q-70 0 -132.5 -11.5t-105.5 -30.5t-78.5 -41.5 t-57 -45t-36 -41t-20.5 -30.5l-6 -12l156 -243h560l156 243q-2 5 -6 12.5t-20 29.5t-36.5 42t-57 44.5t-79 42t-105 29.5t-132.5 12zM762 703h-157l195 261z" />
+<glyph unicode="&#xe231;" d="M475 1300h150q103 0 189 -86t86 -189v-500q0 -41 -42 -83t-83 -42h-450q-41 0 -83 42t-42 83v500q0 103 86 189t189 86zM700 300v-225q0 -21 -27 -48t-48 -27h-150q-21 0 -48 27t-27 48v225h300z" />
+<glyph unicode="&#xe232;" d="M475 1300h96q0 -150 89.5 -239.5t239.5 -89.5v-446q0 -41 -42 -83t-83 -42h-450q-41 0 -83 42t-42 83v500q0 103 86 189t189 86zM700 300v-225q0 -21 -27 -48t-48 -27h-150q-21 0 -48 27t-27 48v225h300z" />
+<glyph unicode="&#xe233;" d="M1294 767l-638 -283l-378 170l-78 -60v-224l100 -150v-199l-150 148l-150 -149v200l100 150v250q0 4 -0.5 10.5t0 9.5t1 8t3 8t6.5 6l47 40l-147 65l642 283zM1000 380l-350 -166l-350 166v147l350 -165l350 165v-147z" />
+<glyph unicode="&#xe234;" d="M250 800q62 0 106 -44t44 -106t-44 -106t-106 -44t-106 44t-44 106t44 106t106 44zM650 800q62 0 106 -44t44 -106t-44 -106t-106 -44t-106 44t-44 106t44 106t106 44zM1050 800q62 0 106 -44t44 -106t-44 -106t-106 -44t-106 44t-44 106t44 106t106 44z" />
+<glyph unicode="&#xe235;" d="M550 1100q62 0 106 -44t44 -106t-44 -106t-106 -44t-106 44t-44 106t44 106t106 44zM550 700q62 0 106 -44t44 -106t-44 -106t-106 -44t-106 44t-44 106t44 106t106 44zM550 300q62 0 106 -44t44 -106t-44 -106t-106 -44t-106 44t-44 106t44 106t106 44z" />
+<glyph unicode="&#xe236;" d="M125 1100h950q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-950q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5zM125 700h950q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-950q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5 t17.5 7.5zM125 300h950q10 0 17.5 -7.5t7.5 -17.5v-150q0 -10 -7.5 -17.5t-17.5 -7.5h-950q-10 0 -17.5 7.5t-7.5 17.5v150q0 10 7.5 17.5t17.5 7.5z" />
+<glyph unicode="&#xe237;" d="M350 1200h500q162 0 256 -93.5t94 -256.5v-500q0 -165 -93.5 -257.5t-256.5 -92.5h-500q-165 0 -257.5 92.5t-92.5 257.5v500q0 165 92.5 257.5t257.5 92.5zM900 1000h-600q-41 0 -70.5 -29.5t-29.5 -70.5v-600q0 -41 29.5 -70.5t70.5 -29.5h600q41 0 70.5 29.5 t29.5 70.5v600q0 41 -29.5 70.5t-70.5 29.5zM350 900h500q21 0 35.5 -14.5t14.5 -35.5v-300q0 -21 -14.5 -35.5t-35.5 -14.5h-500q-21 0 -35.5 14.5t-14.5 35.5v300q0 21 14.5 35.5t35.5 14.5zM400 800v-200h400v200h-400z" />
+<glyph unicode="&#xe238;" d="M150 1100h1000q21 0 35.5 -14.5t14.5 -35.5t-14.5 -35.5t-35.5 -14.5h-50v-200h50q21 0 35.5 -14.5t14.5 -35.5t-14.5 -35.5t-35.5 -14.5h-50v-200h50q21 0 35.5 -14.5t14.5 -35.5t-14.5 -35.5t-35.5 -14.5h-50v-200h50q21 0 35.5 -14.5t14.5 -35.5t-14.5 -35.5 t-35.5 -14.5h-1000q-21 0 -35.5 14.5t-14.5 35.5t14.5 35.5t35.5 14.5h50v200h-50q-21 0 -35.5 14.5t-14.5 35.5t14.5 35.5t35.5 14.5h50v200h-50q-21 0 -35.5 14.5t-14.5 35.5t14.5 35.5t35.5 14.5h50v200h-50q-21 0 -35.5 14.5t-14.5 35.5t14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe239;" d="M650 1187q87 -67 118.5 -156t0 -178t-118.5 -155q-87 66 -118.5 155t0 178t118.5 156zM300 800q124 0 212 -88t88 -212q-124 0 -212 88t-88 212zM1000 800q0 -124 -88 -212t-212 -88q0 124 88 212t212 88zM300 500q124 0 212 -88t88 -212q-124 0 -212 88t-88 212z M1000 500q0 -124 -88 -212t-212 -88q0 124 88 212t212 88zM700 199v-144q0 -21 -14.5 -35.5t-35.5 -14.5t-35.5 14.5t-14.5 35.5v142q40 -4 43 -4q17 0 57 6z" />
+<glyph unicode="&#xe240;" d="M745 878l69 19q25 6 45 -12l298 -295q11 -11 15 -26.5t-2 -30.5q-5 -14 -18 -23.5t-28 -9.5h-8q1 0 1 -13q0 -29 -2 -56t-8.5 -62t-20 -63t-33 -53t-51 -39t-72.5 -14h-146q-184 0 -184 288q0 24 10 47q-20 4 -62 4t-63 -4q11 -24 11 -47q0 -288 -184 -288h-142 q-48 0 -84.5 21t-56 51t-32 71.5t-16 75t-3.5 68.5q0 13 2 13h-7q-15 0 -27.5 9.5t-18.5 23.5q-6 15 -2 30.5t15 25.5l298 296q20 18 46 11l76 -19q20 -5 30.5 -22.5t5.5 -37.5t-22.5 -31t-37.5 -5l-51 12l-182 -193h891l-182 193l-44 -12q-20 -5 -37.5 6t-22.5 31t6 37.5 t31 22.5z" />
+<glyph unicode="&#xe241;" d="M1200 900h-50q0 21 -4 37t-9.5 26.5t-18 17.5t-22 11t-28.5 5.5t-31 2t-37 0.5h-200v-850q0 -22 25 -34.5t50 -13.5l25 -2v-100h-400v100q4 0 11 0.5t24 3t30 7t24 15t11 24.5v850h-200q-25 0 -37 -0.5t-31 -2t-28.5 -5.5t-22 -11t-18 -17.5t-9.5 -26.5t-4 -37h-50v300 h1000v-300zM500 450h-25q0 15 -4 24.5t-9 14.5t-17 7.5t-20 3t-25 0.5h-100v-425q0 -11 12.5 -17.5t25.5 -7.5h12v-50h-200v50q50 0 50 25v425h-100q-17 0 -25 -0.5t-20 -3t-17 -7.5t-9 -14.5t-4 -24.5h-25v150h500v-150z" />
+<glyph unicode="&#xe242;" d="M1000 300v50q-25 0 -55 32q-14 14 -25 31t-16 27l-4 11l-289 747h-69l-300 -754q-18 -35 -39 -56q-9 -9 -24.5 -18.5t-26.5 -14.5l-11 -5v-50h273v50q-49 0 -78.5 21.5t-11.5 67.5l69 176h293l61 -166q13 -34 -3.5 -66.5t-55.5 -32.5v-50h312zM412 691l134 342l121 -342 h-255zM1100 150v-100q0 -21 -14.5 -35.5t-35.5 -14.5h-1000q-21 0 -35.5 14.5t-14.5 35.5v100q0 21 14.5 35.5t35.5 14.5h1000q21 0 35.5 -14.5t14.5 -35.5z" />
+<glyph unicode="&#xe243;" d="M50 1200h1100q21 0 35.5 -14.5t14.5 -35.5v-1100q0 -21 -14.5 -35.5t-35.5 -14.5h-1100q-21 0 -35.5 14.5t-14.5 35.5v1100q0 21 14.5 35.5t35.5 14.5zM611 1118h-70q-13 0 -18 -12l-299 -753q-17 -32 -35 -51q-18 -18 -56 -34q-12 -5 -12 -18v-50q0 -8 5.5 -14t14.5 -6 h273q8 0 14 6t6 14v50q0 8 -6 14t-14 6q-55 0 -71 23q-10 14 0 39l63 163h266l57 -153q11 -31 -6 -55q-12 -17 -36 -17q-8 0 -14 -6t-6 -14v-50q0 -8 6 -14t14 -6h313q8 0 14 6t6 14v50q0 7 -5.5 13t-13.5 7q-17 0 -42 25q-25 27 -40 63h-1l-288 748q-5 12 -19 12zM639 611 h-197l103 264z" />
+<glyph unicode="&#xe244;" d="M1200 1100h-1200v100h1200v-100zM50 1000h400q21 0 35.5 -14.5t14.5 -35.5v-900q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5v900q0 21 14.5 35.5t35.5 14.5zM650 1000h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400 q-21 0 -35.5 14.5t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5zM700 900v-300h300v300h-300z" />
+<glyph unicode="&#xe245;" d="M50 1200h400q21 0 35.5 -14.5t14.5 -35.5v-900q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5v900q0 21 14.5 35.5t35.5 14.5zM650 700h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5v400 q0 21 14.5 35.5t35.5 14.5zM700 600v-300h300v300h-300zM1200 0h-1200v100h1200v-100z" />
+<glyph unicode="&#xe246;" d="M50 1000h400q21 0 35.5 -14.5t14.5 -35.5v-350h100v150q0 21 14.5 35.5t35.5 14.5h400q21 0 35.5 -14.5t14.5 -35.5v-150h100v-100h-100v-150q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5v150h-100v-350q0 -21 -14.5 -35.5t-35.5 -14.5h-400 q-21 0 -35.5 14.5t-14.5 35.5v800q0 21 14.5 35.5t35.5 14.5zM700 700v-300h300v300h-300z" />
+<glyph unicode="&#xe247;" d="M100 0h-100v1200h100v-1200zM250 1100h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5zM300 1000v-300h300v300h-300zM250 500h900q21 0 35.5 -14.5t14.5 -35.5v-400 q0 -21 -14.5 -35.5t-35.5 -14.5h-900q-21 0 -35.5 14.5t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe248;" d="M600 1100h150q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-150v-100h450q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-900q-21 0 -35.5 14.5t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5h350v100h-150q-21 0 -35.5 14.5 t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5h150v100h100v-100zM400 1000v-300h300v300h-300z" />
+<glyph unicode="&#xe249;" d="M1200 0h-100v1200h100v-1200zM550 1100h400q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-400q-21 0 -35.5 14.5t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5zM600 1000v-300h300v300h-300zM50 500h900q21 0 35.5 -14.5t14.5 -35.5v-400 q0 -21 -14.5 -35.5t-35.5 -14.5h-900q-21 0 -35.5 14.5t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5z" />
+<glyph unicode="&#xe250;" d="M865 565l-494 -494q-23 -23 -41 -23q-14 0 -22 13.5t-8 38.5v1000q0 25 8 38.5t22 13.5q18 0 41 -23l494 -494q14 -14 14 -35t-14 -35z" />
+<glyph unicode="&#xe251;" d="M335 635l494 494q29 29 50 20.5t21 -49.5v-1000q0 -41 -21 -49.5t-50 20.5l-494 494q-14 14 -14 35t14 35z" />
+<glyph unicode="&#xe252;" d="M100 900h1000q41 0 49.5 -21t-20.5 -50l-494 -494q-14 -14 -35 -14t-35 14l-494 494q-29 29 -20.5 50t49.5 21z" />
+<glyph unicode="&#xe253;" d="M635 865l494 -494q29 -29 20.5 -50t-49.5 -21h-1000q-41 0 -49.5 21t20.5 50l494 494q14 14 35 14t35 -14z" />
+<glyph unicode="&#xe254;" d="M700 741v-182l-692 -323v221l413 193l-413 193v221zM1200 0h-800v200h800v-200z" />
+<glyph unicode="&#xe255;" d="M1200 900h-200v-100h200v-100h-300v300h200v100h-200v100h300v-300zM0 700h50q0 21 4 37t9.5 26.5t18 17.5t22 11t28.5 5.5t31 2t37 0.5h100v-550q0 -22 -25 -34.5t-50 -13.5l-25 -2v-100h400v100q-4 0 -11 0.5t-24 3t-30 7t-24 15t-11 24.5v550h100q25 0 37 -0.5t31 -2 t28.5 -5.5t22 -11t18 -17.5t9.5 -26.5t4 -37h50v300h-800v-300z" />
+<glyph unicode="&#xe256;" d="M800 700h-50q0 21 -4 37t-9.5 26.5t-18 17.5t-22 11t-28.5 5.5t-31 2t-37 0.5h-100v-550q0 -22 25 -34.5t50 -14.5l25 -1v-100h-400v100q4 0 11 0.5t24 3t30 7t24 15t11 24.5v550h-100q-25 0 -37 -0.5t-31 -2t-28.5 -5.5t-22 -11t-18 -17.5t-9.5 -26.5t-4 -37h-50v300 h800v-300zM1100 200h-200v-100h200v-100h-300v300h200v100h-200v100h300v-300z" />
+<glyph unicode="&#xe257;" d="M701 1098h160q16 0 21 -11t-7 -23l-464 -464l464 -464q12 -12 7 -23t-21 -11h-160q-13 0 -23 9l-471 471q-7 8 -7 18t7 18l471 471q10 9 23 9z" />
+<glyph unicode="&#xe258;" d="M339 1098h160q13 0 23 -9l471 -471q7 -8 7 -18t-7 -18l-471 -471q-10 -9 -23 -9h-160q-16 0 -21 11t7 23l464 464l-464 464q-12 12 -7 23t21 11z" />
+<glyph unicode="&#xe259;" d="M1087 882q11 -5 11 -21v-160q0 -13 -9 -23l-471 -471q-8 -7 -18 -7t-18 7l-471 471q-9 10 -9 23v160q0 16 11 21t23 -7l464 -464l464 464q12 12 23 7z" />
+<glyph unicode="&#xe260;" d="M618 993l471 -471q9 -10 9 -23v-160q0 -16 -11 -21t-23 7l-464 464l-464 -464q-12 -12 -23 -7t-11 21v160q0 13 9 23l471 471q8 7 18 7t18 -7z" />
+<glyph unicode="&#xf8ff;" d="M1000 1200q0 -124 -88 -212t-212 -88q0 124 88 212t212 88zM450 1000h100q21 0 40 -14t26 -33l79 -194q5 1 16 3q34 6 54 9.5t60 7t65.5 1t61 -10t56.5 -23t42.5 -42t29 -64t5 -92t-19.5 -121.5q-1 -7 -3 -19.5t-11 -50t-20.5 -73t-32.5 -81.5t-46.5 -83t-64 -70 t-82.5 -50q-13 -5 -42 -5t-65.5 2.5t-47.5 2.5q-14 0 -49.5 -3.5t-63 -3.5t-43.5 7q-57 25 -104.5 78.5t-75 111.5t-46.5 112t-26 90l-7 35q-15 63 -18 115t4.5 88.5t26 64t39.5 43.5t52 25.5t58.5 13t62.5 2t59.5 -4.5t55.5 -8l-147 192q-12 18 -5.5 30t27.5 12z" />
+<glyph unicode="&#x1f511;" d="M250 1200h600q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-150v-500l-255 -178q-19 -9 -32 -1t-13 29v650h-150q-21 0 -35.5 14.5t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5zM400 1100v-100h300v100h-300z" />
+<glyph unicode="&#x1f6aa;" d="M250 1200h750q39 0 69.5 -40.5t30.5 -84.5v-933l-700 -117v950l600 125h-700v-1000h-100v1025q0 23 15.5 49t34.5 26zM500 525v-100l100 20v100z" />
+</font>
+</defs></svg> 
\ No newline at end of file
diff --git a/app/webroot/fonts/glyphicons-halflings-regular.ttf b/app/webroot/fonts/glyphicons-halflings-regular.ttf
new file mode 100644
index 0000000..1413fc6
Binary files /dev/null and b/app/webroot/fonts/glyphicons-halflings-regular.ttf differ
diff --git a/app/webroot/fonts/glyphicons-halflings-regular.woff b/app/webroot/fonts/glyphicons-halflings-regular.woff
new file mode 100644
index 0000000..9e61285
Binary files /dev/null and b/app/webroot/fonts/glyphicons-halflings-regular.woff differ
diff --git a/app/webroot/fonts/glyphicons-halflings-regular.woff2 b/app/webroot/fonts/glyphicons-halflings-regular.woff2
new file mode 100644
index 0000000..64539b5
Binary files /dev/null and b/app/webroot/fonts/glyphicons-halflings-regular.woff2 differ
diff --git a/app/webroot/img/pictcode/sprite/airplane/001_char_img_airplane_010.png b/app/webroot/img/pictcode/sprite/airplane/001_char_img_airplane_010.png
new file mode 100644
index 0000000..014c17c
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/airplane/001_char_img_airplane_010.png differ
diff --git a/app/webroot/img/pictcode/sprite/airplane/001_char_img_airplane_020.png b/app/webroot/img/pictcode/sprite/airplane/001_char_img_airplane_020.png
new file mode 100644
index 0000000..2be9881
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/airplane/001_char_img_airplane_020.png differ
diff --git a/app/webroot/img/pictcode/sprite/airplane/001_char_img_airplane_030.png b/app/webroot/img/pictcode/sprite/airplane/001_char_img_airplane_030.png
new file mode 100644
index 0000000..83eeb72
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/airplane/001_char_img_airplane_030.png differ
diff --git a/app/webroot/img/pictcode/sprite/airplane/001_char_img_airplane_040.png b/app/webroot/img/pictcode/sprite/airplane/001_char_img_airplane_040.png
new file mode 100644
index 0000000..5e1b34f
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/airplane/001_char_img_airplane_040.png differ
diff --git a/app/webroot/img/pictcode/sprite/airplane/001_char_img_bomb_010.png b/app/webroot/img/pictcode/sprite/airplane/001_char_img_bomb_010.png
new file mode 100644
index 0000000..d64fea5
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/airplane/001_char_img_bomb_010.png differ
diff --git a/app/webroot/img/pictcode/sprite/airplane/001_char_img_bomb_020.png b/app/webroot/img/pictcode/sprite/airplane/001_char_img_bomb_020.png
new file mode 100644
index 0000000..4474da2
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/airplane/001_char_img_bomb_020.png differ
diff --git a/app/webroot/img/pictcode/sprite/airplane/001_char_img_bomb_030.png b/app/webroot/img/pictcode/sprite/airplane/001_char_img_bomb_030.png
new file mode 100644
index 0000000..0c3f5a7
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/airplane/001_char_img_bomb_030.png differ
diff --git a/app/webroot/img/pictcode/sprite/airplane/001_char_img_bomb_040.png b/app/webroot/img/pictcode/sprite/airplane/001_char_img_bomb_040.png
new file mode 100644
index 0000000..ba64f8b
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/airplane/001_char_img_bomb_040.png differ
diff --git a/app/webroot/img/pictcode/sprite/animal/001_char_img_cat_010.png b/app/webroot/img/pictcode/sprite/animal/001_char_img_cat_010.png
new file mode 100644
index 0000000..e27a27b
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/animal/001_char_img_cat_010.png differ
diff --git a/app/webroot/img/pictcode/sprite/animal/001_char_img_cat_020.png b/app/webroot/img/pictcode/sprite/animal/001_char_img_cat_020.png
new file mode 100644
index 0000000..86059d4
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/animal/001_char_img_cat_020.png differ
diff --git a/app/webroot/img/pictcode/sprite/animal/001_char_img_cat_030.png b/app/webroot/img/pictcode/sprite/animal/001_char_img_cat_030.png
new file mode 100644
index 0000000..a06ed01
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/animal/001_char_img_cat_030.png differ
diff --git a/app/webroot/img/pictcode/sprite/animal/001_char_img_dog_010.png b/app/webroot/img/pictcode/sprite/animal/001_char_img_dog_010.png
new file mode 100644
index 0000000..8f54344
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/animal/001_char_img_dog_010.png differ
diff --git a/app/webroot/img/pictcode/sprite/animal/001_char_img_dog_020.png b/app/webroot/img/pictcode/sprite/animal/001_char_img_dog_020.png
new file mode 100644
index 0000000..e697fd4
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/animal/001_char_img_dog_020.png differ
diff --git a/app/webroot/img/pictcode/sprite/animal/001_char_img_dog_030.png b/app/webroot/img/pictcode/sprite/animal/001_char_img_dog_030.png
new file mode 100644
index 0000000..6d573c2
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/animal/001_char_img_dog_030.png differ
diff --git a/app/webroot/img/pictcode/sprite/animal/001_char_img_dog_040.png b/app/webroot/img/pictcode/sprite/animal/001_char_img_dog_040.png
new file mode 100644
index 0000000..b0e5668
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/animal/001_char_img_dog_040.png differ
diff --git a/app/webroot/img/pictcode/sprite/animal/001_char_img_dog_050.png b/app/webroot/img/pictcode/sprite/animal/001_char_img_dog_050.png
new file mode 100644
index 0000000..6327180
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/animal/001_char_img_dog_050.png differ
diff --git a/app/webroot/img/pictcode/sprite/animal/001_char_img_dog_060.png b/app/webroot/img/pictcode/sprite/animal/001_char_img_dog_060.png
new file mode 100644
index 0000000..fee855a
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/animal/001_char_img_dog_060.png differ
diff --git a/app/webroot/img/pictcode/sprite/animal/001_char_img_dolphin_010.png b/app/webroot/img/pictcode/sprite/animal/001_char_img_dolphin_010.png
new file mode 100644
index 0000000..dfe600a
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/animal/001_char_img_dolphin_010.png differ
diff --git a/app/webroot/img/pictcode/sprite/animal/001_char_img_dolphin_020.png b/app/webroot/img/pictcode/sprite/animal/001_char_img_dolphin_020.png
new file mode 100644
index 0000000..6cc9de3
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/animal/001_char_img_dolphin_020.png differ
diff --git a/app/webroot/img/pictcode/sprite/animal/001_char_img_mole_010.png b/app/webroot/img/pictcode/sprite/animal/001_char_img_mole_010.png
new file mode 100644
index 0000000..4fdb4f9
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/animal/001_char_img_mole_010.png differ
diff --git a/app/webroot/img/pictcode/sprite/animal/001_char_img_mole_020.png b/app/webroot/img/pictcode/sprite/animal/001_char_img_mole_020.png
new file mode 100644
index 0000000..fa583b2
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/animal/001_char_img_mole_020.png differ
diff --git a/app/webroot/img/pictcode/sprite/animal/001_char_img_mole_030.png b/app/webroot/img/pictcode/sprite/animal/001_char_img_mole_030.png
new file mode 100644
index 0000000..eff39a2
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/animal/001_char_img_mole_030.png differ
diff --git a/app/webroot/img/pictcode/sprite/animal/001_char_img_mole_040.png b/app/webroot/img/pictcode/sprite/animal/001_char_img_mole_040.png
new file mode 100644
index 0000000..86b0709
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/animal/001_char_img_mole_040.png differ
diff --git a/app/webroot/img/pictcode/sprite/animal/001_char_img_mouse_010.png b/app/webroot/img/pictcode/sprite/animal/001_char_img_mouse_010.png
new file mode 100644
index 0000000..1ae26c8
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/animal/001_char_img_mouse_010.png differ
diff --git a/app/webroot/img/pictcode/sprite/animal/001_char_img_mouse_020.png b/app/webroot/img/pictcode/sprite/animal/001_char_img_mouse_020.png
new file mode 100644
index 0000000..8bd044b
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/animal/001_char_img_mouse_020.png differ
diff --git a/app/webroot/img/pictcode/sprite/animal/001_char_img_mouse_030.png b/app/webroot/img/pictcode/sprite/animal/001_char_img_mouse_030.png
new file mode 100644
index 0000000..4022593
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/animal/001_char_img_mouse_030.png differ
diff --git a/app/webroot/img/pictcode/sprite/animal/001_char_img_whale_010.png b/app/webroot/img/pictcode/sprite/animal/001_char_img_whale_010.png
new file mode 100644
index 0000000..ed102ff
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/animal/001_char_img_whale_010.png differ
diff --git a/app/webroot/img/pictcode/sprite/animal/001_char_img_whale_020.png b/app/webroot/img/pictcode/sprite/animal/001_char_img_whale_020.png
new file mode 100644
index 0000000..904eef2
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/animal/001_char_img_whale_020.png differ
diff --git a/app/webroot/img/pictcode/sprite/artifact/001_char_img_pipe_010.png b/app/webroot/img/pictcode/sprite/artifact/001_char_img_pipe_010.png
new file mode 100644
index 0000000..6416675
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/artifact/001_char_img_pipe_010.png differ
diff --git a/app/webroot/img/pictcode/sprite/background/001_char_bg_bg_010.png b/app/webroot/img/pictcode/sprite/background/001_char_bg_bg_010.png
new file mode 100644
index 0000000..c39794b
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/background/001_char_bg_bg_010.png differ
diff --git a/app/webroot/img/pictcode/sprite/background/001_char_bg_bg_020.png b/app/webroot/img/pictcode/sprite/background/001_char_bg_bg_020.png
new file mode 100644
index 0000000..9e14e25
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/background/001_char_bg_bg_020.png differ
diff --git a/app/webroot/img/pictcode/sprite/background/001_char_bg_bg_030.png b/app/webroot/img/pictcode/sprite/background/001_char_bg_bg_030.png
new file mode 100644
index 0000000..021ae19
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/background/001_char_bg_bg_030.png differ
diff --git a/app/webroot/img/pictcode/sprite/background/001_char_bg_bg_040.png b/app/webroot/img/pictcode/sprite/background/001_char_bg_bg_040.png
new file mode 100644
index 0000000..ee13ed6
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/background/001_char_bg_bg_040.png differ
diff --git a/app/webroot/img/pictcode/sprite/board/001_char_img_display_010.png b/app/webroot/img/pictcode/sprite/board/001_char_img_display_010.png
new file mode 100644
index 0000000..e461d7b
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/board/001_char_img_display_010.png differ
diff --git a/app/webroot/img/pictcode/sprite/board/001_char_img_display_020.png b/app/webroot/img/pictcode/sprite/board/001_char_img_display_020.png
new file mode 100644
index 0000000..5c64640
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/board/001_char_img_display_020.png differ
diff --git a/app/webroot/img/pictcode/sprite/board/001_char_img_display_030.png b/app/webroot/img/pictcode/sprite/board/001_char_img_display_030.png
new file mode 100644
index 0000000..02b4b69
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/board/001_char_img_display_030.png differ
diff --git a/app/webroot/img/pictcode/sprite/board/arrow1.png b/app/webroot/img/pictcode/sprite/board/arrow1.png
new file mode 100644
index 0000000..4d080b3
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/board/arrow1.png differ
diff --git a/app/webroot/img/pictcode/sprite/board/game_clear.png b/app/webroot/img/pictcode/sprite/board/game_clear.png
new file mode 100644
index 0000000..d144bc6
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/board/game_clear.png differ
diff --git a/app/webroot/img/pictcode/sprite/board/game_over.png b/app/webroot/img/pictcode/sprite/board/game_over.png
new file mode 100644
index 0000000..6699863
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/board/game_over.png differ
diff --git a/app/webroot/img/pictcode/sprite/board/transparent_board.png b/app/webroot/img/pictcode/sprite/board/transparent_board.png
new file mode 100644
index 0000000..1165857
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/board/transparent_board.png differ
diff --git a/app/webroot/img/pictcode/sprite/car/001_char_img_bus_010.png b/app/webroot/img/pictcode/sprite/car/001_char_img_bus_010.png
new file mode 100644
index 0000000..46795d5
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/car/001_char_img_bus_010.png differ
diff --git a/app/webroot/img/pictcode/sprite/car/001_char_img_bus_020.png b/app/webroot/img/pictcode/sprite/car/001_char_img_bus_020.png
new file mode 100644
index 0000000..dd8c31e
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/car/001_char_img_bus_020.png differ
diff --git a/app/webroot/img/pictcode/sprite/car/001_char_img_bus_030.png b/app/webroot/img/pictcode/sprite/car/001_char_img_bus_030.png
new file mode 100644
index 0000000..e85775a
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/car/001_char_img_bus_030.png differ
diff --git a/app/webroot/img/pictcode/sprite/car/001_char_img_bus_040.png b/app/webroot/img/pictcode/sprite/car/001_char_img_bus_040.png
new file mode 100644
index 0000000..df2ad62
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/car/001_char_img_bus_040.png differ
diff --git a/app/webroot/img/pictcode/sprite/car/001_char_img_bus_050.png b/app/webroot/img/pictcode/sprite/car/001_char_img_bus_050.png
new file mode 100644
index 0000000..528fbcc
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/car/001_char_img_bus_050.png differ
diff --git a/app/webroot/img/pictcode/sprite/car/001_char_img_bus_060.png b/app/webroot/img/pictcode/sprite/car/001_char_img_bus_060.png
new file mode 100644
index 0000000..9a29eb0
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/car/001_char_img_bus_060.png differ
diff --git a/app/webroot/img/pictcode/sprite/car/001_char_img_car_010.png b/app/webroot/img/pictcode/sprite/car/001_char_img_car_010.png
new file mode 100644
index 0000000..110aa73
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/car/001_char_img_car_010.png differ
diff --git a/app/webroot/img/pictcode/sprite/car/001_char_img_car_020.png b/app/webroot/img/pictcode/sprite/car/001_char_img_car_020.png
new file mode 100644
index 0000000..2456baa
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/car/001_char_img_car_020.png differ
diff --git a/app/webroot/img/pictcode/sprite/car/001_char_img_car_030.png b/app/webroot/img/pictcode/sprite/car/001_char_img_car_030.png
new file mode 100644
index 0000000..74bd11d
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/car/001_char_img_car_030.png differ
diff --git a/app/webroot/img/pictcode/sprite/car/001_char_img_car_040.png b/app/webroot/img/pictcode/sprite/car/001_char_img_car_040.png
new file mode 100644
index 0000000..5dab691
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/car/001_char_img_car_040.png differ
diff --git a/app/webroot/img/pictcode/sprite/car/001_char_img_car_050.png b/app/webroot/img/pictcode/sprite/car/001_char_img_car_050.png
new file mode 100644
index 0000000..7921c4f
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/car/001_char_img_car_050.png differ
diff --git a/app/webroot/img/pictcode/sprite/car/001_char_img_car_060.png b/app/webroot/img/pictcode/sprite/car/001_char_img_car_060.png
new file mode 100644
index 0000000..9c450a1
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/car/001_char_img_car_060.png differ
diff --git a/app/webroot/img/pictcode/sprite/car/001_char_img_car_070.png b/app/webroot/img/pictcode/sprite/car/001_char_img_car_070.png
new file mode 100644
index 0000000..6aef1d5
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/car/001_char_img_car_070.png differ
diff --git a/app/webroot/img/pictcode/sprite/car/001_char_img_car_080.png b/app/webroot/img/pictcode/sprite/car/001_char_img_car_080.png
new file mode 100644
index 0000000..693d894
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/car/001_char_img_car_080.png differ
diff --git a/app/webroot/img/pictcode/sprite/car/car03.png b/app/webroot/img/pictcode/sprite/car/car03.png
new file mode 100644
index 0000000..07b2f59
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/car/car03.png differ
diff --git a/app/webroot/img/pictcode/sprite/fish/001_char_img_fish_010.png b/app/webroot/img/pictcode/sprite/fish/001_char_img_fish_010.png
new file mode 100644
index 0000000..bb60910
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/fish/001_char_img_fish_010.png differ
diff --git a/app/webroot/img/pictcode/sprite/fish/001_char_img_fish_020.png b/app/webroot/img/pictcode/sprite/fish/001_char_img_fish_020.png
new file mode 100644
index 0000000..8837cbe
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/fish/001_char_img_fish_020.png differ
diff --git a/app/webroot/img/pictcode/sprite/fish/001_char_img_fish_030.png b/app/webroot/img/pictcode/sprite/fish/001_char_img_fish_030.png
new file mode 100644
index 0000000..3c10eb0
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/fish/001_char_img_fish_030.png differ
diff --git a/app/webroot/img/pictcode/sprite/fish/001_char_img_fish_040.png b/app/webroot/img/pictcode/sprite/fish/001_char_img_fish_040.png
new file mode 100644
index 0000000..c8f0d0d
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/fish/001_char_img_fish_040.png differ
diff --git a/app/webroot/img/pictcode/sprite/fish/001_char_img_fish_050.png b/app/webroot/img/pictcode/sprite/fish/001_char_img_fish_050.png
new file mode 100644
index 0000000..d223eea
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/fish/001_char_img_fish_050.png differ
diff --git a/app/webroot/img/pictcode/sprite/fish/001_char_img_fish_060.png b/app/webroot/img/pictcode/sprite/fish/001_char_img_fish_060.png
new file mode 100644
index 0000000..4443af1
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/fish/001_char_img_fish_060.png differ
diff --git a/app/webroot/img/pictcode/sprite/fish/shell.png b/app/webroot/img/pictcode/sprite/fish/shell.png
new file mode 100644
index 0000000..0098bf1
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/fish/shell.png differ
diff --git a/app/webroot/img/pictcode/sprite/instrument/001_char_img_inst_010.png b/app/webroot/img/pictcode/sprite/instrument/001_char_img_inst_010.png
new file mode 100644
index 0000000..b40fcef
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/instrument/001_char_img_inst_010.png differ
diff --git a/app/webroot/img/pictcode/sprite/instrument/001_char_img_inst_020.png b/app/webroot/img/pictcode/sprite/instrument/001_char_img_inst_020.png
new file mode 100644
index 0000000..6ad689f
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/instrument/001_char_img_inst_020.png differ
diff --git a/app/webroot/img/pictcode/sprite/instrument/001_char_img_inst_030.png b/app/webroot/img/pictcode/sprite/instrument/001_char_img_inst_030.png
new file mode 100644
index 0000000..3f35b0f
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/instrument/001_char_img_inst_030.png differ
diff --git a/app/webroot/img/pictcode/sprite/instrument/001_char_img_inst_040.png b/app/webroot/img/pictcode/sprite/instrument/001_char_img_inst_040.png
new file mode 100644
index 0000000..9b68a52
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/instrument/001_char_img_inst_040.png differ
diff --git a/app/webroot/img/pictcode/sprite/instrument/001_char_img_inst_050.png b/app/webroot/img/pictcode/sprite/instrument/001_char_img_inst_050.png
new file mode 100644
index 0000000..8f4418d
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/instrument/001_char_img_inst_050.png differ
diff --git a/app/webroot/img/pictcode/sprite/instrument/001_char_img_inst_060.png b/app/webroot/img/pictcode/sprite/instrument/001_char_img_inst_060.png
new file mode 100644
index 0000000..bfe770a
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/instrument/001_char_img_inst_060.png differ
diff --git a/app/webroot/img/pictcode/sprite/instrument/music_note.png b/app/webroot/img/pictcode/sprite/instrument/music_note.png
new file mode 100644
index 0000000..ca752bf
Binary files /dev/null and b/app/webroot/img/pictcode/sprite/instrument/music_note.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_branch_001.png b/app/webroot/img/pictcode/ui/blk_branch_001.png
index 17696b5..9009f68 100644
Binary files a/app/webroot/img/pictcode/ui/blk_branch_001.png and b/app/webroot/img/pictcode/ui/blk_branch_001.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_branch_002.png b/app/webroot/img/pictcode/ui/blk_branch_002.png
index d1413f5..babf35e 100644
Binary files a/app/webroot/img/pictcode/ui/blk_branch_002.png and b/app/webroot/img/pictcode/ui/blk_branch_002.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_branch_003.png b/app/webroot/img/pictcode/ui/blk_branch_003.png
index 8bb9d79..8a2d4cb 100644
Binary files a/app/webroot/img/pictcode/ui/blk_branch_003.png and b/app/webroot/img/pictcode/ui/blk_branch_003.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_branch_004.png b/app/webroot/img/pictcode/ui/blk_branch_004.png
index c94ba0a..9f411cc 100644
Binary files a/app/webroot/img/pictcode/ui/blk_branch_004.png and b/app/webroot/img/pictcode/ui/blk_branch_004.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_branch_005.png b/app/webroot/img/pictcode/ui/blk_branch_005.png
index 8303044..895443b 100644
Binary files a/app/webroot/img/pictcode/ui/blk_branch_005.png and b/app/webroot/img/pictcode/ui/blk_branch_005.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_data_001.png b/app/webroot/img/pictcode/ui/blk_data_001.png
index f3e963d..36f0024 100644
Binary files a/app/webroot/img/pictcode/ui/blk_data_001.png and b/app/webroot/img/pictcode/ui/blk_data_001.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_data_002.png b/app/webroot/img/pictcode/ui/blk_data_002.png
new file mode 100644
index 0000000..e24f7b7
Binary files /dev/null and b/app/webroot/img/pictcode/ui/blk_data_002.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_data_003.png b/app/webroot/img/pictcode/ui/blk_data_003.png
new file mode 100644
index 0000000..d560af0
Binary files /dev/null and b/app/webroot/img/pictcode/ui/blk_data_003.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_data_004.png b/app/webroot/img/pictcode/ui/blk_data_004.png
new file mode 100644
index 0000000..8043d20
Binary files /dev/null and b/app/webroot/img/pictcode/ui/blk_data_004.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_data_005.png b/app/webroot/img/pictcode/ui/blk_data_005.png
new file mode 100644
index 0000000..0575466
Binary files /dev/null and b/app/webroot/img/pictcode/ui/blk_data_005.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_data_006.png b/app/webroot/img/pictcode/ui/blk_data_006.png
new file mode 100644
index 0000000..90c4d2e
Binary files /dev/null and b/app/webroot/img/pictcode/ui/blk_data_006.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_data_007.png b/app/webroot/img/pictcode/ui/blk_data_007.png
new file mode 100644
index 0000000..9388dd2
Binary files /dev/null and b/app/webroot/img/pictcode/ui/blk_data_007.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_data_008.png b/app/webroot/img/pictcode/ui/blk_data_008.png
new file mode 100644
index 0000000..6902f24
Binary files /dev/null and b/app/webroot/img/pictcode/ui/blk_data_008.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_function_002.png b/app/webroot/img/pictcode/ui/blk_function_002.png
new file mode 100644
index 0000000..bf3e051
Binary files /dev/null and b/app/webroot/img/pictcode/ui/blk_function_002.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_function_003.png b/app/webroot/img/pictcode/ui/blk_function_003.png
new file mode 100644
index 0000000..5f0ebf7
Binary files /dev/null and b/app/webroot/img/pictcode/ui/blk_function_003.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_gmctrl_001.png b/app/webroot/img/pictcode/ui/blk_gmctrl_001.png
index 9574151..8d7ff22 100644
Binary files a/app/webroot/img/pictcode/ui/blk_gmctrl_001.png and b/app/webroot/img/pictcode/ui/blk_gmctrl_001.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_gmctrl_002.png b/app/webroot/img/pictcode/ui/blk_gmctrl_002.png
index 80fabe2..5077a78 100644
Binary files a/app/webroot/img/pictcode/ui/blk_gmctrl_002.png and b/app/webroot/img/pictcode/ui/blk_gmctrl_002.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_gmctrl_003.png b/app/webroot/img/pictcode/ui/blk_gmctrl_003.png
new file mode 100644
index 0000000..5b4e774
Binary files /dev/null and b/app/webroot/img/pictcode/ui/blk_gmctrl_003.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_gmctrl_004.png b/app/webroot/img/pictcode/ui/blk_gmctrl_004.png
new file mode 100644
index 0000000..ecae9a3
Binary files /dev/null and b/app/webroot/img/pictcode/ui/blk_gmctrl_004.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_motion_001.png b/app/webroot/img/pictcode/ui/blk_motion_001.png
index 1c1f25e..7ba7610 100644
Binary files a/app/webroot/img/pictcode/ui/blk_motion_001.png and b/app/webroot/img/pictcode/ui/blk_motion_001.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_motion_002.png b/app/webroot/img/pictcode/ui/blk_motion_002.png
index 3a44acc..e0c8557 100644
Binary files a/app/webroot/img/pictcode/ui/blk_motion_002.png and b/app/webroot/img/pictcode/ui/blk_motion_002.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_motion_003.png b/app/webroot/img/pictcode/ui/blk_motion_003.png
index fb15af9..6a8efbb 100644
Binary files a/app/webroot/img/pictcode/ui/blk_motion_003.png and b/app/webroot/img/pictcode/ui/blk_motion_003.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_motion_004.png b/app/webroot/img/pictcode/ui/blk_motion_004.png
index 6cb062e..5141dca 100644
Binary files a/app/webroot/img/pictcode/ui/blk_motion_004.png and b/app/webroot/img/pictcode/ui/blk_motion_004.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_motion_005.png b/app/webroot/img/pictcode/ui/blk_motion_005.png
index 36e0eed..f51e38c 100644
Binary files a/app/webroot/img/pictcode/ui/blk_motion_005.png and b/app/webroot/img/pictcode/ui/blk_motion_005.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_motion_006.png b/app/webroot/img/pictcode/ui/blk_motion_006.png
new file mode 100644
index 0000000..7949e28
Binary files /dev/null and b/app/webroot/img/pictcode/ui/blk_motion_006.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_motion_007.png b/app/webroot/img/pictcode/ui/blk_motion_007.png
new file mode 100644
index 0000000..7491de8
Binary files /dev/null and b/app/webroot/img/pictcode/ui/blk_motion_007.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_motion_008.png b/app/webroot/img/pictcode/ui/blk_motion_008.png
new file mode 100644
index 0000000..153abf7
Binary files /dev/null and b/app/webroot/img/pictcode/ui/blk_motion_008.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_sprctrl_001.png b/app/webroot/img/pictcode/ui/blk_sprctrl_001.png
new file mode 100644
index 0000000..183ccbf
Binary files /dev/null and b/app/webroot/img/pictcode/ui/blk_sprctrl_001.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_sprctrl_002.png b/app/webroot/img/pictcode/ui/blk_sprctrl_002.png
new file mode 100644
index 0000000..211d127
Binary files /dev/null and b/app/webroot/img/pictcode/ui/blk_sprctrl_002.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_sprctrl_003.png b/app/webroot/img/pictcode/ui/blk_sprctrl_003.png
new file mode 100644
index 0000000..f4f9730
Binary files /dev/null and b/app/webroot/img/pictcode/ui/blk_sprctrl_003.png differ
diff --git a/app/webroot/img/pictcode/ui/blk_timectrl_002.png b/app/webroot/img/pictcode/ui/blk_timectrl_002.png
index 98e2af0..05d8de2 100644
Binary files a/app/webroot/img/pictcode/ui/blk_timectrl_002.png and b/app/webroot/img/pictcode/ui/blk_timectrl_002.png differ
diff --git a/app/webroot/img/pictcode/ui/btn_modal_008.png b/app/webroot/img/pictcode/ui/btn_modal_008.png
index 46bac16..8ff5999 100644
Binary files a/app/webroot/img/pictcode/ui/btn_modal_008.png and b/app/webroot/img/pictcode/ui/btn_modal_008.png differ
diff --git a/app/webroot/img/pictcode/ui/ctgry_blk_003.png b/app/webroot/img/pictcode/ui/ctgry_blk_003.png
index 13381a7..e8f0b39 100644
Binary files a/app/webroot/img/pictcode/ui/ctgry_blk_003.png and b/app/webroot/img/pictcode/ui/ctgry_blk_003.png differ
diff --git a/app/webroot/img/pictcode/ui/ctgry_blk_005.png b/app/webroot/img/pictcode/ui/ctgry_blk_005.png
index 829c509..3e3428f 100644
Binary files a/app/webroot/img/pictcode/ui/ctgry_blk_005.png and b/app/webroot/img/pictcode/ui/ctgry_blk_005.png differ
diff --git a/app/webroot/img/pictcode/ui/ctgry_spr_006.png b/app/webroot/img/pictcode/ui/ctgry_spr_006.png
new file mode 100644
index 0000000..7aa3465
Binary files /dev/null and b/app/webroot/img/pictcode/ui/ctgry_spr_006.png differ
diff --git a/app/webroot/img/pictcode/ui/ctgry_spr_007.png b/app/webroot/img/pictcode/ui/ctgry_spr_007.png
new file mode 100644
index 0000000..9a5fb4e
Binary files /dev/null and b/app/webroot/img/pictcode/ui/ctgry_spr_007.png differ
diff --git a/app/webroot/img/pictcode/ui/ctgry_spr_008.png b/app/webroot/img/pictcode/ui/ctgry_spr_008.png
new file mode 100644
index 0000000..aa9c965
Binary files /dev/null and b/app/webroot/img/pictcode/ui/ctgry_spr_008.png differ
diff --git a/app/webroot/img/pictcode/ui/icon_blk_002.png b/app/webroot/img/pictcode/ui/icon_blk_002.png
index 295b4b3..50bd608 100644
Binary files a/app/webroot/img/pictcode/ui/icon_blk_002.png and b/app/webroot/img/pictcode/ui/icon_blk_002.png differ
diff --git a/app/webroot/img/pictcode/ui/icon_blk_004.png b/app/webroot/img/pictcode/ui/icon_blk_004.png
index 09feced..5044664 100644
Binary files a/app/webroot/img/pictcode/ui/icon_blk_004.png and b/app/webroot/img/pictcode/ui/icon_blk_004.png differ
diff --git a/app/webroot/img/pictcode/ui/icon_blk_005.png b/app/webroot/img/pictcode/ui/icon_blk_005.png
index c8fd71b..24d4401 100644
Binary files a/app/webroot/img/pictcode/ui/icon_blk_005.png and b/app/webroot/img/pictcode/ui/icon_blk_005.png differ
diff --git a/app/webroot/img/pictcode/ui/icon_blk_006.png b/app/webroot/img/pictcode/ui/icon_blk_006.png
index 6073c15..68cd807 100644
Binary files a/app/webroot/img/pictcode/ui/icon_blk_006.png and b/app/webroot/img/pictcode/ui/icon_blk_006.png differ
diff --git a/app/webroot/img/pictcode/ui/icon_blk_007.png b/app/webroot/img/pictcode/ui/icon_blk_007.png
index bce13b5..3a70ae8 100644
Binary files a/app/webroot/img/pictcode/ui/icon_blk_007.png and b/app/webroot/img/pictcode/ui/icon_blk_007.png differ
diff --git a/app/webroot/img/pictcode/ui/icon_blk_010.png b/app/webroot/img/pictcode/ui/icon_blk_010.png
new file mode 100644
index 0000000..9f5e1a5
Binary files /dev/null and b/app/webroot/img/pictcode/ui/icon_blk_010.png differ
diff --git a/app/webroot/img/pictcode/ui/icon_blk_011.png b/app/webroot/img/pictcode/ui/icon_blk_011.png
new file mode 100644
index 0000000..04eb5c3
Binary files /dev/null and b/app/webroot/img/pictcode/ui/icon_blk_011.png differ
diff --git a/app/webroot/img/pictcode/ui/icon_blk_012.png b/app/webroot/img/pictcode/ui/icon_blk_012.png
new file mode 100644
index 0000000..119a22a
Binary files /dev/null and b/app/webroot/img/pictcode/ui/icon_blk_012.png differ
diff --git a/app/webroot/img/pictcode/ui/icon_blk_013.png b/app/webroot/img/pictcode/ui/icon_blk_013.png
new file mode 100644
index 0000000..edc0f3e
Binary files /dev/null and b/app/webroot/img/pictcode/ui/icon_blk_013.png differ
diff --git a/app/webroot/img/pictcode/ui/icon_blk_014.png b/app/webroot/img/pictcode/ui/icon_blk_014.png
new file mode 100644
index 0000000..7beaa26
Binary files /dev/null and b/app/webroot/img/pictcode/ui/icon_blk_014.png differ
diff --git a/app/webroot/img/pictcode/ui/icon_blk_015.png b/app/webroot/img/pictcode/ui/icon_blk_015.png
new file mode 100644
index 0000000..7beaa26
Binary files /dev/null and b/app/webroot/img/pictcode/ui/icon_blk_015.png differ
diff --git a/app/webroot/img/pictcode/ui/icon_blk_016.png b/app/webroot/img/pictcode/ui/icon_blk_016.png
new file mode 100644
index 0000000..85034d3
Binary files /dev/null and b/app/webroot/img/pictcode/ui/icon_blk_016.png differ
diff --git a/app/webroot/img/pictcode/ui/icon_blk_017.png b/app/webroot/img/pictcode/ui/icon_blk_017.png
new file mode 100644
index 0000000..7bd0664
Binary files /dev/null and b/app/webroot/img/pictcode/ui/icon_blk_017.png differ
diff --git a/app/webroot/img/pictcode/ui/icon_blk_018.png b/app/webroot/img/pictcode/ui/icon_blk_018.png
new file mode 100644
index 0000000..16578aa
Binary files /dev/null and b/app/webroot/img/pictcode/ui/icon_blk_018.png differ
diff --git a/app/webroot/img/pictcode/ui/icon_blk_019.png b/app/webroot/img/pictcode/ui/icon_blk_019.png
new file mode 100644
index 0000000..dca1adf
Binary files /dev/null and b/app/webroot/img/pictcode/ui/icon_blk_019.png differ
diff --git a/app/webroot/img/pictcode/ui/icon_blk_020.png b/app/webroot/img/pictcode/ui/icon_blk_020.png
new file mode 100644
index 0000000..d8171b3
Binary files /dev/null and b/app/webroot/img/pictcode/ui/icon_blk_020.png differ
diff --git a/app/webroot/img/pictcode/ui/icon_blk_021.png b/app/webroot/img/pictcode/ui/icon_blk_021.png
new file mode 100644
index 0000000..610bbe5
Binary files /dev/null and b/app/webroot/img/pictcode/ui/icon_blk_021.png differ
diff --git a/app/webroot/img/pictcode/ui/icon_blk_022.png b/app/webroot/img/pictcode/ui/icon_blk_022.png
new file mode 100644
index 0000000..3fbfa09
Binary files /dev/null and b/app/webroot/img/pictcode/ui/icon_blk_022.png differ
diff --git a/app/webroot/img/pictcode/ui/icon_blk_023.png b/app/webroot/img/pictcode/ui/icon_blk_023.png
new file mode 100644
index 0000000..a79ef48
Binary files /dev/null and b/app/webroot/img/pictcode/ui/icon_blk_023.png differ
diff --git a/app/webroot/img/pictcode/ui/icon_blk_024.png b/app/webroot/img/pictcode/ui/icon_blk_024.png
new file mode 100644
index 0000000..d618345
Binary files /dev/null and b/app/webroot/img/pictcode/ui/icon_blk_024.png differ
diff --git a/app/webroot/img/pictcode/ui/icon_blk_025.png b/app/webroot/img/pictcode/ui/icon_blk_025.png
new file mode 100644
index 0000000..216af7b
Binary files /dev/null and b/app/webroot/img/pictcode/ui/icon_blk_025.png differ
diff --git a/app/webroot/img/pictcode/ui/preview_001.png b/app/webroot/img/pictcode/ui/preview_001.png
index e697fd4..2013561 100644
Binary files a/app/webroot/img/pictcode/ui/preview_001.png and b/app/webroot/img/pictcode/ui/preview_001.png differ
diff --git a/app/webroot/img/pictcode/ui/sound_001.png b/app/webroot/img/pictcode/ui/sound_001.png
new file mode 100644
index 0000000..66924df
Binary files /dev/null and b/app/webroot/img/pictcode/ui/sound_001.png differ
diff --git a/app/webroot/img/pictcode/ui/sound_002.png b/app/webroot/img/pictcode/ui/sound_002.png
new file mode 100644
index 0000000..18b3730
Binary files /dev/null and b/app/webroot/img/pictcode/ui/sound_002.png differ
diff --git a/app/webroot/img/pictcode/ui/sound_003.png b/app/webroot/img/pictcode/ui/sound_003.png
new file mode 100644
index 0000000..5947fd7
Binary files /dev/null and b/app/webroot/img/pictcode/ui/sound_003.png differ
diff --git a/app/webroot/img/pictcode/ui/sound_004.png b/app/webroot/img/pictcode/ui/sound_004.png
new file mode 100644
index 0000000..7b27836
Binary files /dev/null and b/app/webroot/img/pictcode/ui/sound_004.png differ
diff --git a/app/webroot/img/pictcode/ui/sound_005.png b/app/webroot/img/pictcode/ui/sound_005.png
new file mode 100644
index 0000000..13fc65e
Binary files /dev/null and b/app/webroot/img/pictcode/ui/sound_005.png differ
diff --git a/app/webroot/js/pictcode/app.js b/app/webroot/js/pictcode/app.js
index 0a4fd9d..41089c5 100644
--- a/app/webroot/js/pictcode/app.js
+++ b/app/webroot/js/pictcode/app.js
@@ -14,9 +14,19 @@ define(function(require, exports, module) {
 	//（必要か？）
 	require('screen_adjuster');
 
-  document.addEventListener("touchmove", function(evt) {
-    evt.preventDefault();
-  }, false);
+  document.getElementById("preload").addEventListener("touchmove", function(evt) {evt.preventDefault();}, false);
+  document.getElementById("ui_editor").addEventListener("touchmove", function(evt) {evt.preventDefault();}, false);
+  document.getElementById("modal_ui_sprite").addEventListener("touchmove", function(evt) {evt.preventDefault();}, false);
+  document.getElementById("modal_ui_tag").addEventListener("touchmove", function(evt) {evt.preventDefault();}, false);
+  document.getElementById("modal_ui_function").addEventListener("touchmove", function(evt) {evt.preventDefault();}, false);
+  document.getElementById("modal_ui_collision").addEventListener("touchmove", function(evt) {evt.preventDefault();}, false);
+  document.getElementById("modal_coding_block").addEventListener("touchmove", function(evt) {evt.preventDefault();}, false);
+  document.getElementById("modal_coding_vector").addEventListener("touchmove", function(evt) {evt.preventDefault();}, false);
+  document.getElementById("modal_coding_scalar").addEventListener("touchmove", function(evt) {evt.preventDefault();}, false);
+  document.getElementById("modal_coding_function").addEventListener("touchmove", function(evt) {evt.preventDefault();}, false);
+  document.getElementById("modal_coding_tag").addEventListener("touchmove", function(evt) {evt.preventDefault();}, false);
+    document.getElementById("coding-tab").addEventListener("touchmove", function(evt) {evt.preventDefault();}, false);
+  document.getElementById("play-tab").addEventListener("touchmove", function(evt) {evt.preventDefault();}, false);
 
   var isJSONLoaded = false;
   var isImagesLoaded = false;
@@ -56,19 +66,19 @@ define(function(require, exports, module) {
     //最初に開くタブ
     switcher.openCodingTab();
 
-    //UI
+    //Coding
     (function () {
-      uIManager.initialize(codingManager.getFunctions, dataObj.sprites);
+      codingManager.initialize(dataObj.blocks, uIManager.removeFunctionFromSprite);
     }());
 
-    //Coding
+    //UI
     (function () {
-      codingManager.initialize(dataObj.blocks, uIManager.removeFunctionFromSprite);
+      uIManager.initialize(codingManager.getFunctions, dataObj.sprites);
     }());
 
     //実行
     (function () {
-      playManager.initialize(codingManager.findBlock, uIManager.sprites, codingManager.findFunctionWithId);
+      playManager.initialize(uIManager.sprites, codingManager.findFunctionWithId);
     }());
   }
 });
\ No newline at end of file
diff --git a/app/webroot/js/pictcode/block_action.js b/app/webroot/js/pictcode/block_action.js
index 7f72909..e92a608 100644
--- a/app/webroot/js/pictcode/block_action.js
+++ b/app/webroot/js/pictcode/block_action.js
@@ -1,4 +1,322 @@
-define(function(){
+define(['sprite_manager', 'block_manager', 'sound_manager'], function(spriteManager, blockManager, soundManager){
+
+  var currentSprites;
+  var currentVariables;
+  var detaTime;
+  var getIdentifiedTrigger;
+  var resetApp;
+
+  function startAction(curSprts, curVrs, deltaT, gtIdTrg, rstApp){
+    currentSprites = curSprts;
+    currentVariables = curVrs;
+    deltaTime = deltaT;
+    getIdentifiedTrigger = gtIdTrg;
+    resetApp = rstApp;
+    //start_appブロック
+    var startAppBlocks = blockManager.getStartAppBlocks();
+    _.each(startAppBlocks, function(strtAppBlks){
+      var ghostSprite = {
+        type:"ghost",
+        position:{x:0, y:0},
+        aspectRatio:1.0,
+        scale:1.0,
+        angle:0,
+        opacity:1.0,
+        mirrored:false,
+        animating:false,
+        animationCount:0,
+        tag:0,
+        tapFuncIdx:null,
+        startFuncIdx:null,
+        collision:[{tag:1, funcIdx:null}, {tag:2, funcIdx:null}, {tag:3, funcIdx:null}],
+        reactions: {},
+      };
+      currentSprites.push(ghostSprite);
+      setBlock(ghostSprite, strtAppBlks, getIdentifiedTrigger("start_app"));
+    });
+  }
+
+  function setBlock(sprite, block, trigger){
+    //各ブロックのアクション
+    var action = behaviors[block.name];
+    if (action) {
+      action = action();
+    }else{
+      action = null;
+    };
+    //スプライトと紐づけられたアクションとブロック
+    var reaction = sprite.reactions[trigger];
+    if (reaction) {
+      reaction.block = block;
+      reaction.action = action;
+    }else{
+      reaction = {block:block, action:action};
+      sprite.reactions[trigger] = reaction;
+    };
+    //各valueが入力値の場合と変数の場合で場合分け
+    var value1;
+    if (!block.value1.isVariable) {
+      value1 = block.value1.value;
+    }else{
+      value1 = _.find(currentVariables, function (varBlock) {return varBlock.value1.value == block.value1.value;}).value2.value; 
+    };
+    var value2;
+    if (!block.value2.isVariable) {
+      value2 = block.value2.value;
+    }else{
+      value2 = _.find(currentVariables, function (varBlock) {return varBlock.value1.value == block.value2.value;}).value2.value; 
+    };
+    //カテゴリ、ブロック別の初期化
+    switch(block.category){
+      //関数
+      case "function":
+      switch(block.name){
+        case "start_function":
+        goNextBlock(sprite, trigger);
+        break;
+
+        case "return_function":
+        var funcBlock = blockManager.findFunctionWithId(value1);
+        if (funcBlock) {
+          setBlock(sprite, funcBlock, trigger);
+        };
+        break;
+
+        case "fork":
+        var nextBlock1 = blockManager.findBlock(block.bottomLinks[0].id);
+        var nextBlock2 = blockManager.findBlock(block.bottomLinks[1].id);
+        if (nextBlock1) {
+          setBlock(sprite, nextBlock1, trigger);
+        };
+        if (nextBlock2) {
+          setBlock(sprite, nextBlock2, getIdentifiedTrigger("fork"));
+        };
+        break;
+      }
+      break;
+
+      //動きの制御
+      case "movement":
+      switch(block.name){
+        case "move":
+        case "rotate_left":
+        case "rotate_right":
+        reaction.action.initialize(deltaTime, value1, value2);
+        break;
+        case "zoom":
+        reaction.action.initialize(deltaTime, value1, sprite.scale, value2);
+        break;
+        case "opacity":
+        reaction.action.initialize(deltaTime, value1, sprite.opacity, value2);
+        break;
+        case "self_duplicate":
+        var copiedSprite = spriteManager.copySprite(sprite, currentSprites, false);
+        copiedSprite.reactions = {};
+        var funcBlock = blockManager.findFunctionWithId(value1);
+        if (funcBlock) {
+          setBlock(copiedSprite, funcBlock, getIdentifiedTrigger("self_duplicate"));
+        };
+        goNextBlock(sprite, trigger);
+        break;
+        case "self_kill":
+        for (var i = 0; i < currentSprites.length; i++) {
+          var spr = currentSprites[i];
+          if (spr == sprite) {
+            currentSprites.splice(i, 1);
+            break;
+          };
+        };     
+        break;
+        case "mirror":
+        sprite.mirrored = !sprite.mirrored;
+        goNextBlock(sprite, trigger);          
+        break;
+
+      }
+      break;
+
+      //分岐
+      case "branch":
+      var isTrue = false;
+      switch(block.name){
+        case "branch_equal":
+        isTrue = (value1 == value2);
+        break;
+        case "branch_larger":
+        isTrue = (value1 > value2);
+        break;
+        case "branch_smaller":
+        isTrue = (value1 < value2);
+        break;
+        case "branch_eqlarger":
+        isTrue = (value1 >= value2);
+        break;
+        case "branch_eqsmaller":
+        isTrue = (value1 <= value2);
+        break;
+      }
+      var nextBlock;
+      if (isTrue) {
+        nextBlock = blockManager.findBlock(block.bottomLinks[0].id);
+      }else{
+        nextBlock = blockManager.findBlock(block.bottomLinks[1].id);
+      }
+      if (nextBlock) {
+        setBlock(sprite, nextBlock, trigger);
+      };
+      break;
+
+      //データ
+      case "data":
+      switch(block.name){
+        case "add_random":
+        var rand = Math.floor(Math.random()*(value2+0.1)*10)/10.0;
+        _.find(currentVariables, function (varBlock) {return varBlock.value1.value == block.value1.value;}).value2.value += rand; 
+        break;
+        case "var_add":
+        _.find(currentVariables, function (varBlock) {return varBlock.value1.value == block.value1.value;}).value2.value += value2; 
+        break;
+        case "var_substract":
+        _.find(currentVariables, function (varBlock) {return varBlock.value1.value == block.value1.value;}).value2.value -= value2; 
+        break;
+        case "var_multiplicate":
+        _.find(currentVariables, function (varBlock) {return varBlock.value1.value == block.value1.value;}).value2.value *= value2; 
+        break;
+        case "var_divide":
+        _.find(currentVariables, function (varBlock) {return varBlock.value1.value == block.value1.value;}).value2.value /= value2; 
+        break;
+        case "var_rest":
+        _.find(currentVariables, function (varBlock) {return varBlock.value1.value == block.value1.value;}).value2.value %= value2; 
+        break;
+        case "var_substitute":
+        _.find(currentVariables, function (varBlock) {return varBlock.value1.value == block.value1.value;}).value2.value = value2; 
+        break;
+      }
+      goNextBlock(sprite, trigger);
+      break;
+
+      //時間の制御
+      case "time_control":
+      switch(block.name){
+        case "set_timer":
+        //タイマーの独自トリガーの場合と、最初に呼ばれた時の分岐
+        if (trigger.indexOf("set_timer") !== -1) {
+          var funcBlock = blockManager.findFunctionWithId(value2);
+          reaction.action.initialize(deltaTime, value1, funcBlock);
+        }else{
+          setBlock(sprite, block, getIdentifiedTrigger("set_timer"));
+          goNextBlock(sprite, trigger);
+        };
+        break;
+        case "wait":
+        reaction.action.initialize(deltaTime, value1);
+        break;
+      }
+      break;
+
+      //アプリの制御
+      case "app_control":
+      switch(block.name){
+        case "start_app":
+        goNextBlock(sprite, trigger);
+        break;
+        case "finish_app":
+        resetApp();
+        break;
+        case "tap_enable":
+        if (value1) {
+          sprite.tappable = true;
+        }else{
+          sprite.tappable = false;
+        };
+        goNextBlock(sprite, trigger);
+        break;
+        case "swipe_enable":
+        if (value1) {
+          sprite.swipeable = true;
+        }else{
+          sprite.swipeable = false;
+        };
+        goNextBlock(sprite, trigger);
+        break;
+      }
+      break;
+
+      //サウンド
+      case "sound":
+      switch(block.name){
+        case "play_sound":
+        if (block.value1.value) {
+          soundManager.playSound(block.value2.value, true);
+        }else{
+          soundManager.playSound(block.value2.value, false);
+        };
+        break;
+      }
+      goNextBlock(sprite, trigger);
+      break;
+
+      //スプライトの制御
+      case "sprite_control":
+      switch(block.name){
+        case "func_on_tag":
+        _.each(currentSprites, function(curSpr){
+          if (curSpr.tag == value1) {
+            var funcBlock = blockManager.findFunctionWithId(value2);
+            if (funcBlock) {
+              curSpr.reactions = {};
+              setBlock(curSpr, funcBlock, getIdentifiedTrigger("func_on_tag"));
+            }
+          };
+        });
+        goNextBlock(sprite, trigger);
+        break;
+        case "duplicate":
+        _.each(currentSprites, function(curSpr){
+          if (curSpr.tag == value1 &&  !curSpr.isCopied) {
+            var copiedSprite = spriteManager.copySprite(curSpr, currentSprites, false);
+            copiedSprite.position.x = sprite.position.x;
+            copiedSprite.position.y = sprite.position.y;
+            copiedSprite.isCopied = true;
+            var funcBlock = blockManager.findFunctionWithId(value2);
+            if (funcBlock) {
+              setBlock(copiedSprite, funcBlock, getIdentifiedTrigger("duplicate"));
+            };
+          };
+        });
+        goNextBlock(sprite, trigger);
+        break;
+        case "display":
+        _.each(currentSprites, function(curSpr){
+          if (curSpr.tag == value1) {
+            curSpr.text = Math.floor(value2);
+          };
+        });
+        goNextBlock(sprite, trigger);
+        break;
+      }
+      break;
+    }
+  }
+
+  function findNextBlock(block){
+    var id = block.bottomLinks[0].id;
+    if (id != null) {
+      return blockManager.findBlock(id);
+    }else{
+      return null;
+    };
+  }
+
+  function goNextBlock(sprite, trigger){
+    var block = sprite.reactions[trigger].block;
+    var nextBlock = findNextBlock(block);
+    if (nextBlock) {
+      setBlock(sprite, nextBlock, trigger);
+    }else{
+      sprite.reactions[trigger] = {block:null, action:null};
+    };
+  }
 
   var behaviors ={
     //移動
@@ -11,15 +329,19 @@ define(function(){
       var initialize = function(det, drtn, vector){
         passedTime = 0;
         //所要時間をミリ秒に変換
-        drtn *= 1000;
-        dx = vector.x/drtn*det;
-        dy = vector.y/drtn*det;
-        duration = drtn;
         dt = det;
+        duration = drtn * 1000;
+        if (drtn > 0) {
+          dx = vector.x/duration*det;
+          dy = vector.y/duration*det;
+        }else{
+          dx = vector.x;
+          dy = vector.y;
+        };
       }
 
       //単位時間ごとの動き
-      var behave = function(sprite, trigger, goNextBlock){
+      var behave = function(sprite, trigger){
         sprite.position.x += dx;
         sprite.position.y += dy;
         passedTime += dt;
@@ -34,24 +356,28 @@ define(function(){
       };
     },
 
-    rotate_left:function(){
+    rotate_right:function(){
       var passedTime = 0;
       //角度、単位時間
       var duration, da, dt;
 
       var initialize = function(det, drtn, angle){
         passedTime = 0;
+        dt = det;
         duration = drtn * 1000;
         //単位時間あたりの回転角度
-        da = angle / (drtn/det);
-        dt = det;
+        if (drtn > 0) {
+          da = angle * Math.PI/180 / (duration/det);
+        }else{
+          da = angle * Math.PI/180;
+        };
       }
 
-      var behave = function(sprite, trigger, goNextBlock){
+      var behave = function(sprite, trigger){
         sprite.angle += da;
         passedTime += dt;
         if (passedTime >= duration) {
-            goNextBlock(sprite, trigger);
+          goNextBlock(sprite, trigger);
         };
       }
 
@@ -61,24 +387,28 @@ define(function(){
       };
     },
 
-    rotate_right:function(){
+    rotate_left:function(){
       var passedTime = 0;
       //角度、単位時間
       var duration, da, dt;
 
       var initialize = function(det, drtn, angle){
         passedTime = 0;
+        dt = det;
         duration = drtn * 1000;
         //単位時間あたりの回転角度
-        da = angle / (drtn/det);
-        dt = det;
+        if (drtn > 0) {
+          da = angle * Math.PI/180 / (duration/det);
+        }else{
+          da = angle * Math.PI/180;
+        };
       }
 
-      var behave = function(sprite, trigger, goNextBlock){
+      var behave = function(sprite, trigger){
         sprite.angle -= da;
         passedTime += dt;
         if (passedTime >= duration) {
-            goNextBlock(sprite, trigger);
+          goNextBlock(sprite, trigger);
         };
       }
 
@@ -93,19 +423,23 @@ define(function(){
       //角度、単位時間
       var duration, ds, dt;
 
-      var initialize = function(det, drtn, scale){
+      var initialize = function(det, drtn, iniScale, finalScale){
         passedTime = 0;
+        dt = det;
         duration = drtn * 1000;
         //単位時間あたりのスケール変化量
-        ds = scale / (drtn/det);
-        dt = det;
+        if (drtn > 0) {
+          ds = (finalScale-iniScale) / (duration/det);
+        }else{
+          ds = finalScale-iniScale;
+        };
       }
 
-      var behave = function(sprite, trigger, goNextBlock){
+      var behave = function(sprite, trigger){
         sprite.scale += ds;
         passedTime += dt;
         if (passedTime >= duration) {
-            goNextBlock(sprite, trigger);
+          goNextBlock(sprite, trigger);
         };
       }
 
@@ -118,21 +452,26 @@ define(function(){
     opacity:function(){
       var passedTime = 0;
       //角度、単位時間
-      var duration, dopct, dt;
+      var duration, dp, dt;
 
-      var initialize = function(det, drtn, opacity){
+      var initialize = function(det, drtn, iniOpacity, finalOpacity){
         passedTime = 0;
+        dt = det;
         duration = drtn * 1000;
         //単位時間あたりのスケール変化量
-        dopct = opacity / (drtn/det);
-        dt = det;
+        if (drtn > 0) {
+          dp = (finalOpacity-iniOpacity) / (duration/det);
+        }else{
+          dp = finalOpacity-iniOpacity;
+        };
       }
 
-      var behave = function(sprite, trigger, goNextBlock){
-        sprite.opacity += dopct;
+      var behave = function(sprite, trigger){
+        sprite.opacity += dp;
         passedTime += dt;
         if (passedTime >= duration) {
-            goNextBlock(sprite, trigger);
+          if (sprite.opacity > 0.95) {sprite.opacity = 1.0};
+          goNextBlock(sprite, trigger);
         };
       }
 
@@ -142,24 +481,26 @@ define(function(){
       };
     },
 
-    mirror:function(){
+    set_timer:function(){
       var passedTime = 0;
-      //角度、単位時間
-      var duration, direction, dt;
+      var interval, dt;
+      var funcBlock;
 
-      var initialize = function(det, drtn, mirror){
+      var initialize = function(det, intvl, fnkBlk){
         passedTime = 0;
-        duration = drtn * 1000;
-        //単位時間あたりのスケール変化量
-        direction = mirror;
+        interval = intvl * 1000;
+        if (interval <= 100) {
+          interval = 100;
+        }
         dt = det;
+        funcBlock = fnkBlk;
       }
 
-      var behave = function(sprite, trigger, goNextBlock){
-        sprite.mirrored = direction;
+      var behave = function(sprite, trigger){
         passedTime += dt;
-        if (passedTime >= duration) {
-            goNextBlock(sprite, trigger);
+        if (passedTime >= interval) {
+          setBlock(sprite, funcBlock, getIdentifiedTrigger("timer"));
+          passedTime = 0;
         };
       }
 
@@ -179,7 +520,7 @@ define(function(){
         dt = det;
       }
 
-      var behave = function(sprite, trigger, goNextBlock){
+      var behave = function(sprite, trigger){
         passedTime += dt;
         if (passedTime >= duration) {
           goNextBlock(sprite, trigger);
@@ -194,6 +535,8 @@ define(function(){
   };
 
   return {
+    startAction:startAction,
+    setBlock:setBlock,
     behaviors:behaviors
   };
 });
diff --git a/app/webroot/js/pictcode/block_data.js b/app/webroot/js/pictcode/block_data.js
index 40a42cc..245907b 100644
--- a/app/webroot/js/pictcode/block_data.js
+++ b/app/webroot/js/pictcode/block_data.js
@@ -10,10 +10,6 @@ define(function(){
     iconImageKey:"ctgry_blk_001",
   },
   {
-    name:"loop",
-    iconImageKey:"ctgry_blk_003",
-  },
-  {
     name:"branch",
     iconImageKey:"ctgry_blk_004",
   },
@@ -26,13 +22,17 @@ define(function(){
     iconImageKey:"ctgry_blk_008",
   },
   {
-    name:"game_control",
+    name:"app_control",
     iconImageKey:"ctgry_blk_006",
   },
   {
     name:"sound",
     iconImageKey:"ctgry_blk_007",
-  }
+  },
+  {
+    name:"sprite_control",
+    iconImageKey:"ctgry_blk_003",
+  },
   ];
 
   var VALUETYPE = {
@@ -43,9 +43,10 @@ define(function(){
     FUNCTION: 4,
     SOUND_SELECTOR: 5,
     VARIABLE: 6,
-    VARIABLE_SELECTOR: 7,
+    TAG_SELECTOR: 7,
   }
 
+  //各ブロックのベース
   var baseBlock = {
     position: {x:0.0, y:0.0},
     size: {width:4.26, height:1.0},
@@ -63,6 +64,7 @@ define(function(){
       value: 0,
       valueSize: 0.629,
       valuePosition: {x:2.514, y:0.386},
+      canInput: true,
       isVariable: false,
       canBeVariable: false,
     },
@@ -77,6 +79,7 @@ define(function(){
       value: 0,
       valueSize: 0.629,
       valuePosition: {x:3.743, y:0.386},
+      canInput: true,
       isVariable:false,
       canBeVariable:false,
     },
@@ -84,7 +87,53 @@ define(function(){
 
   //各ブロックの初期データ
   var blocks = [
+  //関数
+  {
+    size: {width:3.057, height:1.0},
+    topLink: null,
+    category: "function",
+    name: "start_function",
+    imageKey: "blk_function_001",
+    value1:{
+      valueType: VALUETYPE.FUNCTION,
+    },
+    value2:{
+      available: false,
+    }
+  },
+
+  {
+    size: {width:3.057, height:0.771},
+    bottomLinks: null,
+    category: "function",
+    name: "return_function",
+    imageKey: "blk_function_002",
+    value1:{
+      iconImageKey: "icon_blk_003",
+      valueType: VALUETYPE.FUNC_SELECTOR,
+      value: 0,
+    },
+    value2:{
+      available: false,
+    }
+  },
+
+  {
+    size: {width:8.814, height:1.0},
+    bottomLinks: null,
+    category: "function",
+    name: "fork",
+    imageKey: "blk_function_003",
+    bottomLinks: [{id:null, position:{x:1.314, y:0.757}}, {id:null, position:{x:7.114, y:0.757}}],
+    value1:{
+      available: false,
+    },
+    value2:{
+      available: false,
+    }
+  },
 
+  //動きの制御
   {
     category: "movement",
     name: "move",
@@ -103,11 +152,227 @@ define(function(){
 
   {
     category: "movement",
-    name: "rotate",
+    name: "rotate_right",
     imageKey: "blk_motion_002",
+    value1:{
+      iconImageKey: "icon_blk_002",
+      value:1.2, //秒
+      canBeVariable: true,
+    },
+    value2:{
+      iconImageKey: "icon_blk_008",
+      value:90,
+      canBeVariable:true,
+    },
+  },
+
+  {
+    category: "movement",
+    name: "rotate_left",
+    imageKey: "blk_motion_003",
+    value1:{
+      iconImageKey: "icon_blk_002",
+      value:1.2, //秒
+      canBeVariable: true,
+    },
+    value2:{
+      iconImageKey: "icon_blk_009",
+      value:90,
+      canBeVariable:true,
+    },
+  },
+
+  {
+    category: "movement",
+    name: "zoom",
+    imageKey: "blk_motion_005",
+    value1:{
+      iconImageKey: "icon_blk_002",
+      value:1.2, //秒
+      canBeVariable: true,
+    },
+    value2:{
+      iconImageKey: "icon_blk_010",
+      value:2.0,
+      canBeVariable:true,
+    },
+  },
+
+  {
+    category: "movement",
+    name: "opacity",
+    imageKey: "blk_motion_004",
+    value1:{
+      iconImageKey: "icon_blk_002",
+      value:1.2, //秒
+      canBeVariable: true,
+    },
+    value2:{
+      iconImageKey: "icon_blk_011",
+      value:0.5,
+      canBeVariable:true,
+    },
+  },
+
+  {
+    category: "movement",
+    name: "self_duplicate",
+    imageKey: "blk_motion_006",
+    size: {width:3.057, height:1.0},
+    value1:{
+      iconImageKey: "icon_blk_020",
+      valueType: VALUETYPE.FUNC_SELECTOR,
+    },
+    value2:{
+      available:false,
+    },
+  },
+
+  {
+    category: "movement",
+    name: "self_kill",
+    imageKey: "blk_motion_007",
+    size: {width:3.057, height:0.771},
+    bottomLinks: null,
+    value1:{
+      available:false,
+    },
+    value2:{
+      available:false,
+    },
+  },
+
+  {
+    category: "movement",
+    name: "mirror",
+    imageKey: "blk_motion_008",
+    size: {width:3.057, height:1.0},
+    value1:{
+      available:false,
+    },
+    value2:{
+      available:false,
+    },
+  },
+
+  //分岐
+  {
+    category: "branch",
+    name: "branch_equal",
+    imageKey: "blk_branch_001",
+    size: {width:8.814, height:1.0},
+    bottomLinks: [{id:null, position:{x:1.314, y:0.757}}, {id:null, position:{x:7.114, y:0.757}}],
+
+    value1:{
+      iconImageKey: "icon_blk_014",
+      valueType: VALUETYPE.SCALAR,
+      value:0,
+      valuePosition: {x:3.19, y:0.386},
+      canBeVariable: true,
+    },
+    value2:{
+      iconImageKey: "icon_blk_015",
+      valueType: VALUETYPE.SCALAR,
+      value:0,
+      valuePosition: {x:5.62, y:0.386},
+      canBeVariable: true,
+    }
+  },
+
+  {
+    category: "branch",
+    name: "branch_larger",
+    imageKey: "blk_branch_005",
+    size: {width:8.814, height:1.0},
+    bottomLinks: [{id:null, position:{x:1.314, y:0.757}}, {id:null, position:{x:7.114, y:0.757}}],
+
+    value1:{
+      iconImageKey: "icon_blk_014",
+      valueType: VALUETYPE.SCALAR,
+      value:0,
+      valuePosition: {x:3.19, y:0.386},
+      canBeVariable: true,
+    },
+    value2:{
+      iconImageKey: "icon_blk_015",
+      valueType: VALUETYPE.SCALAR,
+      value:0,
+      valuePosition: {x:5.62, y:0.386},
+      canBeVariable: true,
+    }
   },
 
   {
+    category: "branch",
+    name: "branch_smaller",
+    imageKey: "blk_branch_003",
+    size: {width:8.814, height:1.0},
+    bottomLinks: [{id:null, position:{x:1.314, y:0.757}}, {id:null, position:{x:7.114, y:0.757}}],
+
+    value1:{
+      iconImageKey: "icon_blk_014",
+      valueType: VALUETYPE.SCALAR,
+      value:0,
+      valuePosition: {x:3.19, y:0.386},
+      canBeVariable: true,
+    },
+    value2:{
+      iconImageKey: "icon_blk_015",
+      valueType: VALUETYPE.SCALAR,
+      value:0,
+      valuePosition: {x:5.62, y:0.386},
+      canBeVariable: true,
+    }
+  },
+
+  {
+    category: "branch",
+    name: "branch_eqlarger",
+    imageKey: "blk_branch_004",
+    size: {width:8.814, height:1.0},
+    bottomLinks: [{id:null, position:{x:1.314, y:0.757}}, {id:null, position:{x:7.114, y:0.757}}],
+
+    value1:{
+      iconImageKey: "icon_blk_014",
+      valueType: VALUETYPE.SCALAR,
+      value:0,
+      valuePosition: {x:3.19, y:0.386},
+      canBeVariable: true,
+    },
+    value2:{
+      iconImageKey: "icon_blk_015",
+      valueType: VALUETYPE.SCALAR,
+      value:0,
+      valuePosition: {x:5.62, y:0.386},
+      canBeVariable: true,
+    }
+  },
+
+  {
+    category: "branch",
+    name: "branch_eqsmaller",
+    imageKey: "blk_branch_002",
+    size: {width:8.814, height:1.0},
+    bottomLinks: [{id:null, position:{x:1.314, y:0.757}}, {id:null, position:{x:7.114, y:0.757}}],
+
+    value1:{
+      iconImageKey: "icon_blk_014",
+      valueType: VALUETYPE.SCALAR,
+      value:0,
+      valuePosition: {x:3.19, y:0.386},
+      canBeVariable: true,
+    },
+    value2:{
+      iconImageKey: "icon_blk_015",
+      valueType: VALUETYPE.SCALAR,
+      value:0,
+      valuePosition: {x:5.62, y:0.386},
+      canBeVariable: true,
+    }
+  },
+
+  //データ
+  {
     category: "data",
     name: "var_scalar",
     imageKey: "blk_data_001",
@@ -116,38 +381,186 @@ define(function(){
     bottomLinks: null,
 
     value1:{
-      iconImageKey: "icon_blk_007",
+      iconImageKey: "icon_blk_018",
       valueType: VALUETYPE.VARIABLE,
       value:0,
     },
     value2:{
-      iconImageKey: "icon_blk_006",
+      iconImageKey: "icon_blk_019",
       valueType: VALUETYPE.SCALAR,
       value:0,
     }
   },
 
   {
-    category: "branch",
-    name: "branch_larger",
-    imageKey: "blk_branch_003",
-    size: {width:7.29, height:1.0},
-    bottomLinks: [{id:null, position:{x:1.314, y:0.757}}, {id:null, position:{x:5.571, y:0.757}}],
+    category: "data",
+    name: "add_random",
+    imageKey: "blk_data_002",
+    value1:{
+      iconImageKey: "icon_blk_018",
+      valueType: VALUETYPE.SCALAR,
+      value:0,
+      canInput: false,
+      canBeVariable: true,
+      isVariable: true,
+    },
+    value2:{
+      iconImageKey: "icon_blk_019",
+      value:0.5,
+      canBeVariable:true,
+    },
+  },
 
+  {
+    category: "data",
+    name: "var_add",
+    imageKey: "blk_data_003",
     value1:{
-      iconImageKey: "icon_blk_008",
+      iconImageKey: "icon_blk_018",
       valueType: VALUETYPE.SCALAR,
       value:0,
+      canInput: false,
+      canBeVariable: true,
+      isVariable: true,
     },
     value2:{
-      iconImageKey: "icon_blk_009",
+      iconImageKey: "icon_blk_019",
+      value:0.5,
+      canBeVariable:true,
+    },
+  },
+
+  {
+    category: "data",
+    name: "var_substract",
+    imageKey: "blk_data_004",
+    value1:{
+      iconImageKey: "icon_blk_018",
+      valueType: VALUETYPE.SCALAR,
+      value:0,
+      canInput: false,
+      canBeVariable: true,
+      isVariable: true,
+    },
+    value2:{
+      iconImageKey: "icon_blk_019",
+      value:0.5,
+      canBeVariable:true,
+    },
+  },
+
+  {
+    category: "data",
+    name: "var_multiplicate",
+    imageKey: "blk_data_005",
+    value1:{
+      iconImageKey: "icon_blk_018",
       valueType: VALUETYPE.SCALAR,
       value:0,
-      valuePosition: {x:6.771, y:0.386},
+      canInput: false,
+      canBeVariable: true,
+      isVariable: true,
+    },
+    value2:{
+      iconImageKey: "icon_blk_019",
+      value:0.5,
+      canBeVariable:true,
+    },
+  },
+
+  {
+    category: "data",
+    name: "var_divide",
+    imageKey: "blk_data_006",
+    value1:{
+      iconImageKey: "icon_blk_018",
+      valueType: VALUETYPE.SCALAR,
+      value:0,
+      canInput: false,
+      canBeVariable: true,
+      isVariable: true,
+    },
+    value2:{
+      iconImageKey: "icon_blk_019",
+      value:0.5,
+      canBeVariable:true,
+    },
+  },
+
+  {
+    category: "data",
+    name: "var_rest",
+    imageKey: "blk_data_007",
+    value1:{
+      iconImageKey: "icon_blk_018",
+      valueType: VALUETYPE.SCALAR,
+      value:0,
+      canInput: false,
+      canBeVariable: true,
+      isVariable: true,
+    },
+    value2:{
+      iconImageKey: "icon_blk_019",
+      value:0.5,
+      canBeVariable:true,
+    },
+  },
+
+  {
+    category: "data",
+    name: "var_substitute",
+    imageKey: "blk_data_008",
+    value1:{
+      iconImageKey: "icon_blk_018",
+      valueType: VALUETYPE.SCALAR,
+      value:0,
+      canInput: false,
+      canBeVariable: true,
+      isVariable: true,
+    },
+    value2:{
+      iconImageKey: "icon_blk_019",
+      value:0.5,
+      canBeVariable:true,
+    },
+  },
+
+  //時間の制御
+  {
+    category: "time_control",
+    name: "set_timer",
+    imageKey: "blk_timectrl_002",
+    value1:{
+      iconImageKey: "icon_blk_024",
+      valueType: VALUETYPE.SCALAR,
+      value: 0.5,
+      canBeVariable: true,
+    },
+    value2:{
+      iconImageKey: "icon_blk_013",
+      valueType: VALUETYPE.FUNC_SELECTOR,
+      value: 0,
     }
   },
 
   {
+    size: {width:3.057, height:1.0},
+    category: "time_control",
+    name: "wait",
+    imageKey: "blk_timectrl_001",
+    value1:{
+      iconImageKey: "icon_blk_024",
+      valueType: VALUETYPE.SCALAR,
+      value: 0.5,
+      canBeVariable: true,
+    },
+    value2:{
+      available: false,
+    }
+  },
+
+  //サウンド
+  {
     category: "sound",
     name: "play_sound",
     imageKey: "blk_sound_002",
@@ -161,24 +574,20 @@ define(function(){
     value2:{
       iconImageKey: "icon_blk_005",
       valueType: VALUETYPE.SOUND_SELECTOR,
-      value: null,
+      value: 0,
+      valuePosition: {x:4.829, y:0.386},
     },
   },
 
+  //アプリの制御
   {
-    category: "movement",
-    name: "zoom",
-    imageKey: "blk_motion_005",
-  },
-
-  {
+    category: "app_control",
+    name: "start_app",
+    imageKey: "blk_gmctrl_001",
     size: {width:3.057, height:1.0},
     topLink: null,
-    category: "function",
-    name: "start_function",
-    imageKey: "blk_function_001",
     value1:{
-      valueType: VALUETYPE.FUNCTION,
+      available: false,
     },
     value2:{
       available: false,
@@ -186,14 +595,13 @@ define(function(){
   },
 
   {
+    category: "app_control",
+    name: "finish_app",
+    imageKey: "blk_gmctrl_002",
     size: {width:3.057, height:0.771},
     bottomLinks: null,
-    category: "function",
-    name: "return_function",
-    imageKey: "blk_functoin_002",
     value1:{
-      iconImageKey: "icon_blk_003",
-      valueType: VALUETYPE.FUNC_SELECTOR,
+      available: false,
     },
     value2:{
       available: false,
@@ -201,36 +609,89 @@ define(function(){
   },
 
   {
+    category: "app_control",
+    name: "tap_enable",
+    imageKey: "blk_gmctrl_003",
     size: {width:3.057, height:1.0},
-    category: "time_control",
-    name: "wait",
-    imageKey: "blk_timectrl_001",
+
     value1:{
-      iconImageKey: "icon_blk_002",
-      valueType: VALUETYPE.SCALAR,
-      value: 0.5,
-      canBeVariable: true,
+      iconImageKey: "icon_blk_006",
+      valueType: VALUETYPE.CHECK,
+      value: true,
     },
     value2:{
       available: false,
-    }
+    },
   },
 
   {
+    category: "app_control",
+    name: "swipe_enable",
+    imageKey: "blk_gmctrl_004",
     size: {width:3.057, height:1.0},
-    category: "game_control",
-    name: "stop_time",
-    imageKey: "blk_gmctrl_001",
+
     value1:{
-      available: false,
+      iconImageKey: "icon_blk_006",
+      valueType: VALUETYPE.CHECK,
+      value: true,
     },
     value2:{
       available: false,
-    }
+    },
   },
   
+  //スプライトの制御
+  {
+    category: "sprite_control",
+    name: "func_on_tag",
+    imageKey: "blk_sprctrl_001",
+    value1:{
+      iconImageKey: "icon_blk_023",
+      valueType: VALUETYPE.TAG_SELECTOR,
+      value: 0,
+    },
+    value2:{
+      iconImageKey: "icon_blk_013",
+      valueType: VALUETYPE.FUNC_SELECTOR,
+      value: 0,
+    }
+  },
+
+  {
+    category: "sprite_control",
+    name: "duplicate",
+    imageKey: "blk_sprctrl_002",
+    value1:{
+      iconImageKey: "icon_blk_023",
+      valueType: VALUETYPE.TAG_SELECTOR,
+      value: 0,
+    },
+    value2:{
+      iconImageKey: "icon_blk_013",
+      valueType: VALUETYPE.FUNC_SELECTOR,
+      value: 0,
+    }
+  },
+
+  {
+    category: "sprite_control",
+    name: "display",
+    imageKey: "blk_sprctrl_003",
+    value1:{
+      iconImageKey: "icon_blk_023",
+      valueType: VALUETYPE.TAG_SELECTOR,
+      value: 0,
+    },
+    value2:{
+      iconImageKey: "icon_blk_025",
+      valueType: VALUETYPE.SCALAR,
+      value: 0,
+      canBeVariable: true,
+    }
+  },
   ];
 
+  //ベースブロックを継承
   _.each( blocks, function(block, i){
     var extended = $.extend(true, {}, baseBlock, block);
     blocks[i] = extended;
diff --git a/app/webroot/js/pictcode/block_drawer.js b/app/webroot/js/pictcode/block_drawer.js
index 0e32088..d863592 100644
--- a/app/webroot/js/pictcode/block_drawer.js
+++ b/app/webroot/js/pictcode/block_drawer.js
@@ -1,4 +1,4 @@
-define(["block_data", "image_manager", "utility", "sound_manager", "sprite_drawer"], function(blockData, imageManager, utility, soundManager, spriteDrawer){
+define(["block_data", "image_manager", "utility", "sound_manager", "sprite_drawer", "tag_selector"], function(blockData, imageManager, utility, soundManager, spriteDrawer, tagSelector){
 
   var gbCenterPositionOfCanvas = {x:0, y:0};//グローバル座標系
   var maxScroll = 100;
@@ -6,6 +6,8 @@ define(["block_data", "image_manager", "utility", "sound_manager", "sprite_drawe
 
   var dpInpRatio = spriteDrawer.dislayInnerSize.width/spriteDrawer.editorInnerSize.width;
 
+  var textBaseLineFactor = 0.05;
+
   //Canvasへの描画
   function drawBlocks(canvas, canvasContext, blocks, cBRatio){
 
@@ -45,57 +47,13 @@ define(["block_data", "image_manager", "utility", "sound_manager", "sprite_drawe
     });
 }
 
-  //選択強調の描画
-  function drawMarker(block, ctx){
-    //凸部を除いた高さの割合
-    var heightRatio = 1.0;
-    if (block.bottomLinks) {
-      heightRatio = block.bottomLinks[0].position.y;
-    }  
-    var l = block.drawnRect.x;
-    var t = block.drawnRect.y;
-    var w = block.drawnRect.width;
-    var h = block.drawnRect.height * heightRatio;
-    var originalH = block.drawnRect.height;
-    var topLink = block.topLink;
-    var bottomLinks = block.bottomLinks;
-
-    var r = h*0.1;
-    var linkR = h*0.5;
-    var pi = Math.PI;
-    var rightAngle = pi/8;
-    var leftAngle = pi-rightAngle;
-    var linkDepth = linkR*Math.sin(rightAngle);
-
-    ctx.save();
-    ctx.lineWidth = 6;
-    ctx.strokeStyle = "#ff0000";   
-    ctx.beginPath();
-    ctx.arc(l + r, t + r, r, - pi, - 0.5 * pi, false);
-    if (topLink) {
-      ctx.arc(l + originalH/block.size.height*topLink.position.x, t-linkDepth, linkR, leftAngle, rightAngle, true);
-    };
-    ctx.arc(l + w - r, t + r, r, - 0.5 * pi, 0, false);
-    ctx.arc(l + w - r, t + h - r, r, 0, 0.5 * pi, false);
-    if (bottomLinks) {
-      for (var i = bottomLinks.length - 1; i >= 0; i--) {
-        var bottomLink = bottomLinks[i];
-        ctx.arc(l + originalH*bottomLink.position.x, t-linkDepth + h, linkR, rightAngle, leftAngle, false);
-      };
-    };
-    ctx.arc(l + r, t + h - r, r, 0.5 * pi, pi, false);
-    ctx.closePath();
-    ctx.stroke();
-    ctx.restore();
-  }
-
   //ブロック上での描画
   function drawOnBlock(block, value, blkPosition, blkHeight, canvasContext){
     if (!value.available) {return;};
     switch(value.valueType){
       case blockData.VALUETYPE.SCALAR:
       if (value.isVariable) {
-        drawSelectedVariable(block, value, blkPosition, blkHeight, canvasContext);
+        drawVariable(block, value, blkPosition, blkHeight, canvasContext);
       }else{
         drawScalar(block, value, blkPosition, blkHeight, canvasContext);
       };
@@ -117,14 +75,17 @@ define(["block_data", "image_manager", "utility", "sound_manager", "sprite_drawe
       case blockData.VALUETYPE.VARIABLE_SELECTOR:
       drawVariable(block, value, blkPosition, blkHeight, canvasContext);
       break;
+      case blockData.VALUETYPE.TAG_SELECTOR:
+      drawTag(block, value, blkPosition, blkHeight, canvasContext);
+      break;
     }
   }
 
   function drawScalar(block, value, blkPosition, blkHeight, canvasContext){
-    var x = (value.valuePosition.x-value.valueSize*0.42)*blkHeight + blkPosition.x;
-    var y = (value.valuePosition.y+value.valueSize*0.18)*blkHeight + blkPosition.y;
-    var text = value.value.toFixed(1);
-    var size = value.valueSize * blkHeight*0.4;
+    var x = (value.valuePosition.x-value.valueSize*0.0)*blkHeight + blkPosition.x;
+    var y = (value.valuePosition.y+value.valueSize*textBaseLineFactor)*blkHeight + blkPosition.y;
+    var text = (value.value*1).toFixed(1);
+    var size = value.valueSize * blkHeight*0.5;
     drawText(text, x, y, size, canvasContext);
   }
 
@@ -146,73 +107,120 @@ define(["block_data", "image_manager", "utility", "sound_manager", "sprite_drawe
     canvasContext.restore();
 
     var distance = Math.round(Math.sqrt(value.value.x*value.value.x + value.value.y*value.value.y)*dpInpRatio);
-    var x = (value.valuePosition.x-value.valueSize*0.42)*blkHeight + blkPosition.x;
-    var y = (value.valuePosition.y+value.valueSize*0.18)*blkHeight + blkPosition.y;
-    var size = value.valueSize * blkHeight*0.4;
+    var x = (value.valuePosition.x-value.valueSize*0.0)*blkHeight + blkPosition.x;
+    var y = (value.valuePosition.y+value.valueSize*textBaseLineFactor)*blkHeight + blkPosition.y;
+    var size = value.valueSize * blkHeight*0.5;
     drawText(distance, x, y, size, canvasContext);
   }
 
   function drawCheck(block, value, blkPosition, blkHeight, canvasContext){
-    var x = (value.valuePosition.x-value.valueSize*0.38)*blkHeight + blkPosition.x;
-    var y = (value.valuePosition.y+value.valueSize*0.28)*blkHeight + blkPosition.y;
-    var check = "";
-    if (value.value) {
-      check = "O";
-    }else{
-      check = "X";
-    };
-    var size = value.valueSize * blkHeight*0.8;
-    drawText(check, x, y, size, canvasContext);
+    var checkImage;
+    switch(block.category == "sound"){
+      case "app_control":
+      if (value.value) {
+        checkImage = imageManager.images.icon_blk_021;
+      }else{
+        checkImage = imageManager.images.icon_blk_022;
+      };
+      default:
+      if (value.value) {
+        checkImage = imageManager.images.icon_blk_006;
+      }else{
+        checkImage = imageManager.images.icon_blk_007;
+      };
+      break;
+    }
+    var size = value.valueSize * blkHeight*0.7;
+    var x = (value.valuePosition.x)*blkHeight -size*0.5 + blkPosition.x;
+    var y = (value.valuePosition.y)*blkHeight -size*0.5 + blkPosition.y;
+    canvasContext.drawImage(checkImage, x, y, size, size);
   }
 
   function drawFunction(block, value, blkPosition, blkHeight, canvasContext){
-    var alphabet = utility.numberToAlphabet(value.value);
-    var x = (value.valuePosition.x-value.valueSize*0.21)*blkHeight + blkPosition.x;
-    var y = (value.valuePosition.y+value.valueSize*0.22)*blkHeight + blkPosition.y;
-    var size = value.valueSize * blkHeight*0.5;
+    var alphabet = utility.numberToLargeAlphabet(value.value);
+    var x = (value.valuePosition.x-value.valueSize*0.0)*blkHeight + blkPosition.x;
+    var y = (value.valuePosition.y+value.valueSize*textBaseLineFactor)*blkHeight + blkPosition.y;
+    var size = value.valueSize * blkHeight*0.32;
     drawText(alphabet, x, y, size, canvasContext);
   }
 
   function drawSound(block, value, blkPosition, blkHeight, canvasContext){
-    var x = (value.valuePosition.x-value.valueSize*0.3)*blkHeight + blkPosition.x;
-    var y = (value.valuePosition.y+value.valueSize*0.18)*blkHeight + blkPosition.y;
+    var x = (value.valuePosition.x-value.valueSize*0.0)*blkHeight + blkPosition.x;
+    var y = (value.valuePosition.y+value.valueSize*textBaseLineFactor)*blkHeight + blkPosition.y;
     var soundInfo = soundManager.findSoundInfoFromImageKey(value.value);
     if (!soundInfo) {
       return;
     };
-    var size = value.valueSize * blkHeight*0.4;
+    var size = value.valueSize * blkHeight*1.5;
     drawText(soundInfo.name, x, y, size, canvasContext);
   }
 
   function drawVariable(block, value, blkPosition, blkHeight, canvasContext){
-    var alphabet = utility.numberToAlphabet(value.value);
-    var x = (value.valuePosition.x-value.valueSize*0.21)*blkHeight + blkPosition.x;
-    var y = (value.valuePosition.y+value.valueSize*0.22)*blkHeight + blkPosition.y;
+    var alphabet = utility.numberToSmallAlphabet(value.value);
+    var x = (value.valuePosition.x-value.valueSize*0.0)*blkHeight + blkPosition.x;
+    var y = (value.valuePosition.y-value.valueSize*0.025)*blkHeight + blkPosition.y;
     var size = value.valueSize * blkHeight*0.5;
-    drawText(alphabet, x, y, size, canvasContext);
+    var circleX = value.valuePosition.x*blkHeight + blkPosition.x;
+    var circleY = value.valuePosition.y*blkHeight + blkPosition.y;
+    var circleR = value.valueSize * blkHeight * 0.35;
+    drawCircledText(alphabet, x, y, size, circleX, circleY, circleR, canvasContext, "#3cb371");
   }
 
-  function drawSelectedVariable(block, value, blkPosition, blkHeight, canvasContext){
-    var alphabet = utility.numberToAlphabet(value.value);
-    var x = (value.valuePosition.x-value.valueSize*0.21)*blkHeight + blkPosition.x;
-    var y = (value.valuePosition.y+value.valueSize*0.22)*blkHeight + blkPosition.y;
-    var size = value.valueSize * blkHeight*0.5;
-    drawCircledText(alphabet, x, y, size, canvasContext, "#20b2aa");
+  function drawTag(block, value, blkPosition, blkHeight, canvasContext){
+    var text = value.value;
+    var x = (value.valuePosition.x-value.valueSize*0.0)*blkHeight + blkPosition.x;
+    var y = (value.valuePosition.y+value.valueSize*textBaseLineFactor)*blkHeight + blkPosition.y;
+    var size = value.valueSize * blkHeight*0.4;
+    var circleX = value.valuePosition.x*blkHeight + blkPosition.x;
+    var circleY = value.valuePosition.y*blkHeight + blkPosition.y;
+    var circleR = value.valueSize * blkHeight * 0.35;
+    drawCircleFilledText(text, x, y, size, circleX, circleY, circleR, canvasContext, tagSelector.tagColors[value.value]);
   }
 
   function drawText(text, x, y, size, canvasContext){
-    canvasContext.font = "bold "+ size + "px " + "sans-serif";
+    canvasContext.save();
+    canvasContext.textAlign = "center";
+    canvasContext.textBaseline = "middle";
+    var metrics = canvasContext.measureText(text);
+    var fotSize = Math.floor(size/metrics.width*14);
+    if (fotSize > 30) {fotSize = 30};
+    canvasContext.font = "bold "+ fotSize + "px " + "sans-serif";
     canvasContext.fillStyle = "black";
     canvasContext.fillText(text, x, y);
+    canvasContext.restore();
   }
 
-  function drawCircledText(text, x, y, size, canvasContext, color){
-    // canvasContext.fillStyle = color;
-    // canvasContext.arc(x+size/2, y+size/2, 10, 0, 2*Math.PI, false);
-    // canvasContext.fill();
+  function drawCircledText(text, x, y, size, circleX, circleY, circleR, canvasContext, color){
+    canvasContext.save();
+    canvasContext.strokeStyle = color;
+    canvasContext.lineWidth = 6;
+    canvasContext.beginPath();
+    canvasContext.arc(circleX, circleY, circleR, 0, 2*Math.PI, false);
+    canvasContext.stroke();
+    canvasContext.restore();
+    canvasContext.save();
     canvasContext.font = "bold "+ size + "px " + "sans-serif";
+    canvasContext.textAlign = "center";
+    canvasContext.textBaseline = "middle";
+    canvasContext.fillStyle = color;
+    canvasContext.fillText(text, x, y);
+    canvasContext.restore();
+  }
+
+  function drawCircleFilledText(text, x, y, size, circleX, circleY, circleR, canvasContext, color){
+    canvasContext.save();
     canvasContext.fillStyle = color;
+    canvasContext.beginPath();
+    canvasContext.arc(circleX, circleY, circleR, 0, 2*Math.PI, false);
+    canvasContext.fill();
+    canvasContext.restore();
+    canvasContext.save();
+    canvasContext.font = "bold "+ size + "px " + "sans-serif";
+    canvasContext.textAlign = "center";
+    canvasContext.textBaseline = "middle";
+    canvasContext.fillStyle = "white";
     canvasContext.fillText(text, x, y);
+    canvasContext.restore();
   }
 
   //座標系の変換
@@ -281,8 +289,48 @@ define(["block_data", "image_manager", "utility", "sound_manager", "sprite_drawe
     dBlocks();
   }
 
-  function startPreview(targetBlock){
+  //選択強調の描画
+  function drawMarker(block, ctx){
+    //凸部を除いた高さの割合
+    var heightRatio = 1.0;
+    if (block.bottomLinks) {
+      heightRatio = block.bottomLinks[0].position.y;
+    }  
+    var l = block.drawnRect.x;
+    var t = block.drawnRect.y;
+    var w = block.drawnRect.width;
+    var h = block.drawnRect.height * heightRatio;
+    var originalH = block.drawnRect.height;
+    var topLink = block.topLink;
+    var bottomLinks = block.bottomLinks;
+
+    var r = h*0.1;
+    var linkR = h*0.5;
+    var pi = Math.PI;
+    var rightAngle = pi/8;
+    var leftAngle = pi-rightAngle;
+    var linkDepth = linkR*Math.sin(rightAngle);
 
+    ctx.save();
+    ctx.lineWidth = 6;
+    ctx.strokeStyle = "#ff0000";   
+    ctx.beginPath();
+    ctx.arc(l + r, t + r, r, - pi, - 0.5 * pi, false);
+    if (topLink) {
+      ctx.arc(l + originalH/block.size.height*topLink.position.x, t-linkDepth, linkR, leftAngle, rightAngle, true);
+    };
+    ctx.arc(l + w - r, t + r, r, - 0.5 * pi, 0, false);
+    ctx.arc(l + w - r, t + h - r, r, 0, 0.5 * pi, false);
+    if (bottomLinks) {
+      for (var i = bottomLinks.length - 1; i >= 0; i--) {
+        var bottomLink = bottomLinks[i];
+        ctx.arc(l + originalH*bottomLink.position.x, t-linkDepth + h, linkR, rightAngle, leftAngle, false);
+      };
+    };
+    ctx.arc(l + r, t + h - r, r, 0.5 * pi, pi, false);
+    ctx.closePath();
+    ctx.stroke();
+    ctx.restore();
   }
 
   return {
diff --git a/app/webroot/js/pictcode/block_manager.js b/app/webroot/js/pictcode/block_manager.js
index 7fa4e29..f60b50b 100644
--- a/app/webroot/js/pictcode/block_manager.js
+++ b/app/webroot/js/pictcode/block_manager.js
@@ -1,4 +1,4 @@
-define(['block_data', 'image_manager', 'block_action', 'utility'], function(blockData, imageManager, blockAction, utility){
+define(['block_data', 'image_manager', 'utility'], function(blockData, imageManager, utility){
 
   var targetBlock;
   var previousPosition = {};
@@ -12,7 +12,9 @@ define(['block_data', 'image_manager', 'block_action', 'utility'], function(bloc
   var blockAddCount = 0;
 
   function initialize(blks, dBlks, removeFuncFromSpr, didStTgt){
-    blocks.concat(blks);
+    _.each(blks, function(blk){
+      blocks.push(blk);
+    });
     drawBlocks = dBlks;
     removeFunctionFromSprite = removeFuncFromSpr;
     didSetTarget = didStTgt;
@@ -61,7 +63,7 @@ define(['block_data', 'image_manager', 'block_action', 'utility'], function(bloc
 
     drawBlocks();
 
-    var iconSize = 25;
+    var iconSize = 35;
     var inputButtons = [$("#block_input1"), $("#block_input2")];
     var values = [targetBlock.value1, targetBlock.value2];
     _.each(inputButtons, function(inputButton, idx){
@@ -119,7 +121,7 @@ define(['block_data', 'image_manager', 'block_action', 'utility'], function(bloc
               var topLinkY = block.position.y + block.size.height/2 - block.topLink.position.y;
               if (topLinkX>rangeLeft && topLinkX<rangeRight && topLinkY>rangeBottom && topLinkY<rangeTop) {
                 connectedBlock = block;
-                var linkID = _.uniqueId('link_');
+                var linkID = findUnusedLinkId();
                 block.topLink.id = linkID;
                 bottomLink.id = linkID;
                 var dx = block.position.x - block.size.width/2 + block.topLink.position.x - (gblock.position.x - gblock.size.width/2 +bottomLink.position.x);
@@ -150,7 +152,7 @@ define(['block_data', 'image_manager', 'block_action', 'utility'], function(bloc
               var bottomLinkY = block.position.y + block.size.height/2 - bottomLink.position.y;
               if (bottomLinkX>rangeLeft && bottomLinkX<rangeRight && bottomLinkY>rangeBottom && bottomLinkY<rangeTop) {
                 connectedBlock = block;
-                var linkID = _.uniqueId('link_');
+                var linkID = findUnusedLinkId();
                 bottomLink.id = linkID;
                 gblock.topLink.id = linkID;
                 var dx = block.position.x - block.size.width/2 + bottomLink.position.x - (gblock.position.x - gblock.size.width/2 +gblock.topLink.position.x);
@@ -166,6 +168,37 @@ define(['block_data', 'image_manager', 'block_action', 'utility'], function(bloc
     drawBlocks();
   }
 
+  function findUnusedLinkId(){
+    var idNumber = 0;
+    var linkID = "";
+    var notFound = true;
+    while(notFound){
+      var isUsed = false;
+      linkID = "link_" + idNumber;
+      LINKLOOP:for (var i = 0; i < blocks.length; i++) {
+        var block = blocks[i];
+        if (block.topLink && block.topLink.id === linkID) {
+          isUsed = true;
+          break LINKLOOP;
+        };
+        if (block.bottomLinks) {
+          for (var j = 0; j < block.bottomLinks.length; j++) {
+            if(block.bottomLinks[j].id === linkID){
+              isUsed = true;
+              break LINKLOOP;
+            }
+          };
+        };
+      };
+      if (isUsed) {
+        idNumber++;
+      }else{
+        notFound = false;
+      };
+    };
+    return linkID;
+  }
+
   function moveGroupBlocks(dx, dy, group){
     for (var i = 0; i < group.length; i++) {
       var block = group[i];
@@ -336,6 +369,16 @@ define(['block_data', 'image_manager', 'block_action', 'utility'], function(bloc
     return targetVar;
   }
 
+  function getStartAppBlocks(){
+    var startAppBlocks = [];
+    _.each(blocks, function(block){
+      if (block.name == "start_app") {
+        startAppBlocks.push(block);
+      };
+    });
+    return startAppBlocks;
+  }
+
   function getTargetBlock(){
     return targetBlock;
   }
@@ -349,14 +392,23 @@ define(['block_data', 'image_manager', 'block_action', 'utility'], function(bloc
   function copyBlock(){
     if (!targetBlock) {return;};
     var copiedBlock = $.extend(true, {}, targetBlock);
-    setTarget(0, 0, copiedBlock);
     copiedBlock.position.x += 0.2;
     copiedBlock.position.y -= 0.2;
-    copiedBlock.topLink.id = null;
-    _.each(copiedBlock.bottomLinks, function(bottomLink){
-      bottomLink.id = null;
-    });
+    if (copiedBlock.topLink) {
+      copiedBlock.topLink.id = null;
+    };
+    if (copiedBlock.bottomLinks) {
+      _.each(copiedBlock.bottomLinks, function(bottomLink){
+        bottomLink.id = null;
+      });   
+    };
+    if (copiedBlock.name == "start_function") {
+      copiedBlock.value1.value = findUnusedId(getFunctions());
+    }else if(copiedBlock.name == "var_scalar"){
+      copiedBlock.value1.value = findUnusedId(getVariables());
+    };
     blocks.push(copiedBlock);
+    setTarget(0, 0, copiedBlock);
     drawBlocks();
   }
 
@@ -424,6 +476,7 @@ define(['block_data', 'image_manager', 'block_action', 'utility'], function(bloc
     findFunctionWithId:findFunctionWithId,
     getVariables:getVariables,
     findVariableWithId:findVariableWithId,
+    getStartAppBlocks:getStartAppBlocks,
     unlinkBlock:unlinkBlock,
     copyBlock:copyBlock,
     deleteBlock:deleteBlock,
diff --git a/app/webroot/js/pictcode/coding_manager.js b/app/webroot/js/pictcode/coding_manager.js
index d943a86..98b8f28 100644
--- a/app/webroot/js/pictcode/coding_manager.js
+++ b/app/webroot/js/pictcode/coding_manager.js
@@ -79,8 +79,12 @@ define(['block_selector', 'canvas_manager', 'image_manager', 'block_drawer', 'bl
     //ターゲットの設定
     blockManager.setTarget(0, 0, blockManager.getTargetBlock());
 
+    //block画像の設定
+    _.each(blockManager.blocks, function(block){
+      block.image = imageManager.images[block.imageKey];
+    });
+
     drawBlocks();
-    previewManager.initializePreview();
   }
 
   function didSwitchToCodingTab(){
@@ -149,7 +153,6 @@ define(['block_selector', 'canvas_manager', 'image_manager', 'block_drawer', 'bl
     didSwitchToCodingTab:didSwitchToCodingTab,
     didQuitCodingTab:didQuitCodingTab,
     getFunctions:getFunctions,
-    findBlock:blockManager.findBlock,
     findFunctionWithId:blockManager.findFunctionWithId,
   };
 });
\ No newline at end of file
diff --git a/app/webroot/js/pictcode/connection_manager.js b/app/webroot/js/pictcode/connection_manager.js
index 4edbf3d..89adebe 100644
--- a/app/webroot/js/pictcode/connection_manager.js
+++ b/app/webroot/js/pictcode/connection_manager.js
@@ -1,4 +1,4 @@
-define(['block_manager', 'sprite_manager'], function(blockManager, spriteManager) {
+define(['block_manager', 'sprite_manager', 'image_manager', 'block_data', 'sprite_data', 'dummy_apps'], function(blockManager, spriteManager, imageManager, blockData, spriteData, dummyApps) {
 
   var sampleData = '{"blocks":[], "sprites":[]}';
   var didLoad;
@@ -9,12 +9,71 @@ define(['block_manager', 'sprite_manager'], function(blockManager, spriteManager
   }
 
   function imitateConnection(){
-    didLoadData(sampleData);
+    var appData = JSON.parse(dummyApps.appJSONs[3]);
+    //blockのロード
+    var blocks = [];
+    _.each(appData.blocks, function(blockInfo){
+      var blockProto = blockData.getBlock(blockInfo.name);
+      var block = $.extend(true, {}, blockProto);
+      block.position = blockInfo.position;
+      if (block.topLink) {
+        block.topLink.id = blockInfo.topLinkId;
+      };
+      if (block.bottomLinks) {
+        for (var i = 0; i < block.bottomLinks.length; i++) {
+          if (i < block.bottomLinks.length && i < blockInfo.bottomLinkIds.length) {
+            block.bottomLinks[i].id = blockInfo.bottomLinkIds[i];
+          };
+        };
+      };
+      block.value1.value = blockInfo.values[0];
+      if (blockInfo.isVars) {
+        block.value1.isVariable = blockInfo.isVars[0];
+      };
+      block.value2.value = blockInfo.values[1];
+      if (blockInfo.isVars) {
+        block.value2.isVariable = blockInfo.isVars[1];
+      };
+      blocks.push(block);
+    });
+    //spriteのロード
+    var sprites = [];
+    _.each(appData.sprites, function(spriteInfo){
+      var spriteImageInfo = spriteData.findSpriteImageInfoFromImageKey(spriteInfo.imageKey);
+      var sprite = {
+        id: spriteInfo.id,
+        imageKey:spriteImageInfo.imageKey,
+        type:spriteInfo.type,
+        position:spriteInfo.position,
+        aspectRatio:spriteInfo.aspectRatio,
+        scale:spriteInfo.scale,
+        angle:spriteInfo.angle,
+        opacity:spriteInfo.opacity,
+        mirrored:spriteInfo.mirrored,
+        animating:spriteInfo.animating,
+        animationCount:0,
+        tag:spriteInfo.tag*1,
+        collision:spriteInfo.collision,
+      };
+      if (spriteInfo.tapFuncIdx !== null) {
+        sprite.tapFuncIdx = spriteInfo.tapFuncIdx;
+      }else{
+        sprite.tapFuncIdx = null;
+      };
+      if (spriteInfo.startFuncIdx !== null) {
+        sprite.startFuncIdx = spriteInfo.startFuncIdx;
+      }else{
+        sprite.startFuncIdx = null;
+      };
+      sprites.push(sprite);
+    });
+
+    var blocksAndSprites = {blocks:blocks, sprites:sprites};
+    didLoadData(blocksAndSprites);
   }
 
   function didLoadData(data){
-    var loadedData = JSON.parse(data);
-    didLoad(loadedData);
+    didLoad(data);
   }
 
   function saveData(){
@@ -22,11 +81,55 @@ define(['block_manager', 'sprite_manager'], function(blockManager, spriteManager
   }
 
   $(document).on("click","#save_data", function(event) {
-    console.log(JSON.stringify({blocks:blockManager.blocks, sprites:spriteManager.sprites}));
+    //保存するblockデータ
+    var blocks = blockManager.blocks;
+    var blockInfos = [];
+    _.each(blocks, function(block){
+      var blockInfo = {
+        name: block.name,
+        position: block.position,
+        values: [block.value1.value, block.value2.value],
+        isVars:[block.value1.isVariable, block.value2.isVariable],
+      };
+      if (block.topLink) {
+        blockInfo.topLinkId = block.topLink.id;
+      }
+      if (block.bottomLinks) {
+        var bottomLinkIds = [];
+        _.each(block.bottomLinks, function(btmLinks){
+          bottomLinkIds.push(btmLinks.id);
+        });
+        blockInfo.bottomLinkIds = bottomLinkIds;
+      }
+      blockInfos.push(blockInfo);
+    });
+    //保存するspriteデータ
+    var sprites = spriteManager.sprites;
+    var spriteInfos = [];
+    _.each(sprites, function(sprite){
+      var spriteInfo = {
+        id: sprite.id,
+        imageKey: sprite.imageKey,
+        type:sprite.type,
+        position: sprite.position,
+        aspectRatio:sprite.aspectRatio,
+        scale: sprite.scale,
+        angle: sprite.angle,
+        opacity: sprite.opacity,
+        mirrored: sprite.mirrored,
+        animating: sprite.animating,
+        tag: sprite.tag,
+        tapFuncIdx: sprite.tapFuncIdx,
+        startFuncIdx: sprite.startFuncIdx,
+        collision: sprite.collision,
+      };
+      spriteInfos.push(spriteInfo);
+    });
+    console.log(JSON.stringify({blocks:blockInfos, sprites:spriteInfos}));
   });
 
-  return {
-    loadData:loadData,
-    saveData:saveData,
-  };
+return {
+  loadData:loadData,
+  saveData:saveData,
+};
 });
\ No newline at end of file
diff --git a/app/webroot/js/pictcode/dummy_apps.js b/app/webroot/js/pictcode/dummy_apps.js
new file mode 100644
index 0000000..d737dab
--- /dev/null
+++ b/app/webroot/js/pictcode/dummy_apps.js
@@ -0,0 +1,14 @@
+define(function(){
+
+  var appJSONs = [
+    '{"blocks":[], "sprites":[]}',
+    '{"blocks":[{"name":"start_function","position":{"x":-4.418815487997178,"y":3.9997275626056488},"values":[0,0],"bottomLinkIds":["link_1"]},{"name":"play_sound","position":{"x":-2.7323154879971883,"y":3.2427275626056518},"values":[false,"60"],"topLinkId":"link_1","bottomLinkIds":["link_6"]},{"name":"return_function","position":{"x":-4.4188154879971835,"y":2.600227562605656},"values":["3",0],"topLinkId":"link_6"},{"name":"play_sound","position":{"x":-2.797133792859666,"y":0.6866903499469788},"values":[false,"59"],"topLinkId":"link_11","bottomLinkIds":["link_14"]},{"name":"return_function","position":{"x":-4.483633792859668,"y":0.044190349946979526},"values":["3",0],"topLinkId":"link_14"},{"name":"start_function","position":{"x":-4.483633792859669,"y":1.4436903499469793},"values":[1,0],"bottomLinkIds":["link_11"]},{"name":"play_sound","position":{"x":-2.77387469070343,"y":-1.901874513962532},"values":[false,"26"],"topLinkId":"link_10","bottomLinkIds":["link_13"]},{"name":"return_function","position":{"x":-4.460374690703429,"y":-2.5443745139625307},"values":["3",0],"topLinkId":"link_13"},{"name":"start_function","position":{"x":-4.460374690703429,"y":-1.1448745139625296},"values":[2,0],"bottomLinkIds":["link_10"]},{"name":"start_function","position":{"x":2.892506185931424,"y":-1.072074938140686},"values":[4,0],"bottomLinkIds":["link_3"]},{"name":"fork","position":{"x":5.771006185931424,"y":-1.829074938140686},"values":[0,0],"topLinkId":"link_3","bottomLinkIds":["link_5","link_7"]},{"name":"move","position":{"x":3.4940061859314238,"y":-2.586074938140686},"values":[1.2,{"x":4.2862637970157365e-15,"y":70}],"topLinkId":"link_5","bottomLinkIds":["link_8"]},{"name":"opacity","position":{"x":9.294006185931424,"y":-2.586074938140686},"values":[1.2,0],"topLinkId":"link_7","bottomLinkIds":[null]},{"name":"self_kill","position":{"x":2.892506185931424,"y":-3.228574938140686},"values":[0,0],"topLinkId":"link_8"},{"name":"start_function","position":{"x":2.851113467656425,"y":2.3071580063626675},"values":[3,0],"bottomLinkIds":["link_0"]},{"name":"rotate_right","position":{"x":3.452613467656425,"y":0.7931580063626673},"values":[0.1,5.4],"topLinkId":"link_2","bottomLinkIds":["link_4"]},{"name":"rotate_left","position":{"x":3.452613467656425,"y":0.03615800636266332},"values":[0.1,5.4],"topLinkId":"link_4","bottomLinkIds":[null]},{"name":"duplicate","position":{"x":3.452613467656425,"y":1.5501580063626674},"values":["1","4"],"topLinkId":"link_0","bottomLinkIds":["link_2"]}],"sprites":[{"id":0,"imageKey":203,"type":"background","position":{"x":0,"y":0},"aspectRatio":0.8,"scale":1,"angle":0,"opacity":1,"mirrored":false,"animating":false,"tag":0,"tapFuncIdx":null,"startFuncIdx":null,"collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":1,"imageKey":700,"type":"sprite","position":{"x":-215.96244131455407,"y":-7.511737089201878},"aspectRatio":0.9375,"scale":1,"angle":0,"opacity":1,"mirrored":false,"animating":true,"tag":0,"tapFuncIdx":"0","startFuncIdx":null,"collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":2,"imageKey":701,"type":"sprite","position":{"x":214.69483568075134,"y":-15.633802816901408},"aspectRatio":0.9375,"scale":1,"angle":0,"opacity":1,"mirrored":false,"animating":true,"tag":0,"tapFuncIdx":"2","startFuncIdx":null,"collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":3,"imageKey":702,"type":"sprite","position":{"x":3.708920187793417,"y":13.192488262910796},"aspectRatio":0.9375,"scale":1.367258634792404,"angle":0.043229417243818014,"opacity":1,"mirrored":false,"animating":true,"tag":0,"tapFuncIdx":"1","startFuncIdx":null,"collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":4,"imageKey":703,"type":"sprite","position":{"x":-430.0469483568079,"y":334.2723004694838},"aspectRatio":1,"scale":0.3305164319248875,"angle":-3.219646771412954e-15,"opacity":1,"mirrored":false,"animating":false,"tag":"1","tapFuncIdx":null,"startFuncIdx":null,"collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]}]}',
+    '{"blocks":[{"name":"var_scalar","position":{"x":-8.767833156592431,"y":2.4899964651820294},"values":[0,0],"isVars":[false,false]},{"name":"start_function","position":{"x":6.473382820784737,"y":-2.7933300636267244},"values":[3,0],"isVars":[false,false],"bottomLinkIds":["link_25"]},{"name":"move","position":{"x":7.074882820784737,"y":-3.5503300636267245},"values":[0.8,{"x":-2.5717582782094416e-14,"y":-140}],"isVars":[false,false],"topLinkId":"link_25","bottomLinkIds":["link_28"]},{"name":"finish_app","position":{"x":6.473382820784737,"y":-4.949830063626722},"values":[0,0],"isVars":[false,false],"topLinkId":"link_26"},{"name":"wait","position":{"x":6.473382820784737,"y":-4.307330063626722},"values":[3,0],"isVars":[false,false],"topLinkId":"link_28","bottomLinkIds":["link_26"]},{"name":"start_function","position":{"x":-0.228632025450691,"y":0.0807467302933916},"values":[1,0],"isVars":[false,false],"bottomLinkIds":["link_0"]},{"name":"play_sound","position":{"x":1.4578679745493142,"y":-0.6762532697066111},"values":[false,"4"],"isVars":[false,false],"topLinkId":"link_0","bottomLinkIds":["link_22"]},{"name":"var_add","position":{"x":0.37286797454931386,"y":-1.4332532697066094},"values":["2",100],"isVars":[true,false],"topLinkId":"link_22","bottomLinkIds":["link_21"]},{"name":"tap_enable","position":{"x":-0.22863202545068584,"y":-2.9472532697066094},"values":[false,0],"isVars":[false,false],"topLinkId":"link_4","bottomLinkIds":["link_2"]},{"name":"move","position":{"x":0.372867974549314,"y":-3.7042532697066113},"values":[0.2,{"x":0,"y":210}],"isVars":[false,false],"topLinkId":"link_2","bottomLinkIds":["link_3"]},{"name":"move","position":{"x":0.372867974549314,"y":-4.461253269706616},"values":[0.3,{"x":-3.857637417314162e-14,"y":-210}],"isVars":[false,false],"topLinkId":"link_3","bottomLinkIds":["link_5"]},{"name":"return_function","position":{"x":-0.22863202545068434,"y":-5.10375326970662},"values":[0,0],"isVars":[false,false],"topLinkId":"link_5"},{"name":"display","position":{"x":0.3728679745493141,"y":-2.1902532697066106},"values":["1","2"],"isVars":[false,true],"topLinkId":"link_21","bottomLinkIds":["link_4"]},{"name":"var_scalar","position":{"x":0.37274655355249653,"y":1.764050901378583},"values":[2,0],"isVars":[false,false]},{"name":"start_app","position":{"x":-0.232732414280665,"y":4.618748586072811},"values":[0,0],"isVars":[false,false],"bottomLinkIds":["link_9"]},{"name":"play_sound","position":{"x":1.4537675857193393,"y":3.8617485860728107},"values":[true,"1007"],"isVars":[false,false],"topLinkId":"link_9","bottomLinkIds":["link_23"]},{"name":"display","position":{"x":0.3687675857193393,"y":3.104748586072812},"values":["1",0],"isVars":[false,false],"topLinkId":"link_23","bottomLinkIds":[null]},{"name":"var_scalar","position":{"x":7.218663838812305,"y":1.8870272180982715},"values":[1,30],"isVars":[false,false]},{"name":"start_function","position":{"x":6.574019088016972,"y":0.6640930540827135},"values":[2,0],"isVars":[false,false],"bottomLinkIds":["link_16"]},{"name":"var_substract","position":{"x":7.175519088016972,"y":-0.09290694591728356},"values":["1",1],"isVars":[true,false],"topLinkId":"link_16","bottomLinkIds":["link_18"]},{"name":"branch_larger","position":{"x":9.452519088016972,"y":-0.8499069459172834},"values":["1",0],"isVars":[true,false],"topLinkId":"link_18","bottomLinkIds":["link_19","link_24"]},{"name":"display","position":{"x":7.175519088016972,"y":-1.6069069459172838},"values":["2","1"],"isVars":[false,true],"topLinkId":"link_19","bottomLinkIds":[null]},{"name":"display","position":{"x":12.97551908801697,"y":-1.6069069459172838},"values":["2",0],"isVars":[false,false],"topLinkId":"link_24","bottomLinkIds":["link_20"]},{"name":"func_on_tag","position":{"x":12.975519088016972,"y":-3.1209069459172825},"values":["4","3"],"isVars":[false,false],"topLinkId":"link_27","bottomLinkIds":[null]},{"name":"branch_equal","position":{"x":15.252519088016971,"y":-2.3639069459172806},"values":["1",0],"isVars":[true,false],"topLinkId":"link_20","bottomLinkIds":["link_27",null]},{"name":"start_app","position":{"x":6.563237893248489,"y":4.510374690703422},"values":[0,0],"isVars":[false,false],"bottomLinkIds":["link_17"]},{"name":"display","position":{"x":7.164737893248489,"y":3.7533746907034224},"values":["2","1"],"isVars":[false,true],"topLinkId":"link_17","bottomLinkIds":["link_12"]},{"name":"set_timer","position":{"x":7.164737893248489,"y":2.9963746907034223},"values":[1,"2"],"isVars":[false,false],"topLinkId":"link_12","bottomLinkIds":[null]},{"name":"start_function","position":{"x":-4.850063278735963,"y":4.641385392227412},"values":[0,0],"isVars":[false,false],"bottomLinkIds":["link_7"]},{"name":"tap_enable","position":{"x":-4.850063278735963,"y":3.884385392227415},"values":[false,0],"isVars":[false,false],"topLinkId":"link_7","bottomLinkIds":["link_11"]},{"name":"move","position":{"x":-4.248563278735963,"y":3.1273853922274157},"values":[0.5,{"x":-1.2858791391047208e-14,"y":-70}],"isVars":[false,false],"topLinkId":"link_11","bottomLinkIds":["link_6"]},{"name":"var_substitute","position":{"x":-4.248563278735963,"y":2.3703853922274165},"values":[0,0],"isVars":[true,false],"topLinkId":"link_6","bottomLinkIds":["link_10"]},{"name":"add_random","position":{"x":-4.248563278735964,"y":1.6133853922274257},"values":[0,1.5],"isVars":[true,false],"topLinkId":"link_10","bottomLinkIds":["link_1"]},{"name":"wait","position":{"x":-4.850063278735968,"y":0.8563853922274287},"values":["0",0],"isVars":[true,false],"topLinkId":"link_1","bottomLinkIds":["link_14"]},{"name":"move","position":{"x":-4.248563278735968,"y":0.09938539222742812},"values":[0.3,{"x":4.2862637970157365e-15,"y":70}],"isVars":[false,false],"topLinkId":"link_14","bottomLinkIds":["link_15"]},{"name":"tap_enable","position":{"x":-4.850063278735968,"y":-0.6576146077725716},"values":[true,0],"isVars":[false,false],"topLinkId":"link_15","bottomLinkIds":["link_13"]},{"name":"return_function","position":{"x":-4.850063278735968,"y":-2.05711460777257},"values":["0",0],"isVars":[false,false],"topLinkId":"link_8"},{"name":"wait","position":{"x":-4.850063278735968,"y":-1.4146146077725705},"values":[0.3,0],"isVars":[false,false],"topLinkId":"link_13","bottomLinkIds":["link_8"]}],"sprites":[{"id":0,"imageKey":200,"type":"background","position":{"x":0,"y":0},"aspectRatio":0.8,"scale":1,"angle":0,"opacity":1,"mirrored":false,"animating":false,"tag":0,"tapFuncIdx":null,"startFuncIdx":null,"collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":2,"imageKey":500,"type":"sprite","position":{"x":143.94366197183075,"y":-202.1596244131459},"aspectRatio":1.1777777777777778,"scale":1,"angle":0,"opacity":1,"mirrored":false,"animating":false,"tag":1,"tapFuncIdx":null,"startFuncIdx":null,"collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":4,"imageKey":501,"type":"sprite","position":{"x":272.2535211267606,"y":-202.76995305164323},"aspectRatio":1.1777777777777778,"scale":1,"angle":0,"opacity":1,"mirrored":false,"animating":false,"tag":2,"tapFuncIdx":null,"startFuncIdx":null,"collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":1,"imageKey":110,"type":"sprite","position":{"x":0.6103286384976525,"y":-8.12206572769953},"aspectRatio":0.9375,"scale":1,"angle":0,"opacity":1,"mirrored":false,"animating":false,"tag":0,"tapFuncIdx":"1","startFuncIdx":"0","collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":7,"imageKey":110,"type":"sprite","position":{"x":235.9624413145541,"y":23.19248826291081},"aspectRatio":0.9375,"scale":1,"angle":0,"opacity":1,"mirrored":false,"animating":false,"tag":0,"tapFuncIdx":"1","startFuncIdx":"0","collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":8,"imageKey":110,"type":"sprite","position":{"x":-221.64319248826314,"y":20.70422535211267},"aspectRatio":0.9375,"scale":1,"angle":0,"opacity":1,"mirrored":false,"animating":false,"tag":0,"tapFuncIdx":"1","startFuncIdx":"0","collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":6,"imageKey":300,"type":"sprite","position":{"x":-219.8122065727701,"y":-60.000000000000064},"aspectRatio":0.9375,"scale":1.1430865684547267,"angle":0.005971721820647091,"opacity":1,"mirrored":false,"animating":false,"tag":0,"tapFuncIdx":null,"startFuncIdx":null,"collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":3,"imageKey":300,"type":"sprite","position":{"x":0.5164319248825189,"y":-90.65727699530517},"aspectRatio":0.9375,"scale":1.1430865684547267,"angle":0.005971721820647091,"opacity":1,"mirrored":false,"animating":false,"tag":0,"tapFuncIdx":null,"startFuncIdx":null,"collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":5,"imageKey":300,"type":"sprite","position":{"x":237.74647887323903,"y":-55.58685446009401},"aspectRatio":0.9375,"scale":1.1430865684547267,"angle":0.005971721820647091,"opacity":1,"mirrored":false,"animating":false,"tag":0,"tapFuncIdx":null,"startFuncIdx":null,"collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":9,"imageKey":504,"type":"sprite","position":{"x":-1.8779342723004726,"y":315.49295774647885},"aspectRatio":0.1875,"scale":1.83981847121349,"angle":0.006440191991010785,"opacity":1,"mirrored":false,"animating":false,"tag":4,"tapFuncIdx":null,"startFuncIdx":null,"collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]}]}',
+    '{"blocks":[{"name":"start_function","position":{"x":-4.534146341463417,"y":-0.36511134676564205},"values":[5,0],"isVars":[false,false],"bottomLinkIds":["link_1"]},{"name":"duplicate","position":{"x":-3.9326463414634145,"y":-1.122111346765642},"values":["1","4"],"isVars":[false,false],"topLinkId":"link_1","bottomLinkIds":[null]},{"name":"set_timer","position":{"x":5.3503511841640075,"y":1.077924001413924},"values":["0","9"],"isVars":[true,false],"topLinkId":"link_4","bottomLinkIds":[null]},{"name":"start_function","position":{"x":4.748851184164008,"y":1.8349240014139239},"values":[8,0],"isVars":[false,false],"bottomLinkIds":["link_4"]},{"name":"duplicate","position":{"x":5.565975079533401,"y":-1.119142099681867},"values":["3","4"],"isVars":[false,false],"topLinkId":"link_21","bottomLinkIds":[null]},{"name":"start_function","position":{"x":4.964475079533401,"y":-0.3621420996818669},"values":[9,0],"isVars":[false,false],"bottomLinkIds":["link_21"]},{"name":"start_function","position":{"x":-4.686143513609052,"y":1.7895369388476507},"values":[1,0],"isVars":[false,false],"bottomLinkIds":["link_2"]},{"name":"set_timer","position":{"x":-4.084643513609051,"y":1.03253693884765},"values":["0","5"],"isVars":[true,false],"topLinkId":"link_2","bottomLinkIds":[null]},{"name":"var_scalar","position":{"x":-8.365889006716165,"y":-9.582149169317779},"values":[3,0],"isVars":[false,false]},{"name":"var_scalar","position":{"x":-8.461223047013085,"y":-3.1860021208907723},"values":[2,1.2],"isVars":[false,false]},{"name":"var_scalar","position":{"x":-8.598161894662423,"y":1.242205726405085},"values":[0,2],"isVars":[false,false]},{"name":"start_function","position":{"x":-4.269671261930015,"y":-8.914301961823961},"values":[13,0],"isVars":[false,false],"bottomLinkIds":["link_15"]},{"name":"var_add","position":{"x":-3.668171261930013,"y":-9.67130196182396},"values":["3",100],"isVars":[true,false],"topLinkId":"link_15","bottomLinkIds":["link_22"]},{"name":"display","position":{"x":-3.668171261930013,"y":-10.42830196182396},"values":["8","3"],"isVars":[false,true],"topLinkId":"link_22","bottomLinkIds":["link_17"]},{"name":"play_sound","position":{"x":-2.5831712619300125,"y":-11.18530196182396},"values":[false,"0"],"isVars":[false,false],"topLinkId":"link_17","bottomLinkIds":["link_29"]},{"name":"self_kill","position":{"x":-4.269671261930016,"y":-11.82780196182396},"values":[0,0],"isVars":[false,false],"topLinkId":"link_29"},{"name":"set_timer","position":{"x":0.6540627430187294,"y":1.0304867444326566},"values":["0","7"],"isVars":[true,false],"topLinkId":"link_3","bottomLinkIds":[null]},{"name":"start_function","position":{"x":0.05256274301872944,"y":1.7874867444326568},"values":[6,0],"isVars":[false,false],"bottomLinkIds":["link_3"]},{"name":"swipe_enable","position":{"x":10.939968534625631,"y":0.7011050811634376},"values":[true,0],"isVars":[false,false],"topLinkId":"link_0","bottomLinkIds":["link_8"]},{"name":"set_timer","position":{"x":11.541468534625631,"y":-0.05589491883656595},"values":[0.5,"11"],"isVars":[false,false],"topLinkId":"link_8","bottomLinkIds":[null]},{"name":"start_function","position":{"x":10.939968534625631,"y":1.4581050811634364},"values":[0,0],"isVars":[false,false],"bottomLinkIds":["link_0"]},{"name":"play_sound","position":{"x":12.562215800636265,"y":-2.5713867090844698},"values":[true,"1000"],"isVars":[false,false],"topLinkId":"link_23","bottomLinkIds":["link_12"]},{"name":"display","position":{"x":11.477215800636266,"y":-3.3283867090844743},"values":["8","3"],"isVars":[false,true],"topLinkId":"link_12","bottomLinkIds":[null]},{"name":"start_app","position":{"x":10.875715800636263,"y":-1.8143867090844754},"values":[0,0],"isVars":[false,false],"bottomLinkIds":["link_23"]},{"name":"duplicate","position":{"x":6.104918516951564,"y":-5.700576078256864},"values":["9","10"],"isVars":[false,false],"topLinkId":"link_9","bottomLinkIds":[null]},{"name":"start_function","position":{"x":5.503418516951564,"y":-4.943576078256864},"values":[11,0],"isVars":[false,false],"bottomLinkIds":["link_9"]},{"name":"move","position":{"x":6.07470607988688,"y":-8.126635913750436},"values":[1.2,{"x":840,"y":0}],"isVars":[false,false],"topLinkId":"link_10","bottomLinkIds":["link_13"]},{"name":"self_kill","position":{"x":5.4732060798868805,"y":-8.76913591375042},"values":[0,0],"isVars":[false,false],"topLinkId":"link_13"},{"name":"start_function","position":{"x":5.4732060798868805,"y":-7.369635913750437},"values":[10,0],"isVars":[false,false],"bottomLinkIds":["link_10"]},{"name":"swipe_enable","position":{"x":11.254683633792865,"y":-6.245227995758225},"values":[false,0],"isVars":[false,false],"topLinkId":"link_30","bottomLinkIds":["link_32"]},{"name":"zoom","position":{"x":11.856183633792863,"y":-7.0022279957582265},"values":[0.3,0.1],"isVars":[false,false],"topLinkId":"link_32","bottomLinkIds":["link_20"]},{"name":"finish_app","position":{"x":11.254683633792865,"y":-7.644727995758226},"values":[0,0],"isVars":[false,false],"topLinkId":"link_20"},{"name":"start_function","position":{"x":11.254683633792865,"y":-5.4882279957582245},"values":[14,0],"isVars":[false,false],"bottomLinkIds":["link_30"]},{"name":"start_function","position":{"x":0.1692117355956139,"y":-0.21808059384941741},"values":[7,0],"isVars":[false,false],"bottomLinkIds":["link_11"]},{"name":"duplicate","position":{"x":0.7707117355956145,"y":-0.975080593849418},"values":["2","4"],"isVars":[false,false],"topLinkId":"link_11","bottomLinkIds":["link_16"]},{"name":"var_substract","position":{"x":0.7707117355956146,"y":-1.732080593849418},"values":["1",1],"isVars":[true,false],"topLinkId":"link_16","bottomLinkIds":["link_24"]},{"name":"branch_eqsmaller","position":{"x":3.047711735595617,"y":-2.489080593849419},"values":["1",0],"isVars":[true,false],"topLinkId":"link_24","bottomLinkIds":["link_19",null]},{"name":"duplicate","position":{"x":0.7707117355956163,"y":-3.246080593849418},"values":["4","3"],"isVars":[false,false],"topLinkId":"link_19","bottomLinkIds":["link_27"]},{"name":"var_substitute","position":{"x":0.7707117355956163,"y":-4.003080593849418},"values":["1",8.3],"isVars":[true,false],"topLinkId":"link_27","bottomLinkIds":[null]},{"name":"wait","position":{"x":-4.289395546129375,"y":-7.2204182573347495},"values":[0.1,0],"isVars":[false,false],"topLinkId":"link_31","bottomLinkIds":["link_14"]},{"name":"self_kill","position":{"x":-4.289395546129375,"y":-7.862918257334749},"values":[0,0],"isVars":[false,false],"topLinkId":"link_14"},{"name":"start_function","position":{"x":-4.289395546129375,"y":-6.46341825733475},"values":[12,0],"isVars":[false,false],"bottomLinkIds":["link_31"]},{"name":"start_function","position":{"x":0.275256274301873,"y":-5.431696005655707},"values":[3,0],"isVars":[false,false],"bottomLinkIds":["link_18"]},{"name":"move","position":{"x":0.8767562743018729,"y":-6.188696005655706},"values":[9.9,{"x":-1381.3481525552854,"y":-502.76961068873294}],"isVars":[false,false],"topLinkId":"link_18","bottomLinkIds":["link_25"]},{"name":"self_kill","position":{"x":0.27525627430187277,"y":-6.831196005655708},"values":[0,0],"isVars":[false,false],"topLinkId":"link_25"},{"name":"start_function","position":{"x":-4.324001413927188,"y":-2.507829621774477},"values":[4,0],"isVars":[false,false],"bottomLinkIds":["link_5"]},{"name":"var_substitute","position":{"x":-3.72250141392718,"y":-3.2648296217744783},"values":["2",1.2],"isVars":[true,false],"topLinkId":"link_5","bottomLinkIds":["link_6"]},{"name":"add_random","position":{"x":-3.722501413927181,"y":-4.021829621774492},"values":["2",5.5],"isVars":[true,false],"topLinkId":"link_6","bottomLinkIds":["link_7"]},{"name":"self_kill","position":{"x":-4.32400141392718,"y":-5.421329621774494},"values":[0,0],"isVars":[false,false],"topLinkId":"link_26"},{"name":"move","position":{"x":-3.72250141392718,"y":-4.778829621774494},"values":["2",{"x":-1050,"y":1.2858791391047208e-13}],"isVars":[true,false],"topLinkId":"link_7","bottomLinkIds":["link_26"]},{"name":"var_scalar","position":{"x":0.3469777306468765,"y":3.4564863909508707},"values":[1,4],"isVars":[false,false]}],"sprites":[{"id":0,"imageKey":201,"type":"background","position":{"x":0,"y":0},"aspectRatio":0.8,"scale":1,"angle":0,"opacity":1,"mirrored":false,"animating":false,"tag":0,"tapFuncIdx":null,"startFuncIdx":null,"collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":8,"imageKey":101,"type":"sprite","position":{"x":490.04694835680795,"y":-418.6854460093903},"aspectRatio":0.4166666666666667,"scale":3.507378862265857,"angle":-0.0037270654921821578,"opacity":1,"mirrored":false,"animating":true,"tag":4,"tapFuncIdx":null,"startFuncIdx":null,"collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":3,"imageKey":100,"type":"sprite","position":{"x":-237.8873239436619,"y":3.145539906103288},"aspectRatio":0.4166666666666667,"scale":1.1964062470107846,"angle":0.022391152818445836,"opacity":1,"mirrored":true,"animating":true,"tag":0,"tapFuncIdx":null,"startFuncIdx":"0","collision":[{"tag":1,"funcIdx":14},{"tag":2,"funcIdx":14},{"tag":3,"funcIdx":14}]},{"id":4,"imageKey":603,"type":"sprite","position":{"x":382.4413145539906,"y":-143.94366197183103},"aspectRatio":1,"scale":0.28254118701719166,"angle":0.10654685089911231,"opacity":1,"mirrored":false,"animating":false,"tag":5,"tapFuncIdx":null,"startFuncIdx":"8","collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":5,"imageKey":600,"type":"sprite","position":{"x":-187.84037558685455,"y":-349.24882629108015},"aspectRatio":0.9375,"scale":1,"angle":0,"opacity":1,"mirrored":false,"animating":true,"tag":1,"tapFuncIdx":null,"startFuncIdx":null,"collision":[{"tag":9,"funcIdx":13},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":6,"imageKey":602,"type":"sprite","position":{"x":-8.826291079812153,"y":-351.73708920187795},"aspectRatio":0.9375,"scale":1,"angle":0,"opacity":1,"mirrored":false,"animating":true,"tag":2,"tapFuncIdx":null,"startFuncIdx":null,"collision":[{"tag":9,"funcIdx":13},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":7,"imageKey":601,"type":"sprite","position":{"x":164.55399061032836,"y":-342.95774647887345},"aspectRatio":0.9375,"scale":0.9764295400579222,"angle":-0.06015334411531048,"opacity":1,"mirrored":false,"animating":true,"tag":3,"tapFuncIdx":null,"startFuncIdx":null,"collision":[{"tag":9,"funcIdx":13},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":2,"imageKey":502,"type":"sprite","position":{"x":-3.2394366197182656,"y":232.34741784037575},"aspectRatio":1.1777777777777778,"scale":1,"angle":0,"opacity":1,"mirrored":false,"animating":false,"tag":8,"tapFuncIdx":null,"startFuncIdx":null,"collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":10,"imageKey":603,"type":"sprite","position":{"x":482.5821596244139,"y":18.826291079812147},"aspectRatio":1,"scale":0.28254118701719166,"angle":0.10654685089911231,"opacity":1,"mirrored":false,"animating":false,"tag":6,"tapFuncIdx":null,"startFuncIdx":"6","collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":11,"imageKey":603,"type":"sprite","position":{"x":379.9061032863853,"y":177.84037558685435},"aspectRatio":1,"scale":0.28254118701719166,"angle":0.10654685089911231,"opacity":1,"mirrored":false,"animating":false,"tag":7,"tapFuncIdx":null,"startFuncIdx":"1","collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":12,"imageKey":603,"type":"sprite","position":{"x":-447.6525821596242,"y":346.24413145539904},"aspectRatio":1,"scale":0.28254118701719166,"angle":0.10654685089911231,"opacity":1,"mirrored":false,"animating":false,"tag":9,"tapFuncIdx":null,"startFuncIdx":null,"collision":[{"tag":1,"funcIdx":12},{"tag":2,"funcIdx":12},{"tag":3,"funcIdx":12}]}]}',
+    '{"blocks":[{"name":"start_function","position":{"x":2.41456344998232,"y":-5.790844821491695},"values":[6,0],"isVars":[false,false],"bottomLinkIds":["link_14"]},{"name":"return_function","position":{"x":2.41456344998232,"y":-7.190344821491695},"values":["11",0],"isVars":[false,false],"topLinkId":"link_25"},{"name":"var_substitute","position":{"x":3.01606344998232,"y":-6.547844821491695},"values":["1",0],"isVars":[true,false],"topLinkId":"link_14","bottomLinkIds":["link_25"]},{"name":"var_scalar","position":{"x":-1.6509367267585695,"y":-6.389006716154138},"values":[1,0],"isVars":[false,false]},{"name":"start_function","position":{"x":14.168575468363388,"y":0.32417815482502677},"values":[12,0],"isVars":[false,false],"bottomLinkIds":["link_26"]},{"name":"move","position":{"x":14.7700754683634,"y":-0.4328218451749733},"values":[8.3,{"x":910,"y":0}],"isVars":[false,false],"topLinkId":"link_26","bottomLinkIds":["link_27"]},{"name":"move","position":{"x":14.7700754683634,"y":-1.1898218451749731},"values":[0,{"x":-910,"y":1.1144285872240914e-13}],"isVars":[false,false],"topLinkId":"link_27","bottomLinkIds":["link_28"]},{"name":"return_function","position":{"x":14.168575468363388,"y":-1.8323218451749734},"values":["12",0],"isVars":[false,false],"topLinkId":"link_28"},{"name":"set_timer","position":{"x":14.734727288794629,"y":-4.60390703428774},"values":[0.1,"8"],"isVars":[false,false],"topLinkId":"link_19","bottomLinkIds":[null]},{"name":"start_app","position":{"x":14.133227288794632,"y":-3.8469070342877383},"values":[0,0],"isVars":[false,false],"bottomLinkIds":["link_19"]},{"name":"var_substitute","position":{"x":14.818537822552155,"y":-7.069635913750437},"values":["2",0],"isVars":[true,false],"topLinkId":"link_20","bottomLinkIds":["link_21"]},{"name":"add_random","position":{"x":14.818537822552155,"y":-7.826635913750438},"values":["2",0.1],"isVars":[true,false],"topLinkId":"link_21","bottomLinkIds":[null]},{"name":"start_function","position":{"x":14.217037822552154,"y":-6.312635913750437},"values":[8,0],"isVars":[false,false],"bottomLinkIds":["link_20"]},{"name":"var_scalar","position":{"x":14.884658890067174,"y":-9.43396960056558},"values":[2,0],"isVars":[false,false]},{"name":"var_scalar","position":{"x":-1.9362318840579578,"y":-10.656557087309979},"values":[3,0],"isVars":[false,false]},{"name":"start_app","position":{"x":-2.427854365500174,"y":-11.843973135383518},"values":[0,0],"isVars":[false,false],"bottomLinkIds":["link_29"]},{"name":"display","position":{"x":-1.8263543655001744,"y":-12.600973135383517},"values":["4","3"],"isVars":[false,true],"topLinkId":"link_29","bottomLinkIds":["link_36"]},{"name":"play_sound","position":{"x":-0.7413543655001745,"y":-13.357973135383517},"values":[true,"1008"],"isVars":[false,false],"topLinkId":"link_36","bottomLinkIds":[null]},{"name":"move","position":{"x":2.4690150229763144,"y":-2.3957239307175677},"values":[0.5,{"x":8.572527594031473e-15,"y":140}],"isVars":[false,false],"topLinkId":"link_8","bottomLinkIds":[null]},{"name":"start_function","position":{"x":1.8675150229763147,"y":-1.6387239307175667},"values":[3,0],"isVars":[false,false],"bottomLinkIds":["link_8"]},{"name":"var_substitute","position":{"x":8.559223577235764,"y":-7.347897843761049},"values":["1",0.1],"isVars":[true,false],"topLinkId":"link_15","bottomLinkIds":["link_24"]},{"name":"return_function","position":{"x":7.957723577235765,"y":-7.990397843761049},"values":["11",0],"isVars":[false,false],"topLinkId":"link_24"},{"name":"start_function","position":{"x":7.957723577235765,"y":-6.5908978437610495},"values":[7,0],"isVars":[false,false],"bottomLinkIds":["link_15"]},{"name":"start_function","position":{"x":7.375680452456707,"y":-2.221915871332628},"values":[4,0],"isVars":[false,false],"bottomLinkIds":["link_10"]},{"name":"move","position":{"x":7.977180452456707,"y":-2.9789158713326267},"values":[0.5,{"x":-2.5717582782094416e-14,"y":-140}],"isVars":[false,false],"topLinkId":"link_10","bottomLinkIds":[null]},{"name":"var_scalar","position":{"x":8.984588193708012,"y":4.433580770590315},"values":[0,0],"isVars":[false,false]},{"name":"start_function","position":{"x":1.5038882997525638,"y":5.356700600919044},"values":[2,0],"isVars":[false,false],"bottomLinkIds":["link_35"]},{"name":"tap_enable","position":{"x":1.5038882997525638,"y":4.59970060091905},"values":[false,0],"isVars":[false,false],"topLinkId":"link_35","bottomLinkIds":["link_37"]},{"name":"play_sound","position":{"x":3.1903882997525637,"y":3.8427006009190525},"values":[false,"8"],"isVars":[false,false],"topLinkId":"link_37","bottomLinkIds":["link_6"]},{"name":"branch_equal","position":{"x":4.382388299752567,"y":3.0857006009190524},"values":["0",0],"isVars":[true,false],"topLinkId":"link_6","bottomLinkIds":["link_7","link_9"]},{"name":"func_on_tag","position":{"x":2.1053882997525637,"y":2.3287006009190523},"values":["1","3"],"isVars":[false,false],"topLinkId":"link_7","bottomLinkIds":["link_11"]},{"name":"var_substitute","position":{"x":2.1053882997525637,"y":1.5717006009190513},"values":[0,1],"isVars":[true,false],"topLinkId":"link_11","bottomLinkIds":["link_38"]},{"name":"wait","position":{"x":1.5038882997525638,"y":0.8147006009190507},"values":[0.5,0],"isVars":[false,false],"topLinkId":"link_38","bottomLinkIds":["link_40"]},{"name":"func_on_tag","position":{"x":7.905388299752568,"y":2.3287006009190523},"values":["1","4"],"isVars":[false,false],"topLinkId":"link_9","bottomLinkIds":["link_12"]},{"name":"var_substitute","position":{"x":7.905388299752568,"y":1.5717006009190513},"values":[0,0],"isVars":[true,false],"topLinkId":"link_12","bottomLinkIds":["link_39"]},{"name":"wait","position":{"x":7.303888299752568,"y":0.8147006009190507},"values":[0.5,0],"isVars":[false,false],"topLinkId":"link_39","bottomLinkIds":["link_41"]},{"name":"tap_enable","position":{"x":7.303888299752568,"y":0.0577006009190507},"values":[true,0],"isVars":[false,false],"topLinkId":"link_41","bottomLinkIds":[null]},{"name":"tap_enable","position":{"x":1.5038882997525638,"y":0.057700600919050715},"values":[true,0],"isVars":[false,false],"topLinkId":"link_40","bottomLinkIds":[null]},{"name":"start_function","position":{"x":-3.596677271120532,"y":2.216433280311059},"values":[0,0],"isVars":[false,false],"bottomLinkIds":["link_0"]},{"name":"move","position":{"x":-2.9951772711205327,"y":0.7024332803110646},"values":[0,{"x":1400,"y":0}],"isVars":[false,false],"topLinkId":"link_5","bottomLinkIds":["link_3"]},{"name":"return_function","position":{"x":-3.596677271120532,"y":0.05993328031106532},"values":["1",0],"isVars":[false,false],"topLinkId":"link_3"},{"name":"move","position":{"x":-2.9951772711205322,"y":1.459433280311065},"values":[1,{"x":-700,"y":8.572527594031473e-14}],"isVars":[false,false],"topLinkId":"link_0","bottomLinkIds":["link_5"]},{"name":"start_function","position":{"x":-3.617603393425232,"y":-1.6316012725344653},"values":[1,0],"isVars":[false,false],"bottomLinkIds":["link_1"]},{"name":"move","position":{"x":-3.016103393425233,"y":-3.1456012725344658},"values":[0,{"x":1400,"y":0}],"isVars":[false,false],"topLinkId":"link_2","bottomLinkIds":["link_4"]},{"name":"return_function","position":{"x":-3.6176033934252336,"y":-3.788101272534466},"values":["1",0],"isVars":[false,false],"topLinkId":"link_4"},{"name":"move","position":{"x":-3.0161033934252326,"y":-2.3886012725344647},"values":[2,{"x":-1400,"y":1.7145055188062946e-13}],"isVars":[false,false],"topLinkId":"link_1","bottomLinkIds":["link_2"]},{"name":"start_function","position":{"x":7.371553022269359,"y":-10.744504418522437},"values":[10,0],"isVars":[false,false],"bottomLinkIds":["link_22"]},{"name":"self_kill","position":{"x":7.371553022269359,"y":-12.144004418522437},"values":[0,0],"isVars":[false,false],"topLinkId":"link_18"},{"name":"move","position":{"x":7.97305302226936,"y":-11.501504418522437},"values":[2.4,{"x":-910,"y":1.1144285872240914e-13}],"isVars":[false,false],"topLinkId":"link_22","bottomLinkIds":["link_18"]},{"name":"start_function","position":{"x":2.2814151643690423,"y":-8.536089430894314},"values":[11,0],"isVars":[false,false],"bottomLinkIds":["link_23"]},{"name":"self_duplicate","position":{"x":2.2814151643690423,"y":-10.050089430894314},"values":["10",0],"isVars":[false,false],"topLinkId":"link_17","bottomLinkIds":["link_30"]},{"name":"var_add","position":{"x":2.8829151643690425,"y":-10.807089430894314},"values":["3",1],"isVars":[true,false],"topLinkId":"link_30","bottomLinkIds":["link_31"]},{"name":"display","position":{"x":2.8829151643690425,"y":-11.564089430894313},"values":["4","3"],"isVars":[false,true],"topLinkId":"link_31","bottomLinkIds":[null]},{"name":"branch_equal","position":{"x":5.159915164369045,"y":-9.293089430894314},"values":["1","2"],"isVars":[true,true],"topLinkId":"link_23","bottomLinkIds":["link_17",null]},{"name":"start_function","position":{"x":-10.299328384588183,"y":1.3890243902439023},"values":[13,0],"isVars":[false,false],"bottomLinkIds":["link_32"]},{"name":"duplicate","position":{"x":-9.697828384588183,"y":0.6320243902439024},"values":["5","14"],"isVars":[false,false],"topLinkId":"link_32","bottomLinkIds":["link_33"]},{"name":"finish_app","position":{"x":-10.299328384588184,"y":-0.01047560975609757},"values":[0,0],"isVars":[false,false],"topLinkId":"link_33"},{"name":"start_function","position":{"x":7.706185931424535,"y":-4.5177801343230755},"values":[9,0],"isVars":[false,false],"bottomLinkIds":["link_16"]},{"name":"set_timer","position":{"x":8.307685931424535,"y":-5.274780134323073},"values":[0.8,"7"],"isVars":[false,false],"topLinkId":"link_16","bottomLinkIds":[null]},{"name":"start_function","position":{"x":2.177447861435137,"y":-3.6991869918699187},"values":[5,0],"isVars":[false,false],"bottomLinkIds":["link_13"]},{"name":"set_timer","position":{"x":2.7789478614351375,"y":-4.456186991869914},"values":[0.8,"6"],"isVars":[false,false],"topLinkId":"link_13","bottomLinkIds":[null]}],"sprites":[{"id":0,"imageKey":202,"type":"background","position":{"x":0,"y":0},"aspectRatio":0.8,"scale":1.0286125616088817,"angle":-0.0019083946297894228,"opacity":1,"mirrored":false,"animating":false,"tag":0,"tapFuncIdx":null,"startFuncIdx":"0","collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":1,"imageKey":202,"type":"background","position":{"x":708.5915492957737,"y":1.2676056338028023},"aspectRatio":0.8,"scale":1.0286125616088817,"angle":-0.0019083946297894228,"opacity":1,"mirrored":false,"animating":false,"tag":0,"tapFuncIdx":null,"startFuncIdx":"1","collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":2,"imageKey":0,"type":"sprite","position":{"x":-184.0375586854461,"y":-172.7699530516432},"aspectRatio":0.9375,"scale":0.8860513999365415,"angle":0.015299352628850182,"opacity":1,"mirrored":true,"animating":true,"tag":1,"tapFuncIdx":null,"startFuncIdx":null,"collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":13},{"tag":3,"funcIdx":13}]},{"id":3,"imageKey":1,"type":"sprite","position":{"x":428.1220657276995,"y":-174.60093896713622},"aspectRatio":0.9375,"scale":1,"angle":0,"opacity":1,"mirrored":true,"animating":true,"tag":3,"tapFuncIdx":null,"startFuncIdx":"9","collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":6,"imageKey":5,"type":"sprite","position":{"x":449.34272300469587,"y":-34.31924882629123},"aspectRatio":0.4166666666666667,"scale":1,"angle":0,"opacity":1,"mirrored":true,"animating":true,"tag":2,"tapFuncIdx":null,"startFuncIdx":"5","collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":7,"imageKey":400,"type":"sprite","position":{"x":-419.5305164319251,"y":248.63849765258243},"aspectRatio":0.4166666666666667,"scale":0.652687657411096,"angle":0.020376984676248766,"opacity":1,"mirrored":true,"animating":false,"tag":0,"tapFuncIdx":null,"startFuncIdx":"12","collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":8,"imageKey":502,"type":"sprite","position":{"x":-2.018779342723148,"y":238.63849765258232},"aspectRatio":1.1777777777777778,"scale":0.7562846299181998,"angle":0.03762303859768956,"opacity":1,"mirrored":false,"animating":false,"tag":4,"tapFuncIdx":null,"startFuncIdx":null,"collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":9,"imageKey":506,"type":"sprite","position":{"x":5.633802816901189,"y":-1.8779342722995955},"aspectRatio":0.8,"scale":5.556877779615405,"angle":0.002967350341074537,"opacity":1,"mirrored":false,"animating":false,"tag":0,"tapFuncIdx":"2","startFuncIdx":null,"collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]},{"id":4,"imageKey":404,"type":"sprite","position":{"x":-430.046948356808,"y":354.9295774647889},"aspectRatio":0.9375,"scale":1,"angle":0,"opacity":1,"mirrored":false,"animating":false,"tag":5,"tapFuncIdx":null,"startFuncIdx":null,"collision":[{"tag":1,"funcIdx":null},{"tag":2,"funcIdx":null},{"tag":3,"funcIdx":null}]}]}',
+  ];
+
+  return {
+    appJSONs:appJSONs,
+  };
+});
diff --git a/app/webroot/js/pictcode/function_selector.js b/app/webroot/js/pictcode/function_selector.js
index 07b3907..b4c5b83 100644
--- a/app/webroot/js/pictcode/function_selector.js
+++ b/app/webroot/js/pictcode/function_selector.js
@@ -10,7 +10,7 @@ define(["modal_manager", "image_manager", "utility"], function(modalManager, ima
     getFunctions = getFuncs;
   }
 
-  function show(mdl, cntnr, didSelectFunc){
+  function show(mdl, cntnr, didSelectFunc, isWithNoFunc){
 
     modal = mdl;
     container = cntnr;
@@ -28,6 +28,7 @@ define(["modal_manager", "image_manager", "utility"], function(modalManager, ima
       button.style.padding = "0px";
       button.style.backgroundColor = "transparent";
       button.style.borderWidth = "0px";
+      button.style.verticalAlign = "middle";
       button.name = funcBlock.value1.value;
       button.appendChild(functionNode);
       container[0].appendChild(button);
@@ -35,6 +36,21 @@ define(["modal_manager", "image_manager", "utility"], function(modalManager, ima
       container[0].appendChild(space);
     });
 
+    if (isWithNoFunc) {
+      var noFuncImage = imageManager.images.selector_001;
+      var width = scale * noFuncImage.width / noFuncImage.height;
+      noFuncImage.height = scale;
+      noFuncImage.width = width;
+      var noFuncButton = document.createElement('button');
+      noFuncButton.id = 'no_function_button';
+      noFuncButton.style.padding = "0px";
+      noFuncButton.style.backgroundColor = "transparent";
+      noFuncButton.style.borderWidth = "0px";
+      noFuncButton.style.verticalAlign = "middle";
+      noFuncButton.appendChild(noFuncImage);
+      container[0].appendChild(noFuncButton);
+    };
+
     modalManager.showUpModal(modal, didCloseModal);
   }
 
@@ -58,7 +74,7 @@ define(["modal_manager", "image_manager", "utility"], function(modalManager, ima
     div.style.fontSize = scale/2 + "px";
     div.style.width = funcBlock.value1.valueSize*image.height + "px";
     div.style.height = funcBlock.value1.valueSize*image.height + "px";
-    var alphabet = utility.numberToAlphabet(funcBlock.value1.value);
+    var alphabet = utility.numberToLargeAlphabet(funcBlock.value1.value);
     div.innerHTML = alphabet;
     var container = document.createElement('div');
     container.style.position = "relative";
@@ -125,6 +141,11 @@ define(["modal_manager", "image_manager", "utility"], function(modalManager, ima
     modalManager.closeDownModal(modal);
   });
 
+  $(document).on("click","#no_function_button", function(event) {
+    didSelectFunction(null);
+    modalManager.closeDownModal(modal);
+  });
+
   return {
     initialize:initialize,
     show:show,
diff --git a/app/webroot/js/pictcode/image_manager.js b/app/webroot/js/pictcode/image_manager.js
index 64138ad..3c110f7 100644
--- a/app/webroot/js/pictcode/image_manager.js
+++ b/app/webroot/js/pictcode/image_manager.js
@@ -16,19 +16,36 @@ define(['image_loader'], function(imageLoader){
   "blk_branch_005",
   "blk_branch_006",
   "blk_function_001",
-  "blk_functoin_002",
+  "blk_function_002",
+  "blk_function_003",
   "blk_gmctrl_001",
   "blk_gmctrl_002",
+  "blk_gmctrl_003",
+  "blk_gmctrl_004",
   "blk_motion_001",
   "blk_motion_002",
   "blk_motion_003",
   "blk_motion_004",
   "blk_motion_005",
+  "blk_motion_006",
+  "blk_motion_007",
+  "blk_motion_008",
   "blk_data_001",
+  "blk_data_001",
+  "blk_data_002",
+  "blk_data_003",
+  "blk_data_004",
+  "blk_data_005",
+  "blk_data_006",
+  "blk_data_007",
+  "blk_data_008",
   "blk_sound_001",
   "blk_sound_002",
   "blk_timectrl_001",
   "blk_timectrl_002",
+  "blk_sprctrl_001",
+  "blk_sprctrl_002",
+  "blk_sprctrl_003",
   "btn_header_001",
   "btn_header_002",
   "btn_header_003",
@@ -63,6 +80,9 @@ define(['image_loader'], function(imageLoader){
   "ctgry_spr_003",
   "ctgry_spr_004",
   "ctgry_spr_005",
+  "ctgry_spr_006",
+  "ctgry_spr_007",
+  "ctgry_spr_008",
   "icon_blk_001",
   "icon_blk_002",
   "icon_blk_003",
@@ -72,6 +92,22 @@ define(['image_loader'], function(imageLoader){
   "icon_blk_007",
   "icon_blk_008",
   "icon_blk_009",
+  "icon_blk_010",
+  "icon_blk_011",
+  "icon_blk_012",
+  "icon_blk_013",
+  "icon_blk_014",
+  "icon_blk_015",
+  "icon_blk_016",
+  "icon_blk_017",
+  "icon_blk_018",
+  "icon_blk_019",
+  "icon_blk_020",
+  "icon_blk_021",
+  "icon_blk_022",
+  "icon_blk_023",
+  "icon_blk_024",
+  "icon_blk_025",
   "input_scalar_001",
   "input_scalar_002",
   "input_scalar_003",
@@ -93,6 +129,10 @@ define(['image_loader'], function(imageLoader){
   "preview_001",
   "preview_002",
   "selector_001",
+  "sound_001",
+  "sound_002",
+  "sound_003",
+  "sound_004",
   "ui_001",
   "ui_002",
   ];
@@ -232,6 +272,7 @@ define(['image_loader'], function(imageLoader){
     $("#modal_coding_scalar")[0].style.backgroundImage = "url(" + images.bg_modal_001.src + ")";
     $("#modal_coding_function")[0].style.backgroundImage = "url(" + images.bg_modal_001.src + ")";
     $("#modal_coding_sound")[0].style.backgroundImage = "url(" + images.bg_modal_001.src + ")";
+    $("#modal_coding_tag")[0].style.backgroundImage = "url(" + images.bg_modal_001.src + ")";
     $("#modal_ui_sprite")[0].style.backgroundImage = "url(" + images.bg_modal_001.src + ")";
     $("#modal_ui_tag")[0].style.backgroundImage = "url(" + images.bg_modal_001.src + ")";
     $("#modal_ui_function")[0].style.backgroundImage = "url(" + images.bg_modal_001.src + ")";
diff --git a/app/webroot/js/pictcode/input_manager.js b/app/webroot/js/pictcode/input_manager.js
index 398d5f5..f9ecc1e 100644
--- a/app/webroot/js/pictcode/input_manager.js
+++ b/app/webroot/js/pictcode/input_manager.js
@@ -1,4 +1,4 @@
-define(["canvas_manager", "modal_manager", "block_data", "image_manager", "function_selector", "vector_input", "scalar_input", "sound_selector"], function(canvasManager, modalManager, blockData, imageManager, functionSelector, vectorInput, scalarInput, soundSelector){
+define(["canvas_manager", "modal_manager", "block_data", "image_manager", "function_selector", "vector_input", "scalar_input", "sound_selector", "tag_selector"], function(canvasManager, modalManager, blockData, imageManager, functionSelector, vectorInput, scalarInput, soundSelector, tagSelector){
 
   var getTargetBlock;
   var drawBlocks;
@@ -13,7 +13,9 @@ define(["canvas_manager", "modal_manager", "block_data", "image_manager", "funct
     getFunctions = gFuncs;
     didSetTarget = didStTgt;
     var modalSize = document.documentElement.clientHeight * 0.75;
+    //Modalの設定
     $("#modal_coding_function").css({width:modalSize, height:modalSize, bottom:0, display:"none"});
+    $("#modal_coding_tag").css({width:modalSize, height:modalSize, bottom:0, display:"none"});
     functionSelector.initialize(getFunctions);
   }
 
@@ -48,7 +50,7 @@ define(["canvas_manager", "modal_manager", "block_data", "image_manager", "funct
       break;
 
       case blockData.VALUETYPE.FUNC_SELECTOR:
-      functionSelector.show($("#modal_coding_function"), $("#modal_coding_function_container"), didSelectFunction);
+      functionSelector.show($("#modal_coding_function"), $("#modal_coding_function_container"), didSelectFunction, false);
       break;
 
       case blockData.VALUETYPE.FUNCTION:
@@ -57,6 +59,10 @@ define(["canvas_manager", "modal_manager", "block_data", "image_manager", "funct
       case blockData.VALUETYPE.SOUND_SELECTOR:
       soundSelector.openSoundSelector(value, didSelectSound);
       break;
+
+      case blockData.VALUETYPE.TAG_SELECTOR:
+      tagSelector.showTagsWithModal($("#modal_coding_tag"), $("#modal_coding_tag_container"), didSelectTag);
+      break;
     }
   }
 
@@ -88,6 +94,11 @@ define(["canvas_manager", "modal_manager", "block_data", "image_manager", "funct
     drawBlocks();
   }
 
+  function didSelectTag(tag){
+    value.value = tag;
+    drawBlocks();
+  }
+
   $(document).on("click","#inputOKButton", function(event) {
     switch(value.valueType){
       case blockData.VALUETYPE.SCALAR:
diff --git a/app/webroot/js/pictcode/modal_manager.js b/app/webroot/js/pictcode/modal_manager.js
index 2a41d04..dd6a13c 100644
--- a/app/webroot/js/pictcode/modal_manager.js
+++ b/app/webroot/js/pictcode/modal_manager.js
@@ -19,6 +19,7 @@ define(["image_manager"], function(imageManager){
     $(this).blur() ; 
     if(!$("#modal-overlay")[0]) {
       $("body").append('<div id="modal-overlay"></div>');
+      $("#modal-overlay")[0].addEventListener("touchmove", function(evt) {evt.preventDefault();}, false);
       $("#modal-overlay")[0].style.display = "inline";
       $("#modal-overlay").unbind().click(function(){
         closeUpModal(modal);
@@ -37,6 +38,7 @@ define(["image_manager"], function(imageManager){
     $(this).blur() ; 
     if(!$("#modal-overlay")[0]) {
       $("body").append('<div id="modal-overlay"></div>');
+      $("#modal-overlay")[0].addEventListener("touchmove", function(evt) {evt.preventDefault();}, false);
       $("#modal-overlay")[0].style.display = "inline";
       $("#modal-overlay").unbind().click(function(){
         closeDownModal(modal);
diff --git a/app/webroot/js/pictcode/play_manager.js b/app/webroot/js/pictcode/play_manager.js
index ba142f9..5a22e63 100644
--- a/app/webroot/js/pictcode/play_manager.js
+++ b/app/webroot/js/pictcode/play_manager.js
@@ -1,14 +1,15 @@
-define(['canvas_manager', 'sprite_manager', 'sprite_drawer', 'block_action', 'image_manager', 'sound_manager', 'block_manager'], function(canvasManager, spriteManager, spriteDrawer, blockAction, imageManager, soundManager, blockManager) {
+define(['canvas_manager', 'sprite_manager', 'sprite_drawer', 'block_manager', 'block_action', 'image_manager', 'sound_manager', 'sprite_action'], function(canvasManager, spriteManager, spriteDrawer, blockManager, blockAction, imageManager, soundManager, spriteAction) {
 
   var canvas;
   var canvasContext;
 
-  var findBlock;
   var findFunctionWithId;
 
   var originalSprites;
   var currentSprites;
 
+  var currentVariables;
+
   var STATE = {
     DEFAULT : 0,
     PLAYING : 1,
@@ -26,9 +27,8 @@ define(['canvas_manager', 'sprite_manager', 'sprite_drawer', 'block_action', 'im
   var playButtonContainer;
 
   //初期化
-  function initialize(findBlk, sprts, fdFnkWthId) {
+  function initialize(sprts, fdFnkWthId) {
 
-    findBlock = findBlk;
     originalSprites = sprts;
     findFunctionWithId = fdFnkWthId;
 
@@ -39,30 +39,38 @@ define(['canvas_manager', 'sprite_manager', 'sprite_drawer', 'block_action', 'im
       if (appState != STATE.PLAYING) {return};
       var target = spriteDrawer.getPositionInfo(currentSprites, canvasX, canvasY);
       if (target.target == "sprite") {
-        var id = target.sprite.tapFuncIdx;
-        if (id) {
-          var funcBlock = findFunctionWithId(id);
-          if (funcBlock) {
-            resetReactions(target.sprite);
-            setBlock(target.sprite, funcBlock, "tap");
+        //タップ時の処理
+        if (target.sprite.tappable) {
+          var id = target.sprite.tapFuncIdx;
+          if (id) {
+            var funcBlock = findFunctionWithId(id);
+            if (funcBlock) {
+              resetReactions(target.sprite);
+              blockAction.setBlock(target.sprite, funcBlock, "tap");
+            };
           };
         };
+        //スワイプ時の処理
+        if (target.sprite.swipeable) {
+           spriteAction.setSwipeTarget(canvasX, canvasY, canvas, spriteDrawer.editorInnerSize, target.sprite);
+        };
       }
     }
 
     function touchMove(canvasX, canvasY){
-
+      spriteAction.changeSpritesPositionBySwipe(canvasX, canvasY, drawSprites);
     }
 
     function touchEnd(canvasX, canvasY){
-
+      spriteAction.finishSwipe();
     }
 
     //キャンバスの初期化
     var screenWidth = document.documentElement.clientWidth;
     var headerHeight = $('#header')[0].clientHeight;
     var footerHeight = $('#footer')[0].clientHeight;
-    var screenHeight = document.documentElement.clientHeight - headerHeight - footerHeight - 20;
+            var screenHeight = window.innerHeight - headerHeight - footerHeight-20;
+    // var screenHeight = document.documentElement.clientHeight - headerHeight - footerHeight - 20;
     var canvasSize = canvasManager.getCanvasSize(screenWidth, screenHeight);
     canvas = canvasManager.initializeCanvas(canvasSize.width, canvasSize.height, touchStart, touchMove, touchEnd);
     $('#play_screen').append(canvas);
@@ -103,6 +111,9 @@ define(['canvas_manager', 'sprite_manager', 'sprite_drawer', 'block_action', 'im
 
   function didSwitchToPlayTab(){
     resetApp();
+    if (canvas) {
+      spriteDrawer.drawSprites(canvas, canvasContext, currentSprites);
+    };
   }
 
   function didQuitPlayTab(){
@@ -112,17 +123,21 @@ define(['canvas_manager', 'sprite_manager', 'sprite_drawer', 'block_action', 'im
   function resetApp(){
     clearInterval(timer);
 
+    if (canvas) {
+      spriteDrawer.drawSprites(canvas, canvasContext, currentSprites);
+    };
+
     currentSprites = $.extend(true, [], originalSprites);
     _.each(currentSprites, function(sprite){
       resetReactions(sprite);
+      sprite.tappable = true;
+      sprite.swipeable = false;
     });
-    if (canvas) {
-      spriteDrawer.drawSprites(canvas, canvasContext, currentSprites);
-    };
-    appState = STATE.DEFAULT;
 
-    triggerCount = 0;
+    currentVariables = $.extend(true, [], blockManager.getVariables());
 
+    appState = STATE.DEFAULT;
+    triggerCount = 0;
     soundManager.stopAllSound();
 
     var apps = $("#app_start")[0];
@@ -136,122 +151,16 @@ define(['canvas_manager', 'sprite_manager', 'sprite_drawer', 'block_action', 'im
     sprite.reactions = {};
   }
 
-  function setBlock(sprite, block, trigger){
-    //各ブロックのアクション
-    var action = blockAction.behaviors[block.name];
-    if (action) {
-      action = action();
-    }else{
-      action = null;
-    };
-    //スプライトと紐づけられたアクションとブロック
-    var reaction = sprite.reactions[trigger];
-    if (reaction) {
-      reaction.block = block;
-      reaction.action = action;
-    }else{
-      reaction = {block:block, action:action};
-      sprite.reactions[trigger] = reaction;
-    };
-    //各valueが入力値の場合と変数の場合で場合分け
-    var value1;
-    if (!block.value1.isVariable) {
-      value1 = block.value1.value;
-    }else{
-      value1 = blockManager.findVariableWithId(block.value1.value).value2.value;
-    };
-    var value2;
-    if (!block.value2.isVariable) {
-      value2 = block.value2.value;
-    }else{
-      value2 = blockManager.findVariableWithId(block.value2.value).value2.value;
-    };
-    //カテゴリ、ブロック別の初期化
-    switch(block.category){
-      //関数
-      case "function":
-      switch(block.name){
-        case "start_function":
-        goNextBlock(sprite, trigger);
-        break;
-
-        case "return_function":
-        var funcBlock = findFunctionWithId(block.value1.value);
-        if (funcBlock) {
-          setBlock(sprite, funcBlock, trigger);
-        };
-        break;
-      }
-      break;
-
-      //動きの制御ブロックの初期化
-      case "movement":
-      reaction.action.initialize(deltaTime, value1, value2);
-      break;
-
-      //分岐
-      case "branch":
-      var nextBlock;
-      switch(block.name){
-        case "branch_larger":
-        if (value1 < value2) {
-          nextBlock = findBlock(block.bottomLinks[0].id);
-        }else{
-          nextBlock = findBlock(block.bottomLinks[1].id);
-        }
-        break;
-      }
-      if (nextBlock) {
-        setBlock(sprite, nextBlock, trigger);
-      };
-      break;
-
-      case "time_control":
-      reaction.action.initialize(deltaTime, block.value1.value);
-      break;
-
-      case "sound":
-      switch(block.name){
-        case "play_sound":
-        if (block.value1.value) {
-          soundManager.playSound(block.value2.value, true);
-        }else{
-          soundManager.playSound(block.value2.value, false);
-        };
-        break;
-      }
-      goNextBlock(sprite, trigger);
-      break;
-    }
-  }
-
-  function findNextBlock(block){
-    var id = block.bottomLinks[0].id;
-    if (id != null) {
-      return findBlock(id);
-    }else{
-      return null;
-    };
-  }
-
-  function goNextBlock(sprite, trigger){
-    var block = sprite.reactions[trigger].block;
-    var nextBlock = findNextBlock(block);
-    if (nextBlock) {
-      setBlock(sprite, nextBlock, trigger);
-    }else{
-      sprite.reactions[trigger] = {block:null, action:null};
-    };
-  }
-
   $(document).on("click",".app_start_button", function(event) {
-    //アプリ起動時に関数の実行
+    //blockActionの開始
+    blockAction.startAction(currentSprites, currentVariables, deltaTime, getIdentifiedTrigger, resetApp);
     if (appState == STATE.DEFAULT) {
+      //アプリ起動時に関数の実行
       _.each(currentSprites, function(sprite){
         if(sprite.startFuncIdx){
           var funcBlock = findFunctionWithId(sprite.startFuncIdx);
           if (funcBlock) {
-            setBlock(sprite, funcBlock, "start");
+            blockAction.setBlock(sprite, funcBlock, "start");
           };
         }
       });
@@ -268,6 +177,7 @@ define(['canvas_manager', 'sprite_manager', 'sprite_drawer', 'block_action', 'im
   });
 
   function doFrame(){
+
     //アニメーションの間隔調整
     var isTimingOfAnimation = false;
     animationInterval += deltaTime;
@@ -277,18 +187,22 @@ define(['canvas_manager', 'sprite_manager', 'sprite_drawer', 'block_action', 'im
     };
     _.each(currentSprites, function(sprite){        
       //各アクション
+      if (!sprite || !sprite.reactions) {
+        return;
+      };
       _.each(sprite.reactions, function(reaction, trigger){
         if (reaction.action && reaction.block) {
           switch(reaction.block.category){
             case "movement":
             case "time_control":
-            reaction.action.behave(sprite, trigger, goNextBlock);
+            reaction.action.behave(sprite, trigger);
             break;
           };
         };
       });
       //衝突判定
       _.each(currentSprites, function(tSpr) {
+        if (!tSpr) {return;};
         for (var i = 0; i < sprite.collision.length; i++) {
           var collisionSet = sprite.collision[i];
           if (tSpr.tag == collisionSet.tag && collisionSet.funcIdx) {
@@ -301,7 +215,7 @@ define(['canvas_manager', 'sprite_manager', 'sprite_drawer', 'block_action', 'im
               var funcBlock = findFunctionWithId(collisionSet.funcIdx);
               if (funcBlock) {
                 resetReactions(sprite);
-                setBlock(sprite, funcBlock, getIdentifiedTrigger("collision"));
+                blockAction.setBlock(sprite, funcBlock, getIdentifiedTrigger("collision"));
               };
             };
           };
@@ -313,6 +227,12 @@ define(['canvas_manager', 'sprite_manager', 'sprite_drawer', 'block_action', 'im
       };
     });
     //描画
+    if (appState == STATE.PLAYING) {
+      drawSprites();
+    };
+  }
+
+  function drawSprites(){
     if (canvas) {
       spriteDrawer.drawSprites(canvas, canvasContext, currentSprites);
     };
diff --git a/app/webroot/js/pictcode/preview_manager.js b/app/webroot/js/pictcode/preview_manager.js
index ff26eca..cd254fd 100644
--- a/app/webroot/js/pictcode/preview_manager.js
+++ b/app/webroot/js/pictcode/preview_manager.js
@@ -1,28 +1,63 @@
-define(['block_data','image_manager', 'sprite_drawer', 'block_manager'], function(blockData, imageManager, spriteDrawer, blockManager){
+define(['block_data', 'image_manager', 'sprite_drawer', 'block_manager'], function(blockData, imageManager, spriteDrawer, blockManager){
 
   var canvas;
   var canvasContext;
   var dt = 20;//ミリ秒
   var timer;
-  var dummy;
+  var dummy = {};
+  var initialDummy = {size:125, position:{x:0, y:0}, scale:1.0, angle:0, opacity:1.0, mirrored:false};
+
   var aspectRatio;
 
+  var ACTION_TYPE = {
+    ROTATE_RIGHT : 0,
+    ROTATE_LEFT : 1,
+    ZOOM : 2,
+    OPACITY : 3,
+  };
+
   function initialize(cvs, cvsCtx){
+    initialDummy.image = imageManager.images.preview_001;
     canvas = cvs;
     canvasContext = cvsCtx;
     canvasContext.fillStyle = '#4682b4';
-    dummy = {image:imageManager.images.preview_001, globalSize:125};
     aspectRatio = spriteDrawer.editorInnerSize.height/spriteDrawer.editorInnerSize.width;
+    initializeDummy();
+    initializePreview();
   }
 
   function startPreview(targetBlock){
     stopPreview();
-    initializePreview();
+    initializeDummy();
 
     switch(targetBlock.name){
       case "move":
       move(targetBlock);
       break;
+      case "rotate_right":
+      action(targetBlock, ACTION_TYPE.ROTATE_RIGHT);
+      break;
+      case "rotate_left":
+      action(targetBlock, ACTION_TYPE.ROTATE_LEFT);
+      break;
+      case "zoom":
+      action(targetBlock, ACTION_TYPE.ZOOM);
+      break;
+      case "opacity":
+      action(targetBlock, ACTION_TYPE.OPACITY);
+      break;
+      case "self_duplicate":
+      selfDuplicate(targetBlock);
+      break;
+      case "self_kill":
+      selfKill(targetBlock);
+      break;
+      case "mirror":
+      mirror(targetBlock);
+      break;
+      default:
+      initializePreview();
+      break;
     }
   }
 
@@ -33,10 +68,46 @@ define(['block_data','image_manager', 'sprite_drawer', 'block_manager'], functio
   }
 
   function initializePreview(){
-    dummy.position = {x:0, y:0};
     var cvDummySize = canvas.height*0.25;
-    var cvGbRatio = cvDummySize / dummy.globalSize;
-    drawDummy(dummy, cvDummySize, cvGbRatio);
+    var cvGbRatio = cvDummySize / dummy.size;
+    drawDummy(cvDummySize, cvGbRatio);
+  }
+
+  function initializeDummy(){
+    dummy.image = initialDummy.image;
+    dummy.size = initialDummy.size;
+    dummy.position = {x:initialDummy.position.x, y:initialDummy.position.y};
+    dummy.scale = initialDummy.scale;
+    dummy.angle = initialDummy.angle;
+    dummy.opacity = initialDummy.opacity;
+    dummy.mirrored = initialDummy.mirrored;
+  }
+
+  function drawDummy(cvDummySize, cvGbRatio, isTwined){
+    var cvDummyLeft = canvas.width/2 - cvDummySize/2 + dummy.position.x*cvGbRatio;
+    var cvDummyTop = canvas.height/2 - cvDummySize/2 - dummy.position.y*cvGbRatio;
+
+    canvasContext.clearRect(0, 0, canvas.width, canvas.height);
+    canvasContext.fillRect(0, 0, canvas.width, canvas.height);
+    var cvBgSize = {width:spriteDrawer.editorInnerSize.width*cvGbRatio*1.1, height:spriteDrawer.editorInnerSize.height*cvGbRatio*1.1};
+    canvasContext.drawImage(imageManager.images.preview_002, canvas.width/2-cvBgSize.width/2, canvas.height/2-cvBgSize.height/2, cvBgSize.width, cvBgSize.height);
+    canvasContext.save();
+    canvasContext.lineWidth = 10;
+    canvasContext.strokeStyle = "#8b4513";
+    canvasContext.strokeRect(0, 0, canvas.width, canvas.height);
+    canvasContext.translate(canvas.width/2, canvas.height/2);
+    canvasContext.rotate(dummy.angle);
+    if (dummy.mirrored) {
+      canvasContext.transform(-1, 0, 0, 1, 0, 0);
+    };
+    canvasContext.translate(-canvas.width/2, -canvas.height/2);
+    canvasContext.globalAlpha = dummy.opacity;
+    canvasContext.drawImage(dummy.image, cvDummyLeft, cvDummyTop, cvDummySize, cvDummySize);
+    if (isTwined) {
+      var twinedLeft = canvas.width/2 - cvDummySize/2 - dummy.position.x*cvGbRatio;
+      canvasContext.drawImage(dummy.image, twinedLeft, cvDummyTop, cvDummySize, cvDummySize);
+    };
+    canvasContext.restore();
   }
 
   function move(block){
@@ -51,7 +122,7 @@ define(['block_data','image_manager', 'sprite_drawer', 'block_manager'], functio
     var intervalTime = 0;
 
     dummy.position = {x:-block.value2.value.x/2, y:-block.value2.value.y/2};
-    var gbDummySize = dummy.globalSize;
+    var gbDummySize = dummy.size;
     var gbDistance;
     var cvsDistance;
     if (Math.abs(block.value2.value.x) > Math.abs(block.value2.value.y)) {
@@ -65,13 +136,20 @@ define(['block_data','image_manager', 'sprite_drawer', 'block_manager'], functio
     var cvDistance = cvsDistance * gbDistance / (gbDummySize+gbDistance);
     var cvGbRatio = cvDummySize / gbDummySize;
 
-    var gbd = {dx:block.value2.value.x*dt/duration, dy:block.value2.value.y*dt/duration};
+    var gbd;
+    if (block.value1.value > 0) {
+      gbd = {dx:block.value2.value.x*dt/duration, dy:block.value2.value.y*dt/duration};
+    }else{
+      gbd = {dx:block.value2.value.x, dy:block.value2.value.y};
+    };
 
     timer = setInterval(function(){
       if (isInterval) {
         intervalTime += dt;
         if (intervalTime == 500) {
-          drawDummy(dummy, cvDummySize, cvGbRatio);
+          dummy.position.x = -block.value2.value.x/2;
+          dummy.position.y = -block.value2.value.y/2;
+          drawDummy(cvDummySize, cvGbRatio, false);
         }else if (intervalTime >= 1200) {
           isInterval = false;
           passedTime = 0;
@@ -83,36 +161,216 @@ define(['block_data','image_manager', 'sprite_drawer', 'block_manager'], functio
       dummy.position.y += gbd.dy;
       passedTime += dt;
       if(passedTime >= duration){
-        dummy.position.x = -block.value2.value.x/2;
-        dummy.position.y = -block.value2.value.y/2;
         isInterval = true;
         intervalTime = 0;
-        return;
       }
 
-      drawDummy(dummy, cvDummySize, cvGbRatio);
+      drawDummy(cvDummySize, cvGbRatio, false);
     } , dt);
   }
 
-  function drawDummy(dummy, cvDummySize, cvGbRatio){
-    var cvDummyLeft = canvas.width/2 - cvDummySize/2 + dummy.position.x*cvGbRatio;
-    var cvDummyTop = canvas.height/2 - cvDummySize/2 - dummy.position.y*cvGbRatio;
+  function action(block, actinType){
+    var duration;
+    if (!block.value1.isVariable) {
+      duration = block.value1.value * 1000;//ミリ秒
+    }else{
+      duration = blockManager.findVariableWithId(block.value1.value).value2.value * 1000;//ミリ秒
+    };
+    var degree;
+    if (!block.value2.isVariable) {
+      degree = block.value2.value;
+    }else{
+      degree = blockManager.findVariableWithId(block.value2.value).value2.value;
+    };
+    var passedTime = 0;
+    var isInterval = false;
+    var intervalTime = 0;
 
-    canvasContext.clearRect(0, 0, canvas.width, canvas.height);
-    canvasContext.fillRect(0, 0, canvas.width, canvas.height);
-    var cvBgSize = {width:spriteDrawer.editorInnerSize.width*cvGbRatio*1.1, height:spriteDrawer.editorInnerSize.height*cvGbRatio*1.1};
-    canvasContext.drawImage(imageManager.images.preview_002, canvas.width/2-cvBgSize.width/2, canvas.height/2-cvBgSize.height/2, cvBgSize.width, cvBgSize.height);
-    canvasContext.save();
-    canvasContext.lineWidth = 10;
-    canvasContext.strokeStyle = "#8b4513";
-    canvasContext.strokeRect(0, 0, canvas.width, canvas.height);
-    canvasContext.restore();
-    canvasContext.drawImage(dummy.image, cvDummyLeft, cvDummyTop, cvDummySize, cvDummySize);
-  }
+    var ds;
+    var cvDummySize;
+    switch(actinType){
+      case ACTION_TYPE.ROTATE_RIGHT:
+      if (block.value1.value > 0) {
+        ds = (degree*Math.PI/180 - dummy.angle) * dt / duration;
+      }else{
+        ds = degree*Math.PI/180 - dummy.angle;
+      };
+      cvDummySize = canvas.height*0.45;
+      break;
+      case ACTION_TYPE.ROTATE_LEFT:
+      if (block.value1.value > 0) {
+        ds = -(degree*Math.PI/180 - dummy.angle) * dt / duration;
+      }else{
+        ds = -(degree*Math.PI/180 - dummy.angle);
+      };
+      cvDummySize = canvas.height*0.45;
+      break;
+      case ACTION_TYPE.ZOOM:
+      if (block.value1.value > 0) {
+        ds = (degree - dummy.scale) * dt / duration;
+      }else{
+        ds = (degree - dummy.scale);
+      };
+      cvDummySize = canvas.height*0.25;
+      break;
+      case ACTION_TYPE.OPACITY:
+      if (block.value1.value > 0) {
+        ds = (degree - dummy.opacity) * dt / duration;
+      }else{
+        ds = degree - dummy.opacity;
+      };
+      cvDummySize = canvas.height*0.45;
+      break;
+    }
+    if (!ds || !cvDummySize) {return;};
+
+    var cvGbRatio = cvDummySize / dummy.size;
+
+    timer = setInterval(function(){
+      if (isInterval) {
+        intervalTime += dt;
+        if (intervalTime == 500) {
+          initializeDummy();
+          drawDummy(cvDummySize*dummy.scale, cvGbRatio, false);
+        }else if (intervalTime >= 1200) {
+          isInterval = false;
+          passedTime = 0;
+        };
+        return;
+      };
+
+      switch(actinType){
+        case ACTION_TYPE.ROTATE_RIGHT:
+        case ACTION_TYPE.ROTATE_LEFT:
+        dummy.angle += ds;
+        break;
+        case ACTION_TYPE.ZOOM:
+        dummy.scale += ds;
+        break;
+        case ACTION_TYPE.OPACITY:
+        dummy.opacity += ds;
+        break;
+      }
+      passedTime += dt;
+
+      if(passedTime >= duration){
+        isInterval = true;
+        intervalTime = 0;
+      }
+
+      drawDummy(cvDummySize*dummy.scale, cvGbRatio, false);
+    } , dt);
+  } 
+
+  function selfDuplicate(block){
+
+    var passedTime = 0;
+    var isInterval = false;
+    var intervalTime = 0;
+    var duration = 250;
+
+    var cvDummySize=  canvas.height*0.45;
+    var ds = cvDummySize*0.28 * dt / duration;
+    var cvGbRatio = cvDummySize / dummy.size;
+
+    timer = setInterval(function(){
+      if (isInterval) {
+        intervalTime += dt;
+        if (intervalTime == 1000) {
+          drawDummy(cvDummySize*dummy.scale, cvGbRatio, false);
+        }else if (intervalTime >= 1700) {
+          isInterval = false;
+          passedTime = 0;
+        };
+        return;
+      };
+
+      dummy.position.x += ds;
+      passedTime += dt;
+
+      if(passedTime >= duration){
+        initializeDummy();
+        isInterval = true;
+        intervalTime = 0;
+        return;
+      }
+
+      drawDummy(cvDummySize*dummy.scale, cvGbRatio, true);
+    } , dt);
+  } 
+
+  function selfKill(block){
+
+    var passedTime = 0;
+    var isInterval = false;
+    var intervalTime = 0;
+    var duration = 1700;
+
+    var cvDummySize=  canvas.height*0.45;
+    var cvGbRatio = cvDummySize / dummy.size;
+
+    drawDummy(cvDummySize*dummy.scale, cvGbRatio, false);
+    timer = setInterval(function(){
+      if (isInterval) {
+        intervalTime += dt;
+        if (intervalTime >= duration) {
+          isInterval = false;
+          passedTime = 0;
+          initializeDummy();
+          drawDummy(cvDummySize*dummy.scale, cvGbRatio, false);
+        };
+        return;
+      };
+
+      passedTime += dt;
+
+      if(passedTime >= duration){
+        isInterval = true;
+        intervalTime = 0;
+        dummy.opacity = 0;
+        drawDummy(cvDummySize*dummy.scale, cvGbRatio, false);
+        return;
+      }
+    } , dt);
+  } 
+
+  function mirror(block){
+
+    var passedTime = 0;
+    var isInterval = false;
+    var intervalTime = 0;
+    var duration = 1200;
+
+    var cvDummySize=  canvas.height*0.45;
+    var cvGbRatio = cvDummySize / dummy.size;
+
+    drawDummy(cvDummySize*dummy.scale, cvGbRatio, false);
+    timer = setInterval(function(){
+      if (isInterval) {
+        intervalTime += dt;
+        if (intervalTime >= duration) {
+          isInterval = false;
+          passedTime = 0;
+          initializeDummy();
+          drawDummy(cvDummySize*dummy.scale, cvGbRatio, false);
+        };
+        return;
+      };
+
+      passedTime += dt;
+
+      if(passedTime >= duration){
+        isInterval = true;
+        intervalTime = 0;
+        dummy.mirrored = true;
+        drawDummy(cvDummySize*dummy.scale, cvGbRatio, false);
+        return;
+      }
+    } , dt);
+  } 
 
   return {
     initialize:initialize,
-    initializePreview:initializePreview,
     startPreview:startPreview,
     stopPreview:stopPreview,
   };
diff --git a/app/webroot/js/pictcode/require_config.js b/app/webroot/js/pictcode/require_config.js
index 5cf84c9..dfaf244 100644
--- a/app/webroot/js/pictcode/require_config.js
+++ b/app/webroot/js/pictcode/require_config.js
@@ -51,6 +51,12 @@ var require = {
         "tag_selector": {
             deps: ['jquery', 'underscore']
         },
+        "block_actions": {
+            deps: ['jquery', 'underscore']
+        },
+        "dummy_apps": {
+            deps: ['jquery', 'underscore']
+        },
         //UI
         "ui_manager": {
             deps: ['jquery', 'underscore']
@@ -89,9 +95,6 @@ var require = {
         "block_manager": {
             deps: ['jquery', 'underscore']
         },
-        "block_action": {
-            deps: ['jquery', 'underscore']
-        },
         "input_manager": {
             deps: ['jquery', 'underscore']
         },
@@ -111,5 +114,11 @@ var require = {
         "play_manager": {
             deps: ['jquery', 'underscore']
         },
+        "block_action": {
+            deps: ['jquery', 'underscore']
+        },
+        "sprite_action": {
+            deps: ['jquery', 'underscore']
+        },
     }
 };
\ No newline at end of file
diff --git a/app/webroot/js/pictcode/scalar_input.js b/app/webroot/js/pictcode/scalar_input.js
index f62a4c8..8d1d372 100644
--- a/app/webroot/js/pictcode/scalar_input.js
+++ b/app/webroot/js/pictcode/scalar_input.js
@@ -24,7 +24,7 @@ define(["canvas_manager", "block_manager", "image_manager", "modal_manager", "ut
     didSelectScalar = dSlctSclr;
 
     //入力・変数の表示の切り替え
-    if (value.canBeVariable) {
+    if (value.canInput && value.canBeVariable) {
       $("#modal_coding_scalar_input_button")[0].style.display = "inline";
       $("#modal_coding_scalar_variable_button")[0].style.display = "inline";
       if (value.isVariable) {
@@ -33,11 +33,16 @@ define(["canvas_manager", "block_manager", "image_manager", "modal_manager", "ut
         showInput();
       };
       $("#modal_coding_scalar")[0].style.paddingTop = "5px";
-    }else{
+    }else if(value.canInput && !value.canBeVariable){
       $("#modal_coding_scalar_input_button")[0].style.display = "none";
       $("#modal_coding_scalar_variable_button")[0].style.display = "none";
       showInput();
       $("#modal_coding_scalar")[0].style.paddingTop = "50px";
+    }else{
+      $("#modal_coding_scalar_input_button")[0].style.display = "none";
+      $("#modal_coding_scalar_variable_button")[0].style.display = "none";
+      showVariable();
+      $("#modal_coding_scalar")[0].style.paddingTop = "50px";
     }
 
     //入力の設定
@@ -164,7 +169,7 @@ define(["canvas_manager", "block_manager", "image_manager", "modal_manager", "ut
     };
     canvasContext.font = "italic bold "+ fontSize + "px " + "sans-serif";
     var valueString;
-    valueString = valuePointer.value.toFixed(1);
+    valueString = (valuePointer.value*1).toFixed(1);
     canvasContext.fillStyle = "red";
     canvasContext.fillText(valueString, cvIndicatorX+cvIndicatorSize*0.08, cvIndicatorY+cvIndicatorSize*0.5);
     //icon image
@@ -243,7 +248,7 @@ define(["canvas_manager", "block_manager", "image_manager", "modal_manager", "ut
     div1.style.fontWeight = "bold";
     div1.style.width = varBlock.value1.valueSize*image.height + "px";
     div1.style.height = varBlock.value1.valueSize*image.height + "px";
-    var alphabet = utility.numberToAlphabet(varBlock.value1.value);
+    var alphabet = utility.numberToSmallAlphabet(varBlock.value1.value);
     div1.innerHTML = alphabet;
     var div2 = document.createElement('div');
     div2.style.position = 'absolute';
diff --git a/app/webroot/js/pictcode/sound_manager.js b/app/webroot/js/pictcode/sound_manager.js
index 746eee7..feb8b96 100644
--- a/app/webroot/js/pictcode/sound_manager.js
+++ b/app/webroot/js/pictcode/sound_manager.js
@@ -2,9 +2,111 @@ define(["utility"], function(utility){
 
   //----------------サウンド----------------//
   var soundInfos = [
-  {name:"jump-cute1", ext:"mp3", category:"se", soundKey:0},
-  {name:"nyu1", ext:"mp3", category:"se", soundKey:1},
-  {name:"loop_66_Pop", ext:"wav", category:"bgm", soundKey:2},
+  //SE
+  {name:"ACTION1", ext:"mp3", category:"se", soundKey:0},
+  {name:"ACTION2", ext:"mp3", category:"se", soundKey:1},
+  {name:"ACTION3", ext:"mp3", category:"se", soundKey:2},
+  {name:"ACTION4", ext:"mp3", category:"se", soundKey:3},
+  {name:"ACTION5", ext:"mp3", category:"se", soundKey:4},
+  {name:"ACTION6", ext:"mp3", category:"se", soundKey:5},
+  {name:"ACTION7", ext:"mp3", category:"se", soundKey:6},
+  {name:"ACTION8", ext:"mp3", category:"se", soundKey:7},
+  {name:"ACTION9", ext:"mp3", category:"se", soundKey:8},
+  {name:"ACTION10", ext:"mp3", category:"se", soundKey:9},
+  {name:"AIRPLANE1", ext:"mp3", category:"se", soundKey:10},
+  {name:"AIRPLANE2", ext:"mp3", category:"se", soundKey:11},
+  {name:"ALERT1", ext:"mp3", category:"se", soundKey:12},
+  {name:"ALERT2", ext:"mp3", category:"se", soundKey:13},
+  {name:"ALERT3", ext:"mp3", category:"se", soundKey:14},
+  {name:"ALERT4", ext:"mp3", category:"se", soundKey:15},
+  {name:"ALERT5", ext:"mp3", category:"se", soundKey:16},
+  {name:"ATTACK1", ext:"mp3", category:"se", soundKey:17},
+  {name:"ATTACK2", ext:"mp3", category:"se", soundKey:18},
+  {name:"ATTACK3", ext:"mp3", category:"se", soundKey:19},
+  {name:"ATTACK4", ext:"mp3", category:"se", soundKey:20},
+  {name:"ATTACK5", ext:"mp3", category:"se", soundKey:21},
+  {name:"ATTACK6", ext:"mp3", category:"se", soundKey:22},
+  {name:"ATTACK7", ext:"mp3", category:"se", soundKey:23},
+  {name:"ATTACK8", ext:"mp3", category:"se", soundKey:24},
+  {name:"ATTACK9", ext:"mp3", category:"se", soundKey:25},
+  {name:"ATTACK10", ext:"mp3", category:"se", soundKey:26},
+  {name:"ATTACK11", ext:"mp3", category:"se", soundKey:27},
+  {name:"ATTACK12", ext:"mp3", category:"se", soundKey:28},
+  {name:"ATTACK13", ext:"mp3", category:"se", soundKey:29},
+  {name:"ATTACK14", ext:"mp3", category:"se", soundKey:30},
+  {name:"BOAT1", ext:"mp3", category:"se", soundKey:31},
+  {name:"BOAT2", ext:"mp3", category:"se", soundKey:32},
+  {name:"BUS1", ext:"mp3", category:"se", soundKey:33},
+  {name:"BYCICLE1", ext:"mp3", category:"se", soundKey:34},
+  {name:"BYCICLE2", ext:"mp3", category:"se", soundKey:35},
+  {name:"CAR1", ext:"mp3", category:"se", soundKey:36},
+  {name:"CAR2", ext:"mp3", category:"se", soundKey:37},
+  {name:"CAR3", ext:"mp3", category:"se", soundKey:38},  
+  {name:"CAR4", ext:"mp3", category:"se", soundKey:39},
+  {name:"CAR5", ext:"mp3", category:"se", soundKey:40}, 
+  {name:"CAR6", ext:"mp3", category:"se", soundKey:41},
+  {name:"CAT1", ext:"mp3", category:"se", soundKey:42}, 
+  {name:"CAT2", ext:"mp3", category:"se", soundKey:43},
+  {name:"CAT3", ext:"mp3", category:"se", soundKey:44},
+  {name:"CHEER1", ext:"mp3", category:"se", soundKey:45},
+  {name:"CHEER2", ext:"mp3", category:"se", soundKey:46},
+  {name:"CHEER3", ext:"mp3", category:"se", soundKey:47},
+  {name:"CHIME1", ext:"mp3", category:"se", soundKey:48},
+  {name:"CHIME2", ext:"mp3", category:"se", soundKey:49},
+  {name:"CHIME3", ext:"mp3", category:"se", soundKey:50},
+  {name:"CHIME4", ext:"mp3", category:"se", soundKey:51},
+  {name:"CHIME5", ext:"mp3", category:"se", soundKey:52},
+  {name:"CHIME6", ext:"mp3", category:"se", soundKey:53},
+  {name:"CHIME7", ext:"mp3", category:"se", soundKey:54},
+  {name:"CHIME8", ext:"mp3", category:"se", soundKey:55},
+  {name:"CORRECT1", ext:"mp3", category:"se", soundKey:56},
+  {name:"DOG1", ext:"mp3", category:"se", soundKey:57},
+  {name:"DOG2", ext:"mp3", category:"se", soundKey:58},
+  {name:"DRUM1", ext:"mp3", category:"se", soundKey:59},
+  {name:"DRUM2", ext:"mp3", category:"se", soundKey:60},
+  {name:"DRUM3", ext:"mp3", category:"se", soundKey:61},
+  {name:"DRUM4", ext:"mp3", category:"se", soundKey:62},
+  {name:"FALLING1", ext:"mp3", category:"se", soundKey:63},
+  {name:"FALLING2", ext:"mp3", category:"se", soundKey:64},
+  {name:"FALLING3", ext:"mp3", category:"se", soundKey:65},
+  {name:"FIRE1", ext:"mp3", category:"se", soundKey:66},
+  {name:"FIRE2", ext:"mp3", category:"se", soundKey:67},
+  {name:"HORN1", ext:"mp3", category:"se", soundKey:68},
+  {name:"PIANO1", ext:"mp3", category:"se", soundKey:69},
+  {name:"PIANO2", ext:"mp3", category:"se", soundKey:70},
+  {name:"PIANO3", ext:"mp3", category:"se", soundKey:71},
+  {name:"PIANO4", ext:"mp3", category:"se", soundKey:72},
+  {name:"PIANO5", ext:"mp3", category:"se", soundKey:73},
+  {name:"PIANO6", ext:"mp3", category:"se", soundKey:74},
+  {name:"PIANO7", ext:"mp3", category:"se", soundKey:75},
+  {name:"PIANO8", ext:"mp3", category:"se", soundKey:76},
+  {name:"QUESTION1", ext:"mp3", category:"se", soundKey:77},
+  {name:"QUESTION2", ext:"mp3", category:"se", soundKey:78},
+  {name:"QUESTION3", ext:"mp3", category:"se", soundKey:79},
+  {name:"QUESTION4", ext:"mp3", category:"se", soundKey:80},
+  {name:"SIREN1", ext:"mp3", category:"se", soundKey:81},
+  {name:"START1", ext:"mp3", category:"se", soundKey:82},
+  {name:"START2", ext:"mp3", category:"se", soundKey:83},
+  {name:"SWING1", ext:"mp3", category:"se", soundKey:84},
+  {name:"SWING2", ext:"mp3", category:"se", soundKey:85},
+  {name:"SWING3", ext:"mp3", category:"se", soundKey:86},
+  {name:"WATER1", ext:"mp3", category:"se", soundKey:87},
+  
+  //BGM
+  {name:"BOSSA1", ext:"wav", category:"bgm", soundKey:1000},
+  {name:"FANTASY1", ext:"wav", category:"bgm", soundKey:1001},
+  {name:"FANTASY2", ext:"wav", category:"bgm", soundKey:1002},
+  {name:"FANTASY3", ext:"wav", category:"bgm", soundKey:1003},
+  {name:"FANTASY4", ext:"wav", category:"bgm", soundKey:1004},
+  {name:"ORCHESTRA1", ext:"wav", category:"bgm", soundKey:1005},
+  {name:"POP1", ext:"wav", category:"bgm", soundKey:1006},
+  {name:"POP2", ext:"wav", category:"bgm", soundKey:1007},
+  {name:"POP3", ext:"wav", category:"bgm", soundKey:1008},
+  {name:"POP4", ext:"wav", category:"bgm", soundKey:1009},
+  {name:"ROCK1", ext:"wav", category:"bgm", soundKey:1010},
+  {name:"ROCK2", ext:"wav", category:"bgm", soundKey:1011},
+  {name:"ROCK3", ext:"wav", category:"bgm", soundKey:1012},
+
   ];
 
   function findSoundInfoFromImageKey(soundKey){
@@ -26,8 +128,8 @@ define(["utility"], function(utility){
 
   //----------------カテゴリ----------------//
   var categoryInfos =[
-  {name: "se"},
-  {name: "bgm"},
+  {name: "se", imageKey: "sound_001"},
+  {name: "bgm", imageKey: "sound_002"},
   ];
 
   //----------------再生----------------//
diff --git a/app/webroot/js/pictcode/sound_selector.js b/app/webroot/js/pictcode/sound_selector.js
index 0a24b7f..68b20dc 100644
--- a/app/webroot/js/pictcode/sound_selector.js
+++ b/app/webroot/js/pictcode/sound_selector.js
@@ -10,13 +10,19 @@ define(['modal_manager', 'sound_manager', 'image_manager'], function(modalManage
     $("#modal_coding_sound_container").html("");
     var categoryInfos = soundManager.categoryInfos;
     _.each( categoryInfos, function(categoryInfo){ 
+      var image = imageManager.images[categoryInfo.imageKey];
+      image.style.width = "120px";
+      image.style.height = "40px";
       var button = document.createElement('button');
       button.name = categoryInfo.name;
       button.className = 'sound_category_button';
+      button.style.padding = "0px";
       button.style.margin = "5px";
-      button.style.width = "128px";
-      button.style.height = "56px";
-      button.innerHTML = categoryInfo.name;
+      button.style.width = "120px";
+      button.style.height = "40px";
+      button.style.border = "0px";
+      button.style.background = "transparent";
+      button.appendChild(image);
       categoryContainer.appendChild(button);
     });
 
@@ -24,38 +30,42 @@ define(['modal_manager', 'sound_manager', 'image_manager'], function(modalManage
     $("#modal_coding_sound").css({width:modalSize, height:modalSize, bottom:0, display:"none"});
     $("#modal_coding_sound_container")[0].appendChild(categoryContainer);
     modalManager.showUpModal($("#modal_coding_sound"), null);
+
+  //   document.removeEventListener("touchmove", function(evt) {
+  //   evt.preventDefault();
+  // }, false);
+
   };
 
   $(document).on("click",".sound_category_button", function(event) {
     var category = event.currentTarget.name;
     var buttonContainter = document.createElement('div');
+    // buttonContainter.style.minHeight = "101%";
     var iconSize = "56px";
     var categorizedSoundInfos = soundManager.getCategorizedSoundInfos(category);
-    _.each( categorizedSoundInfos, function(soundInfo){
- 
+    _.each( categorizedSoundInfos, function(soundInfo, idx){
+
       var selectButton = document.createElement('button');
       selectButton.name = soundInfo.soundKey;
-      selectButton.className = 'sound_select_button';
-      selectButton.style.margin = "5px";
-      selectButton.style.width = "128px";
-      selectButton.style.height = "56px";
+      selectButton.className = 'sound_select_button btn';
       selectButton.innerHTML = soundInfo.name;
       buttonContainter.appendChild(selectButton);
 
       var playButton = document.createElement('button');
       playButton.name = soundInfo.soundKey;
-      playButton.className = 'sound_play_button';
-      playButton.style.margin = "5px";
-      playButton.style.width = iconSize;
-      playButton.style.height = iconSize;
-      var playImage = imageManager.images.input_sound_001.cloneNode(false);
-      playImage.style.width = iconSize;
-      playImage.style.height = iconSize;
-      playImage.style.background = "transparent";
-      playImage.style.border = "0px";
-      playButton.appendChild(playImage);
+      playButton.id = "sound_play_button" + idx;
+      playButton.idx = idx;
+      playButton.className = 'sound_play_button btn';
       buttonContainter.appendChild(playButton)
 
+      var stopButton = document.createElement('button');
+      stopButton.name = soundInfo.soundKey;
+      stopButton.className = 'sound_stop_button btn';
+      stopButton.id = 'sound_stop_button' + idx;
+      stopButton.idx = idx;
+      stopButton.style.display = "none";
+      buttonContainter.appendChild(stopButton)
+
       buttonContainter.appendChild(document.createElement('br'));
     });
 
@@ -67,18 +77,34 @@ define(['modal_manager', 'sound_manager', 'image_manager'], function(modalManage
   //Modalのバックボタンをタップ時
   var backToTop = function(){
     modalManager.removeBackButton();
+    soundManager.stopAllSound();
     $("#modal_coding_sound_container").html("");
     $("#modal_coding_sound_container")[0].appendChild(categoryContainer);
   }
 
   $(document).on("click",".sound_play_button", function(event) {
     var soundKey = event.currentTarget.name;
+    var idx = event.currentTarget.idx;
+    $(".sound_play_button").css({display: "inline"});
+    $(".sound_stop_button").css({display: "none"});
+    $("#sound_play_button" + idx)[0].style.display = "none";
+    $("#sound_stop_button" + idx)[0].style.display = "inline";
+    soundManager.stopAllSound();
     soundManager.playSound(soundKey);
   });
 
+  $(document).on("click",".sound_stop_button", function(event) {
+    var soundKey = event.currentTarget.name;
+    var idx = event.currentTarget.idx;
+    $("#sound_play_button" + idx)[0].style.display = "inline";
+    $("#sound_stop_button" + idx)[0].style.display = "none";
+    soundManager.stopAllSound();
+  });
+
   $(document).on("click",".sound_select_button", function(event) {
     var soundKey = event.currentTarget.name;
     soundManager.loadSound(soundKey);
+    soundManager.stopAllSound();
     didSelectSound(soundKey);
     modalManager.closeDownModal($("#modal_coding_sound"));
   });
diff --git a/app/webroot/js/pictcode/sprite_action.js b/app/webroot/js/pictcode/sprite_action.js
new file mode 100644
index 0000000..b6712d1
--- /dev/null
+++ b/app/webroot/js/pictcode/sprite_action.js
@@ -0,0 +1,59 @@
+define(['sprite_manager', 'sprite_drawer'], function(spriteManager, spriteDrawer){
+
+  var previousPosition;
+  var targetSprite;
+  var isMoving = false;
+  var ceRatio;
+  var editorSize;
+
+  function setSwipeTarget(x, y, canvas, edtrSize, tSprite){
+    previousPosition= {x:x, y:y};
+    targetSprite = tSprite;
+    isMoving = true;
+    editorSize = edtrSize;
+    ceRatio = canvas.width/editorSize.width;
+  }
+
+  function changeSpritesPositionBySwipe(x, y, drawSprites){
+    if (!isMoving) {return};
+
+    var dx = x-previousPosition.x;
+    var dy = y-previousPosition.y;
+    dx /= ceRatio;
+    dy /= ceRatio;
+    dy *= -1;
+    targetSprite.position.x += dx;
+    targetSprite.position.y += dy;
+    previousPosition.x = x;
+    previousPosition.y = y;
+
+    if (targetSprite.x < -editorSize.width/2){
+      targetSprite.x = -editorSize.width/2;
+      isMoving = false;
+    };
+    if(targetSprite.x > editorSize.width/2){
+      targetSprite.x = editorSize.width/2;
+      isMoving = false;
+    }; 
+    if(targetSprite.y < -editorSize.height/2){
+      targetSprite.y = -editorSize.height/2;
+      isMoving = false;
+    };
+    if(targetSprite.y > editorSize.height/2) {
+      targetSprite.y = editorSize.height/2
+      isMoving = false;
+    };
+
+    drawSprites();
+  }
+
+  function finishSwipe(){
+    isMoving = false;
+  }
+
+  return {
+    setSwipeTarget:setSwipeTarget,
+    changeSpritesPositionBySwipe:changeSpritesPositionBySwipe,
+    finishSwipe:finishSwipe,
+  };
+});
diff --git a/app/webroot/js/pictcode/sprite_data.js b/app/webroot/js/pictcode/sprite_data.js
index fd214d1..af0a3aa 100644
--- a/app/webroot/js/pictcode/sprite_data.js
+++ b/app/webroot/js/pictcode/sprite_data.js
@@ -3,14 +3,68 @@ define(["utility"], function(utility){
   //----------------Sprite画像----------------//
 
   var spriteImageInfos = [
-  {imageNames:["car01.png", "car02.png"], category:"vehicle", imageKey:0},
+  
+  //Vehicle
+  {imageNames:["001_char_img_car_010.png", "001_char_img_car_020.png"], category:"car", imageKey:0},
+  {imageNames:["001_char_img_car_030.png", "001_char_img_car_040.png"], category:"car", imageKey:1},
+  {imageNames:["001_char_img_car_050.png", "001_char_img_car_060.png"], category:"car", imageKey:2},
+  {imageNames:["001_char_img_car_070.png", "001_char_img_car_080.png"], category:"car", imageKey:3},
+  {imageNames:["001_char_img_bus_010.png", "001_char_img_bus_020.png"], category:"car", imageKey:4},
+  {imageNames:["001_char_img_bus_030.png", "001_char_img_bus_040.png"], category:"car", imageKey:5},
   {imageNames:["car03.png"], category:"vehicle", imageKey:1},
-  {imageNames:["mogura01.png"], category:"animal", imageKey:2},
-  {imageNames:["dolphin01.png", "dolphin02.png"], category:"animal", imageKey:3},
-  {imageNames:["whale01.png", "whale02.png"], category:"animal", imageKey:4},
-  {imageNames:["dog01.png", "dog02.png"], category:"animal", imageKey:5},
-  {imageNames:["nohara.png"], category:"background", imageKey:6},
-  {imageNames:["dokan.png"], category:"artifact", imageKey:7},
+  
+  //Animal
+  {imageNames:["001_char_img_dolphin_010.png", "001_char_img_dolphin_020.png"], category:"animal", imageKey:100},
+  {imageNames:["001_char_img_whale_010.png", "001_char_img_whale_020.png"], category:"animal", imageKey:101},
+  {imageNames:["001_char_img_dog_010.png"], category:"animal", imageKey:102},
+  {imageNames:["001_char_img_dog_020.png", "001_char_img_dog_030.png"], category:"animal", imageKey:103},
+  {imageNames:["001_char_img_dog_040.png"], category:"animal", imageKey:104},
+  {imageNames:["001_char_img_dog_050.png", "001_char_img_dog_060.png"], category:"animal", imageKey:105},
+  {imageNames:["001_char_img_cat_010.png"], category:"animal", imageKey:106},
+  {imageNames:["001_char_img_cat_020.png", "001_char_img_cat_030.png"], category:"animal", imageKey:107},
+  {imageNames:["001_char_img_mouse_010.png"], category:"animal", imageKey:108},
+  {imageNames:["001_char_img_mouse_020.png", "001_char_img_mouse_030.png"], category:"animal", imageKey:109},
+  {imageNames:["001_char_img_mole_010.png"], category:"animal", imageKey:110},
+  {imageNames:["001_char_img_mole_020.png"], category:"animal", imageKey:111},
+  {imageNames:["001_char_img_mole_030.png"], category:"animal", imageKey:112},
+
+  //Background
+  {imageNames:["001_char_bg_bg_010.png"], category:"background", imageKey:200},
+  {imageNames:["001_char_bg_bg_020.png"], category:"background", imageKey:201},
+  {imageNames:["001_char_bg_bg_030.png"], category:"background", imageKey:202},
+  {imageNames:["001_char_bg_bg_040.png"], category:"background", imageKey:203},
+
+  //Artifact
+  {imageNames:["001_char_img_pipe_010.png"], category:"artifact", imageKey:300},
+
+  //Airplane
+  {imageNames:["001_char_img_airplane_010.png"], category:"airplane", imageKey:400},
+  {imageNames:["001_char_img_airplane_020.png"], category:"airplane", imageKey:401},
+  {imageNames:["001_char_img_airplane_030.png"], category:"airplane", imageKey:402},
+  {imageNames:["001_char_img_airplane_040.png"], category:"airplane", imageKey:403},
+  {imageNames:["001_char_img_bomb_010.png", "001_char_img_bomb_020.png"], category:"airplane", imageKey:404},
+  {imageNames:["001_char_img_bomb_030.png", "001_char_img_bomb_040.png"], category:"airplane", imageKey:405},
+
+  //Board
+  {imageNames:["001_char_img_display_010.png"], category:"board", imageKey:500},
+  {imageNames:["001_char_img_display_020.png"], category:"board", imageKey:501},
+  {imageNames:["001_char_img_display_030.png"], category:"board", imageKey:502},
+  {imageNames:["game_clear.png"], category:"board", imageKey:503},
+  {imageNames:["game_over.png"], category:"board", imageKey:504},
+  {imageNames:["arrow1.png"], category:"board", imageKey:505},
+  {imageNames:["transparent_board.png"], category:"board", imageKey:506},
+
+  //Fish
+  {imageNames:["001_char_img_fish_010.png", "001_char_img_fish_020.png"], category:"fish", imageKey:600},
+  {imageNames:["001_char_img_fish_030.png", "001_char_img_fish_040.png"], category:"fish", imageKey:601},
+  {imageNames:["001_char_img_fish_050.png", "001_char_img_fish_060.png"], category:"fish", imageKey:602},
+  {imageNames:["shell.png"], category:"fish", imageKey:603},
+
+  //Instrument
+  {imageNames:["001_char_img_inst_010.png", "001_char_img_inst_020.png"], category:"instrument", imageKey:700},
+  {imageNames:["001_char_img_inst_030.png", "001_char_img_inst_040.png"], category:"instrument", imageKey:701},
+  {imageNames:["001_char_img_inst_050.png", "001_char_img_inst_060.png"], category:"instrument", imageKey:702},
+  {imageNames:["music_note.png"], category:"instrument", imageKey:703},
   ];
 
   function loadSpriteImages(sprts, didLoadImages){
@@ -23,24 +77,27 @@ define(["utility"], function(utility){
         return sprite.imageKey == spImgInf.imageKey;
       });
 
-      if (!spriteImageInfo || spriteImageInfo.images) {
-        continue;
-      };
+      // if (!spriteImageInfo || spriteImageInfo.images) {
+      //   continue;
+      // };
       isLoading = true;
 
       spriteImageInfo.images = [];
-      loadingCount++;
-      var lc = 0;
+      sprite.images = spriteImageInfo.images;
+      loadingCount += spriteImageInfo.imageNames.length;
+      // var lc = 0;
       _.each(spriteImageInfo.imageNames, function(imageName){
-        var path = "image/sprite/" + spriteImageInfo.category + "/" + imageName;
+        //var path = "image/sprite/" + spriteImageInfo.category + "/" + imageName;
+        var path = "/img/pictcode/sprite/" + spriteImageInfo.category + "/" + imageName;
         var spImage = new Image();
         spImage.src = path;
         spriteImageInfo.images.push(spImage);
         spImage.onload = function(){
-          lc++;
-          if (lc >= spriteImageInfo.imageNames.length) {
-            loadingCount--;
-          };
+          // lc++;
+          // if (lc >= spriteImageInfo.imageNames.length) {
+          //   loadingCount--;
+          // };
+          loadingCount--;
           if (loadingCount <= 0) {
             didLoadImages();
           };
@@ -60,7 +117,8 @@ define(["utility"], function(utility){
         if (!spriteImageInfo.images) {
           spriteImageInfo.images = [];
           _.each(spriteImageInfo.imageNames, function(imageName){
-            var path = "image/sprite/" + spriteImageInfo.category + "/" + imageName;
+            //var path = "image/sprite/" + spriteImageInfo.category + "/" + imageName;
+            var path = "/img/pictcode/sprite/" + spriteImageInfo.category + "/" + imageName;
             var spImage = new Image();
             spImage.src = path;
             spImage.width = initSize/2;
@@ -98,11 +156,14 @@ define(["utility"], function(utility){
   //----------------カテゴリ画像----------------//
 
   var categoryInfos =[
-  {name: "vehicle", imageKey: "ctgry_spr_004"},
+  {name: "car", imageKey: "ctgry_spr_004"},
+  {name: "airplane", imageKey: "ctgry_spr_006"},
   {name: "animal", imageKey: "ctgry_spr_001"},
+  {name: "fish", imageKey: "ctgry_spr_008"},
   {name: "background", imageKey: "ctgry_spr_003"},
+  {name: "instrument", imageKey: "ctgry_spr_007"},
   {name: "artifact", imageKey: "ctgry_spr_002"},
-  {name: "forest", imageKey: "ctgry_spr_005"},
+  {name: "board", imageKey: "ctgry_spr_005"},
   ];
 
   return {
@@ -112,4 +173,4 @@ define(["utility"], function(utility){
     findSpriteImageInfoFromImageKey:findSpriteImageInfoFromImageKey,
     categoryInfos:categoryInfos,
   };
-});
\ No newline at end of file
+});
diff --git a/app/webroot/js/pictcode/sprite_drawer.js b/app/webroot/js/pictcode/sprite_drawer.js
index 4e33025..1a8de02 100644
--- a/app/webroot/js/pictcode/sprite_drawer.js
+++ b/app/webroot/js/pictcode/sprite_drawer.js
@@ -45,6 +45,9 @@ define(["image_manager"], function(imageManager){
     //スプライト描画
     var targetSprite = null;
     _.each( sprites, function(sprite){
+      if(sprite.type == "ghost"){
+        return;
+      };
       var edSpriteSize = getSpriteSize(sprite);
       var edSpriteLeftTop = {x:sprite.position.x-edSpriteSize.width/2, y:sprite.position.y+edSpriteSize.height/2};
       var cvSpriteLeftTop;
@@ -58,8 +61,7 @@ define(["image_manager"], function(imageManager){
 
       sprite.drawnRect = {x:cvSpriteLeftTop.x, y:cvSpriteLeftTop.y, width:cvSpriteSize.width, height:cvSpriteSize.height};
 
-      // canvasContext.scale(-1,1);
-
+      //スプライトの回転、描画
       canvasContext.save();
       canvasContext.translate(cvSpriteCenter.x, cvSpriteCenter.y);
       canvasContext.rotate(sprite.angle);
@@ -67,9 +69,23 @@ define(["image_manager"], function(imageManager){
         canvasContext.transform(-1, 0, 0, 1, 0, 0);
       };
       canvasContext.translate(-cvSpriteCenter.x, -cvSpriteCenter.y);
-      canvasContext.drawImage(sprite.images[sprite.animationCount], sprite.drawnRect.x, sprite.drawnRect.y, sprite.drawnRect.width, sprite.drawnRect.height);
+      canvasContext.globalAlpha = sprite.opacity;
+      if (sprite.images) {
+        canvasContext.drawImage(sprite.images[sprite.animationCount], sprite.drawnRect.x, sprite.drawnRect.y, sprite.drawnRect.width, sprite.drawnRect.height);
+      };
       canvasContext.restore();
 
+      if (sprite.text || sprite.text == 0) {
+        var textSize = Math.round(cvSpriteSize.width*0.25);
+        canvasContext.save();
+        canvasContext.font = "bold "+ textSize + "px " + "sans-serif";
+        canvasContext.fillStyle = "black";
+        canvasContext.textAlign = "center";
+        canvasContext.textBaseline = "middle";
+        canvasContext.fillText(sprite.text, cvSpriteCenter.x, cvSpriteCenter.y+cvSpriteSize.height*0.05);
+        canvasContext.restore();
+      };
+
       if (sprite.isTarget && canvas.isUI) {
         targetSprite = sprite;
         //十字線の描画
@@ -103,7 +119,7 @@ define(["image_manager"], function(imageManager){
         (edOuterSize.height-edInnerSize.height)/2*ceRatio,
         canvas.width*edInnerSize.width/edOuterSize.width,
         canvas.height*edInnerSize.height/edOuterSize.height
-      );
+        );
     }
     canvasContext.restore();
 
@@ -149,6 +165,7 @@ define(["image_manager"], function(imageManager){
   }
 
   function getPositionInfo(sprites, x, y){
+
     var isOnSprite = false;
     var targetSprite;
 
@@ -157,7 +174,8 @@ define(["image_manager"], function(imageManager){
     }
 
     for (var i=sprites.length-1; i>=0; i--){
-      sprite = sprites[i];
+      var sprite = sprites[i];
+      if (sprite.type == "ghost") {continue;};
       if (sprite.drawnRect.x<x && sprite.drawnRect.x+sprite.drawnRect.width>x && sprite.drawnRect.y<y && sprite.drawnRect.y+sprite.drawnRect.height>y) {
         isOnSprite = true;
         targetSprite = sprite;
diff --git a/app/webroot/js/pictcode/sprite_list.js b/app/webroot/js/pictcode/sprite_list.js
index 22bc2eb..91866aa 100644
--- a/app/webroot/js/pictcode/sprite_list.js
+++ b/app/webroot/js/pictcode/sprite_list.js
@@ -27,11 +27,12 @@ define(["jquery.touch-punch", "image_manager"],function(jqueryUITouchPunch, imag
     cell.addEventListener('touchstart', didSelectSprite);
     cell.addEventListener('mousedown', didSelectSprite);
     $('#list_table')[0].appendChild(cell);
-    var cellHeight = cell.clientHeight;
+    // var cellHeight = cell.clientHeight;
+    var imageHeight = 40;
     var image = sprite.images[0];
     image = image.cloneNode(false);
-    image.width = cellHeight/(sprite.aspectRatio + 1)*1.8;
-    image.height = cellHeight*sprite.aspectRatio/(sprite.aspectRatio + 1)*1.8;
+    image.width = imageHeight/(sprite.aspectRatio + 1)*1.8;
+    image.height = imageHeight*sprite.aspectRatio/(sprite.aspectRatio + 1)*1.8;
     image.style.marginTop = "4px";
     cell.appendChild(image);
   }
diff --git a/app/webroot/js/pictcode/sprite_manager.js b/app/webroot/js/pictcode/sprite_manager.js
index b04b53c..9857861 100644
--- a/app/webroot/js/pictcode/sprite_manager.js
+++ b/app/webroot/js/pictcode/sprite_manager.js
@@ -18,7 +18,9 @@ define(["utility"], function(utility){
   var initialScale;
 
   function initialize(sprts){
-    sprites.concat(sprts);
+    _.each(sprts, function(spr){
+      sprites.push(spr);
+    })
   }
 
   function createNewSprite(spriteImageInfo, didCreateSprite, editorSize){
@@ -35,6 +37,7 @@ define(["utility"], function(utility){
     //新規スプライト
     var newSprite = {
       images:spriteImageInfo.images,
+      imageKey:spriteImageInfo.imageKey,
       type:spriteType,
       position:{x:0, y:0},
       aspectRatio:aspectRatio,
@@ -49,7 +52,7 @@ define(["utility"], function(utility){
       startFuncIdx:null,
       collision:[{tag:1, funcIdx:null}, {tag:2, funcIdx:null}, {tag:3, funcIdx:null}],
     };
-    newSprite.id = findUnusedSpriteId();
+    newSprite.id = findUnusedSpriteId(sprites);
     if (spriteType == "sprite") {
       newSprite.position.x += 10*spriteAddCount;
       newSprite.position.y -= 10*spriteAddCount;
@@ -61,13 +64,13 @@ define(["utility"], function(utility){
     didCreateSprite(newSprite);
   }
 
-  function findUnusedSpriteId(){
+  function findUnusedSpriteId(targetSprites){
     var unusedId = 0;
     var notFound = true;
     while(notFound){
       var isUsed = false;
-      for (var i = 0; i < sprites.length; i++) {
-        sprite = sprites[i];
+      for (var i = 0; i < targetSprites.length; i++) {
+        sprite = targetSprites[i];
         if (sprite.id == unusedId) {
           isUsed = true;
           break;
@@ -131,12 +134,14 @@ define(["utility"], function(utility){
     drawSprites();
   }
 
-  function copySprite(sprite){
+  function copySprite(sprite, targetArray, isUI){
     var copiedSprite = $.extend(true, {}, sprite);
-    copiedSprite.position.x += 10;
-    copiedSprite.position.y -= 10;
-    copiedSprite.id = findUnusedSpriteId();
-    sprites.push(copiedSprite);
+    if (isUI) {
+      copiedSprite.position.x += 10;
+      copiedSprite.position.y -= 10;
+    };
+    copiedSprite.id = findUnusedSpriteId(targetArray);
+    targetArray.push(copiedSprite);
     return copiedSprite;
   }
 
diff --git a/app/webroot/js/pictcode/tag_selector.js b/app/webroot/js/pictcode/tag_selector.js
index 3865ce0..d6f80f3 100644
--- a/app/webroot/js/pictcode/tag_selector.js
+++ b/app/webroot/js/pictcode/tag_selector.js
@@ -5,15 +5,11 @@ define(["modal_manager", "utility"], function(modalManager, utility){
   var container;
   var colors = ["#1e90ff", "#ff4500", "#008b8b", "#ffa500", "#a52a2a", "#20b2aa", "#483d8b", "#0000ff", "#ff1493", "#808000"];
 
-  function initialize(mdl, cntnr, didSlctTg){
+  function showTagsWithModal(mdl, cntnr, didSlctTg){
     modal = mdl;
     container = cntnr;
     container.html("");
     didSelectTag = didSlctTg;
-  }
-
-  function showTagsWithModal(){
-    container.html("");
     for (var i = 0; i <= 9; i++) {
       var button = makeTagElement(i, "button", 50);
       container[0].appendChild(button);
@@ -52,8 +48,8 @@ define(["modal_manager", "utility"], function(modalManager, utility){
   });
 
   return {
-    initialize:initialize,
     showTagsWithModal:showTagsWithModal,
     makeTagElement:makeTagElement,
+    tagColors:colors,
   };
 });
\ No newline at end of file
diff --git a/app/webroot/js/pictcode/ui_manager.js b/app/webroot/js/pictcode/ui_manager.js
index 406f7e1..19b7256 100644
--- a/app/webroot/js/pictcode/ui_manager.js
+++ b/app/webroot/js/pictcode/ui_manager.js
@@ -30,7 +30,6 @@ define(['sprite_selector', 'canvas_manager', 'sprite_manager', 'sprite_drawer',
     //各モジュールの初期化
     spriteManager.initialize(loadedSprites);
     spriteSelector.initialize(didSelectSprite);
-    spriteList.initialize(spriteManager.sprites, drawSprites, setTargetSprite);
 
     //キャンバスのタップ操作の検出
     function touchStart(canvasX, canvasY){
@@ -61,7 +60,8 @@ define(['sprite_selector', 'canvas_manager', 'sprite_manager', 'sprite_drawer',
     var editorWidth = document.documentElement.clientWidth * 0.8;
     var headerHeight = $('#header')[0].clientHeight;
     var footerHeight = $('#footer')[0].clientHeight;
-    var editorHeight = document.documentElement.clientHeight - headerHeight - footerHeight-20;
+    // var editorHeight = document.documentElement.clientHeight - headerHeight - footerHeight-20;
+        var editorHeight = window.innerHeight - headerHeight - footerHeight-20;
     var canvasSize = canvasManager.getCanvasSize(editorWidth, editorHeight);
     canvas = canvasManager.initializeCanvas(canvasSize.width, canvasSize.height, touchStart, touchMove, touchEnd);
     canvas.isUI = true;
@@ -72,12 +72,6 @@ define(['sprite_selector', 'canvas_manager', 'sprite_manager', 'sprite_drawer',
     var cvBgImg = imageManager.images.bg_grid_001;
     canvas.canvasBackgroundImage = cvBgImg;
 
-    //Sprite画像読み込み
-    spriteData.loadSpriteImages(spriteManager.sprites, didLoadSpriteImages);
-    function didLoadSpriteImages(){
-      drawSprites();
-    }
-
     //Modalの設定
     var modalSize = document.documentElement.clientHeight * 0.6;
     $("#modal_ui_sprite").css({width:modalSize, height:modalSize, top:-modalSize});
@@ -86,9 +80,15 @@ define(['sprite_selector', 'canvas_manager', 'sprite_manager', 'sprite_drawer',
     $("#modal_ui_collision").css({width:modalSize, height:modalSize, bottom:0, display:"none"});
 
     //セレクターの設定
-    tagSelector.initialize($("#modal_ui_tag"), $("#modal_ui_tag_container"), didSeletTag);
     functionSelector.initialize(getFunctions);
     collisionSelector.initialize($("#modal_ui_collision"), $("#modal_ui_collision_container"), didSelectCollision, getFunctions, functionSelector.makeFunctionNodeWithIndex);
+
+    //Sprite画像読み込み
+    spriteData.loadSpriteImages(spriteManager.sprites, didLoadSpriteImages);
+    function didLoadSpriteImages(){
+      spriteList.initialize(spriteManager.sprites, drawSprites, setTargetSprite);
+      drawSprites();
+    }
   }
 
   function didSwitchToUITab(){
@@ -131,12 +131,12 @@ define(['sprite_selector', 'canvas_manager', 'sprite_manager', 'sprite_drawer',
     $("#sprite_tag_setting")[0].appendChild(tagNode);
 
     var funcNodeSize = 30;
-    if (targetSprite.tapFuncIdx) {
+    if (targetSprite.tapFuncIdx || targetSprite.tapFuncIdx === 0) {
       var funckNode = functionSelector.makeFunctionNodeWithIndex(targetSprite.tapFuncIdx, funcNodeSize);
       $("#tap_function_setting")[0].appendChild(funckNode);
     };
 
-    if (targetSprite.startFuncIdx) {
+    if (targetSprite.startFuncIdx || targetSprite.startFuncIdx === 0) {
       var funckNode = functionSelector.makeFunctionNodeWithIndex(targetSprite.startFuncIdx, funcNodeSize);
       $("#start_function_setting")[0].appendChild(funckNode);
     };
@@ -194,7 +194,7 @@ define(['sprite_selector', 'canvas_manager', 'sprite_manager', 'sprite_drawer',
   $(document).on("click","#copy_sprite", function(event) {
     if (!targetSprite) {return};
 
-    var copiedSprite = spriteManager.copySprite(targetSprite);
+    var copiedSprite = spriteManager.copySprite(targetSprite, spriteManager.sprites, true);
     spriteList.addSpriteToList(copiedSprite);
     setTargetSprite(copiedSprite);
     drawSprites();
@@ -252,17 +252,17 @@ define(['sprite_selector', 'canvas_manager', 'sprite_manager', 'sprite_drawer',
   }
 
   $(document).on("click","#sprite_tag_setting", function(event) {
-    tagSelector.showTagsWithModal();
+    tagSelector.showTagsWithModal($("#modal_ui_tag"), $("#modal_ui_tag_container"), didSeletTag);
   });
 
   $(document).on("click","#tap_function_setting", function(event) {
     trigger = TRIGGER.TAP;
-    functionSelector.show($("#modal_ui_function"), $("#modal_ui_function_container"), didSelectFunction);
+    functionSelector.show($("#modal_ui_function"), $("#modal_ui_function_container"), didSelectFunction, true);
   });
 
   $(document).on("click","#start_function_setting", function(event) {
     trigger = TRIGGER.APPSTART;
-    functionSelector.show($("#modal_ui_function"), $("#modal_ui_function_container"), didSelectFunction);
+    functionSelector.show($("#modal_ui_function"), $("#modal_ui_function_container"), didSelectFunction, true);
   });
 
   $(document).on("click","#sprite_collision_setting", function(event) {
diff --git a/app/webroot/js/pictcode/utility.js b/app/webroot/js/pictcode/utility.js
index 6897d6b..35b28e4 100644
--- a/app/webroot/js/pictcode/utility.js
+++ b/app/webroot/js/pictcode/utility.js
@@ -1,9 +1,16 @@
 define(function(){
 
-  var alphabets = ["A", "B", "C", "D", "E", "F", "G", "H", "I", "J", "K", "L", "M", "N", "O", "P", "Q", "R", "S", "T", "U", "V", "W", "X", "Y", "Z", "a", "b", "c", "d", "e", "f", "g", "h", "i", "j", "k", "l", "m", "n", "o", "p", "q", "r", "s", "t", "u", "v", "w", "x", "y", "z"];
+  var largeAlphabets = ["A", "B", "C", "D", "E", "F", "G", "H", "I", "J", "K", "L", "M", "N", "O", "P", "Q", "R", "S", "T", "U", "V", "W", "X", "Y", "Z"];
+  var smallAlphabets = ["a", "b", "c", "d", "e", "f", "g", "h", "i", "j", "k", "l", "m", "n", "o", "p", "q", "r", "s", "t", "u", "v", "w", "x", "y", "z"];
 
-  function numberToAlphabet(number){
-    return alphabets[number];
+  function numberToLargeAlphabet(number){
+    if (number >= largeAlphabets.length) {return null;};
+    return largeAlphabets[number];
+  }
+
+  function numberToSmallAlphabet(number){
+    if (number >= smallAlphabets.length) {return null;};
+    return smallAlphabets[number];
   }
 
   function getImageNaturalSize(image) {
@@ -44,7 +51,8 @@ define(function(){
   }
 
   return {
-    numberToAlphabet:numberToAlphabet,
+    numberToLargeAlphabet:numberToLargeAlphabet,
+    numberToSmallAlphabet:numberToSmallAlphabet,
     getImageNaturalSize:getImageNaturalSize,
     bringArrayElementToLast:bringArrayElementToLast,
   };
diff --git a/app/webroot/sound/bgm/BOSSA1.wav b/app/webroot/sound/bgm/BOSSA1.wav
new file mode 100644
index 0000000..7c73cd0
Binary files /dev/null and b/app/webroot/sound/bgm/BOSSA1.wav differ
diff --git a/app/webroot/sound/bgm/FANTASY1.wav b/app/webroot/sound/bgm/FANTASY1.wav
new file mode 100644
index 0000000..18f4ae3
Binary files /dev/null and b/app/webroot/sound/bgm/FANTASY1.wav differ
diff --git a/app/webroot/sound/bgm/FANTASY2.wav b/app/webroot/sound/bgm/FANTASY2.wav
new file mode 100644
index 0000000..b9cef4f
Binary files /dev/null and b/app/webroot/sound/bgm/FANTASY2.wav differ
diff --git a/app/webroot/sound/bgm/FANTASY3.wav b/app/webroot/sound/bgm/FANTASY3.wav
new file mode 100644
index 0000000..45b8b35
Binary files /dev/null and b/app/webroot/sound/bgm/FANTASY3.wav differ
diff --git a/app/webroot/sound/bgm/FANTASY4.wav b/app/webroot/sound/bgm/FANTASY4.wav
new file mode 100644
index 0000000..e98ff19
Binary files /dev/null and b/app/webroot/sound/bgm/FANTASY4.wav differ
diff --git a/app/webroot/sound/bgm/ORCHESTRA1.wav b/app/webroot/sound/bgm/ORCHESTRA1.wav
new file mode 100644
index 0000000..bc79b42
Binary files /dev/null and b/app/webroot/sound/bgm/ORCHESTRA1.wav differ
diff --git a/app/webroot/sound/bgm/POP1.wav b/app/webroot/sound/bgm/POP1.wav
new file mode 100644
index 0000000..e11194e
Binary files /dev/null and b/app/webroot/sound/bgm/POP1.wav differ
diff --git a/app/webroot/sound/bgm/POP2.wav b/app/webroot/sound/bgm/POP2.wav
new file mode 100644
index 0000000..1652190
Binary files /dev/null and b/app/webroot/sound/bgm/POP2.wav differ
diff --git a/app/webroot/sound/bgm/POP3.wav b/app/webroot/sound/bgm/POP3.wav
new file mode 100644
index 0000000..c8715fc
Binary files /dev/null and b/app/webroot/sound/bgm/POP3.wav differ
diff --git a/app/webroot/sound/bgm/POP4.wav b/app/webroot/sound/bgm/POP4.wav
new file mode 100644
index 0000000..1221db1
Binary files /dev/null and b/app/webroot/sound/bgm/POP4.wav differ
diff --git a/app/webroot/sound/bgm/ROCK1.wav b/app/webroot/sound/bgm/ROCK1.wav
new file mode 100644
index 0000000..ab2a802
Binary files /dev/null and b/app/webroot/sound/bgm/ROCK1.wav differ
diff --git a/app/webroot/sound/bgm/ROCK2.wav b/app/webroot/sound/bgm/ROCK2.wav
new file mode 100644
index 0000000..f540b9f
Binary files /dev/null and b/app/webroot/sound/bgm/ROCK2.wav differ
diff --git a/app/webroot/sound/bgm/ROCK3.wav b/app/webroot/sound/bgm/ROCK3.wav
new file mode 100644
index 0000000..33a52ff
Binary files /dev/null and b/app/webroot/sound/bgm/ROCK3.wav differ
diff --git a/app/webroot/sound/se/ACTION1.mp3 b/app/webroot/sound/se/ACTION1.mp3
new file mode 100644
index 0000000..f0fdaa2
Binary files /dev/null and b/app/webroot/sound/se/ACTION1.mp3 differ
diff --git a/app/webroot/sound/se/ACTION10.mp3 b/app/webroot/sound/se/ACTION10.mp3
new file mode 100644
index 0000000..07f5598
Binary files /dev/null and b/app/webroot/sound/se/ACTION10.mp3 differ
diff --git a/app/webroot/sound/se/ACTION2.mp3 b/app/webroot/sound/se/ACTION2.mp3
new file mode 100644
index 0000000..2edb946
Binary files /dev/null and b/app/webroot/sound/se/ACTION2.mp3 differ
diff --git a/app/webroot/sound/se/ACTION3.mp3 b/app/webroot/sound/se/ACTION3.mp3
new file mode 100644
index 0000000..754343c
Binary files /dev/null and b/app/webroot/sound/se/ACTION3.mp3 differ
diff --git a/app/webroot/sound/se/ACTION4.mp3 b/app/webroot/sound/se/ACTION4.mp3
new file mode 100644
index 0000000..f31616c
Binary files /dev/null and b/app/webroot/sound/se/ACTION4.mp3 differ
diff --git a/app/webroot/sound/se/ACTION5.mp3 b/app/webroot/sound/se/ACTION5.mp3
new file mode 100644
index 0000000..2a58d39
Binary files /dev/null and b/app/webroot/sound/se/ACTION5.mp3 differ
diff --git a/app/webroot/sound/se/ACTION6.mp3 b/app/webroot/sound/se/ACTION6.mp3
new file mode 100644
index 0000000..62cfcb8
Binary files /dev/null and b/app/webroot/sound/se/ACTION6.mp3 differ
diff --git a/app/webroot/sound/se/ACTION7.mp3 b/app/webroot/sound/se/ACTION7.mp3
new file mode 100644
index 0000000..69a93c1
Binary files /dev/null and b/app/webroot/sound/se/ACTION7.mp3 differ
diff --git a/app/webroot/sound/se/ACTION8.mp3 b/app/webroot/sound/se/ACTION8.mp3
new file mode 100644
index 0000000..78887bd
Binary files /dev/null and b/app/webroot/sound/se/ACTION8.mp3 differ
diff --git a/app/webroot/sound/se/ACTION9.mp3 b/app/webroot/sound/se/ACTION9.mp3
new file mode 100644
index 0000000..ca5c55f
Binary files /dev/null and b/app/webroot/sound/se/ACTION9.mp3 differ
diff --git a/app/webroot/sound/se/AIRPLANE1.mp3 b/app/webroot/sound/se/AIRPLANE1.mp3
new file mode 100644
index 0000000..28cffbe
Binary files /dev/null and b/app/webroot/sound/se/AIRPLANE1.mp3 differ
diff --git a/app/webroot/sound/se/AIRPLANE2.mp3 b/app/webroot/sound/se/AIRPLANE2.mp3
new file mode 100644
index 0000000..2906ad3
Binary files /dev/null and b/app/webroot/sound/se/AIRPLANE2.mp3 differ
diff --git a/app/webroot/sound/se/ALERT1.mp3 b/app/webroot/sound/se/ALERT1.mp3
new file mode 100644
index 0000000..6a2fb36
Binary files /dev/null and b/app/webroot/sound/se/ALERT1.mp3 differ
diff --git a/app/webroot/sound/se/ALERT2.mp3 b/app/webroot/sound/se/ALERT2.mp3
new file mode 100644
index 0000000..2485e07
Binary files /dev/null and b/app/webroot/sound/se/ALERT2.mp3 differ
diff --git a/app/webroot/sound/se/ALERT3.mp3 b/app/webroot/sound/se/ALERT3.mp3
new file mode 100644
index 0000000..f997c49
Binary files /dev/null and b/app/webroot/sound/se/ALERT3.mp3 differ
diff --git a/app/webroot/sound/se/ALERT4.mp3 b/app/webroot/sound/se/ALERT4.mp3
new file mode 100644
index 0000000..410c6d9
Binary files /dev/null and b/app/webroot/sound/se/ALERT4.mp3 differ
diff --git a/app/webroot/sound/se/ALERT5.mp3 b/app/webroot/sound/se/ALERT5.mp3
new file mode 100644
index 0000000..ff3dce5
Binary files /dev/null and b/app/webroot/sound/se/ALERT5.mp3 differ
diff --git a/app/webroot/sound/se/ATTACK1.mp3 b/app/webroot/sound/se/ATTACK1.mp3
new file mode 100644
index 0000000..7a5101b
Binary files /dev/null and b/app/webroot/sound/se/ATTACK1.mp3 differ
diff --git a/app/webroot/sound/se/ATTACK10.mp3 b/app/webroot/sound/se/ATTACK10.mp3
new file mode 100644
index 0000000..2a6f84f
Binary files /dev/null and b/app/webroot/sound/se/ATTACK10.mp3 differ
diff --git a/app/webroot/sound/se/ATTACK11.mp3 b/app/webroot/sound/se/ATTACK11.mp3
new file mode 100644
index 0000000..d519245
Binary files /dev/null and b/app/webroot/sound/se/ATTACK11.mp3 differ
diff --git a/app/webroot/sound/se/ATTACK12.mp3 b/app/webroot/sound/se/ATTACK12.mp3
new file mode 100644
index 0000000..a9cec39
Binary files /dev/null and b/app/webroot/sound/se/ATTACK12.mp3 differ
diff --git a/app/webroot/sound/se/ATTACK13.mp3 b/app/webroot/sound/se/ATTACK13.mp3
new file mode 100644
index 0000000..63d4ef2
Binary files /dev/null and b/app/webroot/sound/se/ATTACK13.mp3 differ
diff --git a/app/webroot/sound/se/ATTACK14.mp3 b/app/webroot/sound/se/ATTACK14.mp3
new file mode 100644
index 0000000..b6836c7
Binary files /dev/null and b/app/webroot/sound/se/ATTACK14.mp3 differ
diff --git a/app/webroot/sound/se/ATTACK2.mp3 b/app/webroot/sound/se/ATTACK2.mp3
new file mode 100644
index 0000000..56c87e5
Binary files /dev/null and b/app/webroot/sound/se/ATTACK2.mp3 differ
diff --git a/app/webroot/sound/se/ATTACK3.mp3 b/app/webroot/sound/se/ATTACK3.mp3
new file mode 100644
index 0000000..47dac99
Binary files /dev/null and b/app/webroot/sound/se/ATTACK3.mp3 differ
diff --git a/app/webroot/sound/se/ATTACK4.mp3 b/app/webroot/sound/se/ATTACK4.mp3
new file mode 100644
index 0000000..470c4cb
Binary files /dev/null and b/app/webroot/sound/se/ATTACK4.mp3 differ
diff --git a/app/webroot/sound/se/ATTACK5.mp3 b/app/webroot/sound/se/ATTACK5.mp3
new file mode 100644
index 0000000..67d3e48
Binary files /dev/null and b/app/webroot/sound/se/ATTACK5.mp3 differ
diff --git a/app/webroot/sound/se/ATTACK6.mp3 b/app/webroot/sound/se/ATTACK6.mp3
new file mode 100644
index 0000000..73664b9
Binary files /dev/null and b/app/webroot/sound/se/ATTACK6.mp3 differ
diff --git a/app/webroot/sound/se/ATTACK7.mp3 b/app/webroot/sound/se/ATTACK7.mp3
new file mode 100644
index 0000000..595062e
Binary files /dev/null and b/app/webroot/sound/se/ATTACK7.mp3 differ
diff --git a/app/webroot/sound/se/ATTACK8.mp3 b/app/webroot/sound/se/ATTACK8.mp3
new file mode 100644
index 0000000..77a1c25
Binary files /dev/null and b/app/webroot/sound/se/ATTACK8.mp3 differ
diff --git a/app/webroot/sound/se/ATTACK9.mp3 b/app/webroot/sound/se/ATTACK9.mp3
new file mode 100644
index 0000000..9b75487
Binary files /dev/null and b/app/webroot/sound/se/ATTACK9.mp3 differ
diff --git a/app/webroot/sound/se/BOAT1.mp3 b/app/webroot/sound/se/BOAT1.mp3
new file mode 100644
index 0000000..8c1bb43
Binary files /dev/null and b/app/webroot/sound/se/BOAT1.mp3 differ
diff --git a/app/webroot/sound/se/BOAT2.mp3 b/app/webroot/sound/se/BOAT2.mp3
new file mode 100644
index 0000000..f54dfa3
Binary files /dev/null and b/app/webroot/sound/se/BOAT2.mp3 differ
diff --git a/app/webroot/sound/se/BUS1.mp3 b/app/webroot/sound/se/BUS1.mp3
new file mode 100644
index 0000000..fed0e5f
Binary files /dev/null and b/app/webroot/sound/se/BUS1.mp3 differ
diff --git a/app/webroot/sound/se/BYCICLE1.mp3 b/app/webroot/sound/se/BYCICLE1.mp3
new file mode 100644
index 0000000..dcf05c2
Binary files /dev/null and b/app/webroot/sound/se/BYCICLE1.mp3 differ
diff --git a/app/webroot/sound/se/BYCICLE2.mp3 b/app/webroot/sound/se/BYCICLE2.mp3
new file mode 100644
index 0000000..a850fb1
Binary files /dev/null and b/app/webroot/sound/se/BYCICLE2.mp3 differ
diff --git a/app/webroot/sound/se/CAR1.mp3 b/app/webroot/sound/se/CAR1.mp3
new file mode 100644
index 0000000..19bd596
Binary files /dev/null and b/app/webroot/sound/se/CAR1.mp3 differ
diff --git a/app/webroot/sound/se/CAR2.mp3 b/app/webroot/sound/se/CAR2.mp3
new file mode 100644
index 0000000..0a80923
Binary files /dev/null and b/app/webroot/sound/se/CAR2.mp3 differ
diff --git a/app/webroot/sound/se/CAR3.mp3 b/app/webroot/sound/se/CAR3.mp3
new file mode 100644
index 0000000..8cf6def
Binary files /dev/null and b/app/webroot/sound/se/CAR3.mp3 differ
diff --git a/app/webroot/sound/se/CAR4.mp3 b/app/webroot/sound/se/CAR4.mp3
new file mode 100644
index 0000000..9823db3
Binary files /dev/null and b/app/webroot/sound/se/CAR4.mp3 differ
diff --git a/app/webroot/sound/se/CAR5.mp3 b/app/webroot/sound/se/CAR5.mp3
new file mode 100644
index 0000000..90308a8
Binary files /dev/null and b/app/webroot/sound/se/CAR5.mp3 differ
diff --git a/app/webroot/sound/se/CAR6.mp3 b/app/webroot/sound/se/CAR6.mp3
new file mode 100644
index 0000000..23d7127
Binary files /dev/null and b/app/webroot/sound/se/CAR6.mp3 differ
diff --git a/app/webroot/sound/se/CAT1.mp3 b/app/webroot/sound/se/CAT1.mp3
new file mode 100644
index 0000000..6b31379
Binary files /dev/null and b/app/webroot/sound/se/CAT1.mp3 differ
diff --git a/app/webroot/sound/se/CAT2.mp3 b/app/webroot/sound/se/CAT2.mp3
new file mode 100644
index 0000000..b503479
Binary files /dev/null and b/app/webroot/sound/se/CAT2.mp3 differ
diff --git a/app/webroot/sound/se/CAT3.mp3 b/app/webroot/sound/se/CAT3.mp3
new file mode 100644
index 0000000..5c7a5db
Binary files /dev/null and b/app/webroot/sound/se/CAT3.mp3 differ
diff --git a/app/webroot/sound/se/CHEER1.mp3 b/app/webroot/sound/se/CHEER1.mp3
new file mode 100644
index 0000000..937412d
Binary files /dev/null and b/app/webroot/sound/se/CHEER1.mp3 differ
diff --git a/app/webroot/sound/se/CHEER2.mp3 b/app/webroot/sound/se/CHEER2.mp3
new file mode 100644
index 0000000..5965540
Binary files /dev/null and b/app/webroot/sound/se/CHEER2.mp3 differ
diff --git a/app/webroot/sound/se/CHEER3.mp3 b/app/webroot/sound/se/CHEER3.mp3
new file mode 100644
index 0000000..1adb827
Binary files /dev/null and b/app/webroot/sound/se/CHEER3.mp3 differ
diff --git a/app/webroot/sound/se/CHIME1.mp3 b/app/webroot/sound/se/CHIME1.mp3
new file mode 100644
index 0000000..2261f53
Binary files /dev/null and b/app/webroot/sound/se/CHIME1.mp3 differ
diff --git a/app/webroot/sound/se/CHIME2.mp3 b/app/webroot/sound/se/CHIME2.mp3
new file mode 100644
index 0000000..5981a61
Binary files /dev/null and b/app/webroot/sound/se/CHIME2.mp3 differ
diff --git a/app/webroot/sound/se/CHIME3.mp3 b/app/webroot/sound/se/CHIME3.mp3
new file mode 100644
index 0000000..f1c142c
Binary files /dev/null and b/app/webroot/sound/se/CHIME3.mp3 differ
diff --git a/app/webroot/sound/se/CHIME4.mp3 b/app/webroot/sound/se/CHIME4.mp3
new file mode 100644
index 0000000..7462a75
Binary files /dev/null and b/app/webroot/sound/se/CHIME4.mp3 differ
diff --git a/app/webroot/sound/se/CHIME5.mp3 b/app/webroot/sound/se/CHIME5.mp3
new file mode 100644
index 0000000..e6ee1da
Binary files /dev/null and b/app/webroot/sound/se/CHIME5.mp3 differ
diff --git a/app/webroot/sound/se/CHIME6.mp3 b/app/webroot/sound/se/CHIME6.mp3
new file mode 100644
index 0000000..031c9ae
Binary files /dev/null and b/app/webroot/sound/se/CHIME6.mp3 differ
diff --git a/app/webroot/sound/se/CHIME7.mp3 b/app/webroot/sound/se/CHIME7.mp3
new file mode 100644
index 0000000..089e456
Binary files /dev/null and b/app/webroot/sound/se/CHIME7.mp3 differ
diff --git a/app/webroot/sound/se/CHIME8.mp3 b/app/webroot/sound/se/CHIME8.mp3
new file mode 100644
index 0000000..82b5274
Binary files /dev/null and b/app/webroot/sound/se/CHIME8.mp3 differ
diff --git a/app/webroot/sound/se/CORRECT1.mp3 b/app/webroot/sound/se/CORRECT1.mp3
new file mode 100644
index 0000000..3e30830
Binary files /dev/null and b/app/webroot/sound/se/CORRECT1.mp3 differ
diff --git a/app/webroot/sound/se/DOG1.mp3 b/app/webroot/sound/se/DOG1.mp3
new file mode 100644
index 0000000..781bf90
Binary files /dev/null and b/app/webroot/sound/se/DOG1.mp3 differ
diff --git a/app/webroot/sound/se/DOG2.mp3 b/app/webroot/sound/se/DOG2.mp3
new file mode 100644
index 0000000..14b68d7
Binary files /dev/null and b/app/webroot/sound/se/DOG2.mp3 differ
diff --git a/app/webroot/sound/se/DRUM1.mp3 b/app/webroot/sound/se/DRUM1.mp3
new file mode 100644
index 0000000..c5b21ba
Binary files /dev/null and b/app/webroot/sound/se/DRUM1.mp3 differ
diff --git a/app/webroot/sound/se/DRUM2.mp3 b/app/webroot/sound/se/DRUM2.mp3
new file mode 100644
index 0000000..2195d35
Binary files /dev/null and b/app/webroot/sound/se/DRUM2.mp3 differ
diff --git a/app/webroot/sound/se/DRUM3.mp3 b/app/webroot/sound/se/DRUM3.mp3
new file mode 100644
index 0000000..5d0a367
Binary files /dev/null and b/app/webroot/sound/se/DRUM3.mp3 differ
diff --git a/app/webroot/sound/se/DRUM4.mp3 b/app/webroot/sound/se/DRUM4.mp3
new file mode 100644
index 0000000..b6ae556
Binary files /dev/null and b/app/webroot/sound/se/DRUM4.mp3 differ
diff --git a/app/webroot/sound/se/FALLING1.mp3 b/app/webroot/sound/se/FALLING1.mp3
new file mode 100644
index 0000000..f27cbe0
Binary files /dev/null and b/app/webroot/sound/se/FALLING1.mp3 differ
diff --git a/app/webroot/sound/se/FALLING2.mp3 b/app/webroot/sound/se/FALLING2.mp3
new file mode 100644
index 0000000..e0d2897
Binary files /dev/null and b/app/webroot/sound/se/FALLING2.mp3 differ
diff --git a/app/webroot/sound/se/FALLING3.mp3 b/app/webroot/sound/se/FALLING3.mp3
new file mode 100644
index 0000000..bd44e2c
Binary files /dev/null and b/app/webroot/sound/se/FALLING3.mp3 differ
diff --git a/app/webroot/sound/se/FIRE1.mp3 b/app/webroot/sound/se/FIRE1.mp3
new file mode 100644
index 0000000..b94c3fe
Binary files /dev/null and b/app/webroot/sound/se/FIRE1.mp3 differ
diff --git a/app/webroot/sound/se/FIRE2.mp3 b/app/webroot/sound/se/FIRE2.mp3
new file mode 100644
index 0000000..cf53608
Binary files /dev/null and b/app/webroot/sound/se/FIRE2.mp3 differ
diff --git a/app/webroot/sound/se/HORN1.mp3 b/app/webroot/sound/se/HORN1.mp3
new file mode 100644
index 0000000..1e2e568
Binary files /dev/null and b/app/webroot/sound/se/HORN1.mp3 differ
diff --git a/app/webroot/sound/se/PIANO1.mp3 b/app/webroot/sound/se/PIANO1.mp3
new file mode 100644
index 0000000..d86a23e
Binary files /dev/null and b/app/webroot/sound/se/PIANO1.mp3 differ
diff --git a/app/webroot/sound/se/PIANO2.mp3 b/app/webroot/sound/se/PIANO2.mp3
new file mode 100644
index 0000000..25b2819
Binary files /dev/null and b/app/webroot/sound/se/PIANO2.mp3 differ
diff --git a/app/webroot/sound/se/PIANO3.mp3 b/app/webroot/sound/se/PIANO3.mp3
new file mode 100644
index 0000000..5b386be
Binary files /dev/null and b/app/webroot/sound/se/PIANO3.mp3 differ
diff --git a/app/webroot/sound/se/PIANO4.mp3 b/app/webroot/sound/se/PIANO4.mp3
new file mode 100644
index 0000000..d1919b6
Binary files /dev/null and b/app/webroot/sound/se/PIANO4.mp3 differ
diff --git a/app/webroot/sound/se/PIANO5.mp3 b/app/webroot/sound/se/PIANO5.mp3
new file mode 100644
index 0000000..ac0343d
Binary files /dev/null and b/app/webroot/sound/se/PIANO5.mp3 differ
diff --git a/app/webroot/sound/se/PIANO6.mp3 b/app/webroot/sound/se/PIANO6.mp3
new file mode 100644
index 0000000..0d9105b
Binary files /dev/null and b/app/webroot/sound/se/PIANO6.mp3 differ
diff --git a/app/webroot/sound/se/PIANO7.mp3 b/app/webroot/sound/se/PIANO7.mp3
new file mode 100644
index 0000000..5d89827
Binary files /dev/null and b/app/webroot/sound/se/PIANO7.mp3 differ
diff --git a/app/webroot/sound/se/PIANO8.mp3 b/app/webroot/sound/se/PIANO8.mp3
new file mode 100644
index 0000000..fdefc3e
Binary files /dev/null and b/app/webroot/sound/se/PIANO8.mp3 differ
diff --git a/app/webroot/sound/se/QUESTION1.mp3 b/app/webroot/sound/se/QUESTION1.mp3
new file mode 100644
index 0000000..9f1a710
Binary files /dev/null and b/app/webroot/sound/se/QUESTION1.mp3 differ
diff --git a/app/webroot/sound/se/QUESTION2.mp3 b/app/webroot/sound/se/QUESTION2.mp3
new file mode 100644
index 0000000..2ed7efc
Binary files /dev/null and b/app/webroot/sound/se/QUESTION2.mp3 differ
diff --git a/app/webroot/sound/se/QUESTION3.mp3 b/app/webroot/sound/se/QUESTION3.mp3
new file mode 100644
index 0000000..9a559e6
Binary files /dev/null and b/app/webroot/sound/se/QUESTION3.mp3 differ
diff --git a/app/webroot/sound/se/QUESTION4.mp3 b/app/webroot/sound/se/QUESTION4.mp3
new file mode 100644
index 0000000..dc69046
Binary files /dev/null and b/app/webroot/sound/se/QUESTION4.mp3 differ
diff --git a/app/webroot/sound/se/SIREN1.mp3 b/app/webroot/sound/se/SIREN1.mp3
new file mode 100644
index 0000000..181eb3b
Binary files /dev/null and b/app/webroot/sound/se/SIREN1.mp3 differ
diff --git a/app/webroot/sound/se/START1.mp3 b/app/webroot/sound/se/START1.mp3
new file mode 100644
index 0000000..c44a5bc
Binary files /dev/null and b/app/webroot/sound/se/START1.mp3 differ
diff --git a/app/webroot/sound/se/START2.mp3 b/app/webroot/sound/se/START2.mp3
new file mode 100644
index 0000000..cc87e08
Binary files /dev/null and b/app/webroot/sound/se/START2.mp3 differ
diff --git a/app/webroot/sound/se/SWING1.mp3 b/app/webroot/sound/se/SWING1.mp3
new file mode 100644
index 0000000..5e45b5c
Binary files /dev/null and b/app/webroot/sound/se/SWING1.mp3 differ
diff --git a/app/webroot/sound/se/SWING2.mp3 b/app/webroot/sound/se/SWING2.mp3
new file mode 100644
index 0000000..ce2e030
Binary files /dev/null and b/app/webroot/sound/se/SWING2.mp3 differ
diff --git a/app/webroot/sound/se/SWING3.mp3 b/app/webroot/sound/se/SWING3.mp3
new file mode 100644
index 0000000..1c8f9aa
Binary files /dev/null and b/app/webroot/sound/se/SWING3.mp3 differ
diff --git a/app/webroot/sound/se/WATER1.mp3 b/app/webroot/sound/se/WATER1.mp3
new file mode 100644
index 0000000..f074cc2
Binary files /dev/null and b/app/webroot/sound/se/WATER1.mp3 differ
